Imidolactams
Aobchem 1-Ethoxy-4-(iodoethynyl)benzene | 95% | CAS 2086758-95-2 | C10H9IO | 1g
1-Ethoxy-4-(iodoethynyl)benzene | 95% | CAS 2086758-95-2 | C10H9IO | 1g
Aobchem 2 2-Dichloro-1-(4-ethoxy-3-fluorophenyl)ethanol | 97% | CAS 2921719-92-6 | C10H11Cl2FO2 | 500mg
2 2-Dichloro-1-(4-ethoxy-3-fluorophenyl)ethanol | 97% | CAS 2921719-92-6 | C10H11Cl2FO2 | 500mg
Aobchem Ethyl 2-(3-ethoxy-2-methoxyphenyl)-2-oxoacetate | 95% | C13H16O5 | 250mg
Ethyl 2-(3-ethoxy-2-methoxyphenyl)-2-oxoacetate | 95% | C13H16O5 | 250mg
Aobchem Ethyl 2-(3-ethoxy-2-methoxyphenyl)-2-oxoacetate | 95% | C13H16O5 | 500mg
Ethyl 2-(3-ethoxy-2-methoxyphenyl)-2-oxoacetate | 95% | C13H16O5 | 500mg
Aobchem Methyl 3-bromo-2-ethoxy-5-isopropylbenzoate | 97% | CAS 2901105-77-7 | C13H17BrO3 | 500mg
Methyl 3-bromo-2-ethoxy-5-isopropylbenzoate | 97% | CAS 2901105-77-7 | C13H17BrO3 | 500mg
C[C@H]1Cc1ccc(Cl)cc1 | 50mg | 452545329](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502477020.JPG-250.jpg)
eMolecules 2306253-85-8 | (2R,4S)-tert-butyl 4-amino-2-(4-chlorobenzyl)piperidine-1-carboxylate | J & W PharmLab LLC324.850 | C17H25ClN2O2 | 96.000 | CC(C)(C)OC(=O)N1CC[C@H](N)C[C@H]1Cc1ccc(Cl)cc1 | 50mg | 452545329
(2R,4S)-tert-butyl 4-amino-2-(4-chlorobenzyl)piperidine-1-carboxylate | J & W PharmLab LLC | 2306253-85-8324.850 | C17H25ClN2O2 | 96.000 | CC(C)(C)OC(=O)N1CC[C@H](N)C[C@H]1Cc1ccc(Cl)cc1 | 50mg | 452545329
![eMolecules 92260-81-6 | 5,6-DIHYDROIMIDAZO[4,5,1-JK][1]BENZAZEPINE-2,7(1H,4H)-DIONE | 10g](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502145155.JPG-250.jpg)
eMolecules 92260-81-6 | 5,6-DIHYDROIMIDAZO[4,5,1-JK][1]BENZAZEPINE-2,7(1H,4H)-DIONE | 10g
WuXi ChemSupply | 5,6-DIHYDROIMIDAZO[4,5,1-JK][1]BENZAZEPINE-2,7(1H,4H)-DIONE | 10g | 599166085 | LN00215877 | 95.000 | 92260-81-6 | 202.213 | C11H10N2O2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>