Aryl bromides
eMolecules 316-69-8 | 4-Fluoronaphthalene-1-sulfonyl chloride | Combi-Blocks | MFCD02091376 | 244.660 | C10H6ClFO2S | 97.000 | Fc1ccc(c2ccccc12)S(Cl)(=O)=O | 1g | 117562378
4-Fluoronaphthalene-1-sulfonyl chloride | Combi-Blocks | 316-69-8 | MFCD02091376 | 244.660 | C10H6ClFO2S | 97.000 | Fc1ccc(c2ccccc12)S(Cl)(=O)=O | 1g | 117562378
Aobchem 1-(5-Bromobenzofuran-2-yl)-2 2 3 3 3-pentafluoropropan-1-one | 97% | CAS 3002473-49-3 | C11H4BrF5O2 | 1g
1-(5-Bromobenzofuran-2-yl)-2 2 3 3 3-pentafluoropropan-1-one | 97% | CAS 3002473-49-3 | C11H4BrF5O2 | 1g
Aobchem 1-(3-Bromobenzofuran-2-yl)ethanone | ≥95% | CAS 99661-02-6 | C10H7BrO2 | 500mg
1-(3-Bromobenzofuran-2-yl)ethanone | ≥95% | CAS 99661-02-6 | C10H7BrO2 | 500mg
Aobchem 1-(3-Bromobenzofuran-2-yl)ethanone | ≥95% | CAS 99661-02-6 | C10H7BrO2 | 250mg
1-(3-Bromobenzofuran-2-yl)ethanone | ≥95% | CAS 99661-02-6 | C10H7BrO2 | 250mg
Aobchem Ethyl 2-(5-bromobenzofuran-2-yl)-2-oxoacetate | 95% | CAS 1506492-26-7 | C12H9BrO4 | 1g
Ethyl 2-(5-bromobenzofuran-2-yl)-2-oxoacetate | 95% | CAS 1506492-26-7 | C12H9BrO4 | 1g
Aobchem Ethyl 2-(3-bromobenzofuran-2-yl)-2-oxoacetate | 95% | C12H9BrO4 | 500mg
Ethyl 2-(3-bromobenzofuran-2-yl)-2-oxoacetate | 95% | C12H9BrO4 | 500mg
Aobchem 2-(4-Phenylnaphthalen-1-yl)propan-2-ol | 95% | C19H18O | 250mg
2-(4-Phenylnaphthalen-1-yl)propan-2-ol | 95% | C19H18O | 250mg
eMolecules 22098-10-8 | Ethyl (5-bromothien-2-yl)glyoxylate | Combi-Blocks | MFCD00085056 | 263.110 | C8H7BrO3S | 98.000 | CCOC(=O)C(=O)c1ccc(Br)s1 | 1g | 117559469
Ethyl (5-bromothien-2-yl)glyoxylate | Combi-Blocks | 22098-10-8 | MFCD00085056 | 263.110 | C8H7BrO3S | 98.000 | CCOC(=O)C(=O)c1ccc(Br)s1 | 1g | 117559469
eMolecules 4915-06-4 | 5-Bromofuran-2-carbonitrile | MFCD03410206 | 1g
Medchem Express | KY-02327 (acetate) | 5mg | 719836736 | HY-124156A | | 433.505 | C22H31N3O6
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 850554-81-3 | (2-AMINO-4,6-DICHLOROPYRIMIDIN-5-YL)METHANOL | AstaTech | MFCD12756208 | 194.020 | C5H5Cl2N3O | 95.000 | Nc1nc(Cl)c(CO)c(Cl)n1 | 1g | 457903416
(2-AMINO-4,6-DICHLOROPYRIMIDIN-5-YL)METHANOL | AstaTech | 850554-81-3 | MFCD12756208 | 194.020 | C5H5Cl2N3O | 95.000 | Nc1nc(Cl)c(CO)c(Cl)n1 | 1g | 457903416
Accela Chembio Inc 5-bromo-7-azaindole | 25g | 183208-35-7 | MFCD06659677 | 97+% | Shelf Life: 900 Days | Light Sensitive/nitrogen Or Argon/+4
5-bromo-7-azaindole | 25g | 183208-35-7 | MFCD06659677 | 97+% | Shelf Life: 900 Days | Light Sensitive/nitrogen Or Argon/+4
eMolecules 253787-45-0 | Methyl 8-bromoquinoline-5-carboxylate | MFCD12963565 | 1g
Ambeed | trans-4-Methoxycyclohexanamine hydrochloride | 1g | 600837231 | A312730 | 61367-41-7 | MFCD18207785 | 165.660 | C7H16ClNO
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 912934-77-1 | Ambeed | 6-Bromopyridine-2-sulfonyl chloride | 250mg | 490505494 | A132245 | MFCD11870765 | 256.5 | C5H3BrClNO2S
Ambeed | 6-Bromopyridine-2-sulfonyl chloride | 250mg | 490505494 | A132245 | 912934-77-1 | MFCD11870765 | 256.500 | C5H3BrClNO2S
eMolecules 161038-18-2 | Ambeed | 5-Fluoroquinolin-8-amine | 250mg | 791168328 | A496798 | MFCD09263638 | 162.167 | C9H7FN2
Ambeed | rel-(3aS7aS)-(5-Methyloctahydro-7aH-pyrrolo[34-c]pyridin-7a-yl)methanol dihydrochloride | 25mg | 672838188 | A1492717 | 2243507-51-7 | 486.340 | C18H40Cl4N4O2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
![eMolecules 22053-74-3 | 3-Methylbenzo[b]thiophene-2-carboxaldehyde | Combi-Blocks | MFCD00052307 | 176.230 | C10H8OS | 98.000 | Cc1c(C=O)sc2ccccc12 | 25g | 415500568](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502185139.JPG-250.jpg)
eMolecules 22053-74-3 | 3-Methylbenzo[b]thiophene-2-carboxaldehyde | Combi-Blocks | MFCD00052307 | 176.230 | C10H8OS | 98.000 | Cc1c(C=O)sc2ccccc12 | 25g | 415500568
3-Methylbenzo[b]thiophene-2-carboxaldehyde | Combi-Blocks | 22053-74-3 | MFCD00052307 | 176.230 | C10H8OS | 98.000 | Cc1c(C=O)sc2ccccc12 | 25g | 415500568