Oxanes
Accela Chembio Inc Tetrahydropyran-4-methanol | 1g | 14774-37-9 | MFCD00457804 | 98% | Shelf Life: 1620 Days | Light Sensitive
Tetrahydropyran-4-methanol | 1g | 14774-37-9 | MFCD00457804 | 98% | Shelf Life: 1620 Days | Light Sensitive
Aobchem 1-(4-(Oxetan-3-yloxy)phenyl)ethanone | ≥95% | CAS 1601779-56-9 | C11H12O3 | 1g
1-(4-(Oxetan-3-yloxy)phenyl)ethanone | ≥95% | CAS 1601779-56-9 | C11H12O3 | 1g
eMolecules 173206-13-8 | Ambeed | 45-Dichloro-2-(tetrahydro-2H-pyran-2-yl)pyridazin-3(2H)-one | 250mg | 600843920 | A601180 | MFCD14706897 | 249.09 | C9H10Cl2N2O2
Medchem Express | 13-cis-N-[4-(Ethoxycarbonyl)phenyl]retinamide | 5mg | 446260110 | HY-112077 | 251441-94-8 | 447.619 | C29H37NO3
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
Pfaltz & Bauer 3-O-Methyl-D-Glucopyranose 1G | 13224-94-7
3-O-Methyl-D-Glucopyranose 1G | 13224-94-7
![eMolecules 787618-22-8 | [2',6'-bis(propan-2-yloxy)-[1,1'-biphenyl]-3-yl]dicyclohexylphosphane | Pharmablock | MFCD06798294 | 466.646 | C30H43O2PCC(C)Oc1cccc(OC(C)C)c1-c1ccccc1P(C1CCCCC1)C1CCCCC1 | 2.5g | 686927223](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000472230.jpg-250.jpg)
eMolecules 787618-22-8 | [2',6'-bis(propan-2-yloxy)-[1,1'-biphenyl]-3-yl]dicyclohexylphosphane | Pharmablock | MFCD06798294 | 466.646 | C30H43O2PCC(C)Oc1cccc(OC(C)C)c1-c1ccccc1P(C1CCCCC1)C1CCCCC1 | 2.5g | 686927223
[2',6'-bis(propan-2-yloxy)-[1,1'-biphenyl]-3-yl]dicyclohexylphosphane | Pharmablock | 787618-22-8 | MFCD06798294 | 466.646 | C30H43O2PCC(C)Oc1cccc(OC(C)C)c1-c1ccccc1P(C1CCCCC1)C1CCCCC1 | 2.5g | 686927223
Aobchem (2-Propan-2-yloxy)pyridine-4-carboxylic acid | ≥97% | CAS 862507-33-3 | C9H11NO3 | 5g
(2-Propan-2-yloxy)pyridine-4-carboxylic acid | ≥97% | CAS 862507-33-3 | C9H11NO3 | 5g
Aobchem (2-Propan-2-yloxy)pyridine-4-carboxylic acid | ≥97% | CAS 862507-33-3 | C9H11NO3 | 250mg
(2-Propan-2-yloxy)pyridine-4-carboxylic acid | ≥97% | CAS 862507-33-3 | C9H11NO3 | 250mg
Aobchem (2-Propan-2-yloxy)pyridine-4-carboxylic acid | ≥97% | CAS 862507-33-3 | C9H11NO3 | 1g
(2-Propan-2-yloxy)pyridine-4-carboxylic acid | ≥97% | CAS 862507-33-3 | C9H11NO3 | 1g
Chem-Impex International, Inc. 4-Bromotetrahydropyran | 25637-16-5 | MFCD07371501 | 1G
4-Bromotetrahydropyran, 25637-16-5, MFCD07371501, 1G
eMolecules 1363404-80-1 | 1-(Tetrahydro-2H-pyran-4-yl)ethanamine hydrochloride | ChemScene | MFCD21607254 | 165.660 | C7H16ClNO | 97.000 | Cl.CC(N)C1CCOCC1 | 100mg | 687356445
1-(Tetrahydro-2H-pyran-4-yl)ethanamine hydrochloride | ChemScene | 1363404-80-1 | MFCD21607254 | 165.660 | C7H16ClNO | 97.000 | Cl.CC(N)C1CCOCC1 | 100mg | 687356445
Accela Chembio Inc MF: C5H10O2 | MW: 102.13 | >97% | BP: 183? at 760 mmHg | Density: 1.071.
MF: C5H10O2 | MW: 102.13 | >97% | BP: 183? at 760 mmHg | Density: 1.071.
eMolecules 1220635-60-8 | 1-((tetrahydro-2H-pyran-4-yl)methyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole | MFCD18383250 | 1g
Pharmablock | 3-bromo-2-methoxypyridine | 100mg | 551072203 | PB03777 | 13472-59-8 | MFCD03095349 | 188.024 | C6H6BrNO
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
Aobchem 5-Bromo-2-(oxetan-3-yloxy)pyridine | ≥95% | CAS 1600912-06-8 | C8H8BrNO2 | 5g
5-Bromo-2-(oxetan-3-yloxy)pyridine | ≥95% | CAS 1600912-06-8 | C8H8BrNO2 | 5g
Frontier Specialty Chemicals 5G TETRAHYDRO-2H-PYRAN-4-CARBO
Tetrahydro-2H-pyran-4-carboxamide; CAS: 344329-76-6; 5g