Imidolactams
Aobchem Ethyl 4-ethoxy-2 5-dimethylbenzoate | 97% | CAS 1368217-60-0 | C13H18O3 | 250mg
Ethyl 4-ethoxy-2 5-dimethylbenzoate | 97% | CAS 1368217-60-0 | C13H18O3 | 250mg
Aobchem Methyl 2-ethoxy-5-isobutylbenzoate | 97% | CAS 2901086-47-1 | C14H20O3 | 500mg
Methyl 2-ethoxy-5-isobutylbenzoate | 97% | CAS 2901086-47-1 | C14H20O3 | 500mg
Aobchem 1 5-Dichloro-2-ethoxy-3-iodobenzene | 97% | CAS 876486-98-5 | C8H7Cl2IO | 500mg
1 5-Dichloro-2-ethoxy-3-iodobenzene | 97% | CAS 876486-98-5 | C8H7Cl2IO | 500mg
Aobchem Tert-butyl 5-ethoxy-2-methylbenzoate | 95% | C14H20O3 | 500mg
Tert-butyl 5-ethoxy-2-methylbenzoate | 95% | C14H20O3 | 500mg
Aobchem Tert-butyl 5-ethoxy-2-methylbenzoate | 95% | C14H20O3 | 250mg
Tert-butyl 5-ethoxy-2-methylbenzoate | 95% | C14H20O3 | 250mg
Aobchem 1-(3-Ethoxy-5-methylphenyl)propan-1-one | 95% | CAS 1804281-50-2 | C12H16O2 | 1g
1-(3-Ethoxy-5-methylphenyl)propan-1-one | 95% | CAS 1804281-50-2 | C12H16O2 | 1g
Aobchem 1-(3-Ethoxy-5-methylphenyl)-2 2-difluoroethanone | 95% | C11H12F2O2 | 500mg
1-(3-Ethoxy-5-methylphenyl)-2 2-difluoroethanone | 95% | C11H12F2O2 | 500mg
eMolecules 103286-54-0 | 3-Chloro-1H-pyrazol-4-amine | MFCD23701740 | 1g
Medchem Express | L-Serine-d3 | 5mg | 713707436 | HY-N0650S8 | 105591-10-4 | MFCD00144674 | 108.111 | C3H7NO3
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
Aobchem Methyl 2-(3-ethoxy-2-fluorophenyl)-2-oxoacetate | 95% | C11H11FO4 | 500mg
Methyl 2-(3-ethoxy-2-fluorophenyl)-2-oxoacetate | 95% | C11H11FO4 | 500mg
eMolecules 1258652-66-2 | 8-(trifluoromethyl)quinazolin-2-amine | Broadpharm | MFCD18157724 | 213.163 | C9H6F3N3 | 97.000 | Nc1ncc2cccc(c2n1)C(F)(F)F | 1g | 112542062
8-(trifluoromethyl)quinazolin-2-amine | Broadpharm | 1258652-66-2 | MFCD18157724 | 213.163 | C9H6F3N3 | 97.000 | Nc1ncc2cccc(c2n1)C(F)(F)F | 1g | 112542062
eMolecules 63589-18-4 | 2-Hydrazino-benzonitrile | Combi-Blocks | MFCD00120444 | 133.154 | C7H7N3 | 95.000 | NNc1ccccc1C#N | 1g | 439372895
2-Hydrazino-benzonitrile | Combi-Blocks | 63589-18-4 | MFCD00120444 | 133.154 | C7H7N3 | 95.000 | NNc1ccccc1C#N | 1g | 439372895
eMolecules 503089-88-1 | ChemScene | 4-Iodoisoquinolin-3-amine | 100mg | 633432976 | CS-0198221 | MFCD13193663 | 270.073 | C9H7IN2
ChemScene | 4-Iodoisoquinolin-3-amine | 100mg | 633432976 | CS-0198221 | 503089-88-1 | MFCD13193663 | 270.073 | C9H7IN2
eMolecules 1060804-39-8 | 3-Fluoro-5-nitropyridine | MFCD13189114 | 1g
Ambeed | 5-(4-Fluorophenyl)-1H-pyrazole-3-carbaldehyde | 100mg | 600850971 | A1363954 | 1107467-72-0 | MFCD10036215 | 190.177 | C10H7FN2O
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
Frontier Specialty Chemicals 25g, 5-Bromo-2-hydrazinopyridine, 98%, [77992-44-0], B1870 188.03 C5H6BrN3
Compound: 5-Bromo-2-hydrazinopyridine
CAS#: 77992-44-0
MDL#: MFCD00513424
Background: A brominated hydrazinopyridine used as an intermediate in pharmaceutical manufacturing for the synthesis of heterocyclic compounds. Its bromine and hydrazine functional groups make it valuable for complex organic synthesis, including the construction of fused heterocyclic ring systems.
Storage: Store at room temperature, under dry conditions.
eMolecules 3528-51-6 | 1-BENZYL-1H-PYRAZOL-5-AMINE | MFCD03596769 | 1g
Medchem Express | PF-915275 | 5mg | 446268868 | HY-18056 | 857290-04-1 | MFCD12828758 | 350.400 | C18H14N4O2S
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool