Fluorenes
Chem-Impex International, Inc. Na-Fmoc-Nd-Boc-L-ornithine | 109425-55-0 | MFCD00065668 | 25G
Na-Fmoc-Nd-Boc-L-ornithine, 109425-55-0, MFCD00065668, 25G
Chem-Impex International, Inc. Fmoc-L-norleucine | 77284-32-3 | MFCD00037537 | 5G
Fmoc-L-norleucine, 77284-32-3, MFCD00037537, 5G
Chem-Impex International, Inc. N-(9-Fluorenylmethoxycarbonyloxy)succinimide | 82911-69-1 | MFCD00010733 | 25G
N-(9-Fluorenylmethoxycarbonyloxy)succinimide, 82911-69-1, MFCD00010733, 25G
Medchemexpress LLC HY-104004 5mg Medchemexpress, Fmoc-Ser(O-α-D-GalNAc(OAc)3)-OH CAS:120173-57-1 Purity:>98%
Medchemexpress, HY-104004 5mg Fmoc-Ser(O-α-D-GalNAc(OAc)3)-OH CAS:120173-57-1 Fmoc-Ser(O-α-D-GalNAc(OAc)3)-OH is a drug for cancer. Purity:>98% Medchemexpress has over 10000 novel life-science reagents, reference compounds, APIs and natural compounds for laboratory and scientific use. Other quantity can also be offered.
Medchemexpress LLC HY-111413A 5mg Medchemexpress, c(phg-isoDGR-(NMe)k) (TFA) CAS: Purity:>98%
Medchemexpress, HY-111413A 5mg c(phg-isoDGR-(NMe)k) (TFA) CAS: c(phg-isoDGR-(NMe)k) TFA is a selective and potent α5β1-integrin ligand with an IC50 of 2.9 nM. Purity:>98% Medchemexpress has over 10000 novel life-science reagents, reference compounds, APIs and natural compounds for laboratory and scientific use. Other quantity can also be offered.
Chem-Impex International, Inc. Fmoc-Dab(N3)-OH | MFCD11052920 | 100MG
Fmoc-Dab(N3)-OH, MFCD11052920, 100MG
Sigma Aldrich Fine Chemicals Biosciences 9-Bromofluorene 98% | 1940-57-4 | MFCD00001133 | 10G
9-Bromofluorene 98% | Purity: 98% | Mol Wt: 245.11 | 1940-57-4 | MFCD00001133 | 10G
eMolecules 61676-62-8 | CALLERY? Isopropyl Pinacol Borate, min. 98% | Strem Chemicals | MFCD00192241 | 186.060 | C9H19BO3 | 98.000 | CC(C)OB1OC(C)(C)C(C)(C)O1 | 25g | 689248453
CALLERY? Isopropyl Pinacol Borate, min. 98% | Strem Chemicals | 61676-62-8 | MFCD00192241 | 186.060 | C9H19BO3 | 98.000 | CC(C)OB1OC(C)(C)C(C)(C)O1 | 25g | 689248453
eMolecules 220497-83-6 | Fmoc-D-a-(5-bromothienyl)alanine | Chem-Impex472.350 | C22H18BrNO4S | 97.000 | OC(=O)C(Cc1ccc(Br)s1)NC(=O)OCC1c2ccccc2-c2ccccc12 | 1g | 112608282
Fmoc-D-a-(5-bromothienyl)alanine | Chem-Impex | 220497-83-6472.350 | C22H18BrNO4S | 97.000 | OC(=O)C(Cc1ccc(Br)s1)NC(=O)OCC1c2ccccc2-c2ccccc12 | 1g | 112608282
eMolecules 2354216-78-5 | 4-(4-Fmoc-amino-phenyl)-tetrahydro-pyran-4-carboxylic acid | J&W PharmLab LLC443.499 | C27H25NO5 | 96.000 | OC(=O)C1(CCOCC1)c1ccc(NC(=O)OCC2c3ccccc3-c3ccccc23)cc1 | 100mg | 794066975
4-(4-Fmoc-amino-phenyl)-tetrahydro-pyran-4-carboxylic acid | J&W PharmLab LLC | 2354216-78-5443.499 | C27H25NO5 | 96.000 | OC(=O)C1(CCOCC1)c1ccc(NC(=O)OCC2c3ccccc3-c3ccccc23)cc1 | 100mg | 794066975
cc1)(NC(=O)OCC1c2ccccc2-c2ccccc12)C(O)=O | 1g | 537623158](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502191177.JPG-250.jpg)
eMolecules 1310680-28-4 | Fmoc-alpha-methyl-l-4-bromophenylalanine | Combi-Blocks | MFCD18782829 | 480.358 | C25H22BrNO4 | 97.000 | C[C@@](Cc1ccc(Br)cc1)(NC(=O)OCC1c2ccccc2-c2ccccc12)C(O)=O | 1g | 537623158
Fmoc-alpha-methyl-l-4-bromophenylalanine | Combi-Blocks | 1310680-28-4 | MFCD18782829 | 480.358 | C25H22BrNO4 | 97.000 | C[C@@](Cc1ccc(Br)cc1)(NC(=O)OCC1c2ccccc2-c2ccccc12)C(O)=O | 1g | 537623158
eMolecules 500901-89-3 | 3,6-Dibromo-9H-fluorene | ChemScene | MFCD04222135 | 324.015 | C13H8Br2 | 98.000 | Brc1ccc2Cc3ccc(Br)cc3-c2c1 | 100mg | 686071359
3,6-Dibromo-9H-fluorene | ChemScene | 500901-89-3 | MFCD04222135 | 324.015 | C13H8Br2 | 98.000 | Brc1ccc2Cc3ccc(Br)cc3-c2c1 | 100mg | 686071359
Chem-Impex International, Inc. Fmoc-a-aminoisobutyric acid | 94744-50-0 | MFCD00151913 | 5G
Fmoc-a-aminoisobutyric acid, 94744-50-0, MFCD00151913, 5G