Carboxylic acids and derivatives
Filtered Search Results
Edetate Disodium, Multi-Compendial, U.S.P., J.T. Baker™
CAS: 6381-92-6 Molecular Formula: C10H18N2Na2O10 Molecular Weight (g/mol): 372.24 MDL Number: MFCD00150037 InChI Key: OVBJJZOQPCKUOR-UHFFFAOYSA-L Synonym: edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs PubChem CID: 44120005 IUPAC Name: disodium 2-({2-[(carboxylatomethyl)(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetate dihydrate SMILES: O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O
| PubChem CID | 44120005 |
|---|---|
| CAS | 6381-92-6 |
| Molecular Weight (g/mol) | 372.24 |
| MDL Number | MFCD00150037 |
| SMILES | O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
| Synonym | edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs |
| IUPAC Name | disodium 2-({2-[(carboxylatomethyl)(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetate dihydrate |
| InChI Key | OVBJJZOQPCKUOR-UHFFFAOYSA-L |
| Molecular Formula | C10H18N2Na2O10 |
EDTA, Powder, BAKER ANALYZED™ A.C.S. Reagent, J.T. Baker™
CAS: 60-00-4 Molecular Formula: C10H16N2O8 Molecular Weight (g/mol): 292.24 MDL Number: MFCD00003541 InChI Key: KCXVZYZYPLLWCC-UHFFFAOYSA-N Synonym: edta,edetic acid,ethylenediaminetetraacetic acid,edathamil,versene,endrate,havidote,titriplex,edta acid,sequestrol PubChem CID: 6049 ChEBI: CHEBI:42191 IUPAC Name: 2-({2-[bis(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetic acid SMILES: OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O
| PubChem CID | 6049 |
|---|---|
| CAS | 60-00-4 |
| Molecular Weight (g/mol) | 292.24 |
| ChEBI | CHEBI:42191 |
| MDL Number | MFCD00003541 |
| SMILES | OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O |
| Synonym | edta,edetic acid,ethylenediaminetetraacetic acid,edathamil,versene,endrate,havidote,titriplex,edta acid,sequestrol |
| IUPAC Name | 2-({2-[bis(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetic acid |
| InChI Key | KCXVZYZYPLLWCC-UHFFFAOYSA-N |
| Molecular Formula | C10H16N2O8 |
Methyl azetidine-3-carboxylate hydrochloride, 95%, Thermo Scientific Chemicals
CAS: 100202-39-9 Molecular Formula: C5H10ClNO2 Molecular Weight (g/mol): 151.59 MDL Number: MFCD01861758 InChI Key: UOCWTLBPYROHEF-UHFFFAOYSA-N Synonym: methyl azetidine-3-carboxylate hydrochloride,azetidine-3-methyl carboxylate hydrochloride,azetidine-3-carboxylic acid methyl ester hydrochloride,3-azetidinecarboxylic acid, methyl ester, hydrochloride,methyl azetidine-3-carboxylate hcl,methylazetidine-3-carboxylate hydrochloride,methyl 3-azetidinecarboxylate hydrochloride,azetidine-3-carboxylic acid methyl ester hcl,pubchem23516,acmc-209tka PubChem CID: 21100040 IUPAC Name: methyl azetidine-3-carboxylate;hydrochloride SMILES: Cl.COC(=O)C1CNC1
| PubChem CID | 21100040 |
|---|---|
| CAS | 100202-39-9 |
| Molecular Weight (g/mol) | 151.59 |
| MDL Number | MFCD01861758 |
| SMILES | Cl.COC(=O)C1CNC1 |
| Synonym | methyl azetidine-3-carboxylate hydrochloride,azetidine-3-methyl carboxylate hydrochloride,azetidine-3-carboxylic acid methyl ester hydrochloride,3-azetidinecarboxylic acid, methyl ester, hydrochloride,methyl azetidine-3-carboxylate hcl,methylazetidine-3-carboxylate hydrochloride,methyl 3-azetidinecarboxylate hydrochloride,azetidine-3-carboxylic acid methyl ester hcl,pubchem23516,acmc-209tka |
| IUPAC Name | methyl azetidine-3-carboxylate;hydrochloride |
| InChI Key | UOCWTLBPYROHEF-UHFFFAOYSA-N |
| Molecular Formula | C5H10ClNO2 |
Isopropyl Palmitate, NF, 90%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 142-91-6 Molecular Formula: C19H38O2 Molecular Weight (g/mol): 298.51 MDL Number: MFCD00008993 InChI Key: XUGNVMKQXJXZCD-UHFFFAOYSA-N IUPAC Name: propan-2-yl hexadecanoate SMILES: CCCCCCCCCCCCCCCC(=O)OC(C)C
| CAS | 142-91-6 |
|---|---|
| Molecular Weight (g/mol) | 298.51 |
| MDL Number | MFCD00008993 |
| SMILES | CCCCCCCCCCCCCCCC(=O)OC(C)C |
| IUPAC Name | propan-2-yl hexadecanoate |
| InChI Key | XUGNVMKQXJXZCD-UHFFFAOYSA-N |
| Molecular Formula | C19H38O2 |
| CAS | 3891-07-4 |
|---|---|
| MDL Number | MFCD00005903 |
o-Tolylacetic acid, 99%
CAS: 644-36-0 Molecular Formula: C9H10O2 Molecular Weight (g/mol): 150.177 MDL Number: MFCD00004328 InChI Key: RZWGTXHSYZGXKF-UHFFFAOYSA-N Synonym: o-tolylacetic acid,2-methylphenylacetic acid,2-methylphenyl acetic acid,2-2-methylphenyl acetic acid,2-o-tolyl acetic acid,2-tolylacetic acid,2-o-tolylacetic acid,o-methylphenylacetic acid,o-tolyacetic acid PubChem CID: 69519 IUPAC Name: 2-(2-methylphenyl)acetic acid SMILES: CC1=CC=CC=C1CC(=O)O
| PubChem CID | 69519 |
|---|---|
| CAS | 644-36-0 |
| Molecular Weight (g/mol) | 150.177 |
| MDL Number | MFCD00004328 |
| SMILES | CC1=CC=CC=C1CC(=O)O |
| Synonym | o-tolylacetic acid,2-methylphenylacetic acid,2-methylphenyl acetic acid,2-2-methylphenyl acetic acid,2-o-tolyl acetic acid,2-tolylacetic acid,2-o-tolylacetic acid,o-methylphenylacetic acid,o-tolyacetic acid |
| IUPAC Name | 2-(2-methylphenyl)acetic acid |
| InChI Key | RZWGTXHSYZGXKF-UHFFFAOYSA-N |
| Molecular Formula | C9H10O2 |
Ethyl propionate, 99+%
CAS: 105-37-3 Molecular Formula: C5H10O2 Molecular Weight (g/mol): 102.13 MDL Number: MFCD00009308 InChI Key: FKRCODPIKNYEAC-UHFFFAOYSA-N Synonym: ethyl propionate,propanoic acid, ethyl ester,propionic ester,propionic ether,propionic acid, ethyl ester,ethylpropionate,propionate d'ethyle,propanoic acid ethyl ester,ethyl n-propionate,propionic acid ethyl ester PubChem CID: 7749 ChEBI: CHEBI:41330 IUPAC Name: ethyl propanoate SMILES: CCC(=O)OCC
| PubChem CID | 7749 |
|---|---|
| CAS | 105-37-3 |
| Molecular Weight (g/mol) | 102.13 |
| ChEBI | CHEBI:41330 |
| MDL Number | MFCD00009308 |
| SMILES | CCC(=O)OCC |
| Synonym | ethyl propionate,propanoic acid, ethyl ester,propionic ester,propionic ether,propionic acid, ethyl ester,ethylpropionate,propionate d'ethyle,propanoic acid ethyl ester,ethyl n-propionate,propionic acid ethyl ester |
| IUPAC Name | ethyl propanoate |
| InChI Key | FKRCODPIKNYEAC-UHFFFAOYSA-N |
| Molecular Formula | C5H10O2 |
n-Butyl dodecanoate, 99+%
CAS: 106-18-3 Molecular Formula: C16H32O2 Molecular Weight (g/mol): 256.43 MDL Number: MFCD00042870 InChI Key: NDKYEUQMPZIGFN-UHFFFAOYSA-N Synonym: butyl laurate,dodecanoic acid, butyl ester,n-butyl laurate,bytyl laurate,butyl dodecylate,lauric acid butyl ester,lauric acid, butyl ester,lauric acid n-butyl ester,unii-23985ocm4h,n-butyl n-dodecanoate PubChem CID: 61015 IUPAC Name: butyl dodecanoate SMILES: CCCCCCCCCCCC(=O)OCCCC
| PubChem CID | 61015 |
|---|---|
| CAS | 106-18-3 |
| Molecular Weight (g/mol) | 256.43 |
| MDL Number | MFCD00042870 |
| SMILES | CCCCCCCCCCCC(=O)OCCCC |
| Synonym | butyl laurate,dodecanoic acid, butyl ester,n-butyl laurate,bytyl laurate,butyl dodecylate,lauric acid butyl ester,lauric acid, butyl ester,lauric acid n-butyl ester,unii-23985ocm4h,n-butyl n-dodecanoate |
| IUPAC Name | butyl dodecanoate |
| InChI Key | NDKYEUQMPZIGFN-UHFFFAOYSA-N |
| Molecular Formula | C16H32O2 |
Methyle3,4-diaminobenzoate, 97%, Thermo Scientific™
CAS: 36692-49-6 Molecular Formula: C8H10N2O2 Molecular Weight (g/mol): 166.18 MDL Number: MFCD00017098 InChI Key: IOPLHGOSNCJOOO-UHFFFAOYSA-N Synonym: 3,4-diaminobenzoic acid methyl ester,methyl3,4-diaminobenzoate,methyl-3,4-diaminobenzoate,benzoic acid, 3,4-diamino-, methyl ester,3,4-diamino-benzoic acid methyl ester,methyl 3,4-diaminobenzenecarboxylate,pubchem4610,acmc-1bn7s,methyl 3,4-diamino-benzoate,methyl-3,4-diamino-benzoate PubChem CID: 135524 IUPAC Name: methyl 3,4-diaminobenzoate SMILES: COC(=O)C1=CC=C(N)C(N)=C1
| PubChem CID | 135524 |
|---|---|
| CAS | 36692-49-6 |
| Molecular Weight (g/mol) | 166.18 |
| MDL Number | MFCD00017098 |
| SMILES | COC(=O)C1=CC=C(N)C(N)=C1 |
| Synonym | 3,4-diaminobenzoic acid methyl ester,methyl3,4-diaminobenzoate,methyl-3,4-diaminobenzoate,benzoic acid, 3,4-diamino-, methyl ester,3,4-diamino-benzoic acid methyl ester,methyl 3,4-diaminobenzenecarboxylate,pubchem4610,acmc-1bn7s,methyl 3,4-diamino-benzoate,methyl-3,4-diamino-benzoate |
| IUPAC Name | methyl 3,4-diaminobenzoate |
| InChI Key | IOPLHGOSNCJOOO-UHFFFAOYSA-N |
| Molecular Formula | C8H10N2O2 |
Ethylenediamine tetraacetic acid disodium salt dihydrate, 99.74%, MP Biomedicals™
CAS: 6381-92-6 Molecular Formula: C10H18N2Na2O10 Molecular Weight (g/mol): 372.24 MDL Number: MFCD00150037,MFCD00003541 InChI Key: OVBJJZOQPCKUOR-UHFFFAOYSA-L Synonym: edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs PubChem CID: 44120005 IUPAC Name: disodium 2-({2-[(carboxylatomethyl)(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetate dihydrate SMILES: O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O
| PubChem CID | 44120005 |
|---|---|
| CAS | 6381-92-6 |
| Molecular Weight (g/mol) | 372.24 |
| MDL Number | MFCD00150037,MFCD00003541 |
| SMILES | O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
| Synonym | edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs |
| IUPAC Name | disodium 2-({2-[(carboxylatomethyl)(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetate dihydrate |
| InChI Key | OVBJJZOQPCKUOR-UHFFFAOYSA-L |
| Molecular Formula | C10H18N2Na2O10 |
Methyl 2-methoxypropionate, 98%
CAS: 17639-76-8 Molecular Formula: C5H10O3 Molecular Weight (g/mol): 118.132 MDL Number: MFCD00151664 InChI Key: VABBJJOSOCPYIT-UHFFFAOYSA-N Synonym: methyl 2-methoxypropionate,propanoic acid, 2-methoxy-, methyl ester,acmc-20akie,d +-alpha-methoxy-propionic acid methyl ester,methyl2-methoxypropanoate,methyl 2-methoxy-propionate,2-methoxypropanoic acid methyl ester,racemic 2-methoxy-propionic acid methyl ester PubChem CID: 86599 IUPAC Name: methyl 2-methoxypropanoate SMILES: CC(C(=O)OC)OC
| PubChem CID | 86599 |
|---|---|
| CAS | 17639-76-8 |
| Molecular Weight (g/mol) | 118.132 |
| MDL Number | MFCD00151664 |
| SMILES | CC(C(=O)OC)OC |
| Synonym | methyl 2-methoxypropionate,propanoic acid, 2-methoxy-, methyl ester,acmc-20akie,d +-alpha-methoxy-propionic acid methyl ester,methyl2-methoxypropanoate,methyl 2-methoxy-propionate,2-methoxypropanoic acid methyl ester,racemic 2-methoxy-propionic acid methyl ester |
| IUPAC Name | methyl 2-methoxypropanoate |
| InChI Key | VABBJJOSOCPYIT-UHFFFAOYSA-N |
| Molecular Formula | C5H10O3 |
4-Hydroxybenzoic acid, sodium salt, 98%
CAS: 114-63-6 Molecular Formula: C7H5NaO3 Molecular Weight (g/mol): 160.10 MDL Number: MFCD00016530 InChI Key: ZLVSYODPTJZFMK-UHFFFAOYSA-M Synonym: sodium 4-hydroxybenzoate,sodium p-hydroxybenzoate,4-hydroxybenzoic acid sodium salt,sodium paraben,benzoic acid, 4-hydroxy-, monosodium salt,p-hydroxybenzoic acid sodium salt,monosodium p-hydroxybenzoate,monosodium 4-hydroxybenzoate,benzoic acid, p-hydroxy-, sodium salt,benzoic acid, 4-hydroxy-, sodium salt 1:1 PubChem CID: 16219477 IUPAC Name: sodium;4-hydroxybenzoate SMILES: [Na+].OC1=CC=C(C=C1)C([O-])=O
| PubChem CID | 16219477 |
|---|---|
| CAS | 114-63-6 |
| Molecular Weight (g/mol) | 160.10 |
| MDL Number | MFCD00016530 |
| SMILES | [Na+].OC1=CC=C(C=C1)C([O-])=O |
| Synonym | sodium 4-hydroxybenzoate,sodium p-hydroxybenzoate,4-hydroxybenzoic acid sodium salt,sodium paraben,benzoic acid, 4-hydroxy-, monosodium salt,p-hydroxybenzoic acid sodium salt,monosodium p-hydroxybenzoate,monosodium 4-hydroxybenzoate,benzoic acid, p-hydroxy-, sodium salt,benzoic acid, 4-hydroxy-, sodium salt 1:1 |
| IUPAC Name | sodium;4-hydroxybenzoate |
| InChI Key | ZLVSYODPTJZFMK-UHFFFAOYSA-M |
| Molecular Formula | C7H5NaO3 |
Methyl 4-methoxyphenylacetate, 97+%
CAS: 23786-14-3 Molecular Formula: C10H12O3 Molecular Weight (g/mol): 180.20 MDL Number: MFCD00008454 InChI Key: ZQYLDVNTWDEAJI-UHFFFAOYSA-N Synonym: methyl 4-methoxyphenylacetate,methyl 2-4-methoxyphenyl acetate,methyl 4-methoxyphenyl acetate,4-methoxyphenylacetic acid methyl ester,4-methoxy-phenyl-acetic acid methyl ester,methyl 4-methoxybenzeneacetate,methyl p-methoxyphenyl acetate,benzeneacetic acid, 4-methoxy-, methyl ester,acetic acid, p-methoxyphenyl-, methyl ester,methyl 2-p-methoxyphenyl acetate PubChem CID: 90266 IUPAC Name: methyl 2-(4-methoxyphenyl)acetate SMILES: COC(=O)CC1=CC=C(OC)C=C1
| PubChem CID | 90266 |
|---|---|
| CAS | 23786-14-3 |
| Molecular Weight (g/mol) | 180.20 |
| MDL Number | MFCD00008454 |
| SMILES | COC(=O)CC1=CC=C(OC)C=C1 |
| Synonym | methyl 4-methoxyphenylacetate,methyl 2-4-methoxyphenyl acetate,methyl 4-methoxyphenyl acetate,4-methoxyphenylacetic acid methyl ester,4-methoxy-phenyl-acetic acid methyl ester,methyl 4-methoxybenzeneacetate,methyl p-methoxyphenyl acetate,benzeneacetic acid, 4-methoxy-, methyl ester,acetic acid, p-methoxyphenyl-, methyl ester,methyl 2-p-methoxyphenyl acetate |
| IUPAC Name | methyl 2-(4-methoxyphenyl)acetate |
| InChI Key | ZQYLDVNTWDEAJI-UHFFFAOYSA-N |
| Molecular Formula | C10H12O3 |
Ethyl cyclohexanecarboxylate, 98+%
CAS: 3289-28-9 Molecular Formula: C9H16O2 Molecular Weight (g/mol): 156.225 MDL Number: MFCD00041734 InChI Key: JJOYCHKVKWDMEA-UHFFFAOYSA-N Synonym: cyclohexanecarboxylic acid, ethyl ester,ethyl cyclohexylformate,ethyl hexahydrobenzoate,cyclohexanecarboxylic acid ethyl ester,ethoxycarbonylcyclohexane,ethyl cyclohexylcarboxylate,ethyl cyclohexanoate,fema no. 3544,ethyl cyclohexylmethanoate,ethyl cyclohexanocarboxylate PubChem CID: 18686 IUPAC Name: ethyl cyclohexanecarboxylate SMILES: CCOC(=O)C1CCCCC1
| PubChem CID | 18686 |
|---|---|
| CAS | 3289-28-9 |
| Molecular Weight (g/mol) | 156.225 |
| MDL Number | MFCD00041734 |
| SMILES | CCOC(=O)C1CCCCC1 |
| Synonym | cyclohexanecarboxylic acid, ethyl ester,ethyl cyclohexylformate,ethyl hexahydrobenzoate,cyclohexanecarboxylic acid ethyl ester,ethoxycarbonylcyclohexane,ethyl cyclohexylcarboxylate,ethyl cyclohexanoate,fema no. 3544,ethyl cyclohexylmethanoate,ethyl cyclohexanocarboxylate |
| IUPAC Name | ethyl cyclohexanecarboxylate |
| InChI Key | JJOYCHKVKWDMEA-UHFFFAOYSA-N |
| Molecular Formula | C9H16O2 |
Methyl coumalate, 98%
CAS: 6018-41-3 Molecular Formula: C7H6O4 Molecular Weight (g/mol): 154.121 MDL Number: MFCD00010120 InChI Key: HHWWWZQYHPFCBY-UHFFFAOYSA-N Synonym: methyl coumalate,methyl 2-oxo-2h-pyran-5-carboxylate,coumalic acid, methyl ester,5-carbomethoxy-2-pyrone,2h-pyran-5-carboxylic acid, 2-oxo-, methyl ester,coumalic acid methyl ester,unii-1s7tmf0r8t,methyl 2-pyrone-5-carboxylate,methyl 2-oxopyran-5-carboxylate,1s7tmf0r8t PubChem CID: 80113 IUPAC Name: methyl 6-oxopyran-3-carboxylate SMILES: COC(=O)C1=COC(=O)C=C1
| PubChem CID | 80113 |
|---|---|
| CAS | 6018-41-3 |
| Molecular Weight (g/mol) | 154.121 |
| MDL Number | MFCD00010120 |
| SMILES | COC(=O)C1=COC(=O)C=C1 |
| Synonym | methyl coumalate,methyl 2-oxo-2h-pyran-5-carboxylate,coumalic acid, methyl ester,5-carbomethoxy-2-pyrone,2h-pyran-5-carboxylic acid, 2-oxo-, methyl ester,coumalic acid methyl ester,unii-1s7tmf0r8t,methyl 2-pyrone-5-carboxylate,methyl 2-oxopyran-5-carboxylate,1s7tmf0r8t |
| IUPAC Name | methyl 6-oxopyran-3-carboxylate |
| InChI Key | HHWWWZQYHPFCBY-UHFFFAOYSA-N |
| Molecular Formula | C7H6O4 |