Anthracenes
![eMolecules 2247163-07-9 | ChemScene | (2S3S)-4-(Anthracen-9-yl)-3-(tert-butyl)-2-(2-methoxypropan-2-yl)-23-dihydrobenzo[d][13]oxaphosphole | 100mg | 649803494 | CS-0159995 | 442.539 | C29H31O2P](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502467527.JPG-250.jpg)
eMolecules 2247163-07-9 | ChemScene | (2S3S)-4-(Anthracen-9-yl)-3-(tert-butyl)-2-(2-methoxypropan-2-yl)-23-dihydrobenzo[d][13]oxaphosphole | 100mg | 649803494 | CS-0159995 | 442.539 | C29H31O2P
2-tert-Butoxy-2-oxoethylzinc bromide | Rieke Metals | 51656-70-3 | 260.440 | C6H11BrO2Zn | [Br-].CC(C)(C)OC(=O)C[Zn+] | 50ml | 379199205
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
Sigma Aldrich Fine Chemicals Biosciences 9,10-Bis(phenylethynyl)anthracene 97% | 10075-85-1 | MFCD00012050 | 5G
9,10-Bis(phenylethynyl)anthracene 97% | Purity: 97% | Mol Wt: 378.46 | 10075-85-1 | MFCD00012050 | 5G
Aobchem 4 4 -(Pentane-1 2-diyl)bis(2-bromo-1-fluorobenzene) | 95% | CAS 2504201-61-8 | C17H16Br2F2 | 500mg
4 4 -(Pentane-1 2-diyl)bis(2-bromo-1-fluorobenzene) | 95% | CAS 2504201-61-8 | C17H16Br2F2 | 500mg
Sigma Aldrich Fine Chemicals Biosciences Anthracene suitable for scintillation, >=99.0% (GC) | 120-12-7 | MFCD00001240 | 100G
Anthracene suitable for scintillation, >=99.0% (GC) | Purity: >=99.0% (GC) | Mol Wt: 178.23 | 120-12-7 | MFCD00001240 | 100G
Aobchem 1 1 -(Thiophene-2 5-diyl)diethanone | ≥95% | CAS 4927-10-0 | C8H8O2S | 1g
1 1 -(Thiophene-2 5-diyl)diethanone | ≥95% | CAS 4927-10-0 | C8H8O2S | 1g
Aobchem 9 10-Dibromoanthracene | ≥95% | CAS 523-27-3 | C14H8Br2 | 100g
9 10-Dibromoanthracene | ≥95% | CAS 523-27-3 | C14H8Br2 | 100g