Aryl chlorides
eMolecules 111454-68-3 | 5-Bromo-2,3-dimethylpyrazine | MFCD12404946 | 1g
Ambeed | 5-((tert-Butoxycarbonyl)amino)pentyl 4-methylbenzenesulfonate | 250mg | 660583702 | A244026 | 118811-34-0 | MFCD07776967 | 357.470 | C17H27NO5S
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 290-87-9 | 1,3,5-Triazine | Combi-Blocks | MFCD00006044 | 81.078 | C3H3N3 | 98.000 | c1ncncn1 | 1g | 232313412
1,3,5-Triazine | Combi-Blocks | 290-87-9 | MFCD00006044 | 81.078 | C3H3N3 | 98.000 | c1ncncn1 | 1g | 232313412
eMolecules 910231-21-9 | Ambeed | ((135-Triazine-246-triyl)tris(benzene-41-diyl))triboronic acid | 100mg | 633660141 | A1271735 | 440.82 | C21H18B3N3O6
Ambeed | ((135-Triazine-246-triyl)tris(benzene-41-diyl))triboronic acid | 100mg | 633660141 | A1271735 | 910231-21-9 | 440.820 | C21H18B3N3O6
eMolecules 115615-19-5 | 2-Bromo-4,6-dichlorotoluene | Combi-Blocks | MFCD09801039 | 239.920 | C7H5BrCl2 | 98.000 | Cc1c(Cl)cc(Cl)cc1Br | 1g | 117542362
2-Bromo-4,6-dichlorotoluene | Combi-Blocks | 115615-19-5 | MFCD09801039 | 239.920 | C7H5BrCl2 | 98.000 | Cc1c(Cl)cc(Cl)cc1Br | 1g | 117542362
eMolecules 53827-53-5 | 6-methyl-2-benzothiazolinone | MFCD08689970 | 1g
WuXi ChemSupply | 6-methyl-2-benzothiazolinone | 1g | 599167192 | LN01057353 | 95.000 | 53827-53-5 | MFCD08689970 | 165.210 | C8H7NOS
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
Accela Chembio Inc 4-chloropyrazole | 100g | 15878-00-9 | MFCD00159634 | 97+% | Shelf Life: 1260 Days | Light Sensitive/+4
4-chloropyrazole | 100g | 15878-00-9 | MFCD00159634 | 97+% | Shelf Life: 1260 Days | Light Sensitive/+4
eMolecules 85103-31-7 | 5-(p-Tolyl)-1,3,4-thiadiazole-2(3H)-thione | 100mg
Ambeed | 5-(p-Tolyl)-1,3,4-thiadiazole-2(3H)-thione | 100mg | 602849198 | A1166411 | 85103-31-7 | 208.300 | C9H8N2S2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
Frontier Specialty Chemicals 5g 5-Chloro-1-methylimidazole, 872-49-1 MFCD00014505
5-Chloro-1-methylimidazole CAS: 872-49-1 MFCD00014505 Building Blocks Imidazole
eMolecules 157891-77-5 | 1,1'-(OXYBIS(4,1-PHENYLENE))BIS(2-BROMO-2-METHYLPROPAN-1-ONE) | AstaTech | MFCD29921811 | 468.185 | C20H20Br2O3 | 95.000 | CC(C)(Br)C(=O)c1ccc(Oc2ccc(cc2)C(=O)C(C)(C)Br)cc1 | 1g | 302799904
1,1'-(OXYBIS(4,1-PHENYLENE))BIS(2-BROMO-2-METHYLPROPAN-1-ONE) | AstaTech | 157891-77-5 | MFCD29921811 | 468.185 | C20H20Br2O3 | 95.000 | CC(C)(Br)C(=O)c1ccc(Oc2ccc(cc2)C(=O)C(C)(C)Br)cc1 | 1g | 302799904
Accela Chembio Inc 2-chlorobenzimidazole | 100g | 4857-06-1 | MFCD00051944 | 97+% | Shelf Life: 540 Days | Light Sensitive
2-chlorobenzimidazole | 100g | 4857-06-1 | MFCD00051944 | 97+% | Shelf Life: 540 Days | Light Sensitive
Chemscene ChemScene | 3-Chloro-4-cyanopyridine | 10G | CS-W003228 | 0.98 | 68325-15-5| MFCD05663706 | 138.56
ChemScene | 3-Chloro-4-cyanopyridine | 10G | CS-W003228 | 0.98 | 68325-15-5| MFCD05663706 | 138.56
Aobchem 1-Benzyl-3 5-dichlorobenzene | 97% | C13H10Cl2 | 5g
1-Benzyl-3 5-dichlorobenzene | 97% | C13H10Cl2 | 5g
Aobchem 3 5-Dichlorobenzene-1 2-diol | ≥95% | CAS 13673-92-2 | C6H4Cl2O2 | 10g
3 5-Dichlorobenzene-1 2-diol | ≥95% | CAS 13673-92-2 | C6H4Cl2O2 | 10g
Aobchem 3-Bromo-2 4-dichlorotoluene | ≥97% | CAS 206559-41-3 | C7H5BrCl2 | 500mg
3-Bromo-2 4-dichlorotoluene | ≥97% | CAS 206559-41-3 | C7H5BrCl2 | 500mg