Benzenoids
Filtered Search Results
Triphenylphosphine dibromide, ca. 33% bromine
CAS: 1034-39-5 Molecular Formula: C18H15Br2P Molecular Weight (g/mol): 422.10 MDL Number: MFCD00000054 InChI Key: OCXGTPDKNBIOTF-UHFFFAOYSA-N Synonym: dibromotriphenylphosphorane,phosphorane, dibromotriphenyl,triphenyldibromophosphorane,unii-7y0j6r63jd,bromotriphenylphosphonium bromide,dibromotriphenyl-??-phosphane,dibromotriphenylphosphine,dibromtriphenylphosphorane,triphenylphosphinedibromide,dibromo triphenylphosphorane PubChem CID: 70579 IUPAC Name: dibromo(triphenyl)-$l^{5}-phosphane SMILES: BrP(Br)(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 70579 |
|---|---|
| CAS | 1034-39-5 |
| Molecular Weight (g/mol) | 422.10 |
| MDL Number | MFCD00000054 |
| SMILES | BrP(Br)(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | dibromotriphenylphosphorane,phosphorane, dibromotriphenyl,triphenyldibromophosphorane,unii-7y0j6r63jd,bromotriphenylphosphonium bromide,dibromotriphenyl-??-phosphane,dibromotriphenylphosphine,dibromtriphenylphosphorane,triphenylphosphinedibromide,dibromo triphenylphosphorane |
| IUPAC Name | dibromo(triphenyl)-$l^{5}-phosphane |
| InChI Key | OCXGTPDKNBIOTF-UHFFFAOYSA-N |
| Molecular Formula | C18H15Br2P |
4-(Trifluoromethoxy)phenol, 98%
CAS: 828-27-3 Molecular Formula: C7H5F3O2 Molecular Weight (g/mol): 178.11 MDL Number: MFCD00040988 InChI Key: WDRJNKMAZMEYOF-UHFFFAOYSA-N Synonym: 4-trifluoromethoxy phenol,p-trifluoromethoxy phenol,phenol, 4-trifluoromethoxy,4-hydroxytrifluoromethoxybenzene,4-trifluoromethoxy-phenol,4-hydroxyphenyl trifluoromethyl ether,p-trifluoromethoxyphenol PubChem CID: 70015 IUPAC Name: 4-(trifluoromethoxy)phenol SMILES: OC1=CC=C(OC(F)(F)F)C=C1
| PubChem CID | 70015 |
|---|---|
| CAS | 828-27-3 |
| Molecular Weight (g/mol) | 178.11 |
| MDL Number | MFCD00040988 |
| SMILES | OC1=CC=C(OC(F)(F)F)C=C1 |
| Synonym | 4-trifluoromethoxy phenol,p-trifluoromethoxy phenol,phenol, 4-trifluoromethoxy,4-hydroxytrifluoromethoxybenzene,4-trifluoromethoxy-phenol,4-hydroxyphenyl trifluoromethyl ether,p-trifluoromethoxyphenol |
| IUPAC Name | 4-(trifluoromethoxy)phenol |
| InChI Key | WDRJNKMAZMEYOF-UHFFFAOYSA-N |
| Molecular Formula | C7H5F3O2 |
4-Bromo-2-fluorophenol, 98%
CAS: 2105-94-4 Molecular Formula: C6H4BrFO Molecular Weight (g/mol): 191.00 MDL Number: MFCD00011722 InChI Key: RYVOZMPTISNBDB-UHFFFAOYSA-N Synonym: 2-fluoro-4-bromophenol,4-bromo-2-fluoro-phenol,phenol, 4-bromo-2-fluoro,4-bromo-2-fluoro phenol,pubchem1488,p-bromo-o-fluorophenol,2-fluoro-4-bromo phenol,acmc-209fh4,ksc204a3n,3-fluoro-4-hydroxy-bromobenzene PubChem CID: 2724981 IUPAC Name: 4-bromo-2-fluorophenol SMILES: OC1=CC=C(Br)C=C1F
| PubChem CID | 2724981 |
|---|---|
| CAS | 2105-94-4 |
| Molecular Weight (g/mol) | 191.00 |
| MDL Number | MFCD00011722 |
| SMILES | OC1=CC=C(Br)C=C1F |
| Synonym | 2-fluoro-4-bromophenol,4-bromo-2-fluoro-phenol,phenol, 4-bromo-2-fluoro,4-bromo-2-fluoro phenol,pubchem1488,p-bromo-o-fluorophenol,2-fluoro-4-bromo phenol,acmc-209fh4,ksc204a3n,3-fluoro-4-hydroxy-bromobenzene |
| IUPAC Name | 4-bromo-2-fluorophenol |
| InChI Key | RYVOZMPTISNBDB-UHFFFAOYSA-N |
| Molecular Formula | C6H4BrFO |
Thermo Scientific Chemicals 5-Sulfosalicylic acid dihydrate, 99+%
CAS: 5965-83-3 | C9H14O6S | 250.27 g/mol
| Molecular Weight (g/mol) | 250.27 |
|---|---|
| CAS Min % | 99.0 |
| InChI Key | NFYHZVWMQHQKRU-UHFFFAOYSA-N |
| PubChem CID | 2723734 |
| Name Note | p.a. |
| Percent Purity | 99+% |
| Fieser | 01,1118 |
| Infrared Spectrum | Authentic |
| Formula Weight | 254.22 |
| Melting Point | 106.0°C to 110.0°C |
| CAS Max % | 100.0 |
| Color | White |
| Physical Form | Crystalline Powder |
| Chemical Name or Material | 5-Sulfosalicylic acid dihydrate |
| SMILES | C.C.OC(=O)C1=CC(=CC=C1O)S(O)(=O)=O |
| Merck Index | 15, 9094 |
| Assay Percent Range | 99+% |
| CAS | 97-05-2 |
| Health Hazard 3 | GHS P Statement IF SWALLOWED: rinse mouth. Do NOT induce vomiting. Wear protective gloves/protective clothing/eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if pre |
| MDL Number | MFCD00007508,MFCD00149540 |
| Health Hazard 2 | GHS H Statement Causes severe skin burns and eye damage. Harmful if swallowed. |
| Solubility Information | Solubility in water: 127g/L (20°C). Other solubilities: soluble in alcohol and ether |
| Packaging | Plastic bottle |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | 2-hydroxy-5-sulfobenzoic acid dihydrate,5-sulfosalicylic acid dihydrate,sulfosalicylic acid dihydrate,benzoic acid, 2-hydroxy-5-sulfo-, dihydrate,unii-09ngq462s6,2-hydroxy-5-sulfobenzoic acid, hydrate, hydrate,5-sulfosalicylsyre,5-sulfosalicylsaeure,salicylic acid, 5-sulfo-, dihydrate,acmc-1aymd |
| Beilstein | 11, 411 |
| Molecular Formula | C9H14O6S |
3-Chlorophenylhydrazine hydrochloride, 97%
CAS: 2312-23-4 Molecular Formula: C6H7ClN2·HCl Molecular Weight (g/mol): 179.05 MDL Number: MFCD00012935 InChI Key: CRRIAWUJYMLJOE-UHFFFAOYSA-N Synonym: 3-chlorophenylhydrazine hydrochloride,3-chlorophenyl hydrazine hydrochloride,3-chloro phenyl hydrazine hydrochloride,m-chlorophenylhydrazine hydrochloride,hydrazine, 3-chlorophenyl-, monohydrochloride,1-3-chlorophenyl hydrazine hydrochloride,m-chlorophenylhydrazine hcl,3-chlorophenyl hydrazine hydrochloride 1:1,3-chlorophenyl hydrazinehydrochloride PubChem CID: 75331 IUPAC Name: (3-chlorophenyl)hydrazine;hydrochloride SMILES: C1=CC(=CC(=C1)Cl)NN.Cl
| PubChem CID | 75331 |
|---|---|
| CAS | 2312-23-4 |
| Molecular Weight (g/mol) | 179.05 |
| MDL Number | MFCD00012935 |
| SMILES | C1=CC(=CC(=C1)Cl)NN.Cl |
| Synonym | 3-chlorophenylhydrazine hydrochloride,3-chlorophenyl hydrazine hydrochloride,3-chloro phenyl hydrazine hydrochloride,m-chlorophenylhydrazine hydrochloride,hydrazine, 3-chlorophenyl-, monohydrochloride,1-3-chlorophenyl hydrazine hydrochloride,m-chlorophenylhydrazine hcl,3-chlorophenyl hydrazine hydrochloride 1:1,3-chlorophenyl hydrazinehydrochloride |
| IUPAC Name | (3-chlorophenyl)hydrazine;hydrochloride |
| InChI Key | CRRIAWUJYMLJOE-UHFFFAOYSA-N |
| Molecular Formula | C6H7ClN2·HCl |
2-Methoxybenzylamine, 98%
CAS: 6850-57-3 Molecular Formula: C8H11NO Molecular Weight (g/mol): 137.18 MDL Number: MFCD00008110 InChI Key: PXJACNDVRNAFHD-UHFFFAOYSA-N Synonym: 2-methoxybenzylamine,2-methoxyphenyl methanamine,o-methoxybenzylamine,benzenemethanamine, 2-methoxy,2-methoxy-benzylamine,2-methoxyphenyl methylamine,1-2-methoxyphenyl methanamine,2-methyoxybenzylamine,2-methoxy benzylamine,2-methoxybenzyl amine PubChem CID: 81292 IUPAC Name: (2-methoxyphenyl)methanamine SMILES: COC1=CC=CC=C1CN
| PubChem CID | 81292 |
|---|---|
| CAS | 6850-57-3 |
| Molecular Weight (g/mol) | 137.18 |
| MDL Number | MFCD00008110 |
| SMILES | COC1=CC=CC=C1CN |
| Synonym | 2-methoxybenzylamine,2-methoxyphenyl methanamine,o-methoxybenzylamine,benzenemethanamine, 2-methoxy,2-methoxy-benzylamine,2-methoxyphenyl methylamine,1-2-methoxyphenyl methanamine,2-methyoxybenzylamine,2-methoxy benzylamine,2-methoxybenzyl amine |
| IUPAC Name | (2-methoxyphenyl)methanamine |
| InChI Key | PXJACNDVRNAFHD-UHFFFAOYSA-N |
| Molecular Formula | C8H11NO |
2-(Trifluoromethyl)benzenesulfonyl chloride, 98%
CAS: 776-04-5 Molecular Formula: C7H4ClF3O2S Molecular Weight (g/mol): 244.612 MDL Number: MFCD00051696 InChI Key: ZIZGWNOAHUCACM-UHFFFAOYSA-N Synonym: 2-trifluoromethyl benzenesulfonyl chloride,2-trifluoromethyl benzene-1-sulfonyl chloride,2-trifluoromethylbenzenesulphonyl chloride,2-trifluoromethyl benzenesulphonyl chloride,o-trifluoromethyl benzenesulfonyl chloride,o-trifluoromethylbenzenesulfonyl chloride,2-trifluoromethyl benzene sulfonyl chloride,benzenesulfonyl chloride, 2-trifluoromethyl,alpha,alpha,alpha-trifluorotoluene-2-sulfonyl chloride PubChem CID: 136616 IUPAC Name: 2-(trifluoromethyl)benzenesulfonyl chloride SMILES: C1=CC=C(C(=C1)C(F)(F)F)S(=O)(=O)Cl
| PubChem CID | 136616 |
|---|---|
| CAS | 776-04-5 |
| Molecular Weight (g/mol) | 244.612 |
| MDL Number | MFCD00051696 |
| SMILES | C1=CC=C(C(=C1)C(F)(F)F)S(=O)(=O)Cl |
| Synonym | 2-trifluoromethyl benzenesulfonyl chloride,2-trifluoromethyl benzene-1-sulfonyl chloride,2-trifluoromethylbenzenesulphonyl chloride,2-trifluoromethyl benzenesulphonyl chloride,o-trifluoromethyl benzenesulfonyl chloride,o-trifluoromethylbenzenesulfonyl chloride,2-trifluoromethyl benzene sulfonyl chloride,benzenesulfonyl chloride, 2-trifluoromethyl,alpha,alpha,alpha-trifluorotoluene-2-sulfonyl chloride |
| IUPAC Name | 2-(trifluoromethyl)benzenesulfonyl chloride |
| InChI Key | ZIZGWNOAHUCACM-UHFFFAOYSA-N |
| Molecular Formula | C7H4ClF3O2S |
beta-Bromostyrene, 97%, mixture of cis/trans isomers
CAS: 103-64-0 Molecular Formula: C8H7Br Molecular Weight (g/mol): 183.05 MDL Number: MFCD00000185 InChI Key: YMOONIIMQBGTDU-VOTSOKGWSA-N Synonym: 2-bromovinyl benzene,beta-bromostyrene,styryl bromide,2-bromoethenyl benzene,bromostyrolene,1-bromo-2-phenylethene,bromostyrol,bromstyrole,hyacinth base,1-bromo-2-phenylethylene PubChem CID: 5314126 IUPAC Name: [(E)-2-bromoethenyl]benzene SMILES: C1=CC=C(C=C1)C=CBr
| PubChem CID | 5314126 |
|---|---|
| CAS | 103-64-0 |
| Molecular Weight (g/mol) | 183.05 |
| MDL Number | MFCD00000185 |
| SMILES | C1=CC=C(C=C1)C=CBr |
| Synonym | 2-bromovinyl benzene,beta-bromostyrene,styryl bromide,2-bromoethenyl benzene,bromostyrolene,1-bromo-2-phenylethene,bromostyrol,bromstyrole,hyacinth base,1-bromo-2-phenylethylene |
| IUPAC Name | [(E)-2-bromoethenyl]benzene |
| InChI Key | YMOONIIMQBGTDU-VOTSOKGWSA-N |
| Molecular Formula | C8H7Br |
5-Methylsalicylic acid, 98%
CAS: 89-56-5 Molecular Formula: C8H8O3 Molecular Weight (g/mol): 152.15 MDL Number: MFCD00002461 InChI Key: DLGBEGBHXSAQOC-UHFFFAOYSA-N Synonym: 5-methylsalicylic acid,p-cresotic acid,p-cresotinic acid,6-hydroxy-m-toluic acid,p-homosalicylic acid,2,5-cresotic acid,benzoic acid, 2-hydroxy-5-methyl,5-methyl-2-hydroxybenzoic acid,6-hydroxy-3-methylbenzoic acid,alpha-cresotinic acid PubChem CID: 6973 IUPAC Name: 2-hydroxy-5-methylbenzoic acid SMILES: CC1=CC(=C(C=C1)O)C(=O)O
| PubChem CID | 6973 |
|---|---|
| CAS | 89-56-5 |
| Molecular Weight (g/mol) | 152.15 |
| MDL Number | MFCD00002461 |
| SMILES | CC1=CC(=C(C=C1)O)C(=O)O |
| Synonym | 5-methylsalicylic acid,p-cresotic acid,p-cresotinic acid,6-hydroxy-m-toluic acid,p-homosalicylic acid,2,5-cresotic acid,benzoic acid, 2-hydroxy-5-methyl,5-methyl-2-hydroxybenzoic acid,6-hydroxy-3-methylbenzoic acid,alpha-cresotinic acid |
| IUPAC Name | 2-hydroxy-5-methylbenzoic acid |
| InChI Key | DLGBEGBHXSAQOC-UHFFFAOYSA-N |
| Molecular Formula | C8H8O3 |
Cinnamyl chloride, 95% trans
CAS: 2687-12-9 Molecular Formula: C9H9Cl Molecular Weight (g/mol): 152.62 MDL Number: MFCD00000986 InChI Key: IWTYTFSSTWXZFU-QPJJXVBHSA-N Synonym: cinnamyl chloride,3-chloroprop-1-en-1-yl benzene,3-chloro-1-phenyl-1-propene,trans-cinnamyl chloride,1e-3-chloroprop-1-en-1-yl benzene,benzene, 3-chloropropenyl,e-3-chloroprop-1-enyl benzene,unii-2i1adl56tx,2i1adl56tx,cinnamylchloride PubChem CID: 639658 IUPAC Name: [(E)-3-chloroprop-1-enyl]benzene SMILES: C1=CC=C(C=C1)C=CCCl
| PubChem CID | 639658 |
|---|---|
| CAS | 2687-12-9 |
| Molecular Weight (g/mol) | 152.62 |
| MDL Number | MFCD00000986 |
| SMILES | C1=CC=C(C=C1)C=CCCl |
| Synonym | cinnamyl chloride,3-chloroprop-1-en-1-yl benzene,3-chloro-1-phenyl-1-propene,trans-cinnamyl chloride,1e-3-chloroprop-1-en-1-yl benzene,benzene, 3-chloropropenyl,e-3-chloroprop-1-enyl benzene,unii-2i1adl56tx,2i1adl56tx,cinnamylchloride |
| IUPAC Name | [(E)-3-chloroprop-1-enyl]benzene |
| InChI Key | IWTYTFSSTWXZFU-QPJJXVBHSA-N |
| Molecular Formula | C9H9Cl |
(S)-(-)-alpha-Methoxy-alpha-(trifluoromethyl)phenylacetic acid, 98%
CAS: 17257-71-5 Molecular Formula: C10H8F3O3 Molecular Weight (g/mol): 233.17 MDL Number: MFCD00064200 InChI Key: JJYKJUXBWFATTE-VIFPVBQESA-M Synonym: s---alpha-methoxy-alpha-trifluoromethyl phenylacetic acid,s-3,3,3-trifluoro-2-methoxy-2-phenylpropanoic acid,--mosher's acid,--mtpa,unii-172hcj1iqv,172hcj1iqv,2s-3,3,3-trifluoro-2-methoxy-2-phenylpropanoic acid,--alpha-methoxy-alpha-trifluoromethyl phenylacetic acid,s---mtpa,--a-methoxy-a-trifluoromethylphenylacetic acid PubChem CID: 6992788 SMILES: CO[C@](C([O-])=O)(C1=CC=CC=C1)C(F)(F)F
| PubChem CID | 6992788 |
|---|---|
| CAS | 17257-71-5 |
| Molecular Weight (g/mol) | 233.17 |
| MDL Number | MFCD00064200 |
| SMILES | CO[C@](C([O-])=O)(C1=CC=CC=C1)C(F)(F)F |
| Synonym | s---alpha-methoxy-alpha-trifluoromethyl phenylacetic acid,s-3,3,3-trifluoro-2-methoxy-2-phenylpropanoic acid,--mosher's acid,--mtpa,unii-172hcj1iqv,172hcj1iqv,2s-3,3,3-trifluoro-2-methoxy-2-phenylpropanoic acid,--alpha-methoxy-alpha-trifluoromethyl phenylacetic acid,s---mtpa,--a-methoxy-a-trifluoromethylphenylacetic acid |
| InChI Key | JJYKJUXBWFATTE-VIFPVBQESA-M |
| Molecular Formula | C10H8F3O3 |
Ethyl 4-methoxyphenylacetate, 97%
CAS: 14062-18-1 Molecular Formula: C11H14O3 Molecular Weight (g/mol): 194.23 MDL Number: MFCD00040760 InChI Key: DOCCDOCIYYDLGJ-UHFFFAOYSA-N Synonym: ethyl 2-4-methoxyphenyl acetate,ethyl 4-methoxyphenylacetate,4-methoxyphenylacetic acid ethyl ester,benzeneacetic acid, 4-methoxy-, ethyl ester,ethyl p-methoxyphenylacetate,ethyl 4-methoxyphenyl acetate,4-methoxy-phenyl-acetic acid ethyl ester,acmc-1bnx2,homoanisic acid ethyl ester PubChem CID: 84174 IUPAC Name: ethyl 2-(4-methoxyphenyl)acetate SMILES: CCOC(=O)CC1=CC=C(C=C1)OC
| PubChem CID | 84174 |
|---|---|
| CAS | 14062-18-1 |
| Molecular Weight (g/mol) | 194.23 |
| MDL Number | MFCD00040760 |
| SMILES | CCOC(=O)CC1=CC=C(C=C1)OC |
| Synonym | ethyl 2-4-methoxyphenyl acetate,ethyl 4-methoxyphenylacetate,4-methoxyphenylacetic acid ethyl ester,benzeneacetic acid, 4-methoxy-, ethyl ester,ethyl p-methoxyphenylacetate,ethyl 4-methoxyphenyl acetate,4-methoxy-phenyl-acetic acid ethyl ester,acmc-1bnx2,homoanisic acid ethyl ester |
| IUPAC Name | ethyl 2-(4-methoxyphenyl)acetate |
| InChI Key | DOCCDOCIYYDLGJ-UHFFFAOYSA-N |
| Molecular Formula | C11H14O3 |
Pararosaniline base
CAS: 467-62-9 Molecular Formula: C19H19N3O Molecular Weight (g/mol): 305.38 MDL Number: MFCD00036222 InChI Key: KRVRUAYUNOQMOV-UHFFFAOYSA-N Synonym: pararosaniline base,tris 4-aminophenyl methanol,tris p-aminophenyl methanol,benzenemethanol, 4-amino-.alpha.,.alpha.-bis 4-aminophenyl,tris 4-aminophenyl methan-1-ol,fuchsin dye base,parafuchsin carbinol,tris 4-aminophenyl carbinol,methanol, tris 4-aminophenyl,4,4',4-triaminotrityl alcohol PubChem CID: 10084 IUPAC Name: tris(4-aminophenyl)methanol SMILES: C1=CC(=CC=C1C(C2=CC=C(C=C2)N)(C3=CC=C(C=C3)N)O)N
| PubChem CID | 10084 |
|---|---|
| CAS | 467-62-9 |
| Molecular Weight (g/mol) | 305.38 |
| MDL Number | MFCD00036222 |
| SMILES | C1=CC(=CC=C1C(C2=CC=C(C=C2)N)(C3=CC=C(C=C3)N)O)N |
| Synonym | pararosaniline base,tris 4-aminophenyl methanol,tris p-aminophenyl methanol,benzenemethanol, 4-amino-.alpha.,.alpha.-bis 4-aminophenyl,tris 4-aminophenyl methan-1-ol,fuchsin dye base,parafuchsin carbinol,tris 4-aminophenyl carbinol,methanol, tris 4-aminophenyl,4,4',4-triaminotrityl alcohol |
| IUPAC Name | tris(4-aminophenyl)methanol |
| InChI Key | KRVRUAYUNOQMOV-UHFFFAOYSA-N |
| Molecular Formula | C19H19N3O |
2-Hydroxyethyl salicylate, 98+%, Thermo Scientific Chemicals
CAS: 87-28-5 Molecular Formula: C9H10O4 Molecular Weight (g/mol): 182.18 MDL Number: MFCD00002862 InChI Key: LVYLCBNXHHHPSB-UHFFFAOYSA-N Synonym: 2-hydroxyethyl salicylate,glycol salicylate,ethylene glycol monosalicylate,espirosal,glycol monosalicylate,rheumacyl,sarocol,spirosal,glysal,phlogont PubChem CID: 6880 ChEBI: CHEBI:86541 IUPAC Name: 2-hydroxyethyl 2-hydroxybenzoate SMILES: OCCOC(=O)C1=CC=CC=C1O
| PubChem CID | 6880 |
|---|---|
| CAS | 87-28-5 |
| Molecular Weight (g/mol) | 182.18 |
| ChEBI | CHEBI:86541 |
| MDL Number | MFCD00002862 |
| SMILES | OCCOC(=O)C1=CC=CC=C1O |
| Synonym | 2-hydroxyethyl salicylate,glycol salicylate,ethylene glycol monosalicylate,espirosal,glycol monosalicylate,rheumacyl,sarocol,spirosal,glysal,phlogont |
| IUPAC Name | 2-hydroxyethyl 2-hydroxybenzoate |
| InChI Key | LVYLCBNXHHHPSB-UHFFFAOYSA-N |
| Molecular Formula | C9H10O4 |
2,6-Dibromo-4-(trifluoromethyl)aniline, 97%
CAS: 72678-19-4 Molecular Formula: C7H4Br2F3N Molecular Weight (g/mol): 318.919 MDL Number: MFCD00068181 InChI Key: DRSMEHXBOXHXDX-UHFFFAOYSA-N Synonym: 2,6-dibromo-4-trifluoromethyl aniline,4-amino-3,5-dibromobenzotrifluoride,2,6-dibromo-4-trifluoromethyl phenylamine,benzenamine,2,6-dibromo-4-trifluoromethyl,benzenamine, 2,6-dibromo-4-trifluoromethyl,pubchem2805,acmc-209ony,buttpark 29\06-99,2,6-dibromo-4-trifluoromethyl-phenylamine PubChem CID: 144565 IUPAC Name: 2,6-dibromo-4-(trifluoromethyl)aniline SMILES: C1=C(C=C(C(=C1Br)N)Br)C(F)(F)F
| PubChem CID | 144565 |
|---|---|
| CAS | 72678-19-4 |
| Molecular Weight (g/mol) | 318.919 |
| MDL Number | MFCD00068181 |
| SMILES | C1=C(C=C(C(=C1Br)N)Br)C(F)(F)F |
| Synonym | 2,6-dibromo-4-trifluoromethyl aniline,4-amino-3,5-dibromobenzotrifluoride,2,6-dibromo-4-trifluoromethyl phenylamine,benzenamine,2,6-dibromo-4-trifluoromethyl,benzenamine, 2,6-dibromo-4-trifluoromethyl,pubchem2805,acmc-209ony,buttpark 29\06-99,2,6-dibromo-4-trifluoromethyl-phenylamine |
| IUPAC Name | 2,6-dibromo-4-(trifluoromethyl)aniline |
| InChI Key | DRSMEHXBOXHXDX-UHFFFAOYSA-N |
| Molecular Formula | C7H4Br2F3N |