Boronic acid derivatives
Cayman Chemical CAY10487, Purity: ≥98%, CAS: 778624-05-8, 25 mg
An antioxidant with anti-atherogenic activity; inhibits formation of fatty streak lesions of the thoracic aorta in high cholesterol-fed rabbits without affecting plasma lipid profiles or significantly inhibiting ACAT-1 or ACAT-2 activity; dietary administration (0.05%) reduces the percent area occupied by the atherosclerotic lesion in rabbits to 16.1% from 53.5% in control rabbits; inhibits copper-mediated oxidation of LDL by ~75% at 2 µM
eMolecules 134892-19-6 | Ambeed | tert-Butyl 3-(4455-tetramethyl-132-dioxaborolan-2-yl)propanoate | 1g | 717677379 | A113485 | MFCD10700151 | 256.15 | C13H25BO4
AstaTech | 2-AMINO-5-NITROBENZAMIDE | 0.25g | 268488163 | 35381 | 95.000 | 16313-65-8 | MFCD00090235 | 181.151 | C7H7N3O3
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 1036760-03-8 | 3-(1-HYDROXYETHYL)PHENYLBORONIC ACID | AstaTech | MFCD04112541 | 165.980 | C8H11BO3 | 95.000 | CC(O)c1cccc(c1)B(O)O | 1g | 261437041
3-(1-HYDROXYETHYL)PHENYLBORONIC ACID | AstaTech | 1036760-03-8 | MFCD04112541 | 165.980 | C8H11BO3 | 95.000 | CC(O)c1cccc(c1)B(O)O | 1g | 261437041
![eMolecules 256-81-5 | 5H-Dibenzo[a,d]cycloheptene | MFCD00228674 | 250mg](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502174747.JPG-250.jpg)
eMolecules 256-81-5 | 5H-Dibenzo[a,d]cycloheptene | MFCD00228674 | 250mg
ChemScene | Ethyl 4-bromopicolinate | 1g | 536787698 | CS-0041851 | 62150-47-4 | MFCD09839150 | 230.061 | C8H8BrNO2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 874288-28-5 | 3-(4-Bromophenylcarbamoyl)phenylboronic acid | Combi-Blocks | MFCD09475817 | 319.950 | C13H11BBrNO3 | 98.000 | OB(O)c1cccc(c1)C(=O)Nc1ccc(Br)cc1 | 1g | 117522449
3-(4-Bromophenylcarbamoyl)phenylboronic acid | Combi-Blocks | 874288-28-5 | MFCD09475817 | 319.950 | C13H11BBrNO3 | 98.000 | OB(O)c1cccc(c1)C(=O)Nc1ccc(Br)cc1 | 1g | 117522449
Chemscene ChemScene | 2-Methoxyphenylboronic acid | 25G | CS-W002569 | 0.98 | 1395388| MFCD00236047 | 151.96
ChemScene | 2-Methoxyphenylboronic acid | 25G | CS-W002569 | 0.98 | 1395388| MFCD00236047 | 151.96
eMolecules 90767-17-2 | 3-Bromonaphthalen-1-ol | Apollo Scientific | MFCD17012415 | 223.069 | C10H7BrO | 97.000 | Oc1cc(Br)cc2ccccc12 | 250mg | 562465413
3-Bromonaphthalen-1-ol | Apollo Scientific | 90767-17-2 | MFCD17012415 | 223.069 | C10H7BrO | 97.000 | Oc1cc(Br)cc2ccccc12 | 250mg | 562465413
Chem-Impex International, Inc. 3,4-Dichlorophenylboronic acid | MFCD01074646 | 5G
3,4-Dichlorophenylboronic acid, MFCD01074646, 5G
Chem-Impex International, Inc. 4-Carboxyphenylboronic acid | MFCD00151801 | 25G
4-Carboxyphenylboronic acid, MFCD00151801, 25G
Chem-Impex International, Inc. 4-Carboxyphenylboronic acid | MFCD00151801 | 100G
4-Carboxyphenylboronic acid, MFCD00151801, 100G
eMolecules Ambeed | 3-((4-Methyl-3-(4455-tetramethyl-132-dioxaborolan-2-yl)phenoxy)methyl)pyridine | 100mg | 742299485 | A1677273 | 325.22 | C19H24BNO3
Ambeed | 3-((4-Methyl-3-(4455-tetramethyl-132-dioxaborolan-2-yl)phenoxy)methyl)pyridine | 100mg | 742299485 | A1677273 | | 325.220 | C19H24BNO3
eMolecules 136924-78-2 | ChemScene | 7-Bromonaphthalen-1-amine | 250mg | 572181262 | CS-0060605 | MFCD17012507 | 222.085 | C10H8BrN
Ambeed | 1-(2-Ethoxy-2-oxoethyl)pyridin-1-ium bromide | 1g | 552745666 | A590510 | 17282-40-5 | MFCD00463694 | 246.104 | C9H12BrNO2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 480424-70-2 | 4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl acetate | Ambeed | MFCD03453060 | 262.110 | C14H19BO4 | 95.000 | CC(=O)Oc1ccc(cc1)B1OC(C)(C)C(C)(C)O1 | 1g | 525046632
4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl acetate | Ambeed | 480424-70-2 | MFCD03453060 | 262.110 | C14H19BO4 | 95.000 | CC(=O)Oc1ccc(cc1)B1OC(C)(C)C(C)(C)O1 | 1g | 525046632
Chemscene ChemScene | 2-Nitrophenylboronic acid | 10G | CS-W002465 | 0.98 | 5570-19-4| MFCD00161358 | 166.93
ChemScene | 2-Nitrophenylboronic acid | 10G | CS-W002465 | 0.98 | 5570-19-4| MFCD00161358 | 166.93
eMolecules 192804-36-7 | 4-Cbz-aminophenyboronic acid | Ambeed | MFCD02093055 | 271.080 | C14H14BNO4 | 98.000 | OB(O)c1ccc(NC(=O)OCc2ccccc2)cc1 | 250mg | 600834075
4-Cbz-aminophenyboronic acid | Ambeed | 192804-36-7 | MFCD02093055 | 271.080 | C14H14BNO4 | 98.000 | OB(O)c1ccc(NC(=O)OCc2ccccc2)cc1 | 250mg | 600834075