Anthracenes
![eMolecules 1807740-34-6 | (3S)-4-(anthracen-9-yl)-3-tert-butyl-2,3-dihydro-1,3-benzoxaphosphole | Synthonix - Stock370.432 | C25H23OP | 95.000 | CC(C)(C)[P@@]1COc2cccc(c12)-c1c2ccccc2cc2ccccc12 | 1g | 495865168](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502168223.JPG-250.jpg)
eMolecules 1807740-34-6 | (3S)-4-(anthracen-9-yl)-3-tert-butyl-2,3-dihydro-1,3-benzoxaphosphole | Synthonix - Stock370.432 | C25H23OP | 95.000 | CC(C)(C)[P@@]1COc2cccc(c12)-c1c2ccccc2cc2ccccc12 | 1g | 495865168
(3S)-4-(anthracen-9-yl)-3-tert-butyl-2,3-dihydro-1,3-benzoxaphosphole | Synthonix - Stock | 1807740-34-6370.432 | C25H23OP | 95.000 | CC(C)(C)[P@@]1COc2cccc(c12)-c1c2ccccc2cc2ccccc12 | 1g | 495865168
eMolecules 73356-19-1 | 9-(Methylaminomethyl)anthracene | MFCD00009933 | 10g
Combi-Blocks, Inc. | 9-(Methylaminomethyl)anthracene | 10g | 569296234 | QW-8129 | 95.000 | 73356-19-1 | MFCD00009933 | 221.303 | C16H15N
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 36840-85-4 | Pentane-1,5-diyl diacrylate | Ambeed | MFCD00078444 | 212.245 | C11H16O4 | 97.000 | C=CC(=O)OCCCCCOC(=O)C=C | 1g | 525057179
Pentane-1,5-diyl diacrylate | Ambeed | 36840-85-4 | MFCD00078444 | 212.245 | C11H16O4 | 97.000 | C=CC(=O)OCCCCCOC(=O)C=C | 1g | 525057179
![eMolecules 229005-80-5 | TAK-779 | Target Molecule | MFCD05662319 | 531.140 | C33H39ClN2O2 | 0.000 | [Cl-].Cc1ccc(cc1)-c1ccc2CCCC(=Cc2c1)C(=O)Nc1ccc(C[N+](C)(C)C2CCOCC2)cc1 | 10mg | 517682756](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000128683.jpg-250.jpg)
eMolecules 229005-80-5 | TAK-779 | Target Molecule | MFCD05662319 | 531.140 | C33H39ClN2O2 | 0.000 | [Cl-].Cc1ccc(cc1)-c1ccc2CCCC(=Cc2c1)C(=O)Nc1ccc(C[N+](C)(C)C2CCOCC2)cc1 | 10mg | 517682756
TAK-779 | Target Molecule | 229005-80-5 | MFCD05662319 | 531.140 | C33H39ClN2O2 | 0.000 | [Cl-].Cc1ccc(cc1)-c1ccc2CCCC(=Cc2c1)C(=O)Nc1ccc(C[N+](C)(C)C2CCOCC2)cc1 | 10mg | 517682756
eMolecules 7396-21-6 | Ambeed | 1-(Anthracen-1-yl)ethanone | 50mg | 599355899 | A190517 | MFCD00183669 | 220.271 | C16H12O
Ambeed | 1-(Anthracen-1-yl)ethanone | 50mg | 599355899 | A190517 | 7396-21-6 | MFCD00183669 | 220.271 | C16H12O
eMolecules 163087-28-3 | Ambeed | 4-(Anthracen-9-yl)-2262-terpyridine | 1g | 714082090 | A1186735 | 409.492 | C29H19N3
Ambeed | 3-Amino-5-methylbenzoic acid | 250mg | 600836963 | A303624 | 2305-37-5 | MFCD00211069 | 151.165 | C8H9NO2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
![eMolecules 2565792-34-7 | Ambeed | 2-((2S3S)-4-(Anthracen-9-yl)-3-(tert-butyl)-23-dihydrobenzo[d][13]oxaphosphol-2-yl)pyridine | 100mg | 600828550 | A1207642 | 447.518 | C30H26NOP](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502466560.JPG-250.jpg)
eMolecules 2565792-34-7 | Ambeed | 2-((2S3S)-4-(Anthracen-9-yl)-3-(tert-butyl)-23-dihydrobenzo[d][13]oxaphosphol-2-yl)pyridine | 100mg | 600828550 | A1207642 | 447.518 | C30H26NOP
AstaTech | (R)-N-(2-HYDROXY-2-METHYL-1-PHENYL-PROPYL)-4-METHYL-BENZENESULFONAMIDE | 1g | 200611997 | 62436 | 97.000 | 620627-46-5 | MFCD09025333 | 319.420 | C17H21NO3S
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 1213936-15-2 | (1S)-1-(2-anthryl)propylamine | 100mg
Ambeed | Bis((S)-4-phenyl-45-dihydrooxazol-2-yl)methane | 100mg | 600845567 | A681147 | 132098-59-0 | 306.365 | C19H18N2O2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool