Boronic acid derivatives
- (3)
- (2)
- (2)
- (2)
- (3)
- (2)
- (2)
- (5)
- (5)
- (3)
- (2)
- (2)
- (2)
- (2)
- (1)
- (1)
- (2)
- (1)
- (3)
- (14)
- (31)
- (18)
- (1)
- (7)
- (19)
- (2)
- (1)
Filtered Search Results
2,5-Dimethoxybenzeneboronic acid, 98%
CAS: 107099-99-0 Molecular Formula: C8H11BO4 Molecular Weight (g/mol): 181.982 MDL Number: MFCD01318181 InChI Key: QOZLFNQLIKOGDR-UHFFFAOYSA-N Synonym: 2,5-dimethoxyphenyl boronic acid,2,5-dimethoxybenzeneboronic acid,2,5-dimethoxyphenylboronicacid,2,5-dimethoxyphenyl boranediol,boronic acid, 2,5-dimethoxyphenyl,pubchem1824,acmc-2098nk,ksc174i7n,2,5-dimethoxyphenylboronoic acid PubChem CID: 2734342 IUPAC Name: (2,5-dimethoxyphenyl)boronic acid SMILES: B(C1=C(C=CC(=C1)OC)OC)(O)O
| PubChem CID | 2734342 |
|---|---|
| CAS | 107099-99-0 |
| Molecular Weight (g/mol) | 181.982 |
| MDL Number | MFCD01318181 |
| SMILES | B(C1=C(C=CC(=C1)OC)OC)(O)O |
| Synonym | 2,5-dimethoxyphenyl boronic acid,2,5-dimethoxybenzeneboronic acid,2,5-dimethoxyphenylboronicacid,2,5-dimethoxyphenyl boranediol,boronic acid, 2,5-dimethoxyphenyl,pubchem1824,acmc-2098nk,ksc174i7n,2,5-dimethoxyphenylboronoic acid |
| IUPAC Name | (2,5-dimethoxyphenyl)boronic acid |
| InChI Key | QOZLFNQLIKOGDR-UHFFFAOYSA-N |
| Molecular Formula | C8H11BO4 |
Ethylboronic acid, 97%
CAS: 4433-63-0 Molecular Formula: C2H7BO2 Molecular Weight (g/mol): 73.89 MDL Number: MFCD01074536 InChI Key: PAVZHTXVORCEHP-UHFFFAOYSA-N Synonym: boronic acid, ethyl,ethaneboronic acid,ethyldihydroxyborane,ethyl boronic acid,boronic acid, ethyl-9ci,ethylboronicacid,pubchem7960,ethylboric acid,etb oh 2 PubChem CID: 521157 IUPAC Name: ethylboronic acid SMILES: CCB(O)O
| PubChem CID | 521157 |
|---|---|
| CAS | 4433-63-0 |
| Molecular Weight (g/mol) | 73.89 |
| MDL Number | MFCD01074536 |
| SMILES | CCB(O)O |
| Synonym | boronic acid, ethyl,ethaneboronic acid,ethyldihydroxyborane,ethyl boronic acid,boronic acid, ethyl-9ci,ethylboronicacid,pubchem7960,ethylboric acid,etb oh 2 |
| IUPAC Name | ethylboronic acid |
| InChI Key | PAVZHTXVORCEHP-UHFFFAOYSA-N |
| Molecular Formula | C2H7BO2 |
2,3-Dichlorobenzeneboronic acid, 98%
CAS: 151169-74-3 Molecular Formula: C6H5BCl2O2 Molecular Weight (g/mol): 190.81 MDL Number: MFCD01075703 InChI Key: TYIKXPOMOYDGCS-UHFFFAOYSA-N Synonym: 2,3-dichlorophenyl boronic acid,2,3-dichlorobenzeneboronic acid,2,3-dichlorophenyl boranediol,boronic acid, 2,3-dichlorophenyl,contains varying amounts of anhydride,pubchem1810,dichlorophenylboronic acid,acmc-1c0ur,dichlorobenzene boronic acid PubChem CID: 2734661 IUPAC Name: (2,3-dichlorophenyl)boronic acid SMILES: OB(O)C1=C(Cl)C(Cl)=CC=C1
| PubChem CID | 2734661 |
|---|---|
| CAS | 151169-74-3 |
| Molecular Weight (g/mol) | 190.81 |
| MDL Number | MFCD01075703 |
| SMILES | OB(O)C1=C(Cl)C(Cl)=CC=C1 |
| Synonym | 2,3-dichlorophenyl boronic acid,2,3-dichlorobenzeneboronic acid,2,3-dichlorophenyl boranediol,boronic acid, 2,3-dichlorophenyl,contains varying amounts of anhydride,pubchem1810,dichlorophenylboronic acid,acmc-1c0ur,dichlorobenzene boronic acid |
| IUPAC Name | (2,3-dichlorophenyl)boronic acid |
| InChI Key | TYIKXPOMOYDGCS-UHFFFAOYSA-N |
| Molecular Formula | C6H5BCl2O2 |
3,5-Dimethoxybenzeneboronic acid, 98%
CAS: 192182-54-0 Molecular Formula: C8H11BO4 Molecular Weight (g/mol): 181.982 MDL Number: MFCD03095127 InChI Key: XUIURRYWQBBCCK-UHFFFAOYSA-N Synonym: 3,5-dimethoxybenzeneboronic acid,3,5-dimethoxyphenyl boronic acid,3,5-dimethoxyphenylboronicacid,boronic acid, 3,5-dimethoxyphenyl,pubchem1827,acmc-1c82c,ksc174i6h,3,5-dimethoxy phenyl boronic acid,3,5-dimethoxyphenylboronic acid,boronic acid, b-3,5-dimethoxyphenyl PubChem CID: 4374257 IUPAC Name: (3,5-dimethoxyphenyl)boronic acid SMILES: B(C1=CC(=CC(=C1)OC)OC)(O)O
| PubChem CID | 4374257 |
|---|---|
| CAS | 192182-54-0 |
| Molecular Weight (g/mol) | 181.982 |
| MDL Number | MFCD03095127 |
| SMILES | B(C1=CC(=CC(=C1)OC)OC)(O)O |
| Synonym | 3,5-dimethoxybenzeneboronic acid,3,5-dimethoxyphenyl boronic acid,3,5-dimethoxyphenylboronicacid,boronic acid, 3,5-dimethoxyphenyl,pubchem1827,acmc-1c82c,ksc174i6h,3,5-dimethoxy phenyl boronic acid,3,5-dimethoxyphenylboronic acid,boronic acid, b-3,5-dimethoxyphenyl |
| IUPAC Name | (3,5-dimethoxyphenyl)boronic acid |
| InChI Key | XUIURRYWQBBCCK-UHFFFAOYSA-N |
| Molecular Formula | C8H11BO4 |
2,4-Dichlorobenzeneboronic acid, 98%
CAS: 68716-47-2 Molecular Formula: C6H5BCl2O2 Molecular Weight (g/mol): 190.81 MDL Number: MFCD00013930 InChI Key: QNEGDGPAXKYZHZ-UHFFFAOYSA-N Synonym: 2,4-dichlorophenyl boronic acid,2,4-dichlorobenzeneboronic acid,2,4-dichlorophenylbornic acid,2,4-dichlorophenyl boranediol,chembl20726,2,4-dichloro benzene boronic acid,boronic acid, 2,4-dichlorophenyl,2,4-dichlorobenzeneboron dihydroxide,2,4-dichlorobenzeneboronicacid PubChem CID: 2734659 IUPAC Name: (2,4-dichlorophenyl)boronic acid SMILES: OB(O)C1=CC=C(Cl)C=C1Cl
| PubChem CID | 2734659 |
|---|---|
| CAS | 68716-47-2 |
| Molecular Weight (g/mol) | 190.81 |
| MDL Number | MFCD00013930 |
| SMILES | OB(O)C1=CC=C(Cl)C=C1Cl |
| Synonym | 2,4-dichlorophenyl boronic acid,2,4-dichlorobenzeneboronic acid,2,4-dichlorophenylbornic acid,2,4-dichlorophenyl boranediol,chembl20726,2,4-dichloro benzene boronic acid,boronic acid, 2,4-dichlorophenyl,2,4-dichlorobenzeneboron dihydroxide,2,4-dichlorobenzeneboronicacid |
| IUPAC Name | (2,4-dichlorophenyl)boronic acid |
| InChI Key | QNEGDGPAXKYZHZ-UHFFFAOYSA-N |
| Molecular Formula | C6H5BCl2O2 |
3-Aminobenzeneboronic acid, 98%
CAS: 30418-59-8 Molecular Formula: C6H8BNO2 Molecular Weight (g/mol): 136.945 MDL Number: MFCD00007755 InChI Key: JMZFEHDNIAQMNB-UHFFFAOYSA-N Synonym: 3-aminobenzeneboronic acid,3-aminophenyl boronic acid,m-aminophenylboronic acid,3-aminophenyl boranediol,m-aminophenyl boronic acid,3-amino phenylboronic acid,chembl20852,boronic acid, 3-aminophenyl,m-aminophenyl metaboric acid PubChem CID: 92269 IUPAC Name: (3-aminophenyl)boronic acid SMILES: B(C1=CC(=CC=C1)N)(O)O
| PubChem CID | 92269 |
|---|---|
| CAS | 30418-59-8 |
| Molecular Weight (g/mol) | 136.945 |
| MDL Number | MFCD00007755 |
| SMILES | B(C1=CC(=CC=C1)N)(O)O |
| Synonym | 3-aminobenzeneboronic acid,3-aminophenyl boronic acid,m-aminophenylboronic acid,3-aminophenyl boranediol,m-aminophenyl boronic acid,3-amino phenylboronic acid,chembl20852,boronic acid, 3-aminophenyl,m-aminophenyl metaboric acid |
| IUPAC Name | (3-aminophenyl)boronic acid |
| InChI Key | JMZFEHDNIAQMNB-UHFFFAOYSA-N |
| Molecular Formula | C6H8BNO2 |
3-Cyanobenzeneboronic acid, 98%
CAS: 150255-96-2 Molecular Formula: C7H6BNO2 Molecular Weight (g/mol): 146.94 MDL Number: MFCD01318967 InChI Key: XDBHWPLGGBLUHH-UHFFFAOYSA-N Synonym: 3-cyanophenyl boronic acid,3-cyanobenzeneboronic acid,3-boronobenzonitrile,3-dihydroxyboranyl benzonitrile,3-cyanobenzene boronic acid,3-cyano-phenyl-boronic acid,boronic acid, 3-cyanophenyl,pubchem1804,phenylboronic acid, 4 PubChem CID: 2734325 IUPAC Name: (3-cyanophenyl)boronic acid SMILES: OB(O)C1=CC=CC(=C1)C#N
| PubChem CID | 2734325 |
|---|---|
| CAS | 150255-96-2 |
| Molecular Weight (g/mol) | 146.94 |
| MDL Number | MFCD01318967 |
| SMILES | OB(O)C1=CC=CC(=C1)C#N |
| Synonym | 3-cyanophenyl boronic acid,3-cyanobenzeneboronic acid,3-boronobenzonitrile,3-dihydroxyboranyl benzonitrile,3-cyanobenzene boronic acid,3-cyano-phenyl-boronic acid,boronic acid, 3-cyanophenyl,pubchem1804,phenylboronic acid, 4 |
| IUPAC Name | (3-cyanophenyl)boronic acid |
| InChI Key | XDBHWPLGGBLUHH-UHFFFAOYSA-N |
| Molecular Formula | C7H6BNO2 |
3,4,5-Trimethoxybenzeneboronic acid, 98%
CAS: 182163-96-8 Molecular Formula: C9H13BO5 Molecular Weight (g/mol): 212.008 MDL Number: MFCD01075676 InChI Key: RULQUTYJXDLRFL-UHFFFAOYSA-N Synonym: 3,4,5-trimethoxybenzeneboronic acid,3,4,5-trimethoxyphenyl boronic acid,3,4,5-trimethoxyphenyl boranediol,3,4,5-trimethoxylphenylboronic acid,boronic acid, 3,4,5-trimethoxyphenyl,pubchem7894,acmc-1c5iu,ksc174i9j,3,4,5-trimethoxy phenylboronic acid PubChem CID: 2734390 IUPAC Name: (3,4,5-trimethoxyphenyl)boronic acid SMILES: B(C1=CC(=C(C(=C1)OC)OC)OC)(O)O
| PubChem CID | 2734390 |
|---|---|
| CAS | 182163-96-8 |
| Molecular Weight (g/mol) | 212.008 |
| MDL Number | MFCD01075676 |
| SMILES | B(C1=CC(=C(C(=C1)OC)OC)OC)(O)O |
| Synonym | 3,4,5-trimethoxybenzeneboronic acid,3,4,5-trimethoxyphenyl boronic acid,3,4,5-trimethoxyphenyl boranediol,3,4,5-trimethoxylphenylboronic acid,boronic acid, 3,4,5-trimethoxyphenyl,pubchem7894,acmc-1c5iu,ksc174i9j,3,4,5-trimethoxy phenylboronic acid |
| IUPAC Name | (3,4,5-trimethoxyphenyl)boronic acid |
| InChI Key | RULQUTYJXDLRFL-UHFFFAOYSA-N |
| Molecular Formula | C9H13BO5 |
4-Benzyloxy-2-methylbenzeneboronic acid, 98%
CAS: 847560-49-0 Molecular Formula: C14H15BO3 Molecular Weight (g/mol): 242.081 MDL Number: MFCD03788404 InChI Key: VCDFDGOVNBMYRW-UHFFFAOYSA-N Synonym: 4-benzyloxy-2-methylphenylboronic acid,4-benzyloxy-2-methylphenyl boronic acid,4-benzyloxy-2-methylbenzeneboronic acid,5-benzyloxytoluene-2-boronic acid,acmc-209pwd,2-methyl-4-benzyloxyphenylboronic acid,4-benzyloxy-2-methylphenyl boronicacid PubChem CID: 2773245 IUPAC Name: (2-methyl-4-phenylmethoxyphenyl)boronic acid SMILES: B(C1=C(C=C(C=C1)OCC2=CC=CC=C2)C)(O)O
| PubChem CID | 2773245 |
|---|---|
| CAS | 847560-49-0 |
| Molecular Weight (g/mol) | 242.081 |
| MDL Number | MFCD03788404 |
| SMILES | B(C1=C(C=C(C=C1)OCC2=CC=CC=C2)C)(O)O |
| Synonym | 4-benzyloxy-2-methylphenylboronic acid,4-benzyloxy-2-methylphenyl boronic acid,4-benzyloxy-2-methylbenzeneboronic acid,5-benzyloxytoluene-2-boronic acid,acmc-209pwd,2-methyl-4-benzyloxyphenylboronic acid,4-benzyloxy-2-methylphenyl boronicacid |
| IUPAC Name | (2-methyl-4-phenylmethoxyphenyl)boronic acid |
| InChI Key | VCDFDGOVNBMYRW-UHFFFAOYSA-N |
| Molecular Formula | C14H15BO3 |
4-Ethoxybenzeneboronic acid, 98%
CAS: 22237-13-4 Molecular Formula: C8H11BO3 Molecular Weight (g/mol): 165.983 MDL Number: MFCD00674028 InChI Key: WRQNDLDUNQMTCL-UHFFFAOYSA-N Synonym: 4-ethoxybenzeneboronic acid,4-ethoxyphenyl boronic acid,4-ethoxyphenyl boranediol,p-ethoxyphenylboronic acid,4-n-ethoxyphenyl boronic acid,boronic acid, 4-ethoxyphenyl,4-ethoxybenzeneboronicacid,4-ethoxyphenylboronicacid,4-ethoxyphenylboronic PubChem CID: 2734351 IUPAC Name: (4-ethoxyphenyl)boronic acid SMILES: B(C1=CC=C(C=C1)OCC)(O)O
| PubChem CID | 2734351 |
|---|---|
| CAS | 22237-13-4 |
| Molecular Weight (g/mol) | 165.983 |
| MDL Number | MFCD00674028 |
| SMILES | B(C1=CC=C(C=C1)OCC)(O)O |
| Synonym | 4-ethoxybenzeneboronic acid,4-ethoxyphenyl boronic acid,4-ethoxyphenyl boranediol,p-ethoxyphenylboronic acid,4-n-ethoxyphenyl boronic acid,boronic acid, 4-ethoxyphenyl,4-ethoxybenzeneboronicacid,4-ethoxyphenylboronicacid,4-ethoxyphenylboronic |
| IUPAC Name | (4-ethoxyphenyl)boronic acid |
| InChI Key | WRQNDLDUNQMTCL-UHFFFAOYSA-N |
| Molecular Formula | C8H11BO3 |
2,4,6-Trimethoxybenzeneboronic acid, 98%
CAS: 135159-25-0 Molecular Formula: C9H13BO5 Molecular Weight (g/mol): 212.01 MDL Number: MFCD01114642 InChI Key: PKLRXZVPEQJTTJ-UHFFFAOYSA-N Synonym: 2,4,6-trimethoxybenzeneboronic acid,2,4,6-trimethoxyphenyl boronic acid,boronic acid,b-2,4,6-trimethoxyphenyl,1,3,5-trimethoxybenzene-2-boronic ester,pubchem9566,1,3,5-trimethoxybenzene-2-bronic ester,acmc-1cirz,ablock ab-12-9177,2,4,6-trimethoxybenzeneboronicacid PubChem CID: 4197996 IUPAC Name: (2,4,6-trimethoxyphenyl)boronic acid SMILES: COC1=CC(OC)=C(B(O)O)C(OC)=C1
| PubChem CID | 4197996 |
|---|---|
| CAS | 135159-25-0 |
| Molecular Weight (g/mol) | 212.01 |
| MDL Number | MFCD01114642 |
| SMILES | COC1=CC(OC)=C(B(O)O)C(OC)=C1 |
| Synonym | 2,4,6-trimethoxybenzeneboronic acid,2,4,6-trimethoxyphenyl boronic acid,boronic acid,b-2,4,6-trimethoxyphenyl,1,3,5-trimethoxybenzene-2-boronic ester,pubchem9566,1,3,5-trimethoxybenzene-2-bronic ester,acmc-1cirz,ablock ab-12-9177,2,4,6-trimethoxybenzeneboronicacid |
| IUPAC Name | (2,4,6-trimethoxyphenyl)boronic acid |
| InChI Key | PKLRXZVPEQJTTJ-UHFFFAOYSA-N |
| Molecular Formula | C9H13BO5 |
2-Methylbenzeneboronic acid, 98%
CAS: 16419-60-6 Molecular Formula: C7H9BO2 Molecular Weight (g/mol): 135.96 MDL Number: MFCD00093526 InChI Key: NSJVYHOPHZMZPN-UHFFFAOYSA-N Synonym: 2-tolylboronic acid,o-tolylboronic acid,2-methylbenzeneboronic acid,2-methylphenyl boronic acid,o-methylphenylboronic acid,2-methylphenyl boranediol,tolylboronic acid,o-tolueneboronic acid,toluene-2-boronic acid,boronic acid, methylphenyl PubChem CID: 2733267 IUPAC Name: (2-methylphenyl)boronic acid SMILES: CC1=CC=CC=C1B(O)O
| PubChem CID | 2733267 |
|---|---|
| CAS | 16419-60-6 |
| Molecular Weight (g/mol) | 135.96 |
| MDL Number | MFCD00093526 |
| SMILES | CC1=CC=CC=C1B(O)O |
| Synonym | 2-tolylboronic acid,o-tolylboronic acid,2-methylbenzeneboronic acid,2-methylphenyl boronic acid,o-methylphenylboronic acid,2-methylphenyl boranediol,tolylboronic acid,o-tolueneboronic acid,toluene-2-boronic acid,boronic acid, methylphenyl |
| IUPAC Name | (2-methylphenyl)boronic acid |
| InChI Key | NSJVYHOPHZMZPN-UHFFFAOYSA-N |
| Molecular Formula | C7H9BO2 |
3-(Trifluoromethoxy)benzeneboronic acid, 98%
CAS: 179113-90-7 Molecular Formula: C7H6BF3O3 Molecular Weight (g/mol): 205.93 MDL Number: MFCD01320697 InChI Key: UWDFWVLAHRQSKK-UHFFFAOYSA-N Synonym: 3-trifluoromethoxyphenylboronic acid,3-trifluoromethoxy phenylboronic acid,3-trifluoromethoxy phenyl boronic acid,3-trifluoromethoxy benzeneboronic acid,m-trifluoromethoxy phenylboronic acid,3-trifluoromethoxy phenyl boranediol,3-trifluoromethyloxy phenylboronic acid,boronic acid, 3-trifluoromethoxy phenyl PubChem CID: 2734385 IUPAC Name: [3-(trifluoromethoxy)phenyl]boronic acid SMILES: OB(O)C1=CC=CC(OC(F)(F)F)=C1
| PubChem CID | 2734385 |
|---|---|
| CAS | 179113-90-7 |
| Molecular Weight (g/mol) | 205.93 |
| MDL Number | MFCD01320697 |
| SMILES | OB(O)C1=CC=CC(OC(F)(F)F)=C1 |
| Synonym | 3-trifluoromethoxyphenylboronic acid,3-trifluoromethoxy phenylboronic acid,3-trifluoromethoxy phenyl boronic acid,3-trifluoromethoxy benzeneboronic acid,m-trifluoromethoxy phenylboronic acid,3-trifluoromethoxy phenyl boranediol,3-trifluoromethyloxy phenylboronic acid,boronic acid, 3-trifluoromethoxy phenyl |
| IUPAC Name | [3-(trifluoromethoxy)phenyl]boronic acid |
| InChI Key | UWDFWVLAHRQSKK-UHFFFAOYSA-N |
| Molecular Formula | C7H6BF3O3 |
4-n-Nonylbenzeneboronic acid, 98+%
CAS: 256383-45-6 Molecular Formula: C15H25BO2 Molecular Weight (g/mol): 248.173 MDL Number: MFCD02093070 InChI Key: VONVJOGSLHAKOX-UHFFFAOYSA-N Synonym: 4-n-nonylphenylboronic acid,4-n-nonylbenzeneboronic acid,4-nonylphenyl boronic acid,4-n-nonylphenylboronicacid,4-nonylphenyl boranediol,d0f1ud,4-nonylbenzene boronic acid,b-4-nonylphenyl boronic acid,4-n-nonyl benzeneboronic acid,1-borono-4-non-1-yl benzene PubChem CID: 4589192 IUPAC Name: (4-nonylphenyl)boronic acid SMILES: B(C1=CC=C(C=C1)CCCCCCCCC)(O)O
| PubChem CID | 4589192 |
|---|---|
| CAS | 256383-45-6 |
| Molecular Weight (g/mol) | 248.173 |
| MDL Number | MFCD02093070 |
| SMILES | B(C1=CC=C(C=C1)CCCCCCCCC)(O)O |
| Synonym | 4-n-nonylphenylboronic acid,4-n-nonylbenzeneboronic acid,4-nonylphenyl boronic acid,4-n-nonylphenylboronicacid,4-nonylphenyl boranediol,d0f1ud,4-nonylbenzene boronic acid,b-4-nonylphenyl boronic acid,4-n-nonyl benzeneboronic acid,1-borono-4-non-1-yl benzene |
| IUPAC Name | (4-nonylphenyl)boronic acid |
| InChI Key | VONVJOGSLHAKOX-UHFFFAOYSA-N |
| Molecular Formula | C15H25BO2 |
Biphenyl-4-boronic acid, 97+%
CAS: 5122-94-1 Molecular Formula: C12H11BO2 Molecular Weight (g/mol): 198.03 MDL Number: MFCD00093311 InChI Key: XPEIJWZLPWNNOK-UHFFFAOYSA-N Synonym: 4-biphenylboronic acid,1,1'-biphenyl-4-ylboronic acid,biphenyl-4-boronic acid,4-biphenyl boronic acid,biphenylboronic acid,4-phenylphenyl boranediol,4-phenylphenyl boronic acid,biphenyl-4-ylboronic acid,1,1'-biphenyl-4-yl-boronic acid,4-phenylbenzeneboronic acid PubChem CID: 151253 IUPAC Name: (4-phenylphenyl)boronic acid SMILES: OB(O)C1=CC=C(C=C1)C1=CC=CC=C1
| PubChem CID | 151253 |
|---|---|
| CAS | 5122-94-1 |
| Molecular Weight (g/mol) | 198.03 |
| MDL Number | MFCD00093311 |
| SMILES | OB(O)C1=CC=C(C=C1)C1=CC=CC=C1 |
| Synonym | 4-biphenylboronic acid,1,1'-biphenyl-4-ylboronic acid,biphenyl-4-boronic acid,4-biphenyl boronic acid,biphenylboronic acid,4-phenylphenyl boranediol,4-phenylphenyl boronic acid,biphenyl-4-ylboronic acid,1,1'-biphenyl-4-yl-boronic acid,4-phenylbenzeneboronic acid |
| IUPAC Name | (4-phenylphenyl)boronic acid |
| InChI Key | XPEIJWZLPWNNOK-UHFFFAOYSA-N |
| Molecular Formula | C12H11BO2 |