Boronic acid derivatives
Cambridge Isotope Laboratories Dioxin Furan Food/Feed/QQQ Calibration Standard (CS0 4) 0 25 mL
Dioxin Furan Food/Feed/QQQ Calibration Standard (CS0 4) 0 25 mL
Aobchem 3-Fluoro-2-ethoxyphenylboronic acid | ≥97% | CAS 1010097-71-8 | C8H10BFO3 | 500mg
3-Fluoro-2-ethoxyphenylboronic acid | ≥97% | CAS 1010097-71-8 | C8H10BFO3 | 500mg
Matrix Scientific 3-TOLYLBORONIC ACID-5G
3-Tolylboronic acid, 97%; 5g,C7H9BO2, MFCD00040198, mw 135.96, [17933-03-8]
eMolecules 951626-85-0 | TERT-BUTYL 4-(3-FLUOROPHENYL)PIPERAZINE-1-CARBOXYLATE | AstaTech | MFCD09817414 | 280.343 | C15H21FN2O2 | 95.000 | CC(C)(C)OC(=O)N1CCN(CC1)c1cccc(F)c1 | 1g | 436051856
TERT-BUTYL 4-(3-FLUOROPHENYL)PIPERAZINE-1-CARBOXYLATE | AstaTech | 951626-85-0 | MFCD09817414 | 280.343 | C15H21FN2O2 | 95.000 | CC(C)(C)OC(=O)N1CCN(CC1)c1cccc(F)c1 | 1g | 436051856
![eMolecules 23985-81-1 | DIBENZO[B,D]THIOPHENE-4-CARBALDEHYDE | AstaTech | MFCD00961967 | 212.270 | C13H8OS | 95.000 | O=Cc1cccc2c3ccccc3sc12 | 25g | 449741081](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502170519.JPG-250.jpg)
eMolecules 23985-81-1 | DIBENZO[B,D]THIOPHENE-4-CARBALDEHYDE | AstaTech | MFCD00961967 | 212.270 | C13H8OS | 95.000 | O=Cc1cccc2c3ccccc3sc12 | 25g | 449741081
DIBENZO[B,D]THIOPHENE-4-CARBALDEHYDE | AstaTech | 23985-81-1 | MFCD00961967 | 212.270 | C13H8OS | 95.000 | O=Cc1cccc2c3ccccc3sc12 | 25g | 449741081
Apexbio Technology LLC KT 5720 108068-98-0 100ug
KT 5720 (CAS 108068-98-0) is a cell-permeable reversible inhibitor of protein kinase A (PKA) that functions through ATP-competitive antagonism with an experimentally determined IC50 of 3 3 M This compound has been shown to counteract multidrug resistance in tumor cells mediated by MDR1 Additionally KT 5720 suppresses hyperpolarization-activated cyclic nucleotide-gated (HCN) cation channel activity resulting in decreased intracellular calcium levels and reduced excitability in dorsal root ganglion (DRG) neurons KT 5720 is utilized in studies investigating mechanisms underlying hematological malignancies and HCN or DRG-related disorders
Accela Chembio Inc 4-pentylphenylboronic Acid | 25g | 121219-12-3 | MFCD00995151 | 97+% | Shelf Life: 1080 Days | Light Sensitive
4-pentylphenylboronic Acid | 25g | 121219-12-3 | MFCD00995151 | 97+% | Shelf Life: 1080 Days | Light Sensitive
eMolecules 571-57-3 | 4-Bromonaphthalen-1-ol | Ambeed | MFCD03129265 | 223.069 | C10H7BrO | 97.000 | Oc1ccc(Br)c2ccccc12 | 250mg | 490550596
4-Bromonaphthalen-1-ol | Ambeed | 571-57-3 | MFCD03129265 | 223.069 | C10H7BrO | 97.000 | Oc1ccc(Br)c2ccccc12 | 250mg | 490550596
![eMolecules 1632-73-1 | 1,3,3-Trimethylbicyclo[2.2.1]heptan-2-ol | Oakwood Chemical | MFCD00066640 | 154.253 | C10H18O | 0.000 | CC1(C)C2CCC(C)(C2)C1O | 1g | 537722875](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502149302.JPG-250.jpg)
eMolecules 1632-73-1 | 1,3,3-Trimethylbicyclo[2.2.1]heptan-2-ol | Oakwood Chemical | MFCD00066640 | 154.253 | C10H18O | 0.000 | CC1(C)C2CCC(C)(C2)C1O | 1g | 537722875
1,3,3-Trimethylbicyclo[2.2.1]heptan-2-ol | Oakwood Chemical | 1632-73-1 | MFCD00066640 | 154.253 | C10H18O | 0.000 | CC1(C)C2CCC(C)(C2)C1O | 1g | 537722875
eMolecules 1257078-80-0 | Ambeed | 2-(4-(Benzyloxy)-3-methylphenyl)-4455-tetramethyl-132-dioxaborolane | 250mg | 586458475 | A945031 | MFCD18383421 | 324.23 | C20H25BO3
Ambeed | (3-(Methoxymethyl)phenyl)boronic acid | 250mg | 717677735 | A255266 | 142273-84-5 | MFCD03412069 | 165.980 | C8H11BO3
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 14047-29-1 | 4-Carboxyphenylboronic acid | Key Organics/BIONET | MFCD00151801 | 165.940 | C7H7BO4 | 90.000 | OB(O)c1ccc(cc1)C(O)=O | 50mg | 564101495
4-Carboxyphenylboronic acid | Key Organics/BIONET | 14047-29-1 | MFCD00151801 | 165.940 | C7H7BO4 | 90.000 | OB(O)c1ccc(cc1)C(O)=O | 50mg | 564101495
eMolecules 126747-14-6 | (4-cyanophenyl)boronic acid | Pharmablock | MFCD01318968 | 146.940 | C7H6BNO2 | 97.000 | OB(O)c1ccc(cc1)C#N | 100mg | 551219921
(4-cyanophenyl)boronic acid | Pharmablock | 126747-14-6 | MFCD01318968 | 146.940 | C7H6BNO2 | 97.000 | OB(O)c1ccc(cc1)C#N | 100mg | 551219921
eMolecules 14047-29-1 | 4-Carboxyphenylboronic acid | AA Blocks LLC | MFCD00151801 | 165.940 | C7H7BO4 | 0.000 | OB(O)c1ccc(cc1)C(O)=O | 1g | 483290387
4-Carboxyphenylboronic acid | AA Blocks LLC | 14047-29-1 | MFCD00151801 | 165.940 | C7H7BO4 | 0.000 | OB(O)c1ccc(cc1)C(O)=O | 1g | 483290387
eMolecules 126747-14-6 | 4-Cyanophenylboronic acid | Combi-Blocks | MFCD01318968 | 146.940 | C7H6BNO2 | 98.000 | OB(O)c1ccc(cc1)C#N | 500g | 357557801
4-Cyanophenylboronic acid | Combi-Blocks | 126747-14-6 | MFCD01318968 | 146.940 | C7H6BNO2 | 98.000 | OB(O)c1ccc(cc1)C#N | 500g | 357557801
Aobchem 4-tert-Butoxycarbonylphenylboronic acid, AOBCHEM USA 10356-5G. 850568-54-6. MFCD03411946
4-tert-Butoxycarbonylphenylboronic acid, AOBCHEM USA 10356-5G. 850568-54-6. MFCD03411946