Dioxanes
![eMolecules 1401464-08-1 | rel-2-((1R,5S,6s)-3-(tert-Butoxycarbonyl)-3-azabicyclo[3.1.0]hexan-6-yl)acetic acid | Combi-Blocks | MFCD12198681 | 241.287 | C12H19NO4 | 98.000 | CC(C)(C)OC(=O)N1C[C@H]2[C@H](CC(O)=O)[C@H]2C1 | 1g | 495745088](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502191593.JPG-250.jpg)
eMolecules 1401464-08-1 | rel-2-((1R,5S,6s)-3-(tert-Butoxycarbonyl)-3-azabicyclo[3.1.0]hexan-6-yl)acetic acid | Combi-Blocks | MFCD12198681 | 241.287 | C12H19NO4 | 98.000 | CC(C)(C)OC(=O)N1C[C@H]2[C@H](CC(O)=O)[C@H]2C1 | 1g | 495745088
rel-2-((1R,5S,6s)-3-(tert-Butoxycarbonyl)-3-azabicyclo[3.1.0]hexan-6-yl)acetic acid | Combi-Blocks | 1401464-08-1 | MFCD12198681 | 241.287 | C12H19NO4 | 98.000 | CC(C)(C)OC(=O)N1C[C@H]2[C@H](CC(O)=O)[C@H]2C1 | 1g | 495745088
eMolecules 1523541-84-5 | (R)-(1,4-Dioxan-2-yl)methanamine hydrochloride | MFCD27918519 | 1g
ChemScene | 2-(4-(M-tolyl)piperazin-1-yl)ethan-1-amine | 100mg | 714205633 | CS-0286787 | 21103-27-5 | MFCD06742626 | 219.332 | C13H21N3
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
![eMolecules 90965-06-3 | Dimethyl (1-diazo-2-oxopropyl)phosphonate | ACS Scientific | MFCD07368360 | 192.111 | C5H9N2O4P | 97.000 | COP(=O)(OC)C(=[N+]=[N-])C(C)=O | 10g | 460615750](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000492421.jpg-250.jpg)
eMolecules 90965-06-3 | Dimethyl (1-diazo-2-oxopropyl)phosphonate | ACS Scientific | MFCD07368360 | 192.111 | C5H9N2O4P | 97.000 | COP(=O)(OC)C(=[N+]=[N-])C(C)=O | 10g | 460615750
Dimethyl (1-diazo-2-oxopropyl)phosphonate | ACS Scientific | 90965-06-3 | MFCD07368360 | 192.111 | C5H9N2O4P | 97.000 | COP(=O)(OC)C(=[N+]=[N-])C(C)=O | 10g | 460615750
![eMolecules 120705-67-1 | (5R,6S)-Allyl 6-((R)-1-((tert-butyldimethylsilyl)oxy)ethyl)-7-oxo-3-((R)-tetrahydrofuran-2-yl)-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate | MFCD09039289 | 1g](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502141040.JPG-250.jpg)
eMolecules 120705-67-1 | (5R,6S)-Allyl 6-((R)-1-((tert-butyldimethylsilyl)oxy)ethyl)-7-oxo-3-((R)-tetrahydrofuran-2-yl)-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate | MFCD09039289 | 1g
Ambeed | 5-Benzyl-5-azaspiro[2.4]heptane-47-dione | 250mg | 632808990 | A141469 | 129306-04-3 | MFCD22050713 | 215.252 | C13H13NO2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 74181-34-3 | 2,2-Dimethyl-1,3-dioxan-5-one | Combi-Blocks, Inc. | MFCD00671514 | 130.143 | C6H10O3 | 98.000 | CC1(C)OCC(=O)CO1 | 500g | 882682872
2,2-Dimethyl-1,3-dioxan-5-one | Combi-Blocks, Inc. | 74181-34-3 | MFCD00671514 | 130.143 | C6H10O3 | 98.000 | CC1(C)OCC(=O)CO1 | 500g | 882682872
eMolecules 74181-34-3 | 2,2-Dimethyl-1,3-dioxan-5-one | Combi-Blocks | MFCD00671514 | 130.143 | C6H10O3 | 98.000 | CC1(C)OCC(=O)CO1 | 1g | 528669171
2,2-Dimethyl-1,3-dioxan-5-one | Combi-Blocks | 74181-34-3 | MFCD00671514 | 130.143 | C6H10O3 | 98.000 | CC1(C)OCC(=O)CO1 | 1g | 528669171
eMolecules 74181-34-3 | 2,2-dimethyl-1,3-dioxan-5-one | Pharmablock | MFCD00671514 | 130.143 | C6H10O3 | 97.000 | CC1(C)OCC(=O)CO1 | 50g | 779535777
2,2-dimethyl-1,3-dioxan-5-one | Pharmablock | 74181-34-3 | MFCD00671514 | 130.143 | C6H10O3 | 97.000 | CC1(C)OCC(=O)CO1 | 50g | 779535777
eMolecules 282735-66-4 | (5R,6S)-5,6-diphenylmorpholin-2-one | 1g
4-Chloro-2,6-difluoroaniline | Ambeed | 69411-06-9 | MFCD03426173 | 163.550 | C6H4ClF2N | 97.000 | Nc1c(F)cc(Cl)cc1F | 25g | 525085313
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 276252-73-4 | (2S,6S)-2,6-Dimethylmorpholine | 1g
Ambeed | 1-Methyl-2-oxo-12-dihydroquinoline-3-carboxylic acid | 100mg | 521471383 | A510076 | 67984-94-5 | MFCD08754095 | 203.197 | C11H9NO3
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>