Aryl chlorides
eMolecules 245737-33-1 | ChemScene | (Nitrilotri-41-phenylene)trisboronic acid | 100mg | 712787779 | CS-0146300 | 376.77 | C18H18B3NO6
Ambeed | Bis(pentafluorophenyl) Carbonate | 5g | 552652397 | A214554 | 59483-84-0 | MFCD00368353 | 394.124 | C13F10O3
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
Accela Chembio Inc 2 | 6-dichloropurine | 25g | 5451-40-1 | MFCD00077725 | 97+% | Shelf Life: 1260 Days | Moisture Sensitive/+4
2 | 6-dichloropurine | 25g | 5451-40-1 | MFCD00077725 | 97+% | Shelf Life: 1260 Days | Moisture Sensitive/+4
Chem-Impex International, Inc. 5-Chloroindole-2-carboxylic acid | 10517-21-2 | MFCD00005613 | 1G
5-Chloroindole-2-carboxylic acid, 10517-21-2, MFCD00005613, 1G
eMolecules 1646906-26-4 | ((1,3,5-Triazine-2,4,6-triyl)tris(benzene-3,1-diyl))tris(diphenylphosphine oxide) | ChemScene909.902 | C57H42N3O3P3 | 98.000 | O=P(c1ccccc1)(c1ccccc1)c1cccc(c1)-c1nc(nc(n1)-c1cccc(c1)P(=O)(c1ccccc1)c1ccccc1)-c1cccc(c1)P(=O)(c1ccccc1)c1ccccc1 | 100mg | 601110228
((1,3,5-Triazine-2,4,6-triyl)tris(benzene-3,1-diyl))tris(diphenylphosphine oxide) | ChemScene | 1646906-26-4909.902 | C57H42N3O3P3 | 98.000 | O=P(c1ccccc1)(c1ccccc1)c1cccc(c1)-c1nc(nc(n1)-c1cccc(c1)P(=O)(c1ccccc1)c1ccccc1)-c1cccc(c1)P(=O)(c1ccccc1)c1ccccc1 | 100mg | 601110228
Chem-Impex International, Inc. 6-Chloroindole | 17422-33-2 | MFCD00005681 | 5G
6-Chloroindole, 17422-33-2, MFCD00005681, 5G
![Chemscene ChemScene | 6-Chloro-1H-benzo[d]imidazole | 5G | CS-0035816 | 0.98 | 4887-82-5| MFCD07432850 | 152.58](https://assets.fishersci.com/TFS-Assets/CCG/product-images/CS-0035816.jpg-250.jpg)
Chemscene ChemScene | 6-Chloro-1H-benzo[d]imidazole | 5G | CS-0035816 | 0.98 | 4887-82-5| MFCD07432850 | 152.58
ChemScene | 6-Chloro-1H-benzo[d]imidazole | 5G | CS-0035816 | 0.98 | 4887-82-5| MFCD07432850 | 152.58
Chemscene ChemScene | 2-Chloroquinoxaline | 25G | CS-W016083 | 0.98 | 1448-87-9| MFCD00043907 | 164.59
ChemScene | 2-Chloroquinoxaline | 25G | CS-W016083 | 0.98 | 1448-87-9| MFCD00043907 | 164.59
![Accela Chembio Inc 2 | 4-dichlorothiopheno[3 | 2-d]pyrimidine | 1g | 16234-14-3 | MFCD08448158 | 97+% | Shelf Life: 1980 Days | Light Sensitive/+4](https://assets.fishersci.com/TFS-Assets/CCG/product-images/VN00116475-SY003512-1G.PNG-250.jpg)
Accela Chembio Inc 2 | 4-dichlorothiopheno[3 | 2-d]pyrimidine | 1g | 16234-14-3 | MFCD08448158 | 97+% | Shelf Life: 1980 Days | Light Sensitive/+4
2 | 4-dichlorothiopheno[3 | 2-d]pyrimidine | 1g | 16234-14-3 | MFCD08448158 | 97+% | Shelf Life: 1980 Days | Light Sensitive/+4
Chem-Impex International, Inc. 2,6-Dichloropurine | 5451-40-1 | MFCD09749894 | 100G
2,6-Dichloropurine, 5451-40-1, MFCD09749894, 100G
Accela Chembio Inc 5-chloropyridine-2-carbonitrile | 25g | 89809-64-3 | MFCD03788835 | 97+% | Shelf Life: 1440 Days | Light Sensitive
5-chloropyridine-2-carbonitrile | 25g | 89809-64-3 | MFCD03788835 | 97+% | Shelf Life: 1440 Days | Light Sensitive
Chemscene ChemScene | 5,6-Dichloropyrazine-2-carboxylic acid | 250MG | CS-0097645 | 0.98 | 76537-42-3| MFCD20658032 | 192.99
ChemScene | 5,6-Dichloropyrazine-2-carboxylic acid | 250MG | CS-0097645 | 0.98 | 76537-42-3| MFCD20658032 | 192.99
Chembridge Corporation 2,6-DICHLORO-1,3-BENZOTHIAZOLE
2,6-dichloro-1,3-benzothiazole; CAS: 3622-23-9
eMolecules 16606-61-4 | 2,4-Dichlorobenzene-1,3-diol | MFCD13152136 | 1g
Ambeed | 26-Di-tert-butyl-4-methylcyclohexanone | 250mg | 596567893 | A117602 | 23790-39-8 | MFCD27976821 | 224.388 | C15H28O
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 607-68-1 | 2,4-Dichloroquinazoline | Oakwood Chemical | MFCD00091950 | 199.030 | C8H4Cl2N2 | 95.000 | Clc1nc(Cl)c2ccccc2n1 | 1g | 537694248
2,4-Dichloroquinazoline | Oakwood Chemical | 607-68-1 | MFCD00091950 | 199.030 | C8H4Cl2N2 | 95.000 | Clc1nc(Cl)c2ccccc2n1 | 1g | 537694248
Accela Chembio Inc 2 | 4-dichloroquinazoline | 25g | 607-68-1 | MFCD00091950 | 95+% | Shelf Life: 900 Days | Light Sensitive/nitrogen Or Argon/+4
2 | 4-dichloroquinazoline | 25g | 607-68-1 | MFCD00091950 | 95+% | Shelf Life: 900 Days | Light Sensitive/nitrogen Or Argon/+4