Aryl chlorides
eMolecules 615-93-0 | 2,5-DICHLOROBENZO-1,4-QUINONE | AstaTech | MFCD00041736 | 176.980 | C6H2Cl2O2 | 95.000 | ClC1=CC(=O)C(Cl)=CC1=O | 1g | 718062577
2,5-DICHLOROBENZO-1,4-QUINONE | AstaTech | 615-93-0 | MFCD00041736 | 176.980 | C6H2Cl2O2 | 95.000 | ClC1=CC(=O)C(Cl)=CC1=O | 1g | 718062577
Medchemexpress LLC 1,4-dichlorobenzene | 106-46-7 | MFCD00000604 | 99.7% | 147.00 g/mol | C6H4Cl2 | 5g
1 4-Dichlorobenzene is used as an intermediate product in the manufacture of pigments pesticides and disinfectants 1 4-Dichlorobenzene is also employed as a moth control agent[1]
![eMolecules 823831-07-8 | 2-(2-[(5-Amino-1,3,4-thiadiazol-2-yl)thio]ethyl)-1,2-benzisothiazol-3(2H)-one 1,1-dioxide | Combi-Blocks, Inc. | MFCD05999019 | 342.410 | C11H10N4O3S3 | 95.000 | Nc1nnc(SCCN2C(=O)c3ccccc3S2(=O)=O)s1 | 1g | 586076702](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502186601.JPG-250.jpg)
eMolecules 823831-07-8 | 2-(2-[(5-Amino-1,3,4-thiadiazol-2-yl)thio]ethyl)-1,2-benzisothiazol-3(2H)-one 1,1-dioxide | Combi-Blocks, Inc. | MFCD05999019 | 342.410 | C11H10N4O3S3 | 95.000 | Nc1nnc(SCCN2C(=O)c3ccccc3S2(=O)=O)s1 | 1g | 586076702
2-(2-[(5-Amino-1,3,4-thiadiazol-2-yl)thio]ethyl)-1,2-benzisothiazol-3(2H)-one 1,1-dioxide | Combi-Blocks, Inc. | 823831-07-8 | MFCD05999019 | 342.410 | C11H10N4O3S3 | 95.000 | Nc1nnc(SCCN2C(=O)c3ccccc3S2(=O)=O)s1 | 1g | 586076702
eMolecules 17880-88-5 | 2,3-DICHLOROQUINOXALINE-6-CARBOXYLIC ACID | AstaTech | MFCD08436439 | 243.040 | C9H4Cl2N2O2 | 95.000 | OC(=O)c1ccc2nc(Cl)c(Cl)nc2c1 | 0.1g | 771345927
2,3-DICHLOROQUINOXALINE-6-CARBOXYLIC ACID | AstaTech | 17880-88-5 | MFCD08436439 | 243.040 | C9H4Cl2N2O2 | 95.000 | OC(=O)c1ccc2nc(Cl)c(Cl)nc2c1 | 0.1g | 771345927
eMolecules 287176-62-9 | 6-BROMO-2-CHLOROQUINOLINE-4-CARBOXYLIC ACID | AstaTech | MFCD00106420 | 286.510 | C10H5BrClNO2 | 95.000 | OC(=O)c1cc(Cl)nc2ccc(Br)cc12 | 0.1g | 746282022
6-BROMO-2-CHLOROQUINOLINE-4-CARBOXYLIC ACID | AstaTech | 287176-62-9 | MFCD00106420 | 286.510 | C10H5BrClNO2 | 95.000 | OC(=O)c1cc(Cl)nc2ccc(Br)cc12 | 0.1g | 746282022
eMolecules 1120-95-2 | 3-Chloropyridazine | Combi-Blocks | MFCD06801356 | 114.530 | C4H3ClN2 | 98.000 | Clc1cccnn1 | 1g | 388719380
3-Chloropyridazine | Combi-Blocks | 1120-95-2 | MFCD06801356 | 114.530 | C4H3ClN2 | 98.000 | Clc1cccnn1 | 1g | 388719380
Chemscene ChemScene | 2-Chloroquinoxaline | 25G | CS-W016083 | 0.98 | 1448-87-9| MFCD00043907 | 164.59
ChemScene | 2-Chloroquinoxaline | 25G | CS-W016083 | 0.98 | 1448-87-9| MFCD00043907 | 164.59
![Accela Chembio Inc 2 | 4-dichlorothiopheno[3 | 2-d]pyrimidine | 1g | 16234-14-3 | MFCD08448158 | 97+% | Shelf Life: 1980 Days | Light Sensitive/+4](https://assets.fishersci.com/TFS-Assets/CCG/product-images/VN00116475-SY003512-1G.PNG-250.jpg)
Accela Chembio Inc 2 | 4-dichlorothiopheno[3 | 2-d]pyrimidine | 1g | 16234-14-3 | MFCD08448158 | 97+% | Shelf Life: 1980 Days | Light Sensitive/+4
2 | 4-dichlorothiopheno[3 | 2-d]pyrimidine | 1g | 16234-14-3 | MFCD08448158 | 97+% | Shelf Life: 1980 Days | Light Sensitive/+4
eMolecules 635-27-8 | AstaTech | 5-CHLOROQUINOLINE | 5g | 448261284 | 23476 | 95 | MFCD00239413 | 163.6 | C9H6ClN
AstaTech | 5-CHLOROQUINOLINE | 5g | 448261284 | 23476 | 95.000 | 635-27-8 | MFCD00239413 | 163.600 | C9H6ClN
Medchemexpress LLC 1,4-dichlorobenzene | 106-46-7 | MFCD00000604 | 99.7% | 147.00 g/mol | C6H4Cl2 | 50g
1 4-Dichlorobenzene is used as an intermediate product in the manufacture of pigments pesticides and disinfectants 1 4-Dichlorobenzene is also employed as a moth control agent[1]
Matrix Scientific CHLOROPYRAZINE-25G
Chloropyrazine, 98%; 25g,C4H3ClN2, MFCD00006124, mw 114.53, [14508-49-7]
Medchemexpress LLC 1,4-dichlorobenzene | 106-46-7 | MFCD00000604 | 99.7% | 147.00 | C6H4Cl2 | 100g
1 4-Dichlorobenzene is used as an intermediate product in the manufacture of pigments pesticides and disinfectants 1 4-Dichlorobenzene is also employed as a moth control agent[1]
eMolecules 13383-44-3 | 3-tert-Butyl-1,2,4-thiadiazol-5-amine | ChemScene | MFCD09865006 | 157.240 | C6H11N3S | 97.000 | CC(C)(C)c1nsc(N)n1 | 100mg | 572174128
3-tert-Butyl-1,2,4-thiadiazol-5-amine | ChemScene | 13383-44-3 | MFCD09865006 | 157.240 | C6H11N3S | 97.000 | CC(C)(C)c1nsc(N)n1 | 100mg | 572174128
eMolecules 108-78-1 | Melamine | Ambeed | MFCD00006055 | 126.123 | C3H6N6 | 98.000 | Nc1nc(N)nc(N)n1 | 25g | 588342046
Melamine | Ambeed | 108-78-1 | MFCD00006055 | 126.123 | C3H6N6 | 98.000 | Nc1nc(N)nc(N)n1 | 25g | 588342046
eMolecules 4316-97-6 | 4,6-Dichloro-5-methylpyrimidine | Ambeed | MFCD01646112 | 163.000 | C5H4Cl2N2 | 98.000 | Cc1c(Cl)ncnc1Cl | 1g | 624119940
4,6-Dichloro-5-methylpyrimidine | Ambeed | 4316-97-6 | MFCD01646112 | 163.000 | C5H4Cl2N2 | 98.000 | Cc1c(Cl)ncnc1Cl | 1g | 624119940