Organic zwitterions
=O | 5g | 205396004](https://assets.fishersci.com/TFS-Assets/CCG/product-images/NC1777385.jpg-250.jpg)
eMolecules 119-32-4 | 4-Methyl-3-nitroaniline | Combi-Blocks | MFCD00007910 | 152.153 | C7H8N2O2 | 98.000 | Cc1ccc(N)cc1[N+]([O-])=O | 5g | 205396004
4-Methyl-3-nitroaniline | Combi-Blocks | 119-32-4 | MFCD00007910 | 152.153 | C7H8N2O2 | 98.000 | Cc1ccc(N)cc1[N+]([O-])=O | 5g | 205396004
=O | 1g | 537705080](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502142890.JPG-250.jpg)
eMolecules 3663-22-7 | 4-Butyl-2-nitroaniline | Oakwood Chemical | MFCD23725964 | 194.234 | C10H14N2O2 | 0.000 | CCCCc1ccc(N)c(c1)[N+]([O-])=O | 1g | 537705080
4-Butyl-2-nitroaniline | Oakwood Chemical | 3663-22-7 | MFCD23725964 | 194.234 | C10H14N2O2 | 0.000 | CCCCc1ccc(N)c(c1)[N+]([O-])=O | 1g | 537705080
eMolecules 1635-61-6 | 5-Chloro-2-nitroaniline | 100g
Ambeed | (S)-2-(26-Dichlorobenzamido)-3-(26-dimethoxy-[11-biphenyl]-4-yl)propanoic acid | 2mg | 534567468 | A234495 | 232271-19-1 | MFCD09970400 | 474.330 | C24H21Cl2NO5
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 5459-50-7 | 2-Iodo-5-nitroaniline | MFCD16877042 | 1g
Ambeed | 2-Iodo-5-nitroaniline | 1g | 600849258 | A871769 | 5459-50-7 | MFCD16877042 | 264.022 | C6H5IN2O2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>