Inorganic Salts
Filtered Search Results
Mercuric Chloride, Crystal, ACS, 99.5%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 7487-94-7 Molecular Formula: Cl2Hg Molecular Weight (g/mol): 271.49 InChI Key: LWJROJCJINYWOX-UHFFFAOYSA-L IUPAC Name: mercury(2+) dichloride SMILES: [Cl-].[Cl-].[Hg++]
| CAS | 7487-94-7 |
|---|---|
| Molecular Weight (g/mol) | 271.49 |
| SMILES | [Cl-].[Cl-].[Hg++] |
| IUPAC Name | mercury(2+) dichloride |
| InChI Key | LWJROJCJINYWOX-UHFFFAOYSA-L |
| Molecular Formula | Cl2Hg |
Potassium antimonate trihydrate, 94+%
CAS: 12208-13-8 Molecular Formula: KSbO3·3H2O MDL Number: MFCD00150439
| CAS | 12208-13-8 |
|---|---|
| MDL Number | MFCD00150439 |
| Molecular Formula | KSbO3·3H2O |
Mercuric Chloride, Saturated Solution at 0°C, Reagents
Mercuric Chloride, Saturated Solution at 0°C, Reagent, for general laboratory use. Manufactured in ISO 9001 facility.
Mercuric Chloride, BAKER ANALYZED™ A.C.S. Reagent, J.T. Baker™
CAS: 7487-94-7 Molecular Formula: Cl2Hg Molecular Weight (g/mol): 271.49 MDL Number: MFCD00011041 InChI Key: LWJROJCJINYWOX-UHFFFAOYSA-L Synonym: mercuric chloride,mercury ii chloride,sublimate,mercury bichloride,mercury dichloride,corrosive sublimate,mercuric bichloride,mercury perchloride,sublimat,hgcl2 PubChem CID: 24085 ChEBI: CHEBI:31823 IUPAC Name: mercury(2+) dichloride SMILES: [Cl-].[Cl-].[Hg++]
| PubChem CID | 24085 |
|---|---|
| CAS | 7487-94-7 |
| Molecular Weight (g/mol) | 271.49 |
| ChEBI | CHEBI:31823 |
| MDL Number | MFCD00011041 |
| SMILES | [Cl-].[Cl-].[Hg++] |
| Synonym | mercuric chloride,mercury ii chloride,sublimate,mercury bichloride,mercury dichloride,corrosive sublimate,mercuric bichloride,mercury perchloride,sublimat,hgcl2 |
| IUPAC Name | mercury(2+) dichloride |
| InChI Key | LWJROJCJINYWOX-UHFFFAOYSA-L |
| Molecular Formula | Cl2Hg |
Iron(II) fumarate, 94%
CAS: 141-01-5 Molecular Formula: C4H2FeO4-2 Molecular Weight (g/mol): 169.901 MDL Number: MFCD00058315 InChI Key: OOPLWEDSEDELIX-TYYBGVCCSA-L Synonym: ferrous fumarate,eisenfumarat PubChem CID: 66524104 IUPAC Name: (E)-but-2-enedioate;iron SMILES: C(=CC(=O)[O-])C(=O)[O-].[Fe]
| PubChem CID | 66524104 |
|---|---|
| CAS | 141-01-5 |
| Molecular Weight (g/mol) | 169.901 |
| MDL Number | MFCD00058315 |
| SMILES | C(=CC(=O)[O-])C(=O)[O-].[Fe] |
| Synonym | ferrous fumarate,eisenfumarat |
| IUPAC Name | (E)-but-2-enedioate;iron |
| InChI Key | OOPLWEDSEDELIX-TYYBGVCCSA-L |
| Molecular Formula | C4H2FeO4-2 |
Mercuric Chloride, Saturated, Ricca Chemical
CAS: 7732-18-5 Molecular Formula: Cl2Hg Molecular Weight (g/mol): 271.49 MDL Number: MFCD00011041 InChI Key: LWJROJCJINYWOX-UHFFFAOYSA-L Synonym: mercuric chloride,mercury ii chloride,sublimate,mercury bichloride,mercury dichloride,corrosive sublimate,mercuric bichloride,mercury perchloride,sublimat,hgcl2 PubChem CID: 24085 ChEBI: CHEBI:31823 IUPAC Name: mercury(2+) dichloride SMILES: [Cl-].[Cl-].[Hg++]
| PubChem CID | 24085 |
|---|---|
| CAS | 7732-18-5 |
| Molecular Weight (g/mol) | 271.49 |
| ChEBI | CHEBI:31823 |
| MDL Number | MFCD00011041 |
| SMILES | [Cl-].[Cl-].[Hg++] |
| Synonym | mercuric chloride,mercury ii chloride,sublimate,mercury bichloride,mercury dichloride,corrosive sublimate,mercuric bichloride,mercury perchloride,sublimat,hgcl2 |
| IUPAC Name | mercury(2+) dichloride |
| InChI Key | LWJROJCJINYWOX-UHFFFAOYSA-L |
| Molecular Formula | Cl2Hg |
Mercuric Chloride, ACS Reagent Mercury(II) Chloride, Reagents
CAS: 7487-94-7 Molecular Formula: Cl2Hg Molecular Weight (g/mol): 271.49 InChI Key: LWJROJCJINYWOX-UHFFFAOYSA-L Synonym: Mercury(II) Chloride IUPAC Name: mercury(2+) dichloride SMILES: [Cl-].[Cl-].[Hg++]
| CAS | 7487-94-7 |
|---|---|
| Molecular Weight (g/mol) | 271.49 |
| SMILES | [Cl-].[Cl-].[Hg++] |
| Synonym | Mercury(II) Chloride |
| IUPAC Name | mercury(2+) dichloride |
| InChI Key | LWJROJCJINYWOX-UHFFFAOYSA-L |
| Molecular Formula | Cl2Hg |
Thermo Scientific Chemicals Cytidine 5'-triphosphate, disodium salt hydrate, 95%
Dibutyltin dilaurate, 94%
CAS: 77-58-7 Molecular Formula: C32H64O4Sn Molecular Weight (g/mol): 631.57 Synonym: Dodecanoic acid 1, 1';-(dibutylstannylene) ester
| CAS | 77-58-7 |
|---|---|
| Molecular Weight (g/mol) | 631.57 |
| Synonym | Dodecanoic acid 1, 1';-(dibutylstannylene) ester |
| Molecular Formula | C32H64O4Sn |
Mercury(II) chloride, 98+%
CAS: 7487-94-7 Molecular Formula: Cl2Hg Molecular Weight (g/mol): 271.49 MDL Number: MFCD00011041 InChI Key: LWJROJCJINYWOX-UHFFFAOYSA-L Synonym: mercuric chloride,mercury ii chloride,sublimate,mercury bichloride,mercury dichloride,corrosive sublimate,mercuric bichloride,mercury perchloride,sublimat,hgcl2 PubChem CID: 24085 ChEBI: CHEBI:31823 IUPAC Name: dichloromercury SMILES: [Cl-].[Cl-].[Hg++]
| PubChem CID | 24085 |
|---|---|
| CAS | 7487-94-7 |
| Molecular Weight (g/mol) | 271.49 |
| ChEBI | CHEBI:31823 |
| MDL Number | MFCD00011041 |
| SMILES | [Cl-].[Cl-].[Hg++] |
| Synonym | mercuric chloride,mercury ii chloride,sublimate,mercury bichloride,mercury dichloride,corrosive sublimate,mercuric bichloride,mercury perchloride,sublimat,hgcl2 |
| IUPAC Name | dichloromercury |
| InChI Key | LWJROJCJINYWOX-UHFFFAOYSA-L |
| Molecular Formula | Cl2Hg |
Sodium tetracyanoplatinate(II) hydrate, Premion™, 99.95% (metals basis), Pt 48.4% min, Thermo Scientific Chemicals
CAS: 699012-94-7 Molecular Formula: C4N4Na2Pt Molecular Weight (g/mol): 345.13 MDL Number: MFCD00798527 InChI Key: WOIFBVMIVVRIIE-UHFFFAOYSA-N Synonym: disodium tetracyanoplatinumdiuide hydrate,sodium tetracyanoplatinate ii hydrate, premion PubChem CID: 16217382 IUPAC Name: disodium tetracyanoplatinumbis(ylium) SMILES: [Na+].[Na+].N#C[Pt++](C#N)(C#N)C#N
| PubChem CID | 16217382 |
|---|---|
| CAS | 699012-94-7 |
| Molecular Weight (g/mol) | 345.13 |
| MDL Number | MFCD00798527 |
| SMILES | [Na+].[Na+].N#C[Pt++](C#N)(C#N)C#N |
| Synonym | disodium tetracyanoplatinumdiuide hydrate,sodium tetracyanoplatinate ii hydrate, premion |
| IUPAC Name | disodium tetracyanoplatinumbis(ylium) |
| InChI Key | WOIFBVMIVVRIIE-UHFFFAOYSA-N |
| Molecular Formula | C4N4Na2Pt |
Phosphorus oxybromide, 95%
CAS: 7789-59-5 Molecular Formula: Br3OP Molecular Weight (g/mol): 286.69 InChI Key: UXCDUFKZSUBXGM-UHFFFAOYSA-N Synonym: phosphorus oxybromide,phosphoric tribromide,phosphoryl bromide,phosphoryl tribromide,phosphorusoxybromide,phosphorus v oxybromide,unii-h98h8y87qq,phosphorousoxybromide,phosphoroyl tribromide,pobr3 PubChem CID: 24613 SMILES: O=P(Br)(Br)Br
| PubChem CID | 24613 |
|---|---|
| CAS | 7789-59-5 |
| Molecular Weight (g/mol) | 286.69 |
| SMILES | O=P(Br)(Br)Br |
| Synonym | phosphorus oxybromide,phosphoric tribromide,phosphoryl bromide,phosphoryl tribromide,phosphorusoxybromide,phosphorus v oxybromide,unii-h98h8y87qq,phosphorousoxybromide,phosphoroyl tribromide,pobr3 |
| InChI Key | UXCDUFKZSUBXGM-UHFFFAOYSA-N |
| Molecular Formula | Br3OP |
Mercury(II) chloride, ACS, 99.5% min
CAS: 7487-94-7 Molecular Formula: Cl2Hg Molecular Weight (g/mol): 271.49 MDL Number: MFCD00011041 InChI Key: LWJROJCJINYWOX-UHFFFAOYSA-L Synonym: mercuric chloride,mercury ii chloride,sublimate,mercury bichloride,mercury dichloride,corrosive sublimate,mercuric bichloride,mercury perchloride,sublimat,hgcl2 PubChem CID: 24085 ChEBI: CHEBI:31823 IUPAC Name: dichloromercury SMILES: [Cl-].[Cl-].[Hg++]
| PubChem CID | 24085 |
|---|---|
| CAS | 7487-94-7 |
| Molecular Weight (g/mol) | 271.49 |
| ChEBI | CHEBI:31823 |
| MDL Number | MFCD00011041 |
| SMILES | [Cl-].[Cl-].[Hg++] |
| Synonym | mercuric chloride,mercury ii chloride,sublimate,mercury bichloride,mercury dichloride,corrosive sublimate,mercuric bichloride,mercury perchloride,sublimat,hgcl2 |
| IUPAC Name | dichloromercury |
| InChI Key | LWJROJCJINYWOX-UHFFFAOYSA-L |
| Molecular Formula | Cl2Hg |
Vinyloxytrimethylsilane, 97%
CAS: 6213-94-1 Molecular Formula: C5H12OSi Molecular Weight (g/mol): 116.235 MDL Number: MFCD00054764 InChI Key: HFTNNOZFRQLFQB-UHFFFAOYSA-N Synonym: trimethyl vinyloxy silane,vinyloxytrimethylsilane,silane, ethenyloxy trimethyl,tmso-ethene,vinyloxy-trimethylsilane,trimethylsiloxy ethylene,snqhhgciiezjp@,acmc-209mzx,ethenoxy trimethyl silane,trimethylsilyl vinyl ether PubChem CID: 80344 IUPAC Name: ethenoxy(trimethyl)silane SMILES: C[Si](C)(C)OC=C
| PubChem CID | 80344 |
|---|---|
| CAS | 6213-94-1 |
| Molecular Weight (g/mol) | 116.235 |
| MDL Number | MFCD00054764 |
| SMILES | C[Si](C)(C)OC=C |
| Synonym | trimethyl vinyloxy silane,vinyloxytrimethylsilane,silane, ethenyloxy trimethyl,tmso-ethene,vinyloxy-trimethylsilane,trimethylsiloxy ethylene,snqhhgciiezjp@,acmc-209mzx,ethenoxy trimethyl silane,trimethylsilyl vinyl ether |
| IUPAC Name | ethenoxy(trimethyl)silane |
| InChI Key | HFTNNOZFRQLFQB-UHFFFAOYSA-N |
| Molecular Formula | C5H12OSi |
Dimethylethoxysilane, 94%
CAS: 14857-34-2 Molecular Formula: C4H11OSi Molecular Weight (g/mol): 103.216 MDL Number: MFCD00026750 InChI Key: DRUOQOFQRYFQGB-UHFFFAOYSA-N Synonym: ethoxydimethylsilane,dimethylethoxysilane,silane, ethoxydimethyl,dimethyl ethoxysilane,ethoxy dimethyl silicon,dimethylethoxysilane, ammonia-free,ethoxydimethylsilyl,ethoxydimethyl-silan,sgqhhgcihcup@,4-04-00-03991 beilstein handbook reference PubChem CID: 6328550 IUPAC Name: ethoxy(dimethyl)silicon SMILES: CCO[Si](C)C
| PubChem CID | 6328550 |
|---|---|
| CAS | 14857-34-2 |
| Molecular Weight (g/mol) | 103.216 |
| MDL Number | MFCD00026750 |
| SMILES | CCO[Si](C)C |
| Synonym | ethoxydimethylsilane,dimethylethoxysilane,silane, ethoxydimethyl,dimethyl ethoxysilane,ethoxy dimethyl silicon,dimethylethoxysilane, ammonia-free,ethoxydimethylsilyl,ethoxydimethyl-silan,sgqhhgcihcup@,4-04-00-03991 beilstein handbook reference |
| IUPAC Name | ethoxy(dimethyl)silicon |
| InChI Key | DRUOQOFQRYFQGB-UHFFFAOYSA-N |
| Molecular Formula | C4H11OSi |