Boronic acid derivatives
Accela Chembio Inc 3 | 5-dimethoxyphenylboronic Acid | 25g | 192182-54-0 | MFCD03095127 | 95+% | Shelf Life: 1260 Days | Light Sensitive
3 | 5-dimethoxyphenylboronic Acid | 25g | 192182-54-0 | MFCD03095127 | 95+% | Shelf Life: 1260 Days | Light Sensitive
Chemscene ChemScene | 4-Ethoxy-3-methylphenylboronic acid | 5G | CS-W017243 | 0.98 | 850568-08-0| MFCD06659870 | 180.012
ChemScene | 4-Ethoxy-3-methylphenylboronic acid | 5G | CS-W017243 | 0.98 | 850568-08-0| MFCD06659870 | 180.012
Chemscene ChemScene | 2-Ethoxy-4-fluorophenylboronic acid | 5G | CS-W017024 | 0.98 | 480438-58-2| MFCD03095001 | 183.97
ChemScene | 2-Ethoxy-4-fluorophenylboronic acid | 5G | CS-W017024 | 0.98 | 480438-58-2| MFCD03095001 | 183.97
Chemscene ChemScene | (2-Fluoro-5-(trifluoromethoxy)phenyl)boronic acid | 10G | CS-W014228 | 0.97 | 881402-22-8| MFCD09027234 | 223.92
ChemScene | (2-Fluoro-5-(trifluoromethoxy)phenyl)boronic acid | 10G | CS-W014228 | 0.97 | 881402-22-8| MFCD09027234 | 223.92
eMolecules 189028-95-3 | (S)-3-((S)-5-(4-Fluorophenyl)-5-hydroxypentanoyl)-4-phenyloxazolidin-2-one | MFCD13194798 | 1g
ChemScene | Ethyl 4h5h6h7h-pyrazolo[15-a]pyridine-2-carboxylate | 100mg | 654767116 | CS-0215400 | 307307-84-2 | MFCD11975790 | 194.234 | C10H14N2O2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
Accela Chembio Inc MF: C7H9O3B | MW: 151.96 | >97% | Flash Point: 146.9 celsius.
MF: C7H9O3B | MW: 151.96 | >97% | Flash Point: 146.9 celsius.
FUJIFILM Biosciences 2-(4,4,5,5-TETRAMETHYL-1,3,2-D
*Orders for this supplier are non-cancellable/non-returnable once they are processed.* 2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1,5-difluorobenzene 5GR
FUJIFILM Biosciences M-AMINOPHENYELBORONIC ACID 5
*Orders for this supplier are non-cancellable/non-returnable once they are processed.* M-aminophenyelboronic Acid 5. 30418-59-8 MFCD00191748
eMolecules 126726-62-3 | Isopropenylboronic Acid Pinacol Ester | Accela ChemBio (ASD) | MFCD08276843 | 168.040 | C9H17BO2 | 98.000 | CC(=C)B1OC(C)(C)C(C)(C)O1 | 100g | 444751636
Isopropenylboronic Acid Pinacol Ester | Accela ChemBio (ASD) | 126726-62-3 | MFCD08276843 | 168.040 | C9H17BO2 | 98.000 | CC(=C)B1OC(C)(C)C(C)(C)O1 | 100g | 444751636
eMolecules 126747-14-6 | 4-Cyanophenylboronic acid | AA Blocks LLC | MFCD01318968 | 146.940 | C7H6BNO2 | 0.000 | OB(O)c1ccc(cc1)C#N | 100g | 410147840
4-Cyanophenylboronic acid | AA Blocks LLC | 126747-14-6 | MFCD01318968 | 146.940 | C7H6BNO2 | 0.000 | OB(O)c1ccc(cc1)C#N | 100g | 410147840
eMolecules 5720-06-9 | 2-Methoxyphenylboronic acid | Key Organics/BIONET | MFCD00236047 | 151.960 | C7H9BO3 | 95.000 | COc1ccccc1B(O)O | 50mg | 564101978
2-Methoxyphenylboronic acid | Key Organics/BIONET | 5720-06-9 | MFCD00236047 | 151.960 | C7H9BO3 | 95.000 | COc1ccccc1B(O)O | 50mg | 564101978
eMolecules 5720-06-9 | 2-Methoxyphenylboronic acid | Key Organics/BIONET | MFCD00236047 | 151.960 | C7H9BO3 | 95.000 | COc1ccccc1B(O)O | 1mg | 564101975
2-Methoxyphenylboronic acid | Key Organics/BIONET | 5720-06-9 | MFCD00236047 | 151.960 | C7H9BO3 | 95.000 | COc1ccccc1B(O)O | 1mg | 564101975
eMolecules 72824-04-5 | Allylboronic acid pinacol ester | Ambeed | MFCD00013347 | 168.040 | C9H17BO2 | 97.000 | CC1(C)OB(CC=C)OC1(C)C | 10g | 552538919
Allylboronic acid pinacol ester | Ambeed | 72824-04-5 | MFCD00013347 | 168.040 | C9H17BO2 | 97.000 | CC1(C)OB(CC=C)OC1(C)C | 10g | 552538919