Boronic acid derivatives
Matrix Scientific 4-METHOXYCARBONYLPHENYLBOR-25G
4-Methoxycarbonylphenylboronic acid, 97%; 25g,C8H9BO4, MFCD01632203, mw 179.97, [99768-12-4]
eMolecules 352535-81-0 | 4-Bromo-2,6-difluorophenylboronic acid | Ambeed | MFCD03095369 | 236.810 | C6H4BBrF2O2 | 95.000 | OB(O)c1c(F)cc(Br)cc1F | 1g | 552731342
4-Bromo-2,6-difluorophenylboronic acid | Ambeed | 352535-81-0 | MFCD03095369 | 236.810 | C6H4BBrF2O2 | 95.000 | OB(O)c1c(F)cc(Br)cc1F | 1g | 552731342
Frontier Specialty Chemicals 5G 4-(METHOXYCARBONYL)PHENYLB
4-(Methoxycarbonyl)phenylboronic acid; CAS No: 99768-12-4
Cayman Chemical CAY10487 Fatty Acids and Deriv
An antioxidant with anti-atherogenic activity; inhibits formation of fatty streak lesions of the thoracic aorta in high cholesterol-fed rabbits without affecting plasma lipid profiles or significantly inhibiting ACAT-1 or ACAT-2 activity; dietary administration (0.05%) reduces the percent area occupied by the atherosclerotic lesion in rabbits to 16.1% from 53.5% in control rabbits; inhibits copper-mediated oxidation of LDL by ~75% at 2 µM
eMolecules 913835-27-5 | 4-Isopropylpyrimidine-5-boronic acid | Combi-Blocks | MFCD08235084 | 165.990 | C7H11BN2O2 | 96.000 | CC(C)c1ncncc1B(O)O | 1g | 117521482
4-Isopropylpyrimidine-5-boronic acid | Combi-Blocks | 913835-27-5 | MFCD08235084 | 165.990 | C7H11BN2O2 | 96.000 | CC(C)c1ncncc1B(O)O | 1g | 117521482
eMolecules 137401-45-7 | 2-((tert-Butoxycarbonyl)amino)-3-ethoxy-3-oxopropanoic acid | ChemScene | MFCD09835539 | 247.247 | C10H17NO6 | 97.000 | CCOC(=O)C(NC(=O)OC(C)(C)C)C(O)=O | 10g | 572245530
2-((tert-Butoxycarbonyl)amino)-3-ethoxy-3-oxopropanoic acid | ChemScene | 137401-45-7 | MFCD09835539 | 247.247 | C10H17NO6 | 97.000 | CCOC(=O)C(NC(=O)OC(C)(C)C)C(O)=O | 10g | 572245530
eMolecules 950511-17-8 | m-Benzenediboronic acid pinacol ester, 1,8-diaminonaphthalene, protected | Combi-Blocks | MFCD17018842 | 370.070 | C22H24B2N2O2 | 95.000 | CC1(C)OB(OC1(C)C)c1cccc(c1)B1Nc2cccc3cccc(N1)c23 | 1g | 482933567
m-Benzenediboronic acid pinacol ester, 1,8-diaminonaphthalene, protected | Combi-Blocks | 950511-17-8 | MFCD17018842 | 370.070 | C22H24B2N2O2 | 95.000 | CC1(C)OB(OC1(C)C)c1cccc(c1)B1Nc2cccc3cccc(N1)c23 | 1g | 482933567
Cambridge Isotope Laboratories Dioxin/Furan/CP-PCB Calibration Series (CDC0 3) 0 25 mL
Dioxin/Furan/CP-PCB Calibration Series (CDC0 3) 0 25 mL
eMolecules 850568-17-1 | 4-(O-Methylhydroxylaminocarbonyl)phenylboronic acid | Combi-Blocks | MFCD04115670 | 194.980 | C8H10BNO4 | 98.000 | CONC(=O)c1ccc(cc1)B(O)O | 5g | 117522273
4-(O-Methylhydroxylaminocarbonyl)phenylboronic acid | Combi-Blocks | 850568-17-1 | MFCD04115670 | 194.980 | C8H10BNO4 | 98.000 | CONC(=O)c1ccc(cc1)B(O)O | 5g | 117522273
eMolecules 2235384-35-5 | 5-Carboxy-2-fluorophenylboronic acid pinacol ester | Combi-Blocks | MFCD23098802 | 266.080 | C13H16BFO4 | 96.000 | CC1(C)OB(OC1(C)C)c1cc(ccc1F)C(O)=O | 1g | 290688501
5-Carboxy-2-fluorophenylboronic acid pinacol ester | Combi-Blocks | 2235384-35-5 | MFCD23098802 | 266.080 | C13H16BFO4 | 96.000 | CC1(C)OB(OC1(C)C)c1cc(ccc1F)C(O)=O | 1g | 290688501
C(O)=O)C(O)=O.CCN(C)C(=O)Oc1cccc(c1)[C@H](C)N(C)C | 10mg | 598442085](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502423761.PNG-250.jpg)
eMolecules 129101-54-8 | Rivastigmine tartrate | Ambeed | MFCD03700731 | 400.428 | C18H28N2O8 | 98.000 | O[C@H]([C@@H](O)C(O)=O)C(O)=O.CCN(C)C(=O)Oc1cccc(c1)[C@H](C)N(C)C | 10mg | 598442085
Rivastigmine tartrate | Ambeed | 129101-54-8 | MFCD03700731 | 400.428 | C18H28N2O8 | 98.000 | O[C@H]([C@@H](O)C(O)=O)C(O)=O.CCN(C)C(=O)Oc1cccc(c1)[C@H](C)N(C)C | 10mg | 598442085
Cayman Chemical 17 RHDHA Fatty Acids and Deriv
An aspirin-induced DHA metabolite; a precursor to resolvins; inhibits TNF-α-induced IL-1β expression in human glioma cells
eMolecules 397843-67-3 | 4-(N-Isopropylaminocarbonyl)phenylboronic acid | Combi-Blocks | MFCD04039353 | 207.040 | C10H14BNO3 | 98.000 | CC(C)NC(=O)c1ccc(cc1)B(O)O | 1g | 117522249
4-(N-Isopropylaminocarbonyl)phenylboronic acid | Combi-Blocks | 397843-67-3 | MFCD04039353 | 207.040 | C10H14BNO3 | 98.000 | CC(C)NC(=O)c1ccc(cc1)B(O)O | 1g | 117522249
Cayman Chemical 19 RHETE Fatty Acids and Deriv
A potent vasodilator of renal arterioles; 30% of the metabolite composition of arachidonic acid by CYP2E1; potent vasodilator of renal preglomerular vessels; blocks 20-HETE-induced vasoconstriction of renal arterioles at 1 µM