Aryl fluorides
eMolecules 5-Fluoro-2-(trifluoromethyl)pyridine | 936841-73-5 | 1G | Purity: 98%
Matrix Scientific | 5-Fluoro-2-(trifluoromethyl)pyridine | 1G | 936841-73-5 | MFCD09864698
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 71346-17-3 | 6-Fluorochromone-3-carboxylic acid | Chem-Impex | MFCD03424505 | 208.144 | C10H5FO4 | 97.000 | OC(=O)c1coc2ccc(F)cc2c1=O | 5g | 386900150
6-Fluorochromone-3-carboxylic acid | Chem-Impex | 71346-17-3 | MFCD03424505 | 208.144 | C10H5FO4 | 97.000 | OC(=O)c1coc2ccc(F)cc2c1=O | 5g | 386900150
eMolecules 22960-18-5 | 8-Bromo-6-fluoroquinoline | MFCD09907837 | 1g
Ambeed | Ethyl 2-(1-hydroxycyclohexyl)acetate | 250mg | 552608655 | A166743 | 5326-50-1 | MFCD00095227 | 186.251 | C10H18O3
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
Medchemexpress LLC 3-(4-bromo-2-fluorophenyl)piperidine-2,6-dione | 2924092-66-8 | 98.6% | 286.10 g/mol | C11H9BrFNO2 | 250mg
3-(4-Bromo-2-fluorophenyl)piperidine-2 6-dione is a CRBN-type E3 ubiquitin ligase ligand that can be used to prepare PROTAC