Inorganic Salts
Filtered Search Results
Sodium phosphate dodecahydrate, ACS, 98.0-102.0%
CAS: 10101-89-0 Molecular Formula: H24Na3O16P Molecular Weight (g/mol): 380.119 MDL Number: MFCD00149198 InChI Key: ASTWEMOBIXQPPV-UHFFFAOYSA-K Synonym: trisodium phosphate dodecahydrate,sodium phosphate dodecahydrate,sodium phosphate tribasic dodecahydrate,phosphoric acid, trisodium salt, dodecahydrate,unii-b70850qphr,ccris 7322,sodium phosphate, tribasic, dodecahydrate,trisodium dodecahydrate phosphate,phosphoric acid, trisodium salt, dodeahydrate,trisodium phosphate tert dodecahydrate PubChem CID: 61473 IUPAC Name: trisodium;phosphate;dodecahydrate SMILES: O.O.O.O.O.O.O.O.O.O.O.O.[O-]P(=O)([O-])[O-].[Na+].[Na+].[Na+]
| PubChem CID | 61473 |
|---|---|
| CAS | 10101-89-0 |
| Molecular Weight (g/mol) | 380.119 |
| MDL Number | MFCD00149198 |
| SMILES | O.O.O.O.O.O.O.O.O.O.O.O.[O-]P(=O)([O-])[O-].[Na+].[Na+].[Na+] |
| Synonym | trisodium phosphate dodecahydrate,sodium phosphate dodecahydrate,sodium phosphate tribasic dodecahydrate,phosphoric acid, trisodium salt, dodecahydrate,unii-b70850qphr,ccris 7322,sodium phosphate, tribasic, dodecahydrate,trisodium dodecahydrate phosphate,phosphoric acid, trisodium salt, dodeahydrate,trisodium phosphate tert dodecahydrate |
| IUPAC Name | trisodium;phosphate;dodecahydrate |
| InChI Key | ASTWEMOBIXQPPV-UHFFFAOYSA-K |
| Molecular Formula | H24Na3O16P |
Sodium chromate tetrahydrate, 99+%
CAS: 10034-82-9 Molecular Formula: CrH8Na2O8 Molecular Weight (g/mol): 234.032 MDL Number: MFCD00149167 InChI Key: AVHUVTPOXZEIRG-UHFFFAOYSA-N Synonym: sodium chromate tetrahydrate,cro4.2na.4h2o,acmc-20ajol,disodium chromate tetrahydrate,ksc492q3d,disodium chromate 2-tetrahydrate,sodium chromate tetrahydrate, reagent grade,sodium chromate tetrahydrate, p.a PubChem CID: 22146515 IUPAC Name: disodium;dioxido(dioxo)chromium;tetrahydrate SMILES: O.O.O.O.[O-][Cr](=O)(=O)[O-].[Na+].[Na+]
| PubChem CID | 22146515 |
|---|---|
| CAS | 10034-82-9 |
| Molecular Weight (g/mol) | 234.032 |
| MDL Number | MFCD00149167 |
| SMILES | O.O.O.O.[O-][Cr](=O)(=O)[O-].[Na+].[Na+] |
| Synonym | sodium chromate tetrahydrate,cro4.2na.4h2o,acmc-20ajol,disodium chromate tetrahydrate,ksc492q3d,disodium chromate 2-tetrahydrate,sodium chromate tetrahydrate, reagent grade,sodium chromate tetrahydrate, p.a |
| IUPAC Name | disodium;dioxido(dioxo)chromium;tetrahydrate |
| InChI Key | AVHUVTPOXZEIRG-UHFFFAOYSA-N |
| Molecular Formula | CrH8Na2O8 |
Manganese(II) sulfate tetrahydrate, 99% (metals basis)
CAS: 10101-68-5 Molecular Formula: H8MnO8S Molecular Weight (g/mol): 223.054 MDL Number: MFCD00149160 InChI Key: CDUFCUKTJFSWPL-UHFFFAOYSA-L Synonym: manganese sulfate tetrahydrate,manganese ii sulfate tetrahydrate,unii-f46lh60l4m,manganese sulphate, tetrahydrate,mnso4.4h2o,acmc-1c6k2,mn.so4.4h2o,manganese 2+ sulfate tetrahydrate,manganese ii sulphate tetrahydrate PubChem CID: 22572548 ChEBI: CHEBI:86358 IUPAC Name: manganese(2+);sulfate;tetrahydrate SMILES: O.O.O.O.[O-]S(=O)(=O)[O-].[Mn+2]
| PubChem CID | 22572548 |
|---|---|
| CAS | 10101-68-5 |
| Molecular Weight (g/mol) | 223.054 |
| ChEBI | CHEBI:86358 |
| MDL Number | MFCD00149160 |
| SMILES | O.O.O.O.[O-]S(=O)(=O)[O-].[Mn+2] |
| Synonym | manganese sulfate tetrahydrate,manganese ii sulfate tetrahydrate,unii-f46lh60l4m,manganese sulphate, tetrahydrate,mnso4.4h2o,acmc-1c6k2,mn.so4.4h2o,manganese 2+ sulfate tetrahydrate,manganese ii sulphate tetrahydrate |
| IUPAC Name | manganese(2+);sulfate;tetrahydrate |
| InChI Key | CDUFCUKTJFSWPL-UHFFFAOYSA-L |
| Molecular Formula | H8MnO8S |
Sodium perchlorate, 98%, extra pure
CAS: 7601-89-0 Molecular Formula: ClNaO4 Molecular Weight (g/mol): 122.44 MDL Number: MFCD00003480 InChI Key: BAZAXWOYCMUHIX-UHFFFAOYSA-M Synonym: sodium perchlorate,perchloric acid, sodium salt,natriumperchlorat,perchlorate de sodium,natriumperchloraat dutch,natriumperchlorat german,unii-97f4mty3va,cpl 46,perchlorate de sodium french,sodio perclorato di italian PubChem CID: 522606 IUPAC Name: sodium;perchlorate SMILES: [O-]Cl(=O)(=O)=O.[Na+]
| PubChem CID | 522606 |
|---|---|
| CAS | 7601-89-0 |
| Molecular Weight (g/mol) | 122.44 |
| MDL Number | MFCD00003480 |
| SMILES | [O-]Cl(=O)(=O)=O.[Na+] |
| Synonym | sodium perchlorate,perchloric acid, sodium salt,natriumperchlorat,perchlorate de sodium,natriumperchloraat dutch,natriumperchlorat german,unii-97f4mty3va,cpl 46,perchlorate de sodium french,sodio perclorato di italian |
| IUPAC Name | sodium;perchlorate |
| InChI Key | BAZAXWOYCMUHIX-UHFFFAOYSA-M |
| Molecular Formula | ClNaO4 |
Cobalt(II) nitrate hexahydrate, 99+%, for analysis
CAS: 10026-22-9 Molecular Formula: CoH12N2O12 Molecular Weight (g/mol): 291.03 MDL Number: MFCD00149647 InChI Key: QGUAJWGNOXCYJF-UHFFFAOYSA-N Synonym: cobalt nitrate hexahydrate,cobalt ii nitrate hexahydrate,cobaltous nitrate hexahydrate,cobalt dinitrate hexahydrate,cobalt 2+ nitrate hexahydrate,cobaltous nitrate, hexahydrate,kobalt ii-nitrat-hexahydrat,nitric acid, cobalt 2+ salt, hexahydrate PubChem CID: 24821 ChEBI: CHEBI:86214 IUPAC Name: λ²-cobalt(2+) hexahydrate dinitrate SMILES: O.O.O.O.O.O.[Co++].[O-][N+]([O-])=O.[O-][N+]([O-])=O
| PubChem CID | 24821 |
|---|---|
| CAS | 10026-22-9 |
| Molecular Weight (g/mol) | 291.03 |
| ChEBI | CHEBI:86214 |
| MDL Number | MFCD00149647 |
| SMILES | O.O.O.O.O.O.[Co++].[O-][N+]([O-])=O.[O-][N+]([O-])=O |
| Synonym | cobalt nitrate hexahydrate,cobalt ii nitrate hexahydrate,cobaltous nitrate hexahydrate,cobalt dinitrate hexahydrate,cobalt 2+ nitrate hexahydrate,cobaltous nitrate, hexahydrate,kobalt ii-nitrat-hexahydrat,nitric acid, cobalt 2+ salt, hexahydrate |
| IUPAC Name | λ²-cobalt(2+) hexahydrate dinitrate |
| InChI Key | QGUAJWGNOXCYJF-UHFFFAOYSA-N |
| Molecular Formula | CoH12N2O12 |
Cobalt(II) chloride hexahydrate, 98-102%, ACS reagent
CAS: 7791-13-1 Molecular Formula: Cl2CoH12O6 Molecular Weight (g/mol): 237.92 MDL Number: MFCD00149652 InChI Key: GFHNAMRJFCEERV-UHFFFAOYSA-L IUPAC Name: λ²-cobalt(2+) hexahydrate dichloride SMILES: O.O.O.O.O.O.[Cl-].[Cl-].[Co++]
| CAS | 7791-13-1 |
|---|---|
| Molecular Weight (g/mol) | 237.92 |
| MDL Number | MFCD00149652 |
| SMILES | O.O.O.O.O.O.[Cl-].[Cl-].[Co++] |
| IUPAC Name | λ²-cobalt(2+) hexahydrate dichloride |
| InChI Key | GFHNAMRJFCEERV-UHFFFAOYSA-L |
| Molecular Formula | Cl2CoH12O6 |
Soda lime, indicator grade
CAS: 8006-28-8 Molecular Formula: CaHNaO2 Molecular Weight (g/mol): 96.074 MDL Number: MFCD00134094 InChI Key: HUAUNKAZQWMVFY-UHFFFAOYSA-M Synonym: soda lime,soda-lime,sodasorb,soda lime nf,sodium hydroxide na oh , mixt. with lime,soda-lime, granular,soda lime, indicating,soda lime, indicator grade,soda lime with sodium hydroxide,soda lime, indicating 8-12 mesh PubChem CID: 66545795 IUPAC Name: sodium;oxocalcium;hydroxide SMILES: [OH-].O=[Ca].[Na+]
| PubChem CID | 66545795 |
|---|---|
| CAS | 8006-28-8 |
| Molecular Weight (g/mol) | 96.074 |
| MDL Number | MFCD00134094 |
| SMILES | [OH-].O=[Ca].[Na+] |
| Synonym | soda lime,soda-lime,sodasorb,soda lime nf,sodium hydroxide na oh , mixt. with lime,soda-lime, granular,soda lime, indicating,soda lime, indicator grade,soda lime with sodium hydroxide,soda lime, indicating 8-12 mesh |
| IUPAC Name | sodium;oxocalcium;hydroxide |
| InChI Key | HUAUNKAZQWMVFY-UHFFFAOYSA-M |
| Molecular Formula | CaHNaO2 |
Lead(II) nitrate, ACS, 99.0% min
CAS: 10099-74-8 Molecular Formula: N2O6Pb Molecular Weight (g/mol): 331.20 MDL Number: MFCD00011153 InChI Key: RLJMLMKIBZAXJO-UHFFFAOYSA-N Synonym: lead dinitrate,lead nitrate,lead ii nitrate,plumbous nitrate,lead 2+ nitrate,lead nitrate pb no3 2,nitrate de plomb french,lead ii nitrate 1:2,nitric acid, lead 2+ salt PubChem CID: 24924 ChEBI: CHEBI:37187 SMILES: [Pb++].[O-][N+]([O-])=O.[O-][N+]([O-])=O
| PubChem CID | 24924 |
|---|---|
| CAS | 10099-74-8 |
| Molecular Weight (g/mol) | 331.20 |
| ChEBI | CHEBI:37187 |
| MDL Number | MFCD00011153 |
| SMILES | [Pb++].[O-][N+]([O-])=O.[O-][N+]([O-])=O |
| Synonym | lead dinitrate,lead nitrate,lead ii nitrate,plumbous nitrate,lead 2+ nitrate,lead nitrate pb no3 2,nitrate de plomb french,lead ii nitrate 1:2,nitric acid, lead 2+ salt |
| InChI Key | RLJMLMKIBZAXJO-UHFFFAOYSA-N |
| Molecular Formula | N2O6Pb |
Potassium dichromate, 99.5%, for analysis
CAS: 7778-50-9 Molecular Formula: Cr2K2O7 Molecular Weight (g/mol): 294.19 MDL Number: MFCD00011367 InChI Key: KMUONIBRACKNSN-UHFFFAOYSA-N Synonym: potassium dichromate,potassium bichromate,kaliumdichromat,iopezite,dipotassium bichromate,dipotassium dichromate,potassium dichromate vi,dichromic acid dipotassium salt,dipotassium dichromium heptaoxide,bichromate of potash PubChem CID: 24502 ChEBI: CHEBI:53444 IUPAC Name: dipotassium;oxido-(oxido(dioxo)chromio)oxy-dioxochromium SMILES: [O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-].[K+].[K+]
| PubChem CID | 24502 |
|---|---|
| CAS | 7778-50-9 |
| Molecular Weight (g/mol) | 294.19 |
| ChEBI | CHEBI:53444 |
| MDL Number | MFCD00011367 |
| SMILES | [O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-].[K+].[K+] |
| Synonym | potassium dichromate,potassium bichromate,kaliumdichromat,iopezite,dipotassium bichromate,dipotassium dichromate,potassium dichromate vi,dichromic acid dipotassium salt,dipotassium dichromium heptaoxide,bichromate of potash |
| IUPAC Name | dipotassium;oxido-(oxido(dioxo)chromio)oxy-dioxochromium |
| InChI Key | KMUONIBRACKNSN-UHFFFAOYSA-N |
| Molecular Formula | Cr2K2O7 |
Sodium bromate, 99+%, extra pure
CAS: 7789-38-0 Molecular Formula: BrNaO3 Molecular Weight (g/mol): 150.9 MDL Number: MFCD00003476 InChI Key: XUXNAKZDHHEHPC-UHFFFAOYSA-M Synonym: sodium bromate,bromic acid, sodium salt,dyetone,bromate de sodium,sodium bromate dot,neutralizer k-126,neutralizer k-140,neutralizer k-938,sodium bromate nabro3,bromate de sodium french PubChem CID: 23668195 ChEBI: CHEBI:75229 IUPAC Name: sodium;bromate SMILES: [O-]Br(=O)=O.[Na+]
| PubChem CID | 23668195 |
|---|---|
| CAS | 7789-38-0 |
| Molecular Weight (g/mol) | 150.9 |
| ChEBI | CHEBI:75229 |
| MDL Number | MFCD00003476 |
| SMILES | [O-]Br(=O)=O.[Na+] |
| Synonym | sodium bromate,bromic acid, sodium salt,dyetone,bromate de sodium,sodium bromate dot,neutralizer k-126,neutralizer k-140,neutralizer k-938,sodium bromate nabro3,bromate de sodium french |
| IUPAC Name | sodium;bromate |
| InChI Key | XUXNAKZDHHEHPC-UHFFFAOYSA-M |
| Molecular Formula | BrNaO3 |
Sodium bromide, 99.5%, for analysis
CAS: 7647-15-6 Molecular Formula: BrNa Molecular Weight (g/mol): 102.89 MDL Number: MFCD00003475 InChI Key: JHJLBTNAGRQEKS-UHFFFAOYSA-M Synonym: sodium bromide,bromide salt of sodium,sodium bromide nabr,sedoneural,sodiumbromide,trisodium tribromide,bromnatrium,nabr,bromnatrium german,caswell no. 750a PubChem CID: 253881 ChEBI: CHEBI:63004 SMILES: [Na+].[Br-]
| PubChem CID | 253881 |
|---|---|
| CAS | 7647-15-6 |
| Molecular Weight (g/mol) | 102.89 |
| ChEBI | CHEBI:63004 |
| MDL Number | MFCD00003475 |
| SMILES | [Na+].[Br-] |
| Synonym | sodium bromide,bromide salt of sodium,sodium bromide nabr,sedoneural,sodiumbromide,trisodium tribromide,bromnatrium,nabr,bromnatrium german,caswell no. 750a |
| InChI Key | JHJLBTNAGRQEKS-UHFFFAOYSA-M |
| Molecular Formula | BrNa |
Tin(II) chloride, anhydrous, 99% min
CAS: 7772-99-8 Molecular Formula: Cl2Sn Molecular Weight (g/mol): 189.61 MDL Number: MFCD00011241 InChI Key: AXZWODMDQAVCJE-UHFFFAOYSA-L Synonym: Stannous chloride PubChem CID: 24479 ChEBI: CHEBI:78067 SMILES: [Cl-].[Cl-].[Sn++]
| PubChem CID | 24479 |
|---|---|
| CAS | 7772-99-8 |
| Molecular Weight (g/mol) | 189.61 |
| ChEBI | CHEBI:78067 |
| MDL Number | MFCD00011241 |
| SMILES | [Cl-].[Cl-].[Sn++] |
| Synonym | Stannous chloride |
| InChI Key | AXZWODMDQAVCJE-UHFFFAOYSA-L |
| Molecular Formula | Cl2Sn |
Lithium hydroxide, anhydrous, 98%
CAS: 1310-65-2 Molecular Formula: HLiO Molecular Weight (g/mol): 23.95 MDL Number: MFCD00011095 InChI Key: WMFOQBRAJBCJND-UHFFFAOYSA-M Synonym: lithium hydroxide,lithium hydrate,lioh,lithium hydroxide anhydrous,lithium hydroxide li oh,lithiumhydroxid,lithiumhydroxide,lithium hydoxide,unii-903yl31jas,lithium hydroxide, anhydrous PubChem CID: 3939 ChEBI: CHEBI:33979 SMILES: [Li+].[OH-]
| PubChem CID | 3939 |
|---|---|
| CAS | 1310-65-2 |
| Molecular Weight (g/mol) | 23.95 |
| ChEBI | CHEBI:33979 |
| MDL Number | MFCD00011095 |
| SMILES | [Li+].[OH-] |
| Synonym | lithium hydroxide,lithium hydrate,lioh,lithium hydroxide anhydrous,lithium hydroxide li oh,lithiumhydroxid,lithiumhydroxide,lithium hydoxide,unii-903yl31jas,lithium hydroxide, anhydrous |
| InChI Key | WMFOQBRAJBCJND-UHFFFAOYSA-M |
| Molecular Formula | HLiO |
Cobalt(II) nitrate hexahydrate, 99%, pure
CAS: 10026-22-9 Molecular Formula: CoH12N2O12 Molecular Weight (g/mol): 291.03 MDL Number: MFCD00149647 InChI Key: QGUAJWGNOXCYJF-UHFFFAOYSA-N Synonym: cobalt nitrate hexahydrate,cobalt ii nitrate hexahydrate,cobaltous nitrate hexahydrate,cobalt dinitrate hexahydrate,cobalt 2+ nitrate hexahydrate,cobaltous nitrate, hexahydrate,kobalt ii-nitrat-hexahydrat,nitric acid, cobalt 2+ salt, hexahydrate PubChem CID: 24821 ChEBI: CHEBI:86214 SMILES: O.O.O.O.O.O.[Co++].[O-][N+]([O-])=O.[O-][N+]([O-])=O
| PubChem CID | 24821 |
|---|---|
| CAS | 10026-22-9 |
| Molecular Weight (g/mol) | 291.03 |
| ChEBI | CHEBI:86214 |
| MDL Number | MFCD00149647 |
| SMILES | O.O.O.O.O.O.[Co++].[O-][N+]([O-])=O.[O-][N+]([O-])=O |
| Synonym | cobalt nitrate hexahydrate,cobalt ii nitrate hexahydrate,cobaltous nitrate hexahydrate,cobalt dinitrate hexahydrate,cobalt 2+ nitrate hexahydrate,cobaltous nitrate, hexahydrate,kobalt ii-nitrat-hexahydrat,nitric acid, cobalt 2+ salt, hexahydrate |
| InChI Key | QGUAJWGNOXCYJF-UHFFFAOYSA-N |
| Molecular Formula | CoH12N2O12 |
Cesium chloride, ultrapure, 99.9% (metals basis)
CAS: 7647-17-8 Molecular Formula: ClCs Molecular Weight (g/mol): 168.36 MDL Number: MFCD00010955 InChI Key: AIYUHDOJVYHVIT-UHFFFAOYSA-M Synonym: cesium chloride,caesium chloride,cesium monochloride,cesium chloride cscl,dicesium dichloride,cscl,tricesium trichloride,unii-gnr9hml8ba,gnr9hml8ba,caesium 1+ ion chloride PubChem CID: 24293 ChEBI: CHEBI:63039 IUPAC Name: cesium;chloride SMILES: [Cl-].[Cs+]
| PubChem CID | 24293 |
|---|---|
| CAS | 7647-17-8 |
| Molecular Weight (g/mol) | 168.36 |
| ChEBI | CHEBI:63039 |
| MDL Number | MFCD00010955 |
| SMILES | [Cl-].[Cs+] |
| Synonym | cesium chloride,caesium chloride,cesium monochloride,cesium chloride cscl,dicesium dichloride,cscl,tricesium trichloride,unii-gnr9hml8ba,gnr9hml8ba,caesium 1+ ion chloride |
| IUPAC Name | cesium;chloride |
| InChI Key | AIYUHDOJVYHVIT-UHFFFAOYSA-M |
| Molecular Formula | ClCs |