Thiophenes
Aobchem 3 6-Dibromo-2-fluorobenzonitrile | ≥97% | CAS 1160574-03-7 | C7H2Br2FN | 500mg
3 6-Dibromo-2-fluorobenzonitrile | ≥97% | CAS 1160574-03-7 | C7H2Br2FN | 500mg
Aobchem 2 5-Dibromo-3-methoxyphenylboronic acid | ≥97% | CAS 919355-33-2 | C7H7BBr2O3 | 5g
2 5-Dibromo-3-methoxyphenylboronic acid | ≥97% | CAS 919355-33-2 | C7H7BBr2O3 | 5g
Aobchem 3 5-Dibromo-4-ethoxybenzaldehyde | ≥97% | CAS 381238-96-6 | C9H8Br2O2 | 5g
3 5-Dibromo-4-ethoxybenzaldehyde | ≥97% | CAS 381238-96-6 | C9H8Br2O2 | 5g
Aobchem 4-Bromo-2-chlorothiophene | ≥95% | CAS 32431-93-9 | C4H2BrClS | 5g
4-Bromo-2-chlorothiophene | ≥95% | CAS 32431-93-9 | C4H2BrClS | 5g
Aobchem -Methyl-2-thiophenemethanol | ≥95% | CAS 2309-47-9 | C6H8OS | 5g
-Methyl-2-thiophenemethanol | ≥95% | CAS 2309-47-9 | C6H8OS | 5g
eMolecules 22353-82-8 | ChemScene | 5-Chlorothiophene-2-carboxamide | 250mg | 632300763 | CS-0157773 | MFCD01922226 | 161.6 | C5H4ClNOS
Ambeed | 2-Butylimidazole | 5g | 592282155 | A115981 | 50790-93-7 | MFCD00792664 | 124.187 | C7H12N2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
Aobchem 2 5-Dibromo-3-chlorothiophene | ≥97% | CAS 32431-91-7 | C4HBr2ClS | 250mg
2 5-Dibromo-3-chlorothiophene | ≥97% | CAS 32431-91-7 | C4HBr2ClS | 250mg
Aobchem 4-Bromo-2-chlorothiophene | ≥95% | CAS 32431-93-9 | C4H2BrClS | 250mg
4-Bromo-2-chlorothiophene | ≥95% | CAS 32431-93-9 | C4H2BrClS | 250mg
Aobchem -Methyl-2-thiophenemethanol | ≥95% | CAS 2309-47-9 | C6H8OS | 1g
-Methyl-2-thiophenemethanol | ≥95% | CAS 2309-47-9 | C6H8OS | 1g
Aobchem 4-Bromo-2-chlorothiophene | ≥95% | CAS 32431-93-9 | C4H2BrClS | 500mg
4-Bromo-2-chlorothiophene | ≥95% | CAS 32431-93-9 | C4H2BrClS | 500mg
Medchemexpress LLC 5-Chlorothiophene-2-carboxylic acid | 24065-33-6 | 99.86% | C5H3ClO2S | 100 G
5-Chlorothiophene-2-carboxylic acid is a biochemical reagent suitable for life science related research as a biological material or organic compound.
- Biochemical reagent
- Suitable for life science related research
- Can be used as a biological material
- Can be used as an organic compound
BLD PHARMATECH CO LIMITED 2-AMINO-5-BROMOTHIOPHENE-1G
2-Amino-5-bromothiophene-3-carbonitrile, 95+%, 1G, CAS# 1312362-19-8
eMolecules 1256360-34-5 | 3-Bromo-4-methylthiophene-2,5-diboronic acid, pinacol ester | Combi-Blocks | MFCD17015833 | 428.980 | C17H27B2BrO4S | 96.000 | Cc1c(Br)c(sc1B1OC(C)(C)C(C)(C)O1)B1OC(C)(C)C(C)(C)O1 | 1g | 117546029
3-Bromo-4-methylthiophene-2,5-diboronic acid, pinacol ester | Combi-Blocks | 1256360-34-5 | MFCD17015833 | 428.980 | C17H27B2BrO4S | 96.000 | Cc1c(Br)c(sc1B1OC(C)(C)C(C)(C)O1)B1OC(C)(C)C(C)(C)O1 | 1g | 117546029
eMolecules 869108-50-9 | Ambeed | Ethyl 5-methyl-134-thiadiazole-2-carboxylate | 100mg | 600845636 | A684498 | MFCD03840446 | 172.2 | C6H8N2O2S
Ambeed | Ethyl 5-methyl-134-thiadiazole-2-carboxylate | 100mg | 600845636 | A684498 | 869108-50-9 | MFCD03840446 | 172.200 | C6H8N2O2S