Inorganic Salts
Filtered Search Results
Cobalt(II) nitrate hexahydrate, 99+%, for analysis
CAS: 10026-22-9 Molecular Formula: CoH12N2O12 Molecular Weight (g/mol): 291.03 MDL Number: MFCD00149647 InChI Key: QGUAJWGNOXCYJF-UHFFFAOYSA-N Synonym: cobalt nitrate hexahydrate,cobalt ii nitrate hexahydrate,cobaltous nitrate hexahydrate,cobalt dinitrate hexahydrate,cobalt 2+ nitrate hexahydrate,cobaltous nitrate, hexahydrate,kobalt ii-nitrat-hexahydrat,nitric acid, cobalt 2+ salt, hexahydrate PubChem CID: 24821 ChEBI: CHEBI:86214 IUPAC Name: λ²-cobalt(2+) hexahydrate dinitrate SMILES: O.O.O.O.O.O.[Co++].[O-][N+]([O-])=O.[O-][N+]([O-])=O
| PubChem CID | 24821 |
|---|---|
| CAS | 10026-22-9 |
| Molecular Weight (g/mol) | 291.03 |
| ChEBI | CHEBI:86214 |
| MDL Number | MFCD00149647 |
| SMILES | O.O.O.O.O.O.[Co++].[O-][N+]([O-])=O.[O-][N+]([O-])=O |
| Synonym | cobalt nitrate hexahydrate,cobalt ii nitrate hexahydrate,cobaltous nitrate hexahydrate,cobalt dinitrate hexahydrate,cobalt 2+ nitrate hexahydrate,cobaltous nitrate, hexahydrate,kobalt ii-nitrat-hexahydrat,nitric acid, cobalt 2+ salt, hexahydrate |
| IUPAC Name | λ²-cobalt(2+) hexahydrate dinitrate |
| InChI Key | QGUAJWGNOXCYJF-UHFFFAOYSA-N |
| Molecular Formula | CoH12N2O12 |
Potassium fluoride, 40 wt.% on alumina, Thermo Scientific Chemicals
CAS: 7789-23-3 Molecular Formula: FK Molecular Weight (g/mol): 58.10 MDL Number: MFCD00011398 InChI Key: NROKBHXJSPEDAR-UHFFFAOYSA-M Synonym: potassium fluoride,potassiumfluoride,potassium fluoride kf,potassium fluorure,fluorure de potassium,potassium fluorure french,potassium fluoride on calcium fluoride,potassium fluoride, anhydrous,unii-9082wg1g3f,ccris 1568 PubChem CID: 522689 ChEBI: CHEBI:66872 IUPAC Name: potassium;fluoride SMILES: [F-].[K+]
| PubChem CID | 522689 |
|---|---|
| CAS | 7789-23-3 |
| Molecular Weight (g/mol) | 58.10 |
| ChEBI | CHEBI:66872 |
| MDL Number | MFCD00011398 |
| SMILES | [F-].[K+] |
| Synonym | potassium fluoride,potassiumfluoride,potassium fluoride kf,potassium fluorure,fluorure de potassium,potassium fluorure french,potassium fluoride on calcium fluoride,potassium fluoride, anhydrous,unii-9082wg1g3f,ccris 1568 |
| IUPAC Name | potassium;fluoride |
| InChI Key | NROKBHXJSPEDAR-UHFFFAOYSA-M |
| Molecular Formula | FK |
Nickel(II) nitrate hexahydrate, 98%
CAS: 13478-00-7 Molecular Formula: H12N2NiO12 Molecular Weight (g/mol): 290.79 MDL Number: MFCD00149805 InChI Key: AOPCKOPZYFFEDA-UHFFFAOYSA-N Synonym: nickel nitrate hexahydrate,nickel ii nitrate hexahydrate,nickel dinitrate hexahydrate,nickel 2+ dinitrate hexahydrate,unii-xbt61wlt1j,nickelous nitrate hexahydrate,nickel 2+ nitrate, hexahydrate,xbt61wlt1j,nitric acid, nickel 2+ salt, hexahydrate,nickel ii nitrate, hexahydrate 1:2:6 PubChem CID: 61630 SMILES: O.O.O.O.O.O.[Ni++].[O-][N+]([O-])=O.[O-][N+]([O-])=O
| PubChem CID | 61630 |
|---|---|
| CAS | 13478-00-7 |
| Molecular Weight (g/mol) | 290.79 |
| MDL Number | MFCD00149805 |
| SMILES | O.O.O.O.O.O.[Ni++].[O-][N+]([O-])=O.[O-][N+]([O-])=O |
| Synonym | nickel nitrate hexahydrate,nickel ii nitrate hexahydrate,nickel dinitrate hexahydrate,nickel 2+ dinitrate hexahydrate,unii-xbt61wlt1j,nickelous nitrate hexahydrate,nickel 2+ nitrate, hexahydrate,xbt61wlt1j,nitric acid, nickel 2+ salt, hexahydrate,nickel ii nitrate, hexahydrate 1:2:6 |
| InChI Key | AOPCKOPZYFFEDA-UHFFFAOYSA-N |
| Molecular Formula | H12N2NiO12 |
Potassium thiocyanate, 98%, pure
CAS: 333-20-0 Molecular Formula: CKNS Molecular Weight (g/mol): 97.18 MDL Number: MFCD00011413 InChI Key: ZNNZYHKDIALBAK-UHFFFAOYSA-M Synonym: potassium thiocyanate,potassium rhodanate,potassium rhodanide,rodanca,potassium sulfocyanate,rhodanide,rhocya,potassium thiocyanide,kscn,thiocyanic acid, potassium salt PubChem CID: 516872 ChEBI: CHEBI:30951 IUPAC Name: potassium;thiocyanate SMILES: C(#N)[S-].[K+]
| PubChem CID | 516872 |
|---|---|
| CAS | 333-20-0 |
| Molecular Weight (g/mol) | 97.18 |
| ChEBI | CHEBI:30951 |
| MDL Number | MFCD00011413 |
| SMILES | C(#N)[S-].[K+] |
| Synonym | potassium thiocyanate,potassium rhodanate,potassium rhodanide,rodanca,potassium sulfocyanate,rhodanide,rhocya,potassium thiocyanide,kscn,thiocyanic acid, potassium salt |
| IUPAC Name | potassium;thiocyanate |
| InChI Key | ZNNZYHKDIALBAK-UHFFFAOYSA-M |
| Molecular Formula | CKNS |
Lithium chloride, ultra dry, 99.9% (metals basis)
CAS: 7447-41-8 Molecular Formula: ClLi Molecular Weight (g/mol): 42.39 MDL Number: MFCD00011078 InChI Key: KWGKDLIKAYFUFQ-UHFFFAOYSA-M Synonym: lithium chloride,lithium chloride licl,lithiumchloride,licl,chlorure de lithium,chlorku litu,chlorolithium,lithiumchlorid,chlorku litu polish,luthium chloride PubChem CID: 433294 ChEBI: CHEBI:48607 IUPAC Name: lithium(1+) chloride SMILES: [Li+].[Cl-]
| PubChem CID | 433294 |
|---|---|
| CAS | 7447-41-8 |
| Molecular Weight (g/mol) | 42.39 |
| ChEBI | CHEBI:48607 |
| MDL Number | MFCD00011078 |
| SMILES | [Li+].[Cl-] |
| Synonym | lithium chloride,lithium chloride licl,lithiumchloride,licl,chlorure de lithium,chlorku litu,chlorolithium,lithiumchlorid,chlorku litu polish,luthium chloride |
| IUPAC Name | lithium(1+) chloride |
| InChI Key | KWGKDLIKAYFUFQ-UHFFFAOYSA-M |
| Molecular Formula | ClLi |
Sodium Nitrite, (USP/FCC), MP Biomedicals
CAS: 7632-00-0 Molecular Formula: NNaO2 Molecular Weight (g/mol): 69.00 MDL Number: MFCD00011118 InChI Key: LPXPTNMVRIOKMN-UHFFFAOYSA-M Synonym: sodium nitrite,nitrous acid, sodium salt,sodiumnitrite,erinitrit,filmerine,natrium nitrit,nitrito sodico,anti-rust,nitrite, sodium,diazotizing salts PubChem CID: 23668193 ChEBI: CHEBI:78870 IUPAC Name: sodium nitrite SMILES: [Na+].[O-]N=O
| PubChem CID | 23668193 |
|---|---|
| CAS | 7632-00-0 |
| Molecular Weight (g/mol) | 69.00 |
| ChEBI | CHEBI:78870 |
| MDL Number | MFCD00011118 |
| SMILES | [Na+].[O-]N=O |
| Synonym | sodium nitrite,nitrous acid, sodium salt,sodiumnitrite,erinitrit,filmerine,natrium nitrit,nitrito sodico,anti-rust,nitrite, sodium,diazotizing salts |
| IUPAC Name | sodium nitrite |
| InChI Key | LPXPTNMVRIOKMN-UHFFFAOYSA-M |
| Molecular Formula | NNaO2 |
Cesium chloride, 99+%, for analysis
CAS: 7647-17-8 Molecular Formula: ClCs Molecular Weight (g/mol): 168.36 MDL Number: MFCD00010955 InChI Key: AIYUHDOJVYHVIT-UHFFFAOYSA-M Synonym: cesium chloride,caesium chloride,cesium monochloride,cesium chloride cscl,dicesium dichloride,cscl,tricesium trichloride,unii-gnr9hml8ba,gnr9hml8ba,caesium 1+ ion chloride PubChem CID: 24293 ChEBI: CHEBI:63039 SMILES: [Cl-].[Cs+]
| PubChem CID | 24293 |
|---|---|
| CAS | 7647-17-8 |
| Molecular Weight (g/mol) | 168.36 |
| ChEBI | CHEBI:63039 |
| MDL Number | MFCD00010955 |
| SMILES | [Cl-].[Cs+] |
| Synonym | cesium chloride,caesium chloride,cesium monochloride,cesium chloride cscl,dicesium dichloride,cscl,tricesium trichloride,unii-gnr9hml8ba,gnr9hml8ba,caesium 1+ ion chloride |
| InChI Key | AIYUHDOJVYHVIT-UHFFFAOYSA-M |
| Molecular Formula | ClCs |
Lanthanum(III) nitrate hexahydrate, 99.9% (REO)
CAS: 10277-43-7 Molecular Formula: H12LaN3O15 Molecular Weight (g/mol): 433.01 MDL Number: MFCD00149751 InChI Key: GJKFIJKSBFYMQK-UHFFFAOYSA-N Synonym: lanthanum iii nitrate hexahydrate,lanthanum nitrate hexahydrate,unii-kj5g6nyf2w,kj5g6nyf2w,lanthanum iii nitrate, hexahydrate 1:3:6,lanthanum nitrate, 6-hydrate,ksc909a4f,lanthanum nitrate hexahydrate,,lanthanum 3+ hexahydrate trinitronate PubChem CID: 16211478 IUPAC Name: lanthanum(3+);trinitrate;hexahydrate SMILES: O.O.O.O.O.O.[La+3].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O
| PubChem CID | 16211478 |
|---|---|
| CAS | 10277-43-7 |
| Molecular Weight (g/mol) | 433.01 |
| MDL Number | MFCD00149751 |
| SMILES | O.O.O.O.O.O.[La+3].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O |
| Synonym | lanthanum iii nitrate hexahydrate,lanthanum nitrate hexahydrate,unii-kj5g6nyf2w,kj5g6nyf2w,lanthanum iii nitrate, hexahydrate 1:3:6,lanthanum nitrate, 6-hydrate,ksc909a4f,lanthanum nitrate hexahydrate,,lanthanum 3+ hexahydrate trinitronate |
| IUPAC Name | lanthanum(3+);trinitrate;hexahydrate |
| InChI Key | GJKFIJKSBFYMQK-UHFFFAOYSA-N |
| Molecular Formula | H12LaN3O15 |
Potassium iodate, 99.4+%, ACS reagent
CAS: 5-6-7758 Molecular Formula: IKO3 Molecular Weight (g/mol): 214.00 MDL Number: MFCD00011406 InChI Key: JLKDVMWYMMLWTI-UHFFFAOYSA-M Synonym: potassium iodate,potassium triodate,caswell no. 693a,iodic acid, potassium salt,unii-i139e44nhl,potassium iodine oxide kio3,iodic acid hio3 , potassium salt,epa pesticide chemical code 075703,iodic acid hio3 , potassium salt 1:1,kaliumjodat PubChem CID: 23665710 IUPAC Name: potassium;iodate SMILES: [O-]I(=O)=O.[K+]
| PubChem CID | 23665710 |
|---|---|
| CAS | 5-6-7758 |
| Molecular Weight (g/mol) | 214.00 |
| MDL Number | MFCD00011406 |
| SMILES | [O-]I(=O)=O.[K+] |
| Synonym | potassium iodate,potassium triodate,caswell no. 693a,iodic acid, potassium salt,unii-i139e44nhl,potassium iodine oxide kio3,iodic acid hio3 , potassium salt,epa pesticide chemical code 075703,iodic acid hio3 , potassium salt 1:1,kaliumjodat |
| IUPAC Name | potassium;iodate |
| InChI Key | JLKDVMWYMMLWTI-UHFFFAOYSA-M |
| Molecular Formula | IKO3 |
Manganese Sulfate Monohydrate, (Crystalline),MP Biomedicals
CAS: 10034-96-5 Molecular Formula: H2MnO5S Molecular Weight (g/mol): 169.01 MDL Number: MFCD00149159 InChI Key: ISPYRSDWRDQNSW-UHFFFAOYSA-L Synonym: manganese sulfate monohydrate,manganese ii sulfate monohydrate,manganese sulfate hydrate,manganese ii sulfate hydrate,mnso4.h2o,manganous sulfate monohydrate,unii-w00lys4t26,manganese 2+ sulfate monohydrate,manganese sulfate usp,manganese 2+ sulfate hydrate PubChem CID: 177577 ChEBI: CHEBI:86364 IUPAC Name: manganese(2+) hydrate sulfate SMILES: O.[Mn++].[O-]S([O-])(=O)=O
| PubChem CID | 177577 |
|---|---|
| CAS | 10034-96-5 |
| Molecular Weight (g/mol) | 169.01 |
| ChEBI | CHEBI:86364 |
| MDL Number | MFCD00149159 |
| SMILES | O.[Mn++].[O-]S([O-])(=O)=O |
| Synonym | manganese sulfate monohydrate,manganese ii sulfate monohydrate,manganese sulfate hydrate,manganese ii sulfate hydrate,mnso4.h2o,manganous sulfate monohydrate,unii-w00lys4t26,manganese 2+ sulfate monohydrate,manganese sulfate usp,manganese 2+ sulfate hydrate |
| IUPAC Name | manganese(2+) hydrate sulfate |
| InChI Key | ISPYRSDWRDQNSW-UHFFFAOYSA-L |
| Molecular Formula | H2MnO5S |
Barium hydroxide octahydrate, 97%
CAS: 12230-71-6 Molecular Formula: BaH18O10 Molecular Weight (g/mol): 315.46 MDL Number: MFCD00149152 InChI Key: ZUDYPQRUOYEARG-UHFFFAOYSA-L Synonym: barium hydroxide octahydrate,unii-l5q5v03tbn,l5q5v03tbn,dihydroxybarium octahydrate,barium dihydroxide octahydrate,barium hydroxide octahydrate mi,barium hydroxide ba oh 2 , octahydrate,acmc-1an7p,barium hydroxide octa hydrate,barium hydroxide octa-hydrate PubChem CID: 17749109 SMILES: O.O.O.O.O.O.O.O.[OH-].[OH-].[Ba++]
| PubChem CID | 17749109 |
|---|---|
| CAS | 12230-71-6 |
| Molecular Weight (g/mol) | 315.46 |
| MDL Number | MFCD00149152 |
| SMILES | O.O.O.O.O.O.O.O.[OH-].[OH-].[Ba++] |
| Synonym | barium hydroxide octahydrate,unii-l5q5v03tbn,l5q5v03tbn,dihydroxybarium octahydrate,barium dihydroxide octahydrate,barium hydroxide octahydrate mi,barium hydroxide ba oh 2 , octahydrate,acmc-1an7p,barium hydroxide octa hydrate,barium hydroxide octa-hydrate |
| InChI Key | ZUDYPQRUOYEARG-UHFFFAOYSA-L |
| Molecular Formula | BaH18O10 |
Isobutyltrimethoxysilane, 97%
CAS: 18395-30-7 Molecular Formula: C7H18O3Si Molecular Weight (g/mol): 178.303 MDL Number: MFCD00051589 InChI Key: XYJRNCYWTVGEEG-UHFFFAOYSA-N Synonym: isobutyltrimethoxysilane,isobutyl trimethoxy silane,silane, trimethoxy 2-methylpropyl,trimethoxy 2-methylpropyl silane,dynasylan ibtmo,prosil 178,isobutyltrimethoxy silane,iso-butyl trimethoxysilane,acmc-1cg69,2-methyl-1-propyltrimethoxysilane PubChem CID: 87622 IUPAC Name: trimethoxy(2-methylpropyl)silane SMILES: CC(C)C[Si](OC)(OC)OC
| PubChem CID | 87622 |
|---|---|
| CAS | 18395-30-7 |
| Molecular Weight (g/mol) | 178.303 |
| MDL Number | MFCD00051589 |
| SMILES | CC(C)C[Si](OC)(OC)OC |
| Synonym | isobutyltrimethoxysilane,isobutyl trimethoxy silane,silane, trimethoxy 2-methylpropyl,trimethoxy 2-methylpropyl silane,dynasylan ibtmo,prosil 178,isobutyltrimethoxy silane,iso-butyl trimethoxysilane,acmc-1cg69,2-methyl-1-propyltrimethoxysilane |
| IUPAC Name | trimethoxy(2-methylpropyl)silane |
| InChI Key | XYJRNCYWTVGEEG-UHFFFAOYSA-N |
| Molecular Formula | C7H18O3Si |
Borax Anhydrous MP Biomedicals
CAS: 1330-43-4 Molecular Formula: B4Na2O7 Molecular Weight (g/mol): 201.21 MDL Number: MFCD00081185 InChI Key: NXSVMNYRVBQCMO-UHFFFAOYSA-N Synonym: Sodium Tetraborate,Sodium Borate Anhydrous,Sodium Borate IUPAC Name: disodium bicyclo[3.3.1]tetraboroxane-3,7-bis(ylium)-1,5-diuide-1,5-bis(olate) SMILES: [Na+].[Na+].[O-][B-]12O[B+]O[B-]([O-])(O[B+]O1)O2
| CAS | 1330-43-4 |
|---|---|
| Molecular Weight (g/mol) | 201.21 |
| MDL Number | MFCD00081185 |
| SMILES | [Na+].[Na+].[O-][B-]12O[B+]O[B-]([O-])(O[B+]O1)O2 |
| Synonym | Sodium Tetraborate,Sodium Borate Anhydrous,Sodium Borate |
| IUPAC Name | disodium bicyclo[3.3.1]tetraboroxane-3,7-bis(ylium)-1,5-diuide-1,5-bis(olate) |
| InChI Key | NXSVMNYRVBQCMO-UHFFFAOYSA-N |
| Molecular Formula | B4Na2O7 |
Tin(IV) iodide, 95%
CAS: 7790-47-8 Molecular Formula: H4I4Sn Molecular Weight (g/mol): 630.36 MDL Number: MFCD00036272 InChI Key: ZBCVLXKKLMNLGV-UHFFFAOYSA-N Synonym: stannic iodide,stannane, tetraiodo,tin iv iodide,tetraiodotin,tin tetraiodide,tin iodide,unii-8h688bw69x,tin iv iodide 1:4,tin-iv-iodide PubChem CID: 24631 IUPAC Name: tetraiodostannane SMILES: [Sn].I.I.I.I
| PubChem CID | 24631 |
|---|---|
| CAS | 7790-47-8 |
| Molecular Weight (g/mol) | 630.36 |
| MDL Number | MFCD00036272 |
| SMILES | [Sn].I.I.I.I |
| Synonym | stannic iodide,stannane, tetraiodo,tin iv iodide,tetraiodotin,tin tetraiodide,tin iodide,unii-8h688bw69x,tin iv iodide 1:4,tin-iv-iodide |
| IUPAC Name | tetraiodostannane |
| InChI Key | ZBCVLXKKLMNLGV-UHFFFAOYSA-N |
| Molecular Formula | H4I4Sn |
Molybdenum hexacarbonyl, 98%
CAS: 13939-06-5 Molecular Formula: C6O6Mo Molecular Weight (g/mol): 264 MDL Number: MFCD00003466 InChI Key: KMKBZNSIJQWHJA-UHFFFAOYSA-N Synonym: molybdenumhexacarbonyl,carbon monooxide-molybdenum 6:1,hexakis carbon monoxide molybdenum,hexacarbonylmolybdenu,hexakis methanidylidyneoxidanium molybdenum,hexacarbonylmolybdenum, may contain up to cr 5g PubChem CID: 2724068 ChEBI: CHEBI:30508 IUPAC Name: carbon monoxide;molybdenum SMILES: [C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[Mo]
| PubChem CID | 2724068 |
|---|---|
| CAS | 13939-06-5 |
| Molecular Weight (g/mol) | 264 |
| ChEBI | CHEBI:30508 |
| MDL Number | MFCD00003466 |
| SMILES | [C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[Mo] |
| Synonym | molybdenumhexacarbonyl,carbon monooxide-molybdenum 6:1,hexakis carbon monoxide molybdenum,hexacarbonylmolybdenu,hexakis methanidylidyneoxidanium molybdenum,hexacarbonylmolybdenum, may contain up to cr 5g |
| IUPAC Name | carbon monoxide;molybdenum |
| InChI Key | KMKBZNSIJQWHJA-UHFFFAOYSA-N |
| Molecular Formula | C6O6Mo |