Imidolactams
Aobchem Methyl 2-ethoxy-6-methylbenzoate | ≥95% | CAS 104216-21-9 | C11H14O3 | 1g
Methyl 2-ethoxy-6-methylbenzoate | ≥95% | CAS 104216-21-9 | C11H14O3 | 1g
Aobchem Methyl 2-ethoxy-6-methylbenzoate | ≥95% | CAS 104216-21-9 | C11H14O3 | 500mg
Methyl 2-ethoxy-6-methylbenzoate | ≥95% | CAS 104216-21-9 | C11H14O3 | 500mg
Aobchem Thianthrene-1-carbonitrile | 95% | CAS 349453-35-6 | C13H7NS2 | 250mg
Thianthrene-1-carbonitrile | 95% | CAS 349453-35-6 | C13H7NS2 | 250mg
Aobchem Methyl 3-bromo-2-ethoxy-5-isopropylbenzoate | 97% | CAS 2901105-77-7 | C13H17BrO3 | 250mg
Methyl 3-bromo-2-ethoxy-5-isopropylbenzoate | 97% | CAS 2901105-77-7 | C13H17BrO3 | 250mg
Aobchem Ethyl 2-(3-ethoxy-2-methoxyphenyl)-2-oxoacetate | 95% | C13H16O5 | 500mg
Ethyl 2-(3-ethoxy-2-methoxyphenyl)-2-oxoacetate | 95% | C13H16O5 | 500mg
C[C@H]1Cc1ccc(Cl)cc1 | 50mg | 452545329](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502477020.JPG-250.jpg)
eMolecules 2306253-85-8 | (2R,4S)-tert-butyl 4-amino-2-(4-chlorobenzyl)piperidine-1-carboxylate | J & W PharmLab LLC324.850 | C17H25ClN2O2 | 96.000 | CC(C)(C)OC(=O)N1CC[C@H](N)C[C@H]1Cc1ccc(Cl)cc1 | 50mg | 452545329
(2R,4S)-tert-butyl 4-amino-2-(4-chlorobenzyl)piperidine-1-carboxylate | J & W PharmLab LLC | 2306253-85-8324.850 | C17H25ClN2O2 | 96.000 | CC(C)(C)OC(=O)N1CC[C@H](N)C[C@H]1Cc1ccc(Cl)cc1 | 50mg | 452545329
eMolecules 519178-28-0 | Medchem Express | TNP | 5mg | 446259755 | HY-110079 | MFCD16875436 | 443.39 | C20H16F3N7O2
Medchem Express | TNP | 5mg | 446259755 | HY-110079 | 519178-28-0 | MFCD16875436 | 443.390 | C20H16F3N7O2
![eMolecules 357166-29-1 | Sodium (S)-2-(4-(2-(2-amino-4-oxo-4,7-dihydro-1H-pyrrolo[2,3-d]pyrimidin-5-yl)ethyl)benzamido)pentanedioate heptahydrate | 1g](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502135538.JPG-250.jpg)
eMolecules 357166-29-1 | Sodium (S)-2-(4-(2-(2-amino-4-oxo-4,7-dihydro-1H-pyrrolo[2,3-d]pyrimidin-5-yl)ethyl)benzamido)pentanedioate heptahydrate | 1g
2-Hexyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane | Ambeed | 86308-26-1 | MFCD08457665 | 212.140 | C12H25BO2 | 98.000 | CCCCCCB1OC(C)(C)C(C)(C)O1 | 25g | 589946779
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
Accela Chembio Inc 4-amino-2-chloro-5-fluoropyrimidine | 5g | 155-10-2 | MFCD00057344 | 97+% | Shelf Life: 1260 Days | Light Sensitive/n2/+4
4-amino-2-chloro-5-fluoropyrimidine | 5g | 155-10-2 | MFCD00057344 | 97+% | Shelf Life: 1260 Days | Light Sensitive/n2/+4
Aobchem Methyl 2-(3-ethoxy-2-fluorophenyl)-2-oxoacetate | 95% | C11H11FO4 | 500mg
Methyl 2-(3-ethoxy-2-fluorophenyl)-2-oxoacetate | 95% | C11H11FO4 | 500mg
eMolecules 1258652-66-2 | 8-(trifluoromethyl)quinazolin-2-amine | Broadpharm | MFCD18157724 | 213.163 | C9H6F3N3 | 97.000 | Nc1ncc2cccc(c2n1)C(F)(F)F | 1g | 112542062
8-(trifluoromethyl)quinazolin-2-amine | Broadpharm | 1258652-66-2 | MFCD18157724 | 213.163 | C9H6F3N3 | 97.000 | Nc1ncc2cccc(c2n1)C(F)(F)F | 1g | 112542062
Frontier Specialty Chemicals 25G 5-BROMO-2-HYDRAZINOPYRIDIN
5-Bromo-2-hydrazinopyridine; CAS No: 77992-44-0
eMolecules 3528-51-6 | 1-BENZYL-1H-PYRAZOL-5-AMINE | MFCD03596769 | 1g
Medchem Express | PF-915275 | 5mg | 446268868 | HY-18056 | 857290-04-1 | MFCD12828758 | 350.400 | C18H14N4O2S
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 343926-69-2 | 2-Amino-4-bromopyrimidine | Combi-Blocks | MFCD09999168 | 174.001 | C4H4BrN3 | 98.000 | Nc1nccc(Br)n1 | 1g | 205394924
2-Amino-4-bromopyrimidine | Combi-Blocks | 343926-69-2 | MFCD09999168 | 174.001 | C4H4BrN3 | 98.000 | Nc1nccc(Br)n1 | 1g | 205394924