Triazines
eMolecules 99584-48-2 | 3,6-Dichloro-1,2,4-triazine | Combi-Blocks, Inc.149.960 | C3HCl2N3 | 97.000 | Clc1cnc(Cl)nn1 | 10g | 859973109
3,6-Dichloro-1,2,4-triazine | Combi-Blocks, Inc. | 99584-48-2149.960 | C3HCl2N3 | 97.000 | Clc1cnc(Cl)nn1 | 10g | 859973109
eMolecules 99584-48-2 | 3,6-Dichloro-1,2,4-triazine | Combi-Blocks, Inc.149.960 | C3HCl2N3 | 97.000 | Clc1cnc(Cl)nn1 | 1g | 726031194
3,6-Dichloro-1,2,4-triazine | Combi-Blocks, Inc. | 99584-48-2149.960 | C3HCl2N3 | 97.000 | Clc1cnc(Cl)nn1 | 1g | 726031194
eMolecules 87-90-1 | Trichloroisocyanuric acid | Oakwood Chemicals | MFCD00006553 | 232.400 | C3Cl3N3O3 | 0.000 | Cln1c(=O)n(Cl)c(=O)n(Cl)c1=O | 500g | 480156333
Trichloroisocyanuric acid | Oakwood Chemicals | 87-90-1 | MFCD00006553 | 232.400 | C3Cl3N3O3 | 0.000 | Cln1c(=O)n(Cl)c(=O)n(Cl)c1=O | 500g | 480156333
![eMolecules 23169-33-7 | 9-(2-Hydroxyethyl)guanine | Toronto Research Chemicals | MFCD30533721 | 195.182 | C7H9N5O2 | 95.000 | Nc1nc2n(CCO)cnc2c(=O)[nH]1 | 50mg | 601596753](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502176554.JPG-250.jpg)
eMolecules 23169-33-7 | 9-(2-Hydroxyethyl)guanine | Toronto Research Chemicals | MFCD30533721 | 195.182 | C7H9N5O2 | 95.000 | Nc1nc2n(CCO)cnc2c(=O)[nH]1 | 50mg | 601596753
9-(2-Hydroxyethyl)guanine | Toronto Research Chemicals | 23169-33-7 | MFCD30533721 | 195.182 | C7H9N5O2 | 95.000 | Nc1nc2n(CCO)cnc2c(=O)[nH]1 | 50mg | 601596753
eMolecules 87-90-1 | Trichloroisocyanuric acid | Oakwood Chemicals | MFCD00006553 | 232.400 | C3Cl3N3O3 | 0.000 | Cln1c(=O)n(Cl)c(=O)n(Cl)c1=O | 1kg | 480156334
Trichloroisocyanuric acid | Oakwood Chemicals | 87-90-1 | MFCD00006553 | 232.400 | C3Cl3N3O3 | 0.000 | Cln1c(=O)n(Cl)c(=O)n(Cl)c1=O | 1kg | 480156334
BIOHIPPO AAV-EF1a-DIO-Cyan-pre-eGRASP(p30)-WPRE-hGH-polyA
Recombinant adeno associated virus expressing pre-eGRASP Cyan under the EF1a promoter with WPRE and hGH polyA elements. The Cre dependent configuration enables expression only after recombination, providing precise targeted control of targeted neurons. Offered under the Biohippo AAVX Series with multiple serotypes available including AAV2/1, AAV2/2, AAV2/5, AAV2/6, AAV2/6m, AAV2/6.2FF, AAV2/7m8, AAV2/8, AAV2/9, AAV2/DJ, AAV2/DJ8, AAV2/Retro, AAV2/PHP.eB, AAV2/PHP.B, AAV2/rh10, AAV2/PHP.S, AAV2/anc80, AAV2/B10, AAV2/olig001, AAV2/BI30, AAV2/BR1, AAV2/MG1.2, AAV1/2, AAV2/MaCPNS1, and AAV2/MaCPNS2. Regular titer is greater than or equal to 2.00E+12 vg per mL, with high titer greater than or equal to 1.00E+13 vg per mL available upon request at no additional cost. Customers may specify preferred serotype and titer when placing orders.
![Chem-Impex International, Inc. 3-(Diethoxy-phosphoryloxy)-3H-benzo[d][1,2,3]triazin-4-one | 165534-43-0 | MFCD01236967 | 25G](https://assets.fishersci.com/TFS-Assets/CCG/product-images/default.jpg-250.jpg)
Chem-Impex International, Inc. 3-(Diethoxy-phosphoryloxy)-3H-benzo[d][1,2,3]triazin-4-one | 165534-43-0 | MFCD01236967 | 25G
3-(Diethoxy-phosphoryloxy)-3H-benzo[d][1,2,3]triazin-4-one, 165534-43-0, MFCD01236967, 25G
eMolecules 2831-66-5 | 2,4-Dichloro-1,3,5-triazine | Apollo Scientific | MFCD04115347 | 149.960 | C3HCl2N3 | 95.000 | Clc1ncnc(Cl)n1 | 5g | 600855904
2,4-Dichloro-1,3,5-triazine | Apollo Scientific | 2831-66-5 | MFCD04115347 | 149.960 | C3HCl2N3 | 95.000 | Clc1ncnc(Cl)n1 | 5g | 600855904
eMolecules 2831-66-5 | 2,4-Dichloro-1,3,5-triazine | Synthonix - Stock | MFCD04115347 | 149.960 | C3HCl2N3 | 97.000 | Clc1ncnc(Cl)n1 | 1g | 487609577
2,4-Dichloro-1,3,5-triazine | Synthonix - Stock | 2831-66-5 | MFCD04115347 | 149.960 | C3HCl2N3 | 97.000 | Clc1ncnc(Cl)n1 | 1g | 487609577
![eMolecules 187732-95-2 | 7-Amino-furo[2,3-b]pyrazine-6-carboxylic acid ethyl ester | Combi-Blocks | MFCD09909670 | 207.189 | C9H9N3O3 | 95.000 | CCOC(=O)c1oc2nccnc2c1N | 1g | 482935688](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502191512.JPG-250.jpg)
eMolecules 187732-95-2 | 7-Amino-furo[2,3-b]pyrazine-6-carboxylic acid ethyl ester | Combi-Blocks | MFCD09909670 | 207.189 | C9H9N3O3 | 95.000 | CCOC(=O)c1oc2nccnc2c1N | 1g | 482935688
7-Amino-furo[2,3-b]pyrazine-6-carboxylic acid ethyl ester | Combi-Blocks | 187732-95-2 | MFCD09909670 | 207.189 | C9H9N3O3 | 95.000 | CCOC(=O)c1oc2nccnc2c1N | 1g | 482935688
eMolecules 3182-83-0 | ETHYL 2-(BUTYLAMINO)ACETATE | AstaTech | MFCD09953131 | 159.229 | C8H17NO2 | 95.000 | CCCCNCC(=O)OCC | 1g | 443836178
ETHYL 2-(BUTYLAMINO)ACETATE | AstaTech | 3182-83-0 | MFCD09953131 | 159.229 | C8H17NO2 | 95.000 | CCCCNCC(=O)OCC | 1g | 443836178
![eMolecules 59944-75-1 | thieno[3,2-b]pyrazin-7-amine | MFCD08271970 | 1g](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502143712.JPG-250.jpg)
eMolecules 59944-75-1 | thieno[3,2-b]pyrazin-7-amine | MFCD08271970 | 1g
WuXi ChemSupply | thieno[3,2-b]pyrazin-7-amine | 1g | 599165948 | LN00204157 | 95.000 | 59944-75-1 | MFCD08271970 | 151.190 | C6H5N3S
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 4543-95-7 | 4-(N-Butylamino)-1-butanol | MFCD00059007 | 1g
Ambeed | (3-Cyano-2-fluorophenyl)boronic acid | 1g | 525208231 | A418505 | 957121-05-0 | MFCD07374984 | 164.930 | C7H5BFNO2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>