Oxanes
Accela Chembio Inc Tetrahydropyran-4-methanol | 5g | 14774-37-9 | MFCD00457804 | 98% | Shelf Life: 1620 Days | Light Sensitive
Tetrahydropyran-4-methanol | 5g | 14774-37-9 | MFCD00457804 | 98% | Shelf Life: 1620 Days | Light Sensitive
Sigma Aldrich Fine Chemicals Biosciences 2-(3-Butynyloxy)tetrahydro-2H-pyran 97% | 40365-61-5 | MFCD00012352 | 5G
2-(3-Butynyloxy)tetrahydro-2H-pyran 97% | Purity: 97% | Mol Wt: 154.21 | 40365-61-5 | MFCD00012352 | 5G
![eMolecules 1219168-18-9 | Ambeed | 6-(4-(2-(Piperidin-1-yl)ethoxy)phenyl)-3-(pyridin-4-yl)pyrazolo[15-a]pyrimidine dihydrochloride | 5mg | 525128250 | A213616 | MFCD11112197 | 472.41 | C24H27Cl2N5O](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502432870.PNG-250.jpg)
eMolecules 1219168-18-9 | Ambeed | 6-(4-(2-(Piperidin-1-yl)ethoxy)phenyl)-3-(pyridin-4-yl)pyrazolo[15-a]pyrimidine dihydrochloride | 5mg | 525128250 | A213616 | MFCD11112197 | 472.41 | C24H27Cl2N5O
ChemScene | 6-Chloro-8-(trifluoromethyl)chroman-4-one | 100mg | 687356413 | CS-0196694 | 1344889-75-3 | MFCD21359512 | 250.600 | C10H6ClF3O2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
![eMolecules 1280214-48-3 | 5-{[(2-methylprop-2-yl)oxy]carbonyl}-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine-3-carboxylic acid | Abosyn Chemicals Inc. | MFCD22571359 | 267.285 | C12H17N3O4 | 0.000 | CC(C)(C)OC(=O)N1CCn2ncc(C(O)=O)c2C1 | 10g | 859371579](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000472624.jpg-250.jpg)
eMolecules 1280214-48-3 | 5-{[(2-methylprop-2-yl)oxy]carbonyl}-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine-3-carboxylic acid | Abosyn Chemicals Inc. | MFCD22571359 | 267.285 | C12H17N3O4 | 0.000 | CC(C)(C)OC(=O)N1CCn2ncc(C(O)=O)c2C1 | 10g | 859371579
5-{[(2-methylprop-2-yl)oxy]carbonyl}-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine-3-carboxylic acid | Abosyn Chemicals Inc. | 1280214-48-3 | MFCD22571359 | 267.285 | C12H17N3O4 | 0.000 | CC(C)(C)OC(=O)N1CCn2ncc(C(O)=O)c2C1 | 10g | 859371579
eMolecules 32776-21-9 | N-Ethyl-2-piperidin-1-ylethanamine | Combi-Blocks, Inc. | MFCD08361609 | 156.273 | C9H20N2 | 95.000 | CCNCCN1CCCCC1 | 1g | 603144213
N-Ethyl-2-piperidin-1-ylethanamine | Combi-Blocks, Inc. | 32776-21-9 | MFCD08361609 | 156.273 | C9H20N2 | 95.000 | CCNCCN1CCCCC1 | 1g | 603144213
Chem-Impex International, Inc. 4-Bromotetrahydropyran | 25637-16-5 | MFCD07371501 | 1G
4-Bromotetrahydropyran, 25637-16-5, MFCD07371501, 1G
![eMolecules 1251925-31-1 | 2-METHYL-5,6,7,8-TETRAHYDRO-[1,2,4]TRIAZOLO[1,5-A]PYRIDIN-6-AMINE | AstaTech | MFCD16817413 | 152.201 | C7H12N4 | 95.000 | Cc1nc2CCC(N)Cn2n1 | 0.1g | 718056288](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502472427.JPG-250.jpg)
eMolecules 1251925-31-1 | 2-METHYL-5,6,7,8-TETRAHYDRO-[1,2,4]TRIAZOLO[1,5-A]PYRIDIN-6-AMINE | AstaTech | MFCD16817413 | 152.201 | C7H12N4 | 95.000 | Cc1nc2CCC(N)Cn2n1 | 0.1g | 718056288
2-METHYL-5,6,7,8-TETRAHYDRO-[1,2,4]TRIAZOLO[1,5-A]PYRIDIN-6-AMINE | AstaTech | 1251925-31-1 | MFCD16817413 | 152.201 | C7H12N4 | 95.000 | Cc1nc2CCC(N)Cn2n1 | 0.1g | 718056288
Accela Chembio Inc Tetrahydropyran-4-carboxylic Acid | 25g | 5337-03-1 | MFCD00031016 | 98% | Shelf Life: 1260 Days | Regular
Tetrahydropyran-4-carboxylic Acid | 25g | 5337-03-1 | MFCD00031016 | 98% | Shelf Life: 1260 Days | Regular
C1CCOCC1 | 1g | 213335521](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502199179.JPG-250.jpg)
eMolecules 1269754-98-4 | (S)-1-(TETRAHYDRO-2H-PYRAN-4-YL)ETHANAMINE | AstaTech | MFCD20921647 | 129.203 | C7H15NO | 97.000 | C[C@H](N)C1CCOCC1 | 1g | 213335521
(S)-1-(TETRAHYDRO-2H-PYRAN-4-YL)ETHANAMINE | AstaTech | 1269754-98-4 | MFCD20921647 | 129.203 | C7H15NO | 97.000 | C[C@H](N)C1CCOCC1 | 1g | 213335521
Accela Chembio Inc 2-(tetrahydropyran-4-yloxy)aniline | 0.25g | 898289-35-5 | MFCD09025872 | 96% | Shelf Life: 2160 Days | Light Sensitive/n2/+4
2-(tetrahydropyran-4-yloxy)aniline | 0.25g | 898289-35-5 | MFCD09025872 | 96% | Shelf Life: 2160 Days | Light Sensitive/n2/+4
eMolecules 1157012-67-3 | 1-(Tetrahydro-2H-pyran-4-yl)-1H-pyrazol-5-amine | MFCD12087781 | 100mg
Medchem Express | GLPG0492 | 5mg | 446268903 | HY-18102 | 1215085-92-9 | MFCD25976946 | 389.334 | C19H14F3N3O3
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
![eMolecules 196597-26-9 | Ramelteon | Ambeed | MFCD08067736 | 259.349 | C16H21NO2 | 98.000 | CCC(=O)NCC[C@@H]1CCc2ccc3OCCc3c12 | 1mg | 490561289](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502431843.PNG-250.jpg)
eMolecules 196597-26-9 | Ramelteon | Ambeed | MFCD08067736 | 259.349 | C16H21NO2 | 98.000 | CCC(=O)NCC[C@@H]1CCc2ccc3OCCc3c12 | 1mg | 490561289
Ramelteon | Ambeed | 196597-26-9 | MFCD08067736 | 259.349 | C16H21NO2 | 98.000 | CCC(=O)NCC[C@@H]1CCc2ccc3OCCc3c12 | 1mg | 490561289