Imidolactams
Aobchem Thianthrene-1-carbonitrile | 95% | CAS 349453-35-6 | C13H7NS2 | 500mg
Thianthrene-1-carbonitrile | 95% | CAS 349453-35-6 | C13H7NS2 | 500mg
Aobchem 2 2-Dichloro-1-(4-ethoxy-3-fluorophenyl)ethanol | 97% | CAS 2921719-92-6 | C10H11Cl2FO2 | 1g
2 2-Dichloro-1-(4-ethoxy-3-fluorophenyl)ethanol | 97% | CAS 2921719-92-6 | C10H11Cl2FO2 | 1g
Aobchem 2 2-Dichloro-1-(4-ethoxy-3-fluorophenyl)ethanol | 97% | CAS 2921719-92-6 | C10H11Cl2FO2 | 250mg
2 2-Dichloro-1-(4-ethoxy-3-fluorophenyl)ethanol | 97% | CAS 2921719-92-6 | C10H11Cl2FO2 | 250mg
Aobchem Ethyl 2-(3-ethoxy-2-methoxyphenyl)-2-oxoacetate | 95% | C13H16O5 | 1g
Ethyl 2-(3-ethoxy-2-methoxyphenyl)-2-oxoacetate | 95% | C13H16O5 | 1g
Aobchem 3-(5-Ethoxy-2-methylphenyl)oxetan-3-ol | 95% | C12H16O3 | 250mg
3-(5-Ethoxy-2-methylphenyl)oxetan-3-ol | 95% | C12H16O3 | 250mg
![eMolecules 64781-79-9 | 4-Methyl-1H-pyrazol-3-amine | Apollo Scientific | MFCD08272068 | 97.121 | C4H7N3 | 97.000 | Cc1c[nH]nc1N | 1g | 562427463](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502151948.JPG-250.jpg)
eMolecules 64781-79-9 | 4-Methyl-1H-pyrazol-3-amine | Apollo Scientific | MFCD08272068 | 97.121 | C4H7N3 | 97.000 | Cc1c[nH]nc1N | 1g | 562427463
4-Methyl-1H-pyrazol-3-amine | Apollo Scientific | 64781-79-9 | MFCD08272068 | 97.121 | C4H7N3 | 97.000 | Cc1c[nH]nc1N | 1g | 562427463
eMolecules 1128-56-9 | 1-phenyl-1H-pyrazol-3-amine | 5g
AstaTech | 1-(2-HYDROXYPHENYL)ETHANONE OXIME | 1g | 323619696 | W12757 | 95.000 | 1196-29-8 | MFCD09859620 | 151.165 | C8H9NO2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 133284-56-7 | 5-Methyl-1H-pyrazol-3-amine, HCl | MFCD04966843 | 1g
ChemScene | 55-Dimethyl-2-thioxoimidazolidin-4-one | 250mg | 536797121 | CS-0069194 | 15998-93-3 | MFCD24549235 | 144.190 | C5H8N2OS
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 1932297-00-1 | tert-butyl (3S,4R)-3-(aminomethyl)-4-hydroxypyrrolidine-1-carboxylate | MFCD20923565 | 1g
ChemScene | 2-(3-Chloro-5-(trifluoromethyl)pyridin-2-yl)ethan-1-amine hydrochloride | 250mg | 717420629 | CS-0469688 | 326816-37-9 | 261.070 | C8H9Cl2F3N2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
Chem-Impex International, Inc. Trimethoprim | 738-70-5 | MFCD00036761 | 250G
Trimethoprim, 738-70-5, MFCD00036761, 250G
Crescent Chemical Co Inc TRIMETHOPRIM RESEARCH GRADE
Trimethoprim research grade, Ph. Eur. Antibacterial substance; activity in vitro (1). Simultaneous detection with sulfamethazine by HPLC (2). Inhibitor of the bacterial enzyme dihydrofolate reductase. Size - 5G Storage Conditions - +2 °C TO +8 °C /
eMolecules 368869-92-5 | 2-Hydrazino-nicotinonitrile | Combi-Blocks | MFCD03086231 | 134.142 | C6H6N4 | 98.000 | NNc1ncccc1C#N | 1g | 232326801
2-Hydrazino-nicotinonitrile | Combi-Blocks | 368869-92-5 | MFCD03086231 | 134.142 | C6H6N4 | 98.000 | NNc1ncccc1C#N | 1g | 232326801
![eMolecules 78583-81-0 | 5-Amino-3-(4-chlorophenyl)pyrazole | Chem-Impex | MFCD11054282 | 193.630 | C9H8ClN3 | 98.000 | Nc1cc([nH]n1)-c1ccc(Cl)cc1 | 5g | 112761238](https://assets.fishersci.com/TFS-Assets/CCG/product-images/501716059.jpg-250.jpg)
eMolecules 78583-81-0 | 5-Amino-3-(4-chlorophenyl)pyrazole | Chem-Impex | MFCD11054282 | 193.630 | C9H8ClN3 | 98.000 | Nc1cc([nH]n1)-c1ccc(Cl)cc1 | 5g | 112761238
5-Amino-3-(4-chlorophenyl)pyrazole | Chem-Impex | 78583-81-0 | MFCD11054282 | 193.630 | C9H8ClN3 | 98.000 | Nc1cc([nH]n1)-c1ccc(Cl)cc1 | 5g | 112761238