Post-Transition Metals
Filtered Search Results
| Form | Ingot |
|---|---|
| Solubility Information | Insoluble in water. |
| Chemical Name or Material | Bismuth Indium Tin ingot (Field's metal) |
| TSCA | Yes |
| Recommended Storage | Ambient temperatures |
| Avg. Mol. Wt. or Mol. Wt. Range | Bi:In:Sn; 32.5:51:16.5 wt% |
Bismuth Lead Tin ingot (Rose's metal)
CAS: 56001-37-7 Molecular Formula: C10H14N5Na2O14P3 Molecular Weight (g/mol): 567.14 MDL Number: MFCD03410297 InChI Key: FIZIYLKEXVIRHJ-KHRSEZDTNA-L Synonym: guanosine 5'-triphosphate,guanosine-5'-triphosphate disodium salt dihydrate gtp,guanosine-triphosphate,guanosine 5'-triphosphate 4-,gtp 4-,2r,3s,4r,5r-5-2-amino-6-hydroxy-9h-purin-9-yl-3,4-dihydroxyoxolan-2-yl methyl phosphonato oxy phosphonatooxy phosphinate,2r,3s,4r,5r-5-2-amino-6-oxo-3h-purin-9-yl-3,4-dihydroxyoxolan-2-yl methoxy-oxidophosphoryl oxy-oxidophosphoryl phosphate PubChem CID: 131676145 IUPAC Name: ({[(2R,3S,4R,5R)-5-(2-amino-6-oxo-6,9-dihydro-3H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphonato}oxy)(phosphonatooxy)phosphinate SMILES: [Na+].[Na+].NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP([O-])(=O)OP([O-])(=O)OP(O)(O)=O)[C@@H](O)[C@H]2O)C(=O)N1
| PubChem CID | 131676145 |
|---|---|
| CAS | 56001-37-7 |
| Molecular Weight (g/mol) | 567.14 |
| MDL Number | MFCD03410297 |
| SMILES | [Na+].[Na+].NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP([O-])(=O)OP([O-])(=O)OP(O)(O)=O)[C@@H](O)[C@H]2O)C(=O)N1 |
| Synonym | guanosine 5'-triphosphate,guanosine-5'-triphosphate disodium salt dihydrate gtp,guanosine-triphosphate,guanosine 5'-triphosphate 4-,gtp 4-,2r,3s,4r,5r-5-2-amino-6-hydroxy-9h-purin-9-yl-3,4-dihydroxyoxolan-2-yl methyl phosphonato oxy phosphonatooxy phosphinate,2r,3s,4r,5r-5-2-amino-6-oxo-3h-purin-9-yl-3,4-dihydroxyoxolan-2-yl methoxy-oxidophosphoryl oxy-oxidophosphoryl phosphate |
| IUPAC Name | ({[(2R,3S,4R,5R)-5-(2-amino-6-oxo-6,9-dihydro-3H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphonato}oxy)(phosphonatooxy)phosphinate |
| InChI Key | FIZIYLKEXVIRHJ-KHRSEZDTNA-L |
| Molecular Formula | C10H14N5Na2O14P3 |
| Percent Purity | 99.95% |
|---|---|
| Form | Lump |
| MDL Number | MFCD00143771 |
| Chemical Name or Material | Bismuth Tin eutectic lump |
| TSCA | Yes |
| Recommended Storage | Ambient temperatures |
| Assay Percent Notes | (metals basis) |
| Melting Point | 138°C |
| Avg. Mol. Wt. or Mol. Wt. Range | Bi:Sn; 58:42 wt% |
| Name Note | 0.79mm (0.031 in.) dia. |
|---|---|
| Form | Wire |
| Health Hazard 3 | P261-P264b-P270-P271-P280-P301+P312-P302+P352-P304+P340-P305+P351+P338-P312-P330-P332+P313-P362-P501c |
| MDL Number | MFCD00801141 |
| Health Hazard 2 | GHS H Statement H360-H373-H302-H332 May damage fertility or the unborn child. May cause damage to organs through prolonged or repeated exposure. Harmful if swallowed. Harmful if inhaled. |
| Solubility Information | Insoluble in water. |
| Health Hazard 1 | H302-H315-H319-H335 |
| Chemical Name or Material | Bismuth Lead eutectic wire |
| TSCA | Yes |
| Recommended Storage | Ambient temperatures |
| Melting Point | 124°C |
| Avg. Mol. Wt. or Mol. Wt. Range | Bi:Pb; 55.5:44.5 wt% |
Bismuth Lead Tin Cadmium ingot (Wood's metal)
CAS: 8049-22-7 Molecular Formula: Cd12Sn2 Molecular Weight (g/mol): 1586.388 MDL Number: MFCD00198175 InChI Key: OIBLPQFTAJDRMC-UHFFFAOYSA-N Synonym: lambda∼2∼-stannane-cadmium 1/6 PubChem CID: 71434152 IUPAC Name: cadmium;tin SMILES: [Cd].[Cd].[Cd].[Cd].[Cd].[Cd].[Cd].[Cd].[Cd].[Cd].[Cd].[Cd].[Sn].[Sn]
| PubChem CID | 71434152 |
|---|---|
| CAS | 8049-22-7 |
| Molecular Weight (g/mol) | 1586.388 |
| MDL Number | MFCD00198175 |
| SMILES | [Cd].[Cd].[Cd].[Cd].[Cd].[Cd].[Cd].[Cd].[Cd].[Cd].[Cd].[Cd].[Sn].[Sn] |
| Synonym | lambda∼2∼-stannane-cadmium 1/6 |
| IUPAC Name | cadmium;tin |
| InChI Key | OIBLPQFTAJDRMC-UHFFFAOYSA-N |
| Molecular Formula | Cd12Sn2 |
Bismuth powder, -325 mesh, 99.5% (metals basis), Thermo Scientific Chemicals
CAS: 7440-69-9 Molecular Formula: Bi Molecular Weight (g/mol): 208.98 MDL Number: MFCD00134033 InChI Key: JCXGWMGPZLAOME-UHFFFAOYSA-N Synonym: bismuth, elemental,unii-u015tt5i8h,powder,iii ion,shot, elongated,rod, 12.7mm 0.5in dia,atom,needles,pieces,rod PubChem CID: 5359367 ChEBI: CHEBI:33301 IUPAC Name: bismuth SMILES: [Bi]
| PubChem CID | 5359367 |
|---|---|
| CAS | 7440-69-9 |
| Molecular Weight (g/mol) | 208.98 |
| ChEBI | CHEBI:33301 |
| MDL Number | MFCD00134033 |
| SMILES | [Bi] |
| Synonym | bismuth, elemental,unii-u015tt5i8h,powder,iii ion,shot, elongated,rod, 12.7mm 0.5in dia,atom,needles,pieces,rod |
| IUPAC Name | bismuth |
| InChI Key | JCXGWMGPZLAOME-UHFFFAOYSA-N |
| Molecular Formula | Bi |
Bismuth needles, 99.99% (metals basis), Thermo Scientific Chemicals
CAS: 7440-69-9 Molecular Formula: Bi Molecular Weight (g/mol): 208.98 MDL Number: MFCD00134033 InChI Key: JCXGWMGPZLAOME-UHFFFAOYSA-N Synonym: bismuth, elemental,unii-u015tt5i8h,powder,iii ion,shot, elongated,rod, 12.7mm 0.5in dia,atom,needles,pieces,rod PubChem CID: 5359367 ChEBI: CHEBI:33301 IUPAC Name: bismuth SMILES: [Bi]
| PubChem CID | 5359367 |
|---|---|
| CAS | 7440-69-9 |
| Molecular Weight (g/mol) | 208.98 |
| ChEBI | CHEBI:33301 |
| MDL Number | MFCD00134033 |
| SMILES | [Bi] |
| Synonym | bismuth, elemental,unii-u015tt5i8h,powder,iii ion,shot, elongated,rod, 12.7mm 0.5in dia,atom,needles,pieces,rod |
| IUPAC Name | bismuth |
| InChI Key | JCXGWMGPZLAOME-UHFFFAOYSA-N |
| Molecular Formula | Bi |
Bismuth powder, -200 mesh, 99.999% (metals basis), Thermo Scientific Chemicals
CAS: 7440-69-9 Molecular Formula: Bi Molecular Weight (g/mol): 208.98 MDL Number: MFCD00134033 InChI Key: JCXGWMGPZLAOME-UHFFFAOYSA-N Synonym: bismuth, elemental,unii-u015tt5i8h,powder,iii ion,shot, elongated,rod, 12.7mm 0.5in dia,atom,needles,pieces,rod PubChem CID: 5359367 ChEBI: CHEBI:33301 IUPAC Name: bismuth SMILES: [Bi]
| PubChem CID | 5359367 |
|---|---|
| CAS | 7440-69-9 |
| Molecular Weight (g/mol) | 208.98 |
| ChEBI | CHEBI:33301 |
| MDL Number | MFCD00134033 |
| SMILES | [Bi] |
| Synonym | bismuth, elemental,unii-u015tt5i8h,powder,iii ion,shot, elongated,rod, 12.7mm 0.5in dia,atom,needles,pieces,rod |
| IUPAC Name | bismuth |
| InChI Key | JCXGWMGPZLAOME-UHFFFAOYSA-N |
| Molecular Formula | Bi |
Bismuth powder, -100 mesh, 99.5% (metals basis), Thermo Scientific Chemicals
CAS: 7440-69-9 Molecular Formula: Bi Molecular Weight (g/mol): 208.98 MDL Number: MFCD00134033 InChI Key: JCXGWMGPZLAOME-UHFFFAOYSA-N Synonym: bismuth, elemental,unii-u015tt5i8h,powder,iii ion,shot, elongated,rod, 12.7mm 0.5in dia,atom,needles,pieces,rod PubChem CID: 5359367 ChEBI: CHEBI:33301 IUPAC Name: bismuth SMILES: [Bi]
| PubChem CID | 5359367 |
|---|---|
| CAS | 7440-69-9 |
| Molecular Weight (g/mol) | 208.98 |
| ChEBI | CHEBI:33301 |
| MDL Number | MFCD00134033 |
| SMILES | [Bi] |
| Synonym | bismuth, elemental,unii-u015tt5i8h,powder,iii ion,shot, elongated,rod, 12.7mm 0.5in dia,atom,needles,pieces,rod |
| IUPAC Name | bismuth |
| InChI Key | JCXGWMGPZLAOME-UHFFFAOYSA-N |
| Molecular Formula | Bi |
Bismuth rod, Puratronic™, 99.9999% (metals basis), Thermo Scientific Chemicals
CAS: 7440-69-9 Molecular Formula: Bi Molecular Weight (g/mol): 208.98 MDL Number: MFCD00134033 InChI Key: JCXGWMGPZLAOME-UHFFFAOYSA-N Synonym: bismuth, elemental,unii-u015tt5i8h,powder,iii ion,shot, elongated,rod, 12.7mm 0.5in dia,atom,needles,pieces,rod PubChem CID: 5359367 ChEBI: CHEBI:33301 IUPAC Name: bismuth SMILES: [Bi]
| PubChem CID | 5359367 |
|---|---|
| CAS | 7440-69-9 |
| Molecular Weight (g/mol) | 208.98 |
| ChEBI | CHEBI:33301 |
| MDL Number | MFCD00134033 |
| SMILES | [Bi] |
| Synonym | bismuth, elemental,unii-u015tt5i8h,powder,iii ion,shot, elongated,rod, 12.7mm 0.5in dia,atom,needles,pieces,rod |
| IUPAC Name | bismuth |
| InChI Key | JCXGWMGPZLAOME-UHFFFAOYSA-N |
| Molecular Formula | Bi |
Bismuth granules, 1-2mm (0.04-0.08in), 99.997% (metals basis), Thermo Scientific Chemicals
CAS: 7440-69-9 Molecular Formula: Bi Molecular Weight (g/mol): 208.98 MDL Number: MFCD00134033 InChI Key: JCXGWMGPZLAOME-UHFFFAOYSA-N Synonym: bismuth, elemental,unii-u015tt5i8h,powder,iii ion,shot, elongated,rod, 12.7mm 0.5in dia,atom,needles,pieces,rod PubChem CID: 5359367 ChEBI: CHEBI:33301 IUPAC Name: bismuth SMILES: [Bi]
| PubChem CID | 5359367 |
|---|---|
| CAS | 7440-69-9 |
| Molecular Weight (g/mol) | 208.98 |
| ChEBI | CHEBI:33301 |
| MDL Number | MFCD00134033 |
| SMILES | [Bi] |
| Synonym | bismuth, elemental,unii-u015tt5i8h,powder,iii ion,shot, elongated,rod, 12.7mm 0.5in dia,atom,needles,pieces,rod |
| IUPAC Name | bismuth |
| InChI Key | JCXGWMGPZLAOME-UHFFFAOYSA-N |
| Molecular Formula | Bi |
Bismuth rod, 12.7mm (0.5in) dia, 99.999+% (metals basis), Thermo Scientific Chemicals
CAS: 7440-69-9 Molecular Formula: Bi Molecular Weight (g/mol): 208.98 MDL Number: MFCD00134033 InChI Key: JCXGWMGPZLAOME-UHFFFAOYSA-N Synonym: bismuth, elemental,unii-u015tt5i8h,powder,iii ion,shot, elongated,rod, 12.7mm 0.5in dia,atom,needles,pieces,rod PubChem CID: 5359367 ChEBI: CHEBI:33301 IUPAC Name: bismuth SMILES: [Bi]
| PubChem CID | 5359367 |
|---|---|
| CAS | 7440-69-9 |
| Molecular Weight (g/mol) | 208.98 |
| ChEBI | CHEBI:33301 |
| MDL Number | MFCD00134033 |
| SMILES | [Bi] |
| Synonym | bismuth, elemental,unii-u015tt5i8h,powder,iii ion,shot, elongated,rod, 12.7mm 0.5in dia,atom,needles,pieces,rod |
| IUPAC Name | bismuth |
| InChI Key | JCXGWMGPZLAOME-UHFFFAOYSA-N |
| Molecular Formula | Bi |
Bismuth rod, 12.7mm (0.5in) dia, 99.9% (metals basis), Thermo Scientific Chemicals
CAS: 7440-69-9 Molecular Formula: Bi Molecular Weight (g/mol): 208.98 MDL Number: MFCD00134033 InChI Key: JCXGWMGPZLAOME-UHFFFAOYSA-N Synonym: bismuth, elemental,unii-u015tt5i8h,powder,iii ion,shot, elongated,rod, 12.7mm 0.5in dia,atom,needles,pieces,rod PubChem CID: 5359367 ChEBI: CHEBI:33301 IUPAC Name: bismuth SMILES: [Bi]
| PubChem CID | 5359367 |
|---|---|
| CAS | 7440-69-9 |
| Molecular Weight (g/mol) | 208.98 |
| ChEBI | CHEBI:33301 |
| MDL Number | MFCD00134033 |
| SMILES | [Bi] |
| Synonym | bismuth, elemental,unii-u015tt5i8h,powder,iii ion,shot, elongated,rod, 12.7mm 0.5in dia,atom,needles,pieces,rod |
| IUPAC Name | bismuth |
| InChI Key | JCXGWMGPZLAOME-UHFFFAOYSA-N |
| Molecular Formula | Bi |
Bismuth foil, 1.0mm (0.04in) thick, 99.999% (metals basis), Thermo Scientific Chemicals
CAS: 7440-69-9 Molecular Formula: Bi Molecular Weight (g/mol): 208.98 MDL Number: MFCD00134033 InChI Key: JCXGWMGPZLAOME-UHFFFAOYSA-N Synonym: bismuth, elemental,unii-u015tt5i8h,powder,iii ion,shot, elongated,rod, 12.7mm 0.5in dia,atom,needles,pieces,rod PubChem CID: 5359367 ChEBI: CHEBI:33301 IUPAC Name: bismuth SMILES: [Bi]
| PubChem CID | 5359367 |
|---|---|
| CAS | 7440-69-9 |
| Molecular Weight (g/mol) | 208.98 |
| ChEBI | CHEBI:33301 |
| MDL Number | MFCD00134033 |
| SMILES | [Bi] |
| Synonym | bismuth, elemental,unii-u015tt5i8h,powder,iii ion,shot, elongated,rod, 12.7mm 0.5in dia,atom,needles,pieces,rod |
| IUPAC Name | bismuth |
| InChI Key | JCXGWMGPZLAOME-UHFFFAOYSA-N |
| Molecular Formula | Bi |
Bismuth rod, 11mm (0.43in) dia, 99.99% (metals basis), Thermo Scientific Chemicals
CAS: 7440-69-9 Molecular Formula: Bi Molecular Weight (g/mol): 208.98 MDL Number: MFCD00134033 InChI Key: JCXGWMGPZLAOME-UHFFFAOYSA-N Synonym: bismuth, elemental,unii-u015tt5i8h,powder,iii ion,shot, elongated,rod, 12.7mm 0.5in dia,atom,needles,pieces,rod PubChem CID: 5359367 ChEBI: CHEBI:33301 IUPAC Name: bismuth SMILES: [Bi]
| PubChem CID | 5359367 |
|---|---|
| CAS | 7440-69-9 |
| Molecular Weight (g/mol) | 208.98 |
| ChEBI | CHEBI:33301 |
| MDL Number | MFCD00134033 |
| SMILES | [Bi] |
| Synonym | bismuth, elemental,unii-u015tt5i8h,powder,iii ion,shot, elongated,rod, 12.7mm 0.5in dia,atom,needles,pieces,rod |
| IUPAC Name | bismuth |
| InChI Key | JCXGWMGPZLAOME-UHFFFAOYSA-N |
| Molecular Formula | Bi |