Biotin and derivatives
Apexbio Technology LLC Sulfo-NHS-LC-D-Desthiobiotin 5X1mg
Sulfo-NHS-LC-D-Desthiobiotin is a sulfonated amine-reactive labeling reagent targeting primary amines on proteins or peptides It is designed to covalently label cell-surface proteins by reacting with lysine residues or protein N-termini thereby enabling selective modification of these proteins Sulfo-NHS-LC-D-Desthiobiotin exerts its biological activity primarily through covalent reaction with primary amines via its activated Sulfo-NHS ester Due to its membrane-impermeable negatively charged sulfonate group it selectively labels cell-surface proteins without entering intact cells Based on these chemical properties Sulfo-NHS-LC-D-Desthiobiotin holds research potential in affinity purification biotin-streptavidin interaction assays selective enrichment and analytical workflows involving reversible labeling of surface proteins
Medchemexpress LLC Biotin-C5-Azide (DecarboxyBiotin-N3) | 1260586-88-6 | C10H17N5OS | 25 MG
Biotin-C5-Azide (DecarboxyBiotin-N3) is a versatile biotin reagent designed for preparing biotinylated conjugates. It functions as a click chemistry reagent, featuring an azide group that enables participation in various cycloaddition reactions.
- Can be used to prepare biotinylated conjugates
- Click chemistry reagent containing an azide group
- Undergoes copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing alkyne groups
- Participates in strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups
Medchemexpress LLC Biotin-C5-Azide (DecarboxyBiotin-N3) | 1260586-88-6 | C10H17N5OS | 1 ML
Biotin-C5-Azide (DecarboxyBiotin-N3) is a biotin reagent used to prepare biotinylated conjugates. It functions as a click chemistry reagent, containing an Azide group that allows it to participate in copper-catalyzed azide-alkyne cycloaddition (CuAAc) reactions with alkyne-containing molecules. Additionally, it can undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
- Used to prepare biotinylated conjugates
- Functions as a click chemistry reagent
- Contains an azide group
- Participates in copper-catalyzed azide-alkyne cycloaddition (CuAAc) reactions
- Undergoes strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with DBCO or BCN groups
eMolecules 1353016-71-3 | DBCO-NHS ester | Knight Chemicals, Inc. | MFCD24386367 | 402.406 | C23H18N2O5 | 99.000 | O=C(CCC(=O)N1Cc2ccccc2C#Cc2ccccc12)ON1C(=O)CCC1=O | 5g | 894265339
DBCO-NHS ester | Knight Chemicals, Inc. | 1353016-71-3 | MFCD24386367 | 402.406 | C23H18N2O5 | 99.000 | O=C(CCC(=O)N1Cc2ccccc2C#Cc2ccccc12)ON1C(=O)CCC1=O | 5g | 894265339
Medchemexpress LLC Norbornene-NHS | 1888335-48-5 | C12H13NO5 | 25 MG
Norbornene-NHS is a dienophile click chemistry reagent used for conjugation via copper-free click reaction with tetrazines. It is intended for research use only.
- Click chemistry reagent
- Dienophile for conjugation via copper-free click reaction with tetrazines