Citric Acid
eMolecules 201740-78-5 | Medchem Express | Boc-Ala-OH-1-13C | 50mg | 721611305 | HY-41121S | MFCD00083884 | 190.203 | C8H15NO4
Ambeed | Boc-His(Tos)-OH | 5g | 552680896 | A259776 | 35899-43-5 | MFCD00065967 | 409.460 | C18H23N3O6S
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 1561-11-1 | Ambeed | 4-Methylhexanoicacid | 100mg | 626257063 | A545679 | MFCD00870848 | 130.187 | C7H14O2
ChemScene | (R)-22-Dimethyl-1-(5-methylfuran-2-yl)propan-1-amine hydrochloride | 100mg | 582636030 | CS-0115163 | 2170760-93-5 | MFCD28290545 | 203.710 | C10H18ClNO
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
![eMolecules 7132-93-6 | TRANS-(4-METHYL-CYCLOHEXYL)-ACETIC ACID | AstaTech | MFCD06796533 | 156.225 | C9H16O2 | 96.000 | C[C@H]1CC[C@H](CC(O)=O)CC1 | 0.1g | 771346207](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502473786.JPG-250.jpg)
eMolecules 7132-93-6 | TRANS-(4-METHYL-CYCLOHEXYL)-ACETIC ACID | AstaTech | MFCD06796533 | 156.225 | C9H16O2 | 96.000 | C[C@H]1CC[C@H](CC(O)=O)CC1 | 0.1g | 771346207
TRANS-(4-METHYL-CYCLOHEXYL)-ACETIC ACID | AstaTech | 7132-93-6 | MFCD06796533 | 156.225 | C9H16O2 | 96.000 | C[C@H]1CC[C@H](CC(O)=O)CC1 | 0.1g | 771346207
eMolecules 77-92-9 | Citric Acid, anhydrous, USP | Oakwood Chemicals192.123 | C6H8O7 | 99.000 | OC(=O)CC(O)(CC(O)=O)C(O)=O | 250g | 480153419
Citric Acid, anhydrous, USP | Oakwood Chemicals | 77-92-9192.123 | C6H8O7 | 99.000 | OC(=O)CC(O)(CC(O)=O)C(O)=O | 250g | 480153419
![eMolecules 711-02-4 | Ambeed | Bicyclo[2.2.2]octane-14-dicarboxylic acid | 1g | 600831263 | A151946 | MFCD00498000 | 198.218 | C10H14O4](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502515657.JPG-250.jpg)
eMolecules 711-02-4 | Ambeed | Bicyclo[2.2.2]octane-14-dicarboxylic acid | 1g | 600831263 | A151946 | MFCD00498000 | 198.218 | C10H14O4
Ambeed | Bicyclo[2.2.2]octane-14-dicarboxylic acid | 1g | 600831263 | A151946 | 711-02-4 | MFCD00498000 | 198.218 | C10H14O4
Sigma Aldrich Fine Chemicals Biosciences Citric acid | 77-92-9 | MFCD00011669 | 50mg
Citric acid | MW:192.12 | 77-92-9 | MFCD00011669 | 50mg
eMolecules 4355-11-7 | 1,1-Cyclohexanediacetic acid | Ambeed | MFCD00001519 | 200.234 | C10H16O4 | 97.000 | OC(=O)CC1(CC(O)=O)CCCCC1 | 5g | 525097751
1,1-Cyclohexanediacetic acid | Ambeed | 4355-11-7 | MFCD00001519 | 200.234 | C10H16O4 | 97.000 | OC(=O)CC1(CC(O)=O)CCCCC1 | 5g | 525097751
Alkali Scientific Citric Acid, Monohydrate, ACS Grade, 5 Kg
Citric Acid Monohydrate, ACS Grade, 5 kg, is a high-purity reagent used in a wide range of laboratory and industrial applications. Citric acid is central to energy metabolism and acts as a natural preservative in food and pharmaceuticals. Its role in buffer systems, as a pH adjuster, and in the chelation of metal ions makes it a versatile reagent in scientific research. The 5 kg package is well-suited for labs and manufacturing processes that require large quantities of citric acid, such as biochemistry experiments, industrial scale synthesis, and production of food and cosmetic products. Its high purity ensures reliable results in sensitive experiments.
eMolecules 25354-95-4 | 2-butyldodecanoic acid | Synthonix | MFCD00506175 | 256.430 | C16H32O2 | 97.000 | CCCCCCCCCCC(CCCC)C(O)=O | 250mg | 784552938
2-butyldodecanoic acid | Synthonix | 25354-95-4 | MFCD00506175 | 256.430 | C16H32O2 | 97.000 | CCCCCCCCCCC(CCCC)C(O)=O | 250mg | 784552938
eMolecules 2229401-94-7 | 4-(4-Boc-amino-phenyl)-tetrahydro-pyran-4-carboxylic acid | J&W PharmLab LLC321.373 | C17H23NO5 | 96.000 | CC(C)(C)OC(=O)Nc1ccc(cc1)C1(CCOCC1)C(O)=O | 100mg | 794066971
4-(4-Boc-amino-phenyl)-tetrahydro-pyran-4-carboxylic acid | J&W PharmLab LLC | 2229401-94-7321.373 | C17H23NO5 | 96.000 | CC(C)(C)OC(=O)Nc1ccc(cc1)C1(CCOCC1)C(O)=O | 100mg | 794066971
![eMolecules 21461-84-7 | (S)-5-Oxo-2-tetrahydrofurancarboxylic Acid | Ambeed | MFCD00064516 | 130.099 | C5H6O4 | 98.000 | OC(=O)[C@@H]1CCC(=O)O1 | 250mg | 525233836](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502422975.PNG-250.jpg)
eMolecules 21461-84-7 | (S)-5-Oxo-2-tetrahydrofurancarboxylic Acid | Ambeed | MFCD00064516 | 130.099 | C5H6O4 | 98.000 | OC(=O)[C@@H]1CCC(=O)O1 | 250mg | 525233836
(S)-5-Oxo-2-tetrahydrofurancarboxylic Acid | Ambeed | 21461-84-7 | MFCD00064516 | 130.099 | C5H6O4 | 98.000 | OC(=O)[C@@H]1CCC(=O)O1 | 250mg | 525233836
eMolecules Medchem Express | Oxaprozin-d4 | 1mg | 415688812 | HY-B0808S | MFCD28900733 | 297.346 | C18H15NO3
Medchem Express | Oxaprozin-d4 | 1mg | 415688812 | HY-B0808S | | MFCD28900733 | 297.346 | C18H15NO3