Halomethanes
![eMolecules 1733-88-6 | POTASSIUM PHENYL SULFATE | AstaTech | MFCD00070590 | 212.260 | C6H5KO4S | 98.000 | [K+].[O-]S(=O)(=O)Oc1ccccc1 | 0.25g | 448280741](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502455664.PNG-250.jpg)
eMolecules 1733-88-6 | POTASSIUM PHENYL SULFATE | AstaTech | MFCD00070590 | 212.260 | C6H5KO4S | 98.000 | [K+].[O-]S(=O)(=O)Oc1ccccc1 | 0.25g | 448280741
POTASSIUM PHENYL SULFATE | AstaTech | 1733-88-6 | MFCD00070590 | 212.260 | C6H5KO4S | 98.000 | [K+].[O-]S(=O)(=O)Oc1ccccc1 | 0.25g | 448280741
eMolecules 174302-88-6 | 2-AMINO-3-(2-FLUOROPHENYL)PROPAN-1-OL | AstaTech | MFCD09744985 | 169.199 | C9H12FNO | 95.000 | NC(CO)Cc1ccccc1F | 0.25g | 323613951
2-AMINO-3-(2-FLUOROPHENYL)PROPAN-1-OL | AstaTech | 174302-88-6 | MFCD09744985 | 169.199 | C9H12FNO | 95.000 | NC(CO)Cc1ccccc1F | 0.25g | 323613951
eMolecules 16849-88-0 | (DIMETHYLAMINOMETHYLENE)MALONONITRILE | AstaTech | MFCD00001853 | 121.143 | C6H7N3 | 97.000 | CN(C)C=C(C#N)C#N | 1g | 449723896
(DIMETHYLAMINOMETHYLENE)MALONONITRILE | AstaTech | 16849-88-0 | MFCD00001853 | 121.143 | C6H7N3 | 97.000 | CN(C)C=C(C#N)C#N | 1g | 449723896
eMolecules 75-11-6 | Diiodomethane | Combi-Blocks | MFCD00001079 | 267.836 | CH2I2 | 98.000 | ICI | 25g | 117543610
Diiodomethane | Combi-Blocks | 75-11-6 | MFCD00001079 | 267.836 | CH2I2 | 98.000 | ICI | 25g | 117543610
eMolecules 33309-88-5 | AstaTech | BIS(TRICYCLOHEXYLPHOSPHINE)PALLADIUM(0) | 0.25g | 696744802 | E73869 | 95 | MFCD01073796 | 667.29 | C36H66P2Pd
Ambeed | 2-(3-Bromophenyl)-2-methylpropanoic acid | 250mg | 521416817 | A181664 | 81606-47-5 | MFCD11036929 | 243.100 | C10H11BrO2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 558-13-4 | Carbon tetrabromide | Oakwood Chemicals | MFCD00000117 | 331.627 | CBr4 | 99.000 | BrC(Br)(Br)Br | 5g | 480153916
Carbon tetrabromide | Oakwood Chemicals | 558-13-4 | MFCD00000117 | 331.627 | CBr4 | 99.000 | BrC(Br)(Br)Br | 5g | 480153916
eMolecules 593-71-5 | Chloroiodomethane | Combi-Blocks | MFCD00001078 | 176.380 | CH2ClI | 98.000 | ClCI | 500g | 228814127
Chloroiodomethane | Combi-Blocks | 593-71-5 | MFCD00001078 | 176.380 | CH2ClI | 98.000 | ClCI | 500g | 228814127
Medchemexpress LLC Aryl Hydrocarbon Receptor Antibody (YA610) | Predicted band size: 96 kDa; Observed band size: 105 kDa | 50 UL
Aryl Hydrocarbon Receptor Antibody (YA610) is a rabbit-derived, non-conjugated IgG monoclonal antibody, specifically targeting the Aryl Hydrocarbon Receptor. It is for research use only and not intended for patient use.
- Rabbit-derived recombinant monoclonal antibody
- Targets human Aryl Hydrocarbon Receptor
- Validated for Western Blot and Immunocytochemistry/Immunofluorescence
- Supplied as a liquid in TBS with BSA, glycerol, and sodium azide preservative
- Store at -20°C for up to 1 year
- Plays a role in development, immunity, and cancer
- Regulates angiogenesis, hematopoiesis, and metabolism
- Functions as a ligand-activated transcription factor
- Subcellular localization in cytoplasm and nucleus
eMolecules 75-11-6 | diiodomethane | Broadpharm | MFCD00001079 | 267.836 | CH2I2 | 96.000 | ICI | 5g | 200183347
diiodomethane | Broadpharm | 75-11-6 | MFCD00001079 | 267.836 | CH2I2 | 96.000 | ICI | 5g | 200183347