Pyrans
FUJIFILM BIOSCIENCES INC Y-27632 MF
Y-27632 is reagent for cell culture applications including human ES/iPS cell culture It is a selective and potent inhibitor of ROCK Rho-associated coiled-coil forming kinase/Rho binding kinase Y-27632 has a variety of activities including vascular smooth muscle contraction through the ROCK signaling Ki 140 nmol/L p160ROCK This product has been reported to suppress death of human ES cells and human iPS cells at the time of cell dispersion and also improve viability of the cells after cryopreservation
eMolecules 5337-03-1 | Tetrahydropyran-4-yl-carboxylic acid | Ambeed | MFCD00031016 | 130.143 | C6H10O3 | 97.000 | OC(=O)C1CCOCC1 | 100g | 552535012
Tetrahydropyran-4-yl-carboxylic acid | Ambeed | 5337-03-1 | MFCD00031016 | 130.143 | C6H10O3 | 97.000 | OC(=O)C1CCOCC1 | 100g | 552535012
eMolecules 1131912-76-9 | Tetrahydropyran-4-boronic acid pinacol ester | Chem-Impex | MFCD11506065 | 212.100 | C11H21BO3 | 97.000 | CC1(C)OB(OC1(C)C)C1CCOCC1 | 100mg | 112760260
Tetrahydropyran-4-boronic acid pinacol ester | Chem-Impex | 1131912-76-9 | MFCD11506065 | 212.100 | C11H21BO3 | 97.000 | CC1(C)OB(OC1(C)C)C1CCOCC1 | 100mg | 112760260
eMolecules 29943-42-8 | Tetrahydro-4H-pyran-4-one | Advanced ChemBlocks | MFCD00006581 | 100.117 | C5H8O2 | 97.000 | O=C1CCOCC1 | 100g | 112238685
Tetrahydro-4H-pyran-4-one | Advanced ChemBlocks | 29943-42-8 | MFCD00006581 | 100.117 | C5H8O2 | 97.000 | O=C1CCOCC1 | 100g | 112238685
eMolecules 38041-19-9 | 4-Aminotetrahydro-2H-pyran | Apollo Scientific | MFCD02179436 | 101.149 | C5H11NO | 95.000 | NC1CCOCC1 | 5g | 600854824
4-Aminotetrahydro-2H-pyran | Apollo Scientific | 38041-19-9 | MFCD02179436 | 101.149 | C5H11NO | 95.000 | NC1CCOCC1 | 5g | 600854824
eMolecules 287944-16-5 | 3,6-Dihydro-2H-pyran-4-boronic acid pinacol ester | Combi-Blocks | MFCD11052631 | 210.080 | C11H19BO3 | 95.000 | CC1(C)OB(OC1(C)C)C1=CCOCC1 | 5g | 117545681
3,6-Dihydro-2H-pyran-4-boronic acid pinacol ester | Combi-Blocks | 287944-16-5 | MFCD11052631 | 210.080 | C11H19BO3 | 95.000 | CC1(C)OB(OC1(C)C)C1=CCOCC1 | 5g | 117545681
eMolecules 287944-16-5 | (3,6-DIHYDRO-2H-PYRAN-4-YL)BORONIC ACID PINACOL ESTER | AstaTech | MFCD11052631 | 210.080 | C11H19BO3 | 95.000 | CC1(C)OB(OC1(C)C)C1=CCOCC1 | 5g | 213339125
(3,6-DIHYDRO-2H-PYRAN-4-YL)BORONIC ACID PINACOL ESTER | AstaTech | 287944-16-5 | MFCD11052631 | 210.080 | C11H19BO3 | 95.000 | CC1(C)OB(OC1(C)C)C1=CCOCC1 | 5g | 213339125
eMolecules 287944-16-5 | 3,6-Dihydro-2H-pyran-4-boronic acid, pinacol ester | Apollo Scientific | MFCD11052631 | 210.080 | C11H19BO3 | 98.000 | CC1(C)OB(OC1(C)C)C1=CCOCC1 | 1g | 600856054
3,6-Dihydro-2H-pyran-4-boronic acid, pinacol ester | Apollo Scientific | 287944-16-5 | MFCD11052631 | 210.080 | C11H19BO3 | 98.000 | CC1(C)OB(OC1(C)C)C1=CCOCC1 | 1g | 600856054
eMolecules 287944-16-5 | 3,6-Dihydro-2H-pyran-4-boronic Acid Pinacol Ester | Accela ChemBio (ASD) | MFCD11052631 | 210.080 | C11H19BO3 | 97.000 | CC1(C)OB(OC1(C)C)C1=CCOCC1 | 25g | 448670179
3,6-Dihydro-2H-pyran-4-boronic Acid Pinacol Ester | Accela ChemBio (ASD) | 287944-16-5 | MFCD11052631 | 210.080 | C11H19BO3 | 97.000 | CC1(C)OB(OC1(C)C)C1=CCOCC1 | 25g | 448670179
eMolecules 25637-16-5 | 4-Bromotetrahydro-2H-pyran | Apollo Scientific US - Building Blocks | MFCD07371501 | 165.030 | C5H9BrO | 97.000 | BrC1CCOCC1 | 5g | 485181052
4-Bromotetrahydro-2H-pyran | Apollo Scientific US - Building Blocks | 25637-16-5 | MFCD07371501 | 165.030 | C5H9BrO | 97.000 | BrC1CCOCC1 | 5g | 485181052
eMolecules 188975-30-6 | 3,6-Dihydro-2H-pyran-4-yl trifluoromethanesulfonate | ChemScene | MFCD09997709 | 232.170 | C6H7F3O4S | 96.000 | FC(F)(F)S(=O)(=O)OC1=CCOCC1 | 5g | 572219356
3,6-Dihydro-2H-pyran-4-yl trifluoromethanesulfonate | ChemScene | 188975-30-6 | MFCD09997709 | 232.170 | C6H7F3O4S | 96.000 | FC(F)(F)S(=O)(=O)OC1=CCOCC1 | 5g | 572219356
OCC2c3ccccc3-c3ccccc23)C(O)=O)cc1 | 100g | 837472693](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000188823.jpg-250.jpg)
eMolecules 183070-44-2 | Fmoc-p-carboxy-Phe(OtBu)-OH | Combi-Blocks, Inc. | MFCD01317016 | 487.552 | C29H29NO6 | 97.000 | CC(C)(C)OC(=O)c1ccc(C[C@H](NC(=O)OCC2c3ccccc3-c3ccccc23)C(O)=O)cc1 | 100g | 837472693
Fmoc-p-carboxy-Phe(OtBu)-OH | Combi-Blocks, Inc. | 183070-44-2 | MFCD01317016 | 487.552 | C29H29NO6 | 97.000 | CC(C)(C)OC(=O)c1ccc(C[C@H](NC(=O)OCC2c3ccccc3-c3ccccc23)C(O)=O)cc1 | 100g | 837472693
eMolecules 188975-30-6 | 3,6-Dihydro-2H-pyran-4-yl trifluoromethanesulfonate | ChemScene | MFCD09997709 | 232.170 | C6H7F3O4S | 96.000 | FC(F)(F)S(=O)(=O)OC1=CCOCC1 | 1g | 569147061
3,6-Dihydro-2H-pyran-4-yl trifluoromethanesulfonate | ChemScene | 188975-30-6 | MFCD09997709 | 232.170 | C6H7F3O4S | 96.000 | FC(F)(F)S(=O)(=O)OC1=CCOCC1 | 1g | 569147061
OCC2c3ccccc3-c3ccccc23)C(O)=O)cc1 | 250mg | 525181538](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000493492.jpg-250.jpg)
eMolecules 183070-44-2 | Fmoc-Phe(4-COOtBu)-OH | Ambeed | MFCD01317016 | 487.552 | C29H29NO6 | 98.000 | CC(C)(C)OC(=O)c1ccc(C[C@H](NC(=O)OCC2c3ccccc3-c3ccccc23)C(O)=O)cc1 | 250mg | 525181538
Fmoc-Phe(4-COOtBu)-OH | Ambeed | 183070-44-2 | MFCD01317016 | 487.552 | C29H29NO6 | 98.000 | CC(C)(C)OC(=O)c1ccc(C[C@H](NC(=O)OCC2c3ccccc3-c3ccccc23)C(O)=O)cc1 | 250mg | 525181538