Aryl chlorides
eMolecules 25235-85-2 | Ambeed | 4-Chloroindole | 10g | 552679932 | A258254 | MFCD00005665 | 151.59 | C8H6ClN
Ambeed | 1-(4-Methoxyphenyl)-3-methylbutan-2-one | 250mg | 570570192 | A783227 | 61173-96-4 | MFCD11935284 | 192.258 | C12H16O2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 1120-95-2 | 3-Chloropyridazine | Combi-Blocks | MFCD06801356 | 114.530 | C4H3ClN2 | 98.000 | Clc1cccnn1 | 1g | 388719380
3-Chloropyridazine | Combi-Blocks | 1120-95-2 | MFCD06801356 | 114.530 | C4H3ClN2 | 98.000 | Clc1cccnn1 | 1g | 388719380
Matrix Scientific 2,6-DICHLOROPHENYLACETIC A-25G
2, 6-Dichlorophenylacetic acid, 99%; 25g,C8H6Cl2O2, MFCD00004320, mw 205.04, [6575-24-2]
Chemscene ChemScene | 3-Chloro-1,2,4-triazole | 5G | CS-W011303 | 0.98 | 6818-99-1| MFCD00128812 | 103.51
ChemScene | 3-Chloro-1,2,4-triazole | 5G | CS-W011303 | 0.98 | 6818-99-1| MFCD00128812 | 103.51
![Accela Chembio Inc 2 | 4-dichlorothiopheno[3 | 2-d]pyrimidine | 5g | 16234-14-3 | MFCD08448158 | 97+% | Shelf Life: 1980 Days | Light Sensitive/+4](https://assets.fishersci.com/TFS-Assets/CCG/product-images/VN00116475-SY003512-5G.PNG-250.jpg)
Accela Chembio Inc 2 | 4-dichlorothiopheno[3 | 2-d]pyrimidine | 5g | 16234-14-3 | MFCD08448158 | 97+% | Shelf Life: 1980 Days | Light Sensitive/+4
2 | 4-dichlorothiopheno[3 | 2-d]pyrimidine | 5g | 16234-14-3 | MFCD08448158 | 97+% | Shelf Life: 1980 Days | Light Sensitive/+4
Chemscene ChemScene | 3-Amino-6-chloropyridazine | 100G | CS-W019657 | 0.98 | 5469-69-2| MFCD00051506 | 129.55
ChemScene | 3-Amino-6-chloropyridazine | 100G | CS-W019657 | 0.98 | 5469-69-2| MFCD00051506 | 129.55
Accela Chembio Inc MF: C8H6ClN | MW: 151.59 | ?98% | Flash Point: 158.9? | BP: 293? at 760 mmHg.
MF: C8H6ClN | MW: 151.59 | ?98% | Flash Point: 158.9? | BP: 293? at 760 mmHg.
Accela Chembio Inc 2 | 3-dichlorophenylacetic Acid | 25g | 10236-60-9 | MFCD01861393 | 98% | Shelf Life: 1800 Days | Regular
2 | 3-dichlorophenylacetic Acid | 25g | 10236-60-9 | MFCD01861393 | 98% | Shelf Life: 1800 Days | Regular
![eMolecules 41102-25-4 | 7-BROMO-2,4-DICHLOROTHIENO[3,2-D]PYRIMIDINE | AstaTech | MFCD11869289 | 283.950 | C6HBrCl2N2S | 95.000 | Clc1nc(Cl)c2scc(Br)c2n1 | 1g | 392628197](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502171637.JPG-250.jpg)
eMolecules 41102-25-4 | 7-BROMO-2,4-DICHLOROTHIENO[3,2-D]PYRIMIDINE | AstaTech | MFCD11869289 | 283.950 | C6HBrCl2N2S | 95.000 | Clc1nc(Cl)c2scc(Br)c2n1 | 1g | 392628197
7-BROMO-2,4-DICHLOROTHIENO[3,2-D]PYRIMIDINE | AstaTech | 41102-25-4 | MFCD11869289 | 283.950 | C6HBrCl2N2S | 95.000 | Clc1nc(Cl)c2scc(Br)c2n1 | 1g | 392628197
![eMolecules 62484-16-6 | 6-Methylquinazoline-2,4(1H,3H)-dione | Combi-Blocks | MFCD00831482 | 176.175 | C9H8N2O2 | 95.000 | Cc1ccc2[nH]c(=O)[nH]c(=O)c2c1 | 1g | 401042274](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502187675.JPG-250.jpg)
eMolecules 62484-16-6 | 6-Methylquinazoline-2,4(1H,3H)-dione | Combi-Blocks | MFCD00831482 | 176.175 | C9H8N2O2 | 95.000 | Cc1ccc2[nH]c(=O)[nH]c(=O)c2c1 | 1g | 401042274
6-Methylquinazoline-2,4(1H,3H)-dione | Combi-Blocks | 62484-16-6 | MFCD00831482 | 176.175 | C9H8N2O2 | 95.000 | Cc1ccc2[nH]c(=O)[nH]c(=O)c2c1 | 1g | 401042274
eMolecules 635-27-8 | AstaTech | 5-CHLOROQUINOLINE | 5g | 448261284 | 23476 | 95 | MFCD00239413 | 163.6 | C9H6ClN
AstaTech | 5-CHLOROQUINOLINE | 5g | 448261284 | 23476 | 95.000 | 635-27-8 | MFCD00239413 | 163.600 | C9H6ClN
Medchemexpress LLC 1,4-dichlorobenzene | 106-46-7 | MFCD00000604 | 99.7% | 147.00 g/mol | C6H4Cl2 | 50g
1 4-Dichlorobenzene is used as an intermediate product in the manufacture of pigments pesticides and disinfectants 1 4-Dichlorobenzene is also employed as a moth control agent[1]
Matrix Scientific CHLOROPYRAZINE-25G
Chloropyrazine, 98%; 25g,C4H3ClN2, MFCD00006124, mw 114.53, [14508-49-7]
Medchemexpress LLC 1,4-dichlorobenzene | 106-46-7 | MFCD00000604 | 99.7% | 147.00 | C6H4Cl2 | 100g
1 4-Dichlorobenzene is used as an intermediate product in the manufacture of pigments pesticides and disinfectants 1 4-Dichlorobenzene is also employed as a moth control agent[1]
eMolecules 13383-44-3 | 3-tert-Butyl-1,2,4-thiadiazol-5-amine | ChemScene | MFCD09865006 | 157.240 | C6H11N3S | 97.000 | CC(C)(C)c1nsc(N)n1 | 100mg | 572174128
3-tert-Butyl-1,2,4-thiadiazol-5-amine | ChemScene | 13383-44-3 | MFCD09865006 | 157.240 | C6H11N3S | 97.000 | CC(C)(C)c1nsc(N)n1 | 100mg | 572174128