Dioxaborolanes
eMolecules 1394346-20-3 | Dimethyl(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)phosphine oxide | Synthonix - Stock280.110 | C14H22BO3P | 95.000 | CC1(C)OB(OC1(C)C)c1ccc(cc1)P(C)(C)=O | 1g | 495867670
Dimethyl(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)phosphine oxide | Synthonix - Stock | 1394346-20-3280.110 | C14H22BO3P | 95.000 | CC1(C)OB(OC1(C)C)c1ccc(cc1)P(C)(C)=O | 1g | 495867670
eMolecules 1312479-75-6 | 2-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-5,6-dihydropyridin-1(2H)-yl)pyrimidine | MFCD22415486 | 250mg
Ambeed | (3R5S)-rel-35-Dimethylmorpholine hydrochloride | 100mg | 650570723 | A775552 | 154596-17-5 | MFCD14525805 | 151.630 | C6H14ClNO
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 3-Amino-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-chromen-2-one | 250mg
Ambeed | 3-Amino-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-chromen-2-one | 250mg | 600828331 | A1188334 | 287.120 | C15H18BNO4
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
Aobchem 4 4 5 5-Tetramethyl-2-(2-phenoxyphenyl)-1 3 2-dioxaborolane | ≥97% | CAS 1688671-98-8 | C18H21BO3 | 500mg
4 4 5 5-Tetramethyl-2-(2-phenoxyphenyl)-1 3 2-dioxaborolane | ≥97% | CAS 1688671-98-8 | C18H21BO3 | 500mg
Frontier Specialty Chemicals 5G 3,6-DIHYDRO-2H-PYRIDINE-1-N
3,6-Dihydro-2H-pyridine-1-N-Boc-4-boronic acid pinacol ester; CAS No: 286961-14-6
eMolecules 1160790-84-0 | 1-methyl-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-dihydropyridin-2-one | Pharmablock | MFCD12032569 | 235.090 | C12H18BNO3 | 97.000 | Cn1ccc(cc1=O)B1OC(C)(C)C(C)(C)O1 | 2.5g | 712847562
1-methyl-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-dihydropyridin-2-one | Pharmablock | 1160790-84-0 | MFCD12032569 | 235.090 | C12H18BNO3 | 97.000 | Cn1ccc(cc1=O)B1OC(C)(C)C(C)(C)O1 | 2.5g | 712847562
Frontier Specialty Chemicals 1G TERT-BUTYL 3-(4,4,5,5-TETRA
tert-Butyl 3-(4,4,5,5-tetramethyl-[1,3,2]dioxaborolan-2-yl) proprionate
eMolecules 269409-97-4 | 2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenol | Ambeed | MFCD02093754 | 220.080 | C12H17BO3 | 95.000 | CC1(C)OB(OC1(C)C)c1ccccc1O | 1g | 525025376
2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenol | Ambeed | 269409-97-4 | MFCD02093754 | 220.080 | C12H17BO3 | 95.000 | CC1(C)OB(OC1(C)C)c1ccccc1O | 1g | 525025376
eMolecules 1052686-67-5 | 2-methyl-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine | Pharmablock | MFCD12032615 | 220.080 | C11H17BN2O2 | 97.000 | Cc1ncc(cn1)B1OC(C)(C)C(C)(C)O1 | 500mg | 701021854
2-methyl-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine | Pharmablock | 1052686-67-5 | MFCD12032615 | 220.080 | C11H17BN2O2 | 97.000 | Cc1ncc(cn1)B1OC(C)(C)C(C)(C)O1 | 500mg | 701021854