Oxazinanes
Aobchem (1-Cyanonaphthalen-2-yl)boronic acid | 95% | C11H8BNO2 | 500mg
(1-Cyanonaphthalen-2-yl)boronic acid | 95% | C11H8BNO2 | 500mg
Aobchem 7-Methoxy-1H-indazole-4-boronic acid pinacol ester | ≥97% | CAS 1186422-15-0 | C14H19BN2O3 | 1g
7-Methoxy-1H-indazole-4-boronic acid pinacol ester | ≥97% | CAS 1186422-15-0 | C14H19BN2O3 | 1g
eMolecules 132073-83-7 | (S)-Morpholin-2-ylmethanol | Ambeed | MFCD09260718 | 117.148 | C5H11NO2 | 95.000 | OC[C@@H]1CNCCO1 | 1g | 572955357
(S)-Morpholin-2-ylmethanol | Ambeed | 132073-83-7 | MFCD09260718 | 117.148 | C5H11NO2 | 95.000 | OC[C@@H]1CNCCO1 | 1g | 572955357
Aobchem 1-(3-Propylphenyl)ethanone | 95% | CAS 717918-70-2 | C11H14O | 1g
1-(3-Propylphenyl)ethanone | 95% | CAS 717918-70-2 | C11H14O | 1g
eMolecules 163105-90-6 | 2-Methoxypyridine-3-boronic acid | Ambeed | MFCD03411572 | 152.940 | C6H8BNO3 | 98.000 | COc1ncccc1B(O)O | 25g | 570567815
2-Methoxypyridine-3-boronic acid | Ambeed | 163105-90-6 | MFCD03411572 | 152.940 | C6H8BNO3 | 98.000 | COc1ncccc1B(O)O | 25g | 570567815
Accela Chembio Inc 2-morpholinobenzaldehyde | 25g | 58028-76-5 | MFCD00662562 | 97+% | Shelf Life: 1080 Days | Light Sensitive
2-morpholinobenzaldehyde | 25g | 58028-76-5 | MFCD00662562 | 97+% | Shelf Life: 1080 Days | Light Sensitive
Aobchem 2 2 2-Trifluoro-1-(4-morpholinophenyl)ethanone | ≥97% | CAS 70783-44-7 | C12H12F3NO2 | 250mg
2 2 2-Trifluoro-1-(4-morpholinophenyl)ethanone | ≥97% | CAS 70783-44-7 | C12H12F3NO2 | 250mg
Aobchem 1-(3-Cyclobutylphenyl)ethanone | 95% | CAS 936249-92-2 | C12H14O | 1g
1-(3-Cyclobutylphenyl)ethanone | 95% | CAS 936249-92-2 | C12H14O | 1g
eMolecules 163105-90-6 | 2-Methoxypyridine-3-boronic acid | Ambeed | MFCD03411572 | 152.940 | C6H8BNO3 | 98.000 | COc1ncccc1B(O)O | 100g | 570567816
2-Methoxypyridine-3-boronic acid | Ambeed | 163105-90-6 | MFCD03411572 | 152.940 | C6H8BNO3 | 98.000 | COc1ncccc1B(O)O | 100g | 570567816
c1ccccc1 | 250mg | 517669112](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000129558.jpg-250.jpg)
eMolecules 1225376-02-2 | (R)-2-Phenylmorpholine | J & W PharmLab LLC | MFCD18249849 | 163.220 | C10H13NO | 96.000 | C1CO[C@@H](CN1)c1ccccc1 | 250mg | 517669112
(R)-2-Phenylmorpholine | J & W PharmLab LLC | 1225376-02-2 | MFCD18249849 | 163.220 | C10H13NO | 96.000 | C1CO[C@@H](CN1)c1ccccc1 | 250mg | 517669112
eMolecules 1624261-27-3 | ChemScene | (R)-3-Phenylmorpholine hydrochloride | 100mg | 633433215 | CS-0198261 | MFCD12910599 | 199.68 | C10H14ClNO
Medchem Express | BAY 2666605 | 5mg | 713706886 | HY-145924 | 2275774-60-0 | 352.289 | C17H12F4N2O2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
Medchemexpress LLC Rhodamine B isothiocyanate | 36877-69-7 | 95.7% | 536.09 | 10 MG
Rhodamine B isothiocyanate (RBITC) is a fluorescent dye used in biological imaging and labeling applications. It features an isothiocyanate functional group that allows for covalent attachment to amino groups on proteins and other biomolecules. This makes it suitable for fluorescent labeling of cells and tissues.
- Emits a bright orange-red fluorescence when excited by green light.
- Facilitates the detection and tracking of labeled molecules within complex samples.
- Offers stability and sensitivity, making it useful in cell biology, immunology, and neurobiology.
- Can be utilized as a biochemical reagent for life science-related research.
eMolecules 1216845-47-4 | 2-Morpholin-4-ylmethyl-1H-benzoimidazol-5-ylamine dihydrochloride | Oakwood Chemicals304.200 | C12H17Cl2N4O | 0.000 | Cl.Cl.Nc1ccc2nc(CN3CCOCC3)nc2c1 | 100mg | 480129187
2-Morpholin-4-ylmethyl-1H-benzoimidazol-5-ylamine dihydrochloride | Oakwood Chemicals | 1216845-47-4304.200 | C12H17Cl2N4O | 0.000 | Cl.Cl.Nc1ccc2nc(CN3CCOCC3)nc2c1 | 100mg | 480129187