Boronic acid derivatives
eMolecules 515131-35-8 | 5-Carboxy-2-methylphenylboronic acid, pinacol ester | Combi-Blocks | MFCD09261433 | 262.110 | C14H19BO4 | 98.000 | Cc1ccc(cc1B1OC(C)(C)C(C)(C)O1)C(O)=O | 1g | 117529838
5-Carboxy-2-methylphenylboronic acid, pinacol ester | Combi-Blocks | 515131-35-8 | MFCD09261433 | 262.110 | C14H19BO4 | 98.000 | Cc1ccc(cc1B1OC(C)(C)C(C)(C)O1)C(O)=O | 1g | 117529838
Accela Chembio Inc 3 | 5-dimethoxyphenylboronic Acid | 5g | 192182-54-0 | MFCD03095127 | 95+% | Shelf Life: 1260 Days | Light Sensitive
3 | 5-dimethoxyphenylboronic Acid | 5g | 192182-54-0 | MFCD03095127 | 95+% | Shelf Life: 1260 Days | Light Sensitive
eMolecules 934586-50-2 | 2,3-Dihydrobenzofuran-7-boronic acid, pinacol ester | Combi-Blocks | MFCD11109314 | 246.110 | C14H19BO3 | 96.000 | CC1(C)OB(OC1(C)C)c1cccc2CCOc12 | 1g | 117545453
2,3-Dihydrobenzofuran-7-boronic acid, pinacol ester | Combi-Blocks | 934586-50-2 | MFCD11109314 | 246.110 | C14H19BO3 | 96.000 | CC1(C)OB(OC1(C)C)c1cccc2CCOc12 | 1g | 117545453
eMolecules 1121599-78-7 | TERT-BUTYL 4-(2-FLUOROPHENYL)PIPERAZINE-1-CARBOXYLATE | MFCD11872506 | 1g
Ambeed | 1-(8-Bromoquinolin-4-yl)-N-methylmethanamine | 100mg | 599356073 | A260178 | 1190322-58-7 | MFCD12024576 | 251.127 | C11H11BrN2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 1-(Phenylsulfonyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole | AmbeedMFCD31418890 | 383.270 | C20H22BNO4S | 95.000 | CC1(C)OB(OC1(C)C)c1cc2ccccc2n1S(=O)(=O)c1ccccc1 | 100mg | 742299535
1-(Phenylsulfonyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole | AmbeedMFCD31418890 | 383.270 | C20H22BNO4S | 95.000 | CC1(C)OB(OC1(C)C)c1cc2ccccc2n1S(=O)(=O)c1ccccc1 | 100mg | 742299535
eMolecules Ambeed / (4-(Benzyloxy)phenyl)boronic acid / 1g / 525006931 / A113646 / / 146631-00-7 / MFCD01075705 / 228.050 / C13H13BO3
Ambeed / (4-(Benzyloxy)phenyl)boronic acid / 1g / 525006931 / A113646 / / 146631-00-7 / MFCD01075705 / 228.050 / C13H13BO3
Chemscene ChemScene | 3,5-Dimethoxyphenylboronic acid | 10G | CS-D1032 | 0.98 | 192182-54-0| MFCD03095127 | 181.98
ChemScene | 3,5-Dimethoxyphenylboronic acid | 10G | CS-D1032 | 0.98 | 192182-54-0| MFCD03095127 | 181.98
eMolecules 768-35-4 | (3-Fluorophenyl)boronic acid | Ambeed | MFCD00236042 | 139.920 | C6H6BFO2 | 98.000 | OB(O)c1cccc(F)c1 | 5g | 552623001
(3-Fluorophenyl)boronic acid | Ambeed | 768-35-4 | MFCD00236042 | 139.920 | C6H6BFO2 | 98.000 | OB(O)c1cccc(F)c1 | 5g | 552623001
eMolecules 126747-13-5 | 4-CARBOXYPHENYLBORONIC ACID PROPANEDIOL ESTER | AstaTech | MFCD23099084 | 224.020 | C10H13BO5 | 95.000 | CCC(O)OB(O)c1ccc(cc1)C(O)=O | 1g | 402180389
4-CARBOXYPHENYLBORONIC ACID PROPANEDIOL ESTER | AstaTech | 126747-13-5 | MFCD23099084 | 224.020 | C10H13BO5 | 95.000 | CCC(O)OB(O)c1ccc(cc1)C(O)=O | 1g | 402180389
Cayman Chemical OSU03012, Purity: ≥98%, CAS: 742112-33-0, 5 mg
An analog of celecoxib that inhibits PDK-1 (IC50 = 5 µM), and therefore Akt activation, with no measurable COX-2 inhibition up to 50 µM; inhibits tumor cell growth (IC50s ~ 1.1 µM) across a panel of 60 cancer cell lines and induces apoptosis of chronic lymphocytic leukemia cells independent of bcl-2 overexpression using both caspase-dependent and independent pathways
eMolecules 5720-06-9 | ChemScene | 2-Methoxyphenylboronic acid | 10g | 346750459 | CS-W002569 | MFCD00236047 | 151.96 | C7H9BO3
ChemScene | 2-Methoxyphenylboronic acid | 10g | 346750459 | CS-W002569 | 5720-06-9 | MFCD00236047 | 151.960 | C7H9BO3
Chemscene ChemScene | 2-Iodo-3-(trifluoromethyl)pyridine | 250MG | CS-0119782 | 0.96 | 927434-20-6| MFCD12922855 | 273
ChemScene | 2-Iodo-3-(trifluoromethyl)pyridine | 250MG | CS-0119782 | 0.96 | 927434-20-6| MFCD12922855 | 273
eMolecules 2640480-55-1 | Ambeed | 24-Bis(benzyloxy)-5-(4455-tetramethyl-132-dioxaborolan-2-yl)pyrimidine | 100mg | 752810304 | A1684313 | MFCD28399193 | 418.3 | C24H27BN2O4
Ambeed | 2-Naphthalenesulfinic acid sodium salt | 250mg | 672522711 | A1125765 | 63735-42-2 | MFCD11618060 | 214.210 | C10H7NaO2S
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 352535-81-0 | 4-Bromo-2,6-difluorophenylboronic acid | Ambeed | MFCD03095369 | 236.810 | C6H4BBrF2O2 | 95.000 | OB(O)c1c(F)cc(Br)cc1F | 1g | 552731342
4-Bromo-2,6-difluorophenylboronic acid | Ambeed | 352535-81-0 | MFCD03095369 | 236.810 | C6H4BBrF2O2 | 95.000 | OB(O)c1c(F)cc(Br)cc1F | 1g | 552731342
eMolecules 397843-61-7 | (4-(Phenoxymethyl)phenyl)boronic acid | Ambeed | MFCD09966155 | 228.050 | C13H13BO3 | 98.000 | OB(O)c1ccc(COc2ccccc2)cc1 | 100mg | 696731732
(4-(Phenoxymethyl)phenyl)boronic acid | Ambeed | 397843-61-7 | MFCD09966155 | 228.050 | C13H13BO3 | 98.000 | OB(O)c1ccc(COc2ccccc2)cc1 | 100mg | 696731732