Isothiocyanates
Aobchem (4-(Cyclopropylmethyl)phenyl)boronic acid | 95% | CAS 179251-29-7 | C10H13BO2 | 250mg
(4-(Cyclopropylmethyl)phenyl)boronic acid | 95% | CAS 179251-29-7 | C10H13BO2 | 250mg
Aobchem 3-Chlorobenzoyl chloride | 95% | CAS 618-46-2 | C7H4Cl2O | 500g
3-Chlorobenzoyl chloride | 95% | CAS 618-46-2 | C7H4Cl2O | 500g
Aobchem 5-(3-Ethoxyphenyl)-3-pyridinecarboxylic acid | ≥95% | CAS 1048273-45-5 | C14H13NO3 | 10g
5-(3-Ethoxyphenyl)-3-pyridinecarboxylic acid | ≥95% | CAS 1048273-45-5 | C14H13NO3 | 10g
Aobchem 5-(3-Ethoxyphenyl)-3-pyridinecarboxylic acid | ≥95% | CAS 1048273-45-5 | C14H13NO3 | 5g
5-(3-Ethoxyphenyl)-3-pyridinecarboxylic acid | ≥95% | CAS 1048273-45-5 | C14H13NO3 | 5g
Aobchem Tert-butyl 3-(4-cyanophenyl)-3-hydroxyazetidine-1-carboxylate | 95% | CAS 1533440-75-3 | C15H18N2O3 | 5g
Tert-butyl 3-(4-cyanophenyl)-3-hydroxyazetidine-1-carboxylate | 95% | CAS 1533440-75-3 | C15H18N2O3 | 5g
Aobchem 5-(3-Ethoxyphenyl)nicotinonitrile | 97% | C14H12N2O | 250mg
5-(3-Ethoxyphenyl)nicotinonitrile | 97% | C14H12N2O | 250mg
Aobchem Ethyl 3-(3-ethoxyphenyl)-3-hydroxypropanoate | ≥97% | CAS 1282563-37-4 | C13H18O4 | 5g
Ethyl 3-(3-ethoxyphenyl)-3-hydroxypropanoate | ≥97% | CAS 1282563-37-4 | C13H18O4 | 5g
Aobchem 5-Bromo-2-(cyclopropylmethyl)-2H-indazole | 97% | CAS 1354220-30-6 | C11H11BrN2 | 5g
5-Bromo-2-(cyclopropylmethyl)-2H-indazole | 97% | CAS 1354220-30-6 | C11H11BrN2 | 5g
Aobchem 2-Bromo-4-(cyclopropylmethyl)-1-methylbenzene | ≥97% | CAS 1369849-40-0 | C11H13Br | 500mg
2-Bromo-4-(cyclopropylmethyl)-1-methylbenzene | ≥97% | CAS 1369849-40-0 | C11H13Br | 500mg
Aobchem 1-(2 3 5 6-Tetrafluorophenyl)-1-propanone | 95% | CAS 135762-98-0 | C9H6F4O | 500mg
1-(2 3 5 6-Tetrafluorophenyl)-1-propanone | 95% | CAS 135762-98-0 | C9H6F4O | 500mg
eMolecules 21724-83-4 | 2-CHLORO-4-ISOTHIOCYANATOBENZONITRILE | AstaTech | MFCD11644904 | 194.640 | C8H3ClN2S | 95.000 | Clc1cc(ccc1C#N)N=C=S | 0.1g | 718059013
2-CHLORO-4-ISOTHIOCYANATOBENZONITRILE | AstaTech | 21724-83-4 | MFCD11644904 | 194.640 | C8H3ClN2S | 95.000 | Clc1cc(ccc1C#N)N=C=S | 0.1g | 718059013
Medchemexpress LLC Nir-797-isothiocyanate | 152111-91-6 | 99.3% | 5 MG
NIR-797-isothiocyanate is a multifunctional dye that serves as an important tool in biological experiments. It aids researchers in observing and analyzing cell structures, tracking biomolecules, evaluating cell functions, distinguishing cell types, detecting biomolecules, studying tissue pathology, and monitoring microorganisms. Its applications range from basic scientific research to clinical diagnostics, as well as traditional fields like textile dyeing and emerging fields such as functional textile processing, food pigments, and dye-sensitized solar cells.
- Observes and analyzes cell structures
- Tracks biomolecules and evaluates cell functions
- Distinguishes cell types and detects biomolecules
- Studies tissue pathology
- Monitors microorganisms
- Utilized in textile dyeing, functional textile processing, food pigments, and dye-sensitized solar cells
eMolecules 951753-87-0 | 5-Isothiocyanato-3-(trifluoromethyl)pyridine-2-carbonitrile | Accela ChemBio (ASD) | MFCD18382742 | 229.180 | C8H2F3N3S | 95.000 | FC(F)(F)c1cc(cnc1C#N)N=C=S | 1g | 650568045
5-Isothiocyanato-3-(trifluoromethyl)pyridine-2-carbonitrile | Accela ChemBio (ASD) | 951753-87-0 | MFCD18382742 | 229.180 | C8H2F3N3S | 95.000 | FC(F)(F)c1cc(cnc1C#N)N=C=S | 1g | 650568045
eMolecules 951753-87-0 | 5-Isothiocyanato-3-(trifluoromethyl)picolinonitrile | Combi-Blocks, Inc. | MFCD18382742 | 229.180 | C8H2F3N3S | 98.000 | FC(F)(F)c1cc(cnc1C#N)N=C=S | 10g | 866383956
5-Isothiocyanato-3-(trifluoromethyl)picolinonitrile | Combi-Blocks, Inc. | 951753-87-0 | MFCD18382742 | 229.180 | C8H2F3N3S | 98.000 | FC(F)(F)c1cc(cnc1C#N)N=C=S | 10g | 866383956
Medchemexpress LLC 4-pentenyl isothiocyanate | 18060-79-2 | MFCD00191527 | 98.9% | 127.21 | C6H9NS | 25 MG
4-Pentenyl isothiocyanate is a naturally occurring isothiocyanate isolated from the aerial parts of Aurinia sinuata. Supplied for research use, the compound has molecular formula C6H9NS and molecular weight 127.21 g/mol. It is provided in small laboratory quantities with analytical documentation for verification.
- Natural isothiocyanate from plant sources.
- High purity: 98.88%.
- Molecular formula C6H9NS; molecular weight 127.21 g/mol.
- Appearance: colorless to light yellow liquid.
- Storage recommendation: 4°C under nitrogen; in solvent -80°C (6 months), -20°C (1 month).
- COA and SDS available for quality and safety verification.