Oxacyclic compounds
Sigma Aldrich Fine Chemicals Biosciences 2-Ethyl-2-methyl-1,3-dioxolane 99% | 126-39-6 | MFCD00014108 | 250G
2-Ethyl-2-methyl-1,3-dioxolane 99% | Purity: 99% | Mol Wt: 116.16 | 126-39-6 | MFCD00014108 | 250G
eMolecules 2-Amino-5-phenyl-3-furonitrile | 14742-32-6 | 1G | Purity: 95%
Combi-Blocks | 2-Amino-5-phenyl-3-furonitrile | 1G | 14742-32-6 | MFCD00463472
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 201733-56-4 | Bis(neopentyl glycolato)diboron | Combi-Blocks | MFCD02093062 | 225.89 | C10H20B2O4 | 98 | CC1(C)COB(OC1)B1OCC(C)(C)CO1 | 500g | 296389764
ChemScene | Benzyl (cyanomethyl)carbamate | 250mg | 714110184 | CS-0129441 | 3589-41-1 | MFCD00033175 | 190.202 | C10H10N2O2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 4252-78-2 | 2,2??,4??-Trichloroacetophenone | Ambeed | MFCD00000934 | 223.480 | C8H5Cl3O | 98.000 | ClCC(=O)c1ccc(Cl)cc1Cl | 100g | 525242640
2,2??,4??-Trichloroacetophenone | Ambeed | 4252-78-2 | MFCD00000934 | 223.480 | C8H5Cl3O | 98.000 | ClCC(=O)c1ccc(Cl)cc1Cl | 100g | 525242640
eMolecules 19814-75-6 | 9,9-Dimethyl-9H-xanthene | Ambeed | MFCD00134434 | 210.276 | C15H14O | 98.000 | CC1(C)c2ccccc2Oc2ccccc12 | 100g | 552725258
9,9-Dimethyl-9H-xanthene | Ambeed | 19814-75-6 | MFCD00134434 | 210.276 | C15H14O | 98.000 | CC1(C)c2ccccc2Oc2ccccc12 | 100g | 552725258
Chem-Impex International, Inc. 2,3-Dimethylmaleic anhydride | 766-39-2 | MFCD00005523 | 5G
2,3-Dimethylmaleic anhydride, 766-39-2, MFCD00005523, 5G
eMolecules 855948-13-9 | 2-(2-Furyl)aniline hydrochloride | Combi-Blocks | MFCD08445548 | 195.650 | C10H10ClNO | 98.000 | Cl.Nc1ccccc1-c1ccco1 | 1g | 232329508
2-(2-Furyl)aniline hydrochloride | Combi-Blocks | 855948-13-9 | MFCD08445548 | 195.650 | C10H10ClNO | 98.000 | Cl.Nc1ccccc1-c1ccco1 | 1g | 232329508
eMolecules 201733-56-4 | Bis(neopentyl glycolato)diboron | Ambeed | MFCD02093062 | 225.89 | C10H20B2O4 | 98 | CC1(C)COB(OC1)B1OCC(C)(C)CO1 | 100g | 552646005
ChemScene | 1-(4-Chloro-26-dimethylphenyl)ethanone | 250mg | 714105559 | CS-0514401 | 35887-71-9 | MFCD11846955 | 182.650 | C10H11ClO
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
![eMolecules Naphtho[2,3-c]furan-1,3-dione | 716-39-2 | MFCD00059091 | 1g](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502169898.JPG-250.jpg)
eMolecules Naphtho[2,3-c]furan-1,3-dione | 716-39-2 | MFCD00059091 | 1g
Matrix Scientific | Naphtho[2,3-c]furan-1,3-dione | 1g | 397231713 | 93869 | 95.000 | 716-39-2 | MFCD00059091 | 198.177 | C12H6O3
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 321392-79-4 | ChemScene | 3-(3-Methyl-124-oxadiazol-5-yl)propanoic acid | 100mg | 654767826 | CS-0215667 | MFCD09040566 | 156.141 | C6H8N2O3
Medchem Express | Oglemilast | 5mg | 446265090 | HY-15178 | 778576-62-8 | MFCD18633298 | 516.300 | C20H13Cl2F2N3O5S
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 52817-13-7 | 6-Bromo-3-cyanochromone | Chem-Impex | MFCD00191842 | 250.051 | C10H4BrNO2 | 99.000 | Brc1ccc2occ(C#N)c(=O)c2c1 | 1g | 386900138
6-Bromo-3-cyanochromone | Chem-Impex | 52817-13-7 | MFCD00191842 | 250.051 | C10H4BrNO2 | 99.000 | Brc1ccc2occ(C#N)c(=O)c2c1 | 1g | 386900138
Chem-Impex International, Inc. 6-Chlorochromone-2-carboxylic acid | MFCD00847039 | 1G
6-Chlorochromone-2-carboxylic acid, MFCD00847039, 1G
eMolecules 845457-55-8 | (3-METHYLBENZOFURAN-2-YL)BORONIC ACID | AstaTech | MFCD18383018 | 175.980 | C9H9BO3 | 95.000 | Cc1c(oc2ccccc12)B(O)O | 0.25g | 386413437
(3-METHYLBENZOFURAN-2-YL)BORONIC ACID | AstaTech | 845457-55-8 | MFCD18383018 | 175.980 | C9H9BO3 | 95.000 | Cc1c(oc2ccccc12)B(O)O | 0.25g | 386413437
eMolecules 7169-34-8 | Ambeed | Benzofuran-3(2H)-one | 1g | 552615900 | A173791 | MFCD00051810 | 134.134 | C8H6O2
Ambeed | Benzofuran-3(2H)-one | 1g | 552615900 | A173791 | 7169-34-8 | MFCD00051810 | 134.134 | C8H6O2
eMolecules 2376634-13-6 | 9-BENZYL-9H-XANTHENE-9-CARBOXYLIC ACID | AstaTech316.356 | C21H16O3 | 95.000 | OC(=O)C1(Cc2ccccc2)c2ccccc2Oc2ccccc12 | 0.25g | 455937342
9-BENZYL-9H-XANTHENE-9-CARBOXYLIC ACID | AstaTech | 2376634-13-6316.356 | C21H16O3 | 95.000 | OC(=O)C1(Cc2ccccc2)c2ccccc2Oc2ccccc12 | 0.25g | 455937342