UserName
Choose the brand aligned with your industry so we can best serve your needs.
For researchers, scientists, and technical professionals: Your one-stop shop for the complete range of laboratory, production, and safety products and services.
For healthcare professionals: Your proven destination for comprehensive diagnostic and clinical laboratory products and services.
8-Fluoroquinoline-6-boronic acid | ≥95% | CAS 1210048-29-5 | C9H7BFNO2 | 1g
8-Fluoroquinoline-6-boronic acid | ≥95% | CAS 1210048-29-5 | C9H7BFNO2 | 10g
8-Fluoroquinoline-6-boronic acid | ≥95% | CAS 1210048-29-5 | C9H7BFNO2 | 5g
8-Fluoroquinoline-6-boronic acid | ≥95% | CAS 1210048-29-5 | C9H7BFNO2 | 250mg
8-Fluoroquinoline-6-boronic acid | ≥95% | CAS 1210048-29-5 | C9H7BFNO2 | 500mg
(3-(Difluoromethoxy)-5-fluorophenyl)boronic acid | ≥97% | CAS 2055539-69-8 | C7H6BF3O3 | 500mg
(4-(Difluoromethoxy)-2-fluorophenyl)boronic acid | 97% | CAS 1004775-34-1 | C7H6BF3O3 | 500mg
(3-(Difluoromethoxy)-5-fluorophenyl)boronic acid | ≥97% | CAS 2055539-69-8 | C7H6BF3O3 | 25g
(3-(Difluoromethoxy)-5-fluorophenyl)boronic acid | ≥97% | CAS 2055539-69-8 | C7H6BF3O3 | 10g
(3-(Difluoromethoxy)-5-fluorophenyl)boronic acid | ≥97% | CAS 2055539-69-8 | C7H6BF3O3 | 5g
(3-(Difluoromethoxy)-5-fluorophenyl)boronic acid | ≥97% | CAS 2055539-69-8 | C7H6BF3O3 | 250mg
(4-(Difluoromethoxy)-2-fluorophenyl)boronic acid | 97% | CAS 1004775-34-1 | C7H6BF3O3 | 250mg
(3-(Difluoromethoxy)-5-fluorophenyl)boronic acid | ≥97% | CAS 2055539-69-8 | C7H6BF3O3 | 1g
(3-Cyano-2-hydroxyphenyl)boronic acid | Oakwood Chemical | 2172876-20-7 | MFCD18394167 | 162.940 | C7H6BNO3 | 90.000 | OB(O)c1cccc(C#N)c1O | 5g | 570751244
2-Fluoropyrimidine-5-boronic Acid Pinacol Ester | Accela ChemBio | 1352796-65-6 | MFCD13182191 | 224.040 | C10H14BFN2O2 | 95.000 | CC1(C)OB(OC1(C)C)c1cnc(F)nc1 | 1g | 802569275