Boronic acid derivatives
Cayman Chemical CAY10455 Fatty Acids and Deriv
A fluorescent substrate for AEA transport; cleavage by intracellular esterases gives a bright fluorescence at 530 nm
eMolecules 1638329-59-5 | 3-(Acetamido)-4-fluorophenylboronic acid pinacol ester | MFCD26141999 | 1g
Ambeed | 3-(Hexadecyloxy)propan-1-ol | 250mg | 525100017 | A182606 | 23377-40-4 | MFCD00171483 | 300.527 | C19H40O2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 850568-26-2 | 4-(2-Thiazolyl)aminocarbonylphenylboronic acid | Combi-Blocks | MFCD06659877 | 248.060 | C10H9BN2O3S | 98.000 | OB(O)c1ccc(cc1)C(=O)Nc1nccs1 | 1g | 117522306
4-(2-Thiazolyl)aminocarbonylphenylboronic acid | Combi-Blocks | 850568-26-2 | MFCD06659877 | 248.060 | C10H9BN2O3S | 98.000 | OB(O)c1ccc(cc1)C(=O)Nc1nccs1 | 1g | 117522306
Matrix Scientific BIPHENYL-3-BORONIC ACID-5G
Biphenyl-3-boronic acid, 98+%-5g,C12H11BO2, MFCD01318102, mw 198.03,
![eMolecules 1531-77-7 | Dibenzo[b,e]thiepin-11(6h)-one | MFCD02093738 | 25g](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502184267.JPG-250.jpg)
eMolecules 1531-77-7 | Dibenzo[b,e]thiepin-11(6h)-one | MFCD02093738 | 25g
Fmoc-9-Anc-OH | Ambeed | 212688-52-3 | MFCD00273465 | 395.499 | C24H29NO4 | 97.000 | OC(=O)CCCCCCCCNC(=O)OCC1c2ccccc2-c2ccccc12 | 1g | 660584387
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 850567-22-5 | 3-(N-Propylaminocarbonyl)phenylboronic acid | Combi-Blocks | MFCD04038919 | 207.040 | C10H14BNO3 | 95.000 | CCCNC(=O)c1cccc(c1)B(O)O | 1g | 117522350
3-(N-Propylaminocarbonyl)phenylboronic acid | Combi-Blocks | 850567-22-5 | MFCD04038919 | 207.040 | C10H14BNO3 | 95.000 | CCCNC(=O)c1cccc(c1)B(O)O | 1g | 117522350
eMolecules 913835-45-7 | 4-(2-Morpholinoethylcarbamoyl)phenylboronic acid | Combi-Blocks | MFCD09027219 | 278.120 | C13H19BN2O4 | 98.000 | OB(O)c1ccc(cc1)C(=O)NCCN1CCOCC1 | 5g | 117522497
4-(2-Morpholinoethylcarbamoyl)phenylboronic acid | Combi-Blocks | 913835-45-7 | MFCD09027219 | 278.120 | C13H19BN2O4 | 98.000 | OB(O)c1ccc(cc1)C(=O)NCCN1CCOCC1 | 5g | 117522497
Matrix Scientific NAPHTHALENE-2-BORONIC ACID-5G
Naphthalene-2-boronic acid, 97%; 5g,C10H9BO2, MFCD00236051, mw 171.99, [32316-92-0]
eMolecules 850568-48-8 | 4-(3-Hydroxypropyl)phenylboronic acid | Combi-Blocks | MFCD04973734 | 180.010 | C9H13BO3 | 95.000 | OCCCc1ccc(cc1)B(O)O | 5g | 117520389
4-(3-Hydroxypropyl)phenylboronic acid | Combi-Blocks | 850568-48-8 | MFCD04973734 | 180.010 | C9H13BO3 | 95.000 | OCCCc1ccc(cc1)B(O)O | 5g | 117520389
Aobchem Isoquinoline-4-boronic acid, AOBCHEM USA 12117-5G. 192182-56-2. MFCD03412093
Isoquinoline-4-boronic acid, AOBCHEM USA 12117-5G. 192182-56-2. MFCD03412093
Cayman Chemical CAY10573 Fatty Acids and Deriv
A PPAR agonist that displays potent binding at PPARα, γ, and δ (IC50s = 113, 50, 223 nM, respectively) and potently transactivates PPARα, γ, and δ (EC50s = 8, 70, 500 nM, respectively); demonstrates stronger binding and functional activity for PPARγ than rosiglitazone
eMolecules 167105-03-5 | (8-Bromonaphthalen-1-yl)boronic acid | MFCD11656280 | 1g
Ambeed | 22-Dimethyl-1-(4-methyl-7-(4455-tetramethyl-132-dioxaborolan-2-yl)-1H-indol-1-yl)propan-1-one | 1g | 714082726 | A1390021 | 2390149-06-9 | 341.260 | C20H28BNO3
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
Aobchem 4-Isopropoxylphenylboronic acid, AOBCHEM USA 10506-100G. 153624-46-5. MFCD03427051
4-Isopropoxylphenylboronic acid, AOBCHEM USA 10506-100G. 153624-46-5. MFCD03427051
Frontier Specialty Chemicals 1G 4-(N-METHYLAMINOCARBONYL)PH
1g 4-(n-methylaminocarbonyl)ph. 121177-82-0