Chlorobenzene
![AA BLOCKS LLC [4-(4-chlorophenyl)phenyl]methylamine hydrochloride | 410077-96-2 | 254.15 g/mol |](https://assets.fishersci.com/TFS-Assets/CCG/product-images/default.jpg-250.jpg)
AA BLOCKS LLC [4-(4-chlorophenyl)phenyl]methylamine hydrochloride | 410077-96-2 | 254.15 g/mol |
[4-(4-chlorophenyl)phenyl]methylamine hydrochloride | 410077-96-2 | 254.15 g/mol |
eMolecules 930766-09-9 | 4-(4-Chlorophenyl)cyclohexanol | MFCD11850098 | 250mg
Ambeed | 4-(4-Chlorophenyl)cyclohexanol | 250mg | 525027140 | A125786 | 930766-09-9 | MFCD11850098 | 210.700 | C12H15ClO
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 63503-60-6 | 3-Chlorobenzeneboronic acid | Oakwood Chemicals | MFCD00161354 | 156.370 | C6H6BClO2 | 98.000 | OB(O)c1cccc(Cl)c1 | 1g | 480110190
3-Chlorobenzeneboronic acid | Oakwood Chemicals | 63503-60-6 | MFCD00161354 | 156.370 | C6H6BClO2 | 98.000 | OB(O)c1cccc(Cl)c1 | 1g | 480110190
![eMolecules 796096-64-5 | (S)-1-tert-Butyl 2-methyl piperazine-1,2-dicarboxylate | Ambeed | MFCD04115328 | 244.291 | C11H20N2O4 | 97.000 | COC(=O)[C@@H]1CNCCN1C(=O)OC(C)(C)C | 100mg | 521415905](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502422516.PNG-250.jpg)
eMolecules 796096-64-5 | (S)-1-tert-Butyl 2-methyl piperazine-1,2-dicarboxylate | Ambeed | MFCD04115328 | 244.291 | C11H20N2O4 | 97.000 | COC(=O)[C@@H]1CNCCN1C(=O)OC(C)(C)C | 100mg | 521415905
(S)-1-tert-Butyl 2-methyl piperazine-1,2-dicarboxylate | Ambeed | 796096-64-5 | MFCD04115328 | 244.291 | C11H20N2O4 | 97.000 | COC(=O)[C@@H]1CNCCN1C(=O)OC(C)(C)C | 100mg | 521415905
Sigma Aldrich Fine Chemicals Biosciences Saclofen solid | 125464-42-8 | MFCD00216817 | 5MG
Saclofen solid | Mol Wt: 249.71 | 125464-42-8 | MFCD00216817 | 5MG
eMolecules 1878-65-5 | 3-Chlorophenylacetic acid | Oakwood Chemical | MFCD00004332 | 170.590 | C8H7ClO2 | 97.000 | OC(=O)Cc1cccc(Cl)c1 | 1g | 537693616
3-Chlorophenylacetic acid | Oakwood Chemical | 1878-65-5 | MFCD00004332 | 170.590 | C8H7ClO2 | 97.000 | OC(=O)Cc1cccc(Cl)c1 | 1g | 537693616
Sigma Aldrich Fine Chemicals Biosciences 1,2,4-Trichlorobenzene-d3 98 atom % D | 2199-72-6 | MFCD00142381 | 5G
1,2,4-Trichlorobenzene-d3 98 atom % D | Purity: 99% (CP) | Mol Wt: 184.47 | 2199-72-6 | MFCD00142381 | 5G
Medchemexpress LLC 2-Chloroaniline hydr 5mg
2-Chloroaniline hydrochloride-13C6 is the 13C labeled 2-Chloroaniline hydrochloride[1]
Medchemexpress LLC 2-Chloroaniline hydr 25mg
2-Chloroaniline hydrochloride-13C6 is the 13C labeled 2-Chloroaniline hydrochloride[1]
eMolecules 22680-44-0 | (2-Chlorophenyl)methanamine hydrochloride | MFCD07375438 | 1g
Ambeed | N-(4-Bromo-2-fluorophenyl)-6-methoxy-7-((1-methylpiperidin-4-yl)methoxy)quinazolin-4-amine hydrochloride | 25mg | 552682777 | A263359 | 524722-52-9 | MFCD26960945 | 511.820 | C22H25BrClFN4O2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>