Inorganic Salts
Filtered Search Results
Bismuth vanadium oxide, 99.9% (metals basis)
CAS: 14059-33-7 Molecular Formula: BiO4V Molecular Weight (g/mol): 323.918 MDL Number: MFCD00064836 InChI Key: YNOWMDYNXXVJMC-UHFFFAOYSA-N Synonym: Bismuth vanadate PubChem CID: 20243764 IUPAC Name: bismuth;trioxido(oxo)vanadium SMILES: [O-][V](=O)([O-])[O-].[Bi+3]
| PubChem CID | 20243764 |
|---|---|
| CAS | 14059-33-7 |
| Molecular Weight (g/mol) | 323.918 |
| MDL Number | MFCD00064836 |
| SMILES | [O-][V](=O)([O-])[O-].[Bi+3] |
| Synonym | Bismuth vanadate |
| IUPAC Name | bismuth;trioxido(oxo)vanadium |
| InChI Key | YNOWMDYNXXVJMC-UHFFFAOYSA-N |
| Molecular Formula | BiO4V |
Millon's reagent, for the detection of Tyrosine
CAS: 10045-94-0 Molecular Formula: HgN2O6 Molecular Weight (g/mol): 324.60 MDL Number: MFCD00011038 InChI Key: ORMNPSYMZOGSSV-UHFFFAOYSA-N Synonym: mercuric nitrate,mercury nitrate,mercury ii nitrate,citrine ointment,mercury dinitrate,millon's reagent,mercury pernitrate,mercury 2+ nitrate,nitrate mercurique french,unii-2fmv9338bw PubChem CID: 24864 IUPAC Name: mercury(2+);dinitrate SMILES: [Hg++].[O-][N+]([O-])=O.[O-][N+]([O-])=O
| PubChem CID | 24864 |
|---|---|
| CAS | 10045-94-0 |
| Molecular Weight (g/mol) | 324.60 |
| MDL Number | MFCD00011038 |
| SMILES | [Hg++].[O-][N+]([O-])=O.[O-][N+]([O-])=O |
| Synonym | mercuric nitrate,mercury nitrate,mercury ii nitrate,citrine ointment,mercury dinitrate,millon's reagent,mercury pernitrate,mercury 2+ nitrate,nitrate mercurique french,unii-2fmv9338bw |
| IUPAC Name | mercury(2+);dinitrate |
| InChI Key | ORMNPSYMZOGSSV-UHFFFAOYSA-N |
| Molecular Formula | HgN2O6 |
Calcium Chloride, ∽97%, MP Biomedicals
CAS: 10043-52-4 Molecular Formula: CaCl2 Molecular Weight (g/mol): 110.98 InChI Key: UXVMQQNJUSDDNG-UHFFFAOYSA-L Synonym: calcium chloride,calcium dichloride,calcium chloride anhydrous,calcium ii chloride,calciumchloride,caloride,liquical,calcium chloride pellets,isocal,jarcal PubChem CID: 5284359 ChEBI: CHEBI:3312 IUPAC Name: calcium dichloride SMILES: [Cl-].[Cl-].[Ca++]
| PubChem CID | 5284359 |
|---|---|
| CAS | 10043-52-4 |
| Molecular Weight (g/mol) | 110.98 |
| ChEBI | CHEBI:3312 |
| SMILES | [Cl-].[Cl-].[Ca++] |
| Synonym | calcium chloride,calcium dichloride,calcium chloride anhydrous,calcium ii chloride,calciumchloride,caloride,liquical,calcium chloride pellets,isocal,jarcal |
| IUPAC Name | calcium dichloride |
| InChI Key | UXVMQQNJUSDDNG-UHFFFAOYSA-L |
| Molecular Formula | CaCl2 |
Cobalt(II) bromide, anhydrous, 97%
CAS: 7789-43-7 Molecular Formula: Br2Co Molecular Weight (g/mol): 218.741 MDL Number: MFCD00016017 InChI Key: BZRRQSJJPUGBAA-UHFFFAOYSA-L Synonym: cobalt bromide,cobalt ii bromide,cobalt bromide cobr2,cobalt dibromide,cobaltous bromide,hsdb 998,cobalt bromide ous PubChem CID: 24610 IUPAC Name: dibromocobalt SMILES: [Co](Br)Br
| PubChem CID | 24610 |
|---|---|
| CAS | 7789-43-7 |
| Molecular Weight (g/mol) | 218.741 |
| MDL Number | MFCD00016017 |
| SMILES | [Co](Br)Br |
| Synonym | cobalt bromide,cobalt ii bromide,cobalt bromide cobr2,cobalt dibromide,cobaltous bromide,hsdb 998,cobalt bromide ous |
| IUPAC Name | dibromocobalt |
| InChI Key | BZRRQSJJPUGBAA-UHFFFAOYSA-L |
| Molecular Formula | Br2Co |
Magnesium sulfate, 99%, extra pure, dried, contains 3 to 4 moles of water
CAS: 22189-08-8 Molecular Formula: MgO4S Molecular Weight (g/mol): 120.36 MDL Number: MFCD00149787 InChI Key: CSNNHWWHGAXBCP-UHFFFAOYSA-L Synonym: magnesium sulfate,magnesium sulphate,magnesium sulfate anhydrous,sulfuric acid magnesium salt 1:1,bitter salt,sal angalis,magnesium sulfate 1:1,mgso4,sal de sedlitz,tomix ot PubChem CID: 24083 ChEBI: CHEBI:32599 SMILES: [Mg++].[O-]S([O-])(=O)=O
| PubChem CID | 24083 |
|---|---|
| CAS | 22189-08-8 |
| Molecular Weight (g/mol) | 120.36 |
| ChEBI | CHEBI:32599 |
| MDL Number | MFCD00149787 |
| SMILES | [Mg++].[O-]S([O-])(=O)=O |
| Synonym | magnesium sulfate,magnesium sulphate,magnesium sulfate anhydrous,sulfuric acid magnesium salt 1:1,bitter salt,sal angalis,magnesium sulfate 1:1,mgso4,sal de sedlitz,tomix ot |
| InChI Key | CSNNHWWHGAXBCP-UHFFFAOYSA-L |
| Molecular Formula | MgO4S |
Sulfuryl chloride, 1.0M solution in dichloromethane, AcroSeal™
CAS: 7791-25-5 | Cl2O2S | 134.96 g/mol
| Linear Formula | SO2Cl2 |
|---|---|
| Molecular Weight (g/mol) | 134.96 |
| ChEBI | CHEBI:29291 |
| Chemical Name or Material | Sulfuryl chloride |
| SMILES | ClS(Cl)(=O)=O |
| Merck Index | 15, 9110 |
| InChI Key | YBBRCQOCSYXUOC-UHFFFAOYSA-N |
| Density | 1.3520g/mL |
| Appearance | Clear pale yellow solution |
| PubChem CID | 24648 |
| Name Note | 1.0M Solution in Dichloromethane |
| Concentration or Composition (by Analyte or Components) | 1M, exact strength on the certificate of analysis |
| CAS | 75-09-2 |
| Health Hazard 3 | GHS P Statement Wear protective gloves/protective clothing/eye protection/face protection. IF SWALLOWED: rinse mouth. Do NOT induce vomiting. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if pre |
| MDL Number | MFCD00011451 |
| Health Hazard 2 | GHS H Statement Suspected of causing cancer. Causes severe skin burns and eye damage. May cause drowsiness or dizziness. Toxic if inhaled. Reacts violently with water. |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | sulfuryl chloride,sulfonyl chloride,sulphuryl dichloride,sulphuryl chloride,sulfonyl dichloride,sulfuric dichloride,sulfuric oxychloride,sulfurylchlorid,caswell no. 816,sulfurylchloride |
| IUPAC Name | sulfuryl dichloride |
| Molecular Formula | Cl2O2S |
| EINECS Number | 232-245-6 |
| Formula Weight | 134.97 |
| Specific Gravity | 1.352 |
Sodium Thiosulfate Solution, (0.1 N) Titripur™ Reag. Ph Eur,Reag. USP; MilliporeSigma™ Sodium Thiosulfate Solution, (0.1 N) Titripur™ Reag. Ph Eur,Reag. USP; MilliporeSigma™
CAS: 10102-17-7 Molecular Formula: H10Na2O8S2 Molecular Weight (g/mol): 248.17 InChI Key: PODWXQQNRWNDGD-UHFFFAOYSA-L Synonym: sodium thiosulfate pentahydrate,ametox,sodium thiosulfate, pentahydrate,antichlor,tinver,disodium thiosulfate pentahydrate,unii-hx1032v43m,ccris 3952,thiosulfuric acid, disodium salt, pentahydrate,sodium hyposulfite pentahydrate PubChem CID: 61475 ChEBI: CHEBI:32150 IUPAC Name: disodium pentahydrate sulfanidesulfonate SMILES: O.O.O.O.O.[Na+].[Na+].[O-]S([S-])(=O)=O
| PubChem CID | 61475 |
|---|---|
| CAS | 10102-17-7 |
| Molecular Weight (g/mol) | 248.17 |
| ChEBI | CHEBI:32150 |
| SMILES | O.O.O.O.O.[Na+].[Na+].[O-]S([S-])(=O)=O |
| Synonym | sodium thiosulfate pentahydrate,ametox,sodium thiosulfate, pentahydrate,antichlor,tinver,disodium thiosulfate pentahydrate,unii-hx1032v43m,ccris 3952,thiosulfuric acid, disodium salt, pentahydrate,sodium hyposulfite pentahydrate |
| IUPAC Name | disodium pentahydrate sulfanidesulfonate |
| InChI Key | PODWXQQNRWNDGD-UHFFFAOYSA-L |
| Molecular Formula | H10Na2O8S2 |
Iodine monochloride, approx. 0.22N soln. in glacial acetic acid
CAS: 7790-99-0 Molecular Formula: ClI Molecular Weight (g/mol): 162.35 MDL Number: MFCD00011354 InChI Key: QZRGKCOWNLSUDK-UHFFFAOYSA-N Synonym: iodine monochloride,iodine chloride,iodochlorine,iodine chloride icl,chloroiodide,wijs' chloride,iodinemonochloride,chlorine iodide,unii-0smg5nlu45,protochlorure d'iode french PubChem CID: 24640 IUPAC Name: iodochlorane SMILES: ClI
| PubChem CID | 24640 |
|---|---|
| CAS | 7790-99-0 |
| Molecular Weight (g/mol) | 162.35 |
| MDL Number | MFCD00011354 |
| SMILES | ClI |
| Synonym | iodine monochloride,iodine chloride,iodochlorine,iodine chloride icl,chloroiodide,wijs' chloride,iodinemonochloride,chlorine iodide,unii-0smg5nlu45,protochlorure d'iode french |
| IUPAC Name | iodochlorane |
| InChI Key | QZRGKCOWNLSUDK-UHFFFAOYSA-N |
| Molecular Formula | ClI |
Sodium metaborate tetrahydrate, 98.5%, extra pure
CAS: 10555-76-7 Molecular Formula: BH8NaO6 Molecular Weight (g/mol): 137.86 MDL Number: MFCD00149205 InChI Key: JAKYJVJWXKRTSJ-UHFFFAOYSA-N Synonym: sodium metaborate tetrahydrate,sodium tetrahydrate oxoborinate,na.bo2.4h2o,boric acid, sodium salt, tetrahydrate PubChem CID: 23694267 SMILES: O.O.O.O.[Na+].[O-]B=O
| PubChem CID | 23694267 |
|---|---|
| CAS | 10555-76-7 |
| Molecular Weight (g/mol) | 137.86 |
| MDL Number | MFCD00149205 |
| SMILES | O.O.O.O.[Na+].[O-]B=O |
| Synonym | sodium metaborate tetrahydrate,sodium tetrahydrate oxoborinate,na.bo2.4h2o,boric acid, sodium salt, tetrahydrate |
| InChI Key | JAKYJVJWXKRTSJ-UHFFFAOYSA-N |
| Molecular Formula | BH8NaO6 |
Mullite
CAS: 1302-93-8 Molecular Formula: Al6O13Si2 Molecular Weight (g/mol): 426.05 MDL Number: MFCD00058866 InChI Key: KZHJGOXRZJKJNY-UHFFFAOYSA-N Synonym: Aluminum oxide/silicon oxide
| CAS | 1302-93-8 |
|---|---|
| Molecular Weight (g/mol) | 426.05 |
| MDL Number | MFCD00058866 |
| Synonym | Aluminum oxide/silicon oxide |
| InChI Key | KZHJGOXRZJKJNY-UHFFFAOYSA-N |
| Molecular Formula | Al6O13Si2 |
Potassium iodide, 99%, extra pure, briquettes
CAS: 7681-11-0 Molecular Formula: IK Molecular Weight (g/mol): 166 InChI Key: NLKNQRATVPKPDG-UHFFFAOYSA-M Synonym: potassium iodide,potassium iodide ki,pima,kali iodide,thyro-block,knollide,kisol,asmofug e,potassium diiodide,potassium monoiodide PubChem CID: 4875 ChEBI: CHEBI:8346 IUPAC Name: potassium;iodide SMILES: [K+].[I-]
| PubChem CID | 4875 |
|---|---|
| CAS | 7681-11-0 |
| Molecular Weight (g/mol) | 166 |
| ChEBI | CHEBI:8346 |
| SMILES | [K+].[I-] |
| Synonym | potassium iodide,potassium iodide ki,pima,kali iodide,thyro-block,knollide,kisol,asmofug e,potassium diiodide,potassium monoiodide |
| IUPAC Name | potassium;iodide |
| InChI Key | NLKNQRATVPKPDG-UHFFFAOYSA-M |
| Molecular Formula | IK |
Indium(III) oxide, 99.99% (metals basis)
CAS: 1312-43-2 Molecular Formula: In2O3 Molecular Weight (g/mol): 277.63 MDL Number: MFCD00011060 InChI Key: PJXISJQVUVHSOJ-UHFFFAOYSA-N IUPAC Name: diindium(3+) trioxidandiide SMILES: [O--].[O--].[O--].[In+3].[In+3]
| CAS | 1312-43-2 |
|---|---|
| Molecular Weight (g/mol) | 277.63 |
| MDL Number | MFCD00011060 |
| SMILES | [O--].[O--].[O--].[In+3].[In+3] |
| IUPAC Name | diindium(3+) trioxidandiide |
| InChI Key | PJXISJQVUVHSOJ-UHFFFAOYSA-N |
| Molecular Formula | In2O3 |
Gallium(III) oxide, 99.99% (metals basis)
CAS: 12024-21-4 Molecular Formula: Ga2O3 Molecular Weight (g/mol): 187.44 MDL Number: MFCD00011020 InChI Key: AJNVQOSZGJRYEI-UHFFFAOYSA-N IUPAC Name: digallium(3+) trioxidandiide SMILES: [O--].[O--].[O--].[Ga+3].[Ga+3]
| CAS | 12024-21-4 |
|---|---|
| Molecular Weight (g/mol) | 187.44 |
| MDL Number | MFCD00011020 |
| SMILES | [O--].[O--].[O--].[Ga+3].[Ga+3] |
| IUPAC Name | digallium(3+) trioxidandiide |
| InChI Key | AJNVQOSZGJRYEI-UHFFFAOYSA-N |
| Molecular Formula | Ga2O3 |
Nickel(II) oxide, green, Ni 78.5%
CAS: 1313-99-1 Molecular Formula: NiO Molecular Weight (g/mol): 74.69 MDL Number: MFCD00011145 InChI Key: GNRSAWUEBMWBQH-UHFFFAOYSA-N Synonym: nickel ii oxide,nickel monoxide,bunsenite,nickelous oxide,nickel oxide,mononickel oxide,nickel protoxide,black nickel oxide,nickel 2+ oxide PubChem CID: 14805 IUPAC Name: oxonickel SMILES: O=[Ni]
| PubChem CID | 14805 |
|---|---|
| CAS | 1313-99-1 |
| Molecular Weight (g/mol) | 74.69 |
| MDL Number | MFCD00011145 |
| SMILES | O=[Ni] |
| Synonym | nickel ii oxide,nickel monoxide,bunsenite,nickelous oxide,nickel oxide,mononickel oxide,nickel protoxide,black nickel oxide,nickel 2+ oxide |
| IUPAC Name | oxonickel |
| InChI Key | GNRSAWUEBMWBQH-UHFFFAOYSA-N |
| Molecular Formula | NiO |