Dihydrofurans
Apexbio Technology LLC DIHYDROFURAN-32H-ONE-1G
Dihydrofuran-3(2H)-one (CAS No 22929-52-8) is a compound of interest in the field of organic chemistry and pharmaceutical research Originating from furan derivatives it is studied for its potential role in modulating biochemical pathways involving lactone rings which are significant in various metabolic processes Its mechanism of action often involves targeting enzyme-catalyzed reactions showcasing inhibitory activity in certain pathways In vitro its activity is generally observed in the nanomolar to low micromolar range This compound is commonly utilized in drug discovery and screening serving as a scaffold for developing therapeutic agents Typical applications include use in cell models and animal studies to investigate pharmacodynamic and pharmacokinetic profiles Experimental concentrations typically depend on the specific research design ensuring optimal engagement with the intended biochemical targets and achieving desired outcomes
eMolecules 212127-80-5 | 2-(2,5-Dihydrofuran-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane | ChemScene | MFCD16996209 | 196.050 | C10H17BO3 | 96.000 | CC1(C)OB(OC1(C)C)C1=CCOC1 | 10g | 893915168
2-(2,5-Dihydrofuran-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane | ChemScene | 212127-80-5 | MFCD16996209 | 196.050 | C10H17BO3 | 96.000 | CC1(C)OB(OC1(C)C)C1=CCOC1 | 10g | 893915168
eMolecules 212127-80-5 | 2-(2,5-Dihydrofuran-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane | Advanced ChemBlocks | MFCD16996209 | 196.050 | C10H17BO3 | 97.000 | CC1(C)OB(OC1(C)C)C1=CCOC1 | 1g | 307159179
2-(2,5-Dihydrofuran-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane | Advanced ChemBlocks | 212127-80-5 | MFCD16996209 | 196.050 | C10H17BO3 | 97.000 | CC1(C)OB(OC1(C)C)C1=CCOC1 | 1g | 307159179
eMolecules 212127-80-5 | (2,5-DIHYDROFURAN-3-YL)BORONIC ACID PINACOL ESTER | AstaTech | MFCD16996209 | 196.050 | C10H17BO3 | 95.000 | CC1(C)OB(OC1(C)C)C1=CCOC1 | 1g | 391060135
(2,5-DIHYDROFURAN-3-YL)BORONIC ACID PINACOL ESTER | AstaTech | 212127-80-5 | MFCD16996209 | 196.050 | C10H17BO3 | 95.000 | CC1(C)OB(OC1(C)C)C1=CCOC1 | 1g | 391060135
Medchemexpress LLC Dihydrofuran-3(2H)-one | 22929-52-8 | 99.97% | 86.09 | 1 ML
Dihydrofuran-3(2H)-one, also known as 3-Oxotetrahydrofuran, is a cyclic ketone primarily utilized in research. It serves as a building block for synthesizing various biologically active compounds and can be used to create cyclic ketone inhibitors that target the serine protease plasmin. This product is intended for research purposes only and has not been fully validated for medical applications.
- Used to synthesize cyclic ketone inhibitors that inhibit serine protease plasmin.
- Serves as a building block for biologically active compounds.
- Detailed solubility information provided for in vitro and in vivo applications.
- Specific storage conditions for pure form and in solvent are available.
eMolecules 22929-52-8 | Dihydrofuran-3(2H)-one | Apollo Scientific | MFCD07778393 | 86.090 | C4H6O2 | 95.000 | O=C1CCOC1 | 1g | 600855129
Dihydrofuran-3(2H)-one | Apollo Scientific | 22929-52-8 | MFCD07778393 | 86.090 | C4H6O2 | 95.000 | O=C1CCOC1 | 1g | 600855129
eMolecules 212127-80-5 | 2,5-Dihydrofuran-3-boronic acid pinacol ester | Combi-Blocks | MFCD16996209 | 196.050 | C10H17BO3 | 98.000 | CC1(C)OB(OC1(C)C)C1=CCOC1 | 1g | 342865695
2,5-Dihydrofuran-3-boronic acid pinacol ester | Combi-Blocks | 212127-80-5 | MFCD16996209 | 196.050 | C10H17BO3 | 98.000 | CC1(C)OB(OC1(C)C)C1=CCOC1 | 1g | 342865695
Medchemexpress LLC Dihydrofuran-3(2H)-one | 22929-52-8 | 99.99% | 86.09 | 10 G
Dihydrofuran-3(2H)-one (3-Oxotetrahydrofuran) is a cyclic ketone primarily used as a building block for the synthesis of biologically active compounds. It is also utilized in the synthesis of cyclic ketone inhibitors that inhibit the serine protease plasmin.
- Cyclic ketone structure
- Building block for biologically active compounds
- Inhibits serine protease plasmin
- For research use only
Aobchem N -(dihydrofuran-3(2H)-ylidene)-4-methylbenzenesulfonohydrazide | 97% | CAS 1708-19-6 | C11H14N2O3S | 1g
N -(dihydrofuran-3(2H)-ylidene)-4-methylbenzenesulfonohydrazide | 97% | CAS 1708-19-6 | C11H14N2O3S | 1g
Aobchem Stannane (2 6-difluorophenyl)trimethyl- | 95% | CAS 55204-79-0 | C9H12F2Sn | 1g
Stannane (2 6-difluorophenyl)trimethyl- | 95% | CAS 55204-79-0 | C9H12F2Sn | 1g
Aflatoxin G1, crystalline, Thermo Scientific™
CAS: 1165-39-5 Molecular Formula: C17H12O7 Molecular Weight (g/mol): 328.28 MDL Number: MFCD00005089 InChI Key: XWIYFDMXXLINPU-UHFFFAOYNA-N Synonym: 1h,12h-furo 3',2':4,5 furo 2,3-h pyrano 3,4-c 1 benzopyran-1,12-dione, 3,4,7a,10a-tetrahydro-5-methoxy-, 7ar-cis,ambotzls-1007 PubChem CID: 15939117 IUPAC Name: 11-methoxy-6,8,16,20-tetraoxapentacyclo[10.8.0.0²,⁹.0³,⁷.0¹³,¹⁸]icosa-1,4,9,11,13(18)-pentaene-17,19-dione SMILES: COC1=C2C3=C(C(=O)OCC3)C(=O)OC2=C2C3C=COC3OC2=C1