Oxazinanes
Aobchem (5-Ethylbenzofuran-2-yl)boronic acid | 97% | CAS 1450790-30-3 | C10H11BO3 | 1g
(5-Ethylbenzofuran-2-yl)boronic acid | 97% | CAS 1450790-30-3 | C10H11BO3 | 1g
![eMolecules 132073-83-7 | (S)-Morpholin-2-ylmethanol | Combi-Blocks, Inc. | MFCD09260718 | 117.148 | C5H11NO2 | 95.000 | OC[C@@H]1CNCCO1 | 25g | 866383955](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000163148.jpg-250.jpg)
eMolecules 132073-83-7 | (S)-Morpholin-2-ylmethanol | Combi-Blocks, Inc. | MFCD09260718 | 117.148 | C5H11NO2 | 95.000 | OC[C@@H]1CNCCO1 | 25g | 866383955
(S)-Morpholin-2-ylmethanol | Combi-Blocks, Inc. | 132073-83-7 | MFCD09260718 | 117.148 | C5H11NO2 | 95.000 | OC[C@@H]1CNCCO1 | 25g | 866383955
eMolecules 163105-89-3 | 2-Methoxypyridine-5-boronic acid | Synthonix - Stock | MFCD02093044 | 152.940 | C6H8BNO3 | 97.000 | COc1ccc(cn1)B(O)O | 25g | 525921205
2-Methoxypyridine-5-boronic acid | Synthonix - Stock | 163105-89-3 | MFCD02093044 | 152.940 | C6H8BNO3 | 97.000 | COc1ccc(cn1)B(O)O | 25g | 525921205
eMolecules 163105-89-3 | 6-Methoxy-pyridine-3-boronic acid | J & W PharmLab LLC | MFCD02093044 | 152.940 | C6H8BNO3 | 96.000 | COc1ccc(cn1)B(O)O | 1g | 525294268
6-Methoxy-pyridine-3-boronic acid | J & W PharmLab LLC | 163105-89-3 | MFCD02093044 | 152.940 | C6H8BNO3 | 96.000 | COc1ccc(cn1)B(O)O | 1g | 525294268
![eMolecules 132073-83-7 | (S)-MORPHOLIN-2-YLMETHANOL | AstaTech | MFCD09260718 | 117.148 | C5H11NO2 | 95.000 | OC[C@@H]1CNCCO1 | 1g | 449764029](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000162821.jpg-250.jpg)
eMolecules 132073-83-7 | (S)-MORPHOLIN-2-YLMETHANOL | AstaTech | MFCD09260718 | 117.148 | C5H11NO2 | 95.000 | OC[C@@H]1CNCCO1 | 1g | 449764029
(S)-MORPHOLIN-2-YLMETHANOL | AstaTech | 132073-83-7 | MFCD09260718 | 117.148 | C5H11NO2 | 95.000 | OC[C@@H]1CNCCO1 | 1g | 449764029
eMolecules 41458-73-5 | 2-Methylamino-1-morpholin-4-yl-ethanone hydrochloride | Oakwood Chemical | MFCD08060102 | 194.660 | C7H15ClN2O2 | 98.000 | Cl.CNCC(=O)N1CCOCC1 | 250mg | 537682619
2-Methylamino-1-morpholin-4-yl-ethanone hydrochloride | Oakwood Chemical | 41458-73-5 | MFCD08060102 | 194.660 | C7H15ClN2O2 | 98.000 | Cl.CNCC(=O)N1CCOCC1 | 250mg | 537682619
Aobchem 2 2 2-Trifluoro-1-(4-morpholinophenyl)ethanone | ≥97% | CAS 70783-44-7 | C12H12F3NO2 | 500mg
2 2 2-Trifluoro-1-(4-morpholinophenyl)ethanone | ≥97% | CAS 70783-44-7 | C12H12F3NO2 | 500mg
Aobchem 1-(3-Cyclobutylphenyl)ethanone | 95% | CAS 936249-92-2 | C12H14O | 1g
1-(3-Cyclobutylphenyl)ethanone | 95% | CAS 936249-92-2 | C12H14O | 1g
Aobchem Ethanone 1-(2-fluoro-4-phenoxyphenyl)- | 97% | CAS 1055973-99-3 | C14H11FO2 | 500mg
Ethanone 1-(2-fluoro-4-phenoxyphenyl)- | 97% | CAS 1055973-99-3 | C14H11FO2 | 500mg
c1ccccc1 | 250mg | 517669112](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000129558.jpg-250.jpg)
eMolecules 1225376-02-2 | (R)-2-Phenylmorpholine | J & W PharmLab LLC | MFCD18249849 | 163.220 | C10H13NO | 96.000 | C1CO[C@@H](CN1)c1ccccc1 | 250mg | 517669112
(R)-2-Phenylmorpholine | J & W PharmLab LLC | 1225376-02-2 | MFCD18249849 | 163.220 | C10H13NO | 96.000 | C1CO[C@@H](CN1)c1ccccc1 | 250mg | 517669112
eMolecules 1225376-02-2 | (R)-2-PHENYLMORPHOLINE | MFCD18249849 | 1g
AstaTech | 2-AMINO-35-DIIODO-4-METHYL-PYRIDINE | 0.25g | 388700728 | 22789 | 90.000 | 1353101-03-7 | MFCD21090429 | 359.937 | C6H6I2N2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 1624261-27-3 | ChemScene | (R)-3-Phenylmorpholine hydrochloride | 100mg | 633433215 | CS-0198261 | MFCD12910599 | 199.68 | C10H14ClNO
Medchem Express | BAY 2666605 | 5mg | 713706886 | HY-145924 | 2275774-60-0 | 352.289 | C17H12F4N2O2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
![eMolecules 366789-02-8 | Rivaroxaban | Ambeed | MFCD11974010 | 435.88 | C19H18ClN3O5S | 98 | Clc1ccc(s1)C(=O)NC[C@H]1CN(C(=O)O1)c1ccc(cc1)N1CCOCC1=O | 1g | 525213664](https://assets.fishersci.com/TFS-Assets/CCG/product-images/NC2228454.JPG-250.jpg)
eMolecules 366789-02-8 | Rivaroxaban | Ambeed | MFCD11974010 | 435.88 | C19H18ClN3O5S | 98 | Clc1ccc(s1)C(=O)NC[C@H]1CN(C(=O)O1)c1ccc(cc1)N1CCOCC1=O | 1g | 525213664
Ambeed | 3-Cyclopropyl-1-(2-fluoro-4-iodophenyl)-6-(methylamino)pyrimidine-24(1H3H)-dione | 250mg | 525031551 | A128495 | 871700-22-0 | MFCD18207184 | 401.180 | C14H13FIN3O2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
Accela Chembio Inc 3-morpholinoaniline | 25g | 159724-40-0 | MFCD03197165 | 97+% | Shelf Life: 1800 Days | Light Sensitive/+4
3-morpholinoaniline | 25g | 159724-40-0 | MFCD03197165 | 97+% | Shelf Life: 1800 Days | Light Sensitive/+4