Carboxylic acids and derivatives
Filtered Search Results
Ethyl methacrylate, 99%, stabilized
CAS: 97-63-2 Molecular Formula: C6H10O2 Molecular Weight (g/mol): 114.14 MDL Number: MFCD00009161 InChI Key: SUPCQIBBMFXVTL-UHFFFAOYSA-N Synonym: ethyl methacrylate,ethyl 2-methylacrylate,2-propenoic acid, 2-methyl-, ethyl ester,methacrylic acid ethyl ester,ethyl 2-methyl-2-propenoate,ethyl 2-methacrylate,rhoplex ac-33,methacrylic acid, ethyl ester,rcra waste number u118,2-methylacrylic acid, ethyl ester PubChem CID: 7343 IUPAC Name: ethyl 2-methylprop-2-enoate SMILES: CCOC(=O)C(=C)C
| PubChem CID | 7343 |
|---|---|
| CAS | 97-63-2 |
| Molecular Weight (g/mol) | 114.14 |
| MDL Number | MFCD00009161 |
| SMILES | CCOC(=O)C(=C)C |
| Synonym | ethyl methacrylate,ethyl 2-methylacrylate,2-propenoic acid, 2-methyl-, ethyl ester,methacrylic acid ethyl ester,ethyl 2-methyl-2-propenoate,ethyl 2-methacrylate,rhoplex ac-33,methacrylic acid, ethyl ester,rcra waste number u118,2-methylacrylic acid, ethyl ester |
| IUPAC Name | ethyl 2-methylprop-2-enoate |
| InChI Key | SUPCQIBBMFXVTL-UHFFFAOYSA-N |
| Molecular Formula | C6H10O2 |
Dehydroacetic acid, 98%
CAS: 520-45-6 Molecular Formula: C8H8O4 Molecular Weight (g/mol): 168.15 MDL Number: MFCD00066709 InChI Key: PGRHXDWITVMQBC-UHFFFAOYSA-N Synonym: dehydroacetic acid,3-acetyl-6-methyl-2h-pyran-2,4 3h-dione,methylacetopyronone,dehydracetic acid,biocide 470f,acetic acid, dehydro,3-acetyl-6-methyl-2,4-pyrandione,2h-pyran-2,4 3h-dione, 3-acetyl-6-methyl,3-acetyl-6-methyl-pyran-2,4-dione,3-acetyl-6-methyldihydropyrandione-2,4 PubChem CID: 122903 IUPAC Name: 3-acetyl-6-methylpyran-2,4-dione SMILES: CC1=CC(=O)C(C(=O)O1)C(=O)C
| PubChem CID | 122903 |
|---|---|
| CAS | 520-45-6 |
| Molecular Weight (g/mol) | 168.15 |
| MDL Number | MFCD00066709 |
| SMILES | CC1=CC(=O)C(C(=O)O1)C(=O)C |
| Synonym | dehydroacetic acid,3-acetyl-6-methyl-2h-pyran-2,4 3h-dione,methylacetopyronone,dehydracetic acid,biocide 470f,acetic acid, dehydro,3-acetyl-6-methyl-2,4-pyrandione,2h-pyran-2,4 3h-dione, 3-acetyl-6-methyl,3-acetyl-6-methyl-pyran-2,4-dione,3-acetyl-6-methyldihydropyrandione-2,4 |
| IUPAC Name | 3-acetyl-6-methylpyran-2,4-dione |
| InChI Key | PGRHXDWITVMQBC-UHFFFAOYSA-N |
| Molecular Formula | C8H8O4 |
Ethyl methacrylate, 98+%, stab. with 10-120ppm, 4-methoxyphenol
CAS: 97-63-2 Molecular Formula: C6H10O2 Molecular Weight (g/mol): 114.144 MDL Number: MFCD00009161 InChI Key: SUPCQIBBMFXVTL-UHFFFAOYSA-N Synonym: ethyl methacrylate,ethyl 2-methylacrylate,2-propenoic acid, 2-methyl-, ethyl ester,methacrylic acid ethyl ester,ethyl 2-methyl-2-propenoate,ethyl 2-methacrylate,rhoplex ac-33,methacrylic acid, ethyl ester,rcra waste number u118,2-methylacrylic acid, ethyl ester PubChem CID: 7343 IUPAC Name: ethyl 2-methylprop-2-enoate SMILES: CCOC(=O)C(=C)C
| PubChem CID | 7343 |
|---|---|
| CAS | 97-63-2 |
| Molecular Weight (g/mol) | 114.144 |
| MDL Number | MFCD00009161 |
| SMILES | CCOC(=O)C(=C)C |
| Synonym | ethyl methacrylate,ethyl 2-methylacrylate,2-propenoic acid, 2-methyl-, ethyl ester,methacrylic acid ethyl ester,ethyl 2-methyl-2-propenoate,ethyl 2-methacrylate,rhoplex ac-33,methacrylic acid, ethyl ester,rcra waste number u118,2-methylacrylic acid, ethyl ester |
| IUPAC Name | ethyl 2-methylprop-2-enoate |
| InChI Key | SUPCQIBBMFXVTL-UHFFFAOYSA-N |
| Molecular Formula | C6H10O2 |
Methyl 4-bromopyrrole-2-carboxylate, 97%, Thermo Scientific Chemicals
CAS: 934-05-4 Molecular Formula: C6H6BrNO2 Molecular Weight (g/mol): 204.023 MDL Number: MFCD00832855 InChI Key: ZXFCRVGOHJHZNF-UHFFFAOYSA-N Synonym: methyl 4-bromopyrrole-2-carboxylate,4-bromo-2-methoxycarbonyl-1h-pyrrole,4-bromo-1h-pyrrole-2-carboxylic acid methyl ester,methyl4-bromo-1h-pyrrole-2-carboxylate,4-bromopyrrole-2-carboxylic acid methyl ester,1h-pyrrole-2-carboxylic acid, 4-bromo-, methyl ester,pubchem13045,acmc-209rlm,ksc497g1p,4-bromo-2-methoxycarbonylpyrrole PubChem CID: 2763594 IUPAC Name: methyl 4-bromo-1H-pyrrole-2-carboxylate SMILES: COC(=O)C1=CC(=CN1)Br
| PubChem CID | 2763594 |
|---|---|
| CAS | 934-05-4 |
| Molecular Weight (g/mol) | 204.023 |
| MDL Number | MFCD00832855 |
| SMILES | COC(=O)C1=CC(=CN1)Br |
| Synonym | methyl 4-bromopyrrole-2-carboxylate,4-bromo-2-methoxycarbonyl-1h-pyrrole,4-bromo-1h-pyrrole-2-carboxylic acid methyl ester,methyl4-bromo-1h-pyrrole-2-carboxylate,4-bromopyrrole-2-carboxylic acid methyl ester,1h-pyrrole-2-carboxylic acid, 4-bromo-, methyl ester,pubchem13045,acmc-209rlm,ksc497g1p,4-bromo-2-methoxycarbonylpyrrole |
| IUPAC Name | methyl 4-bromo-1H-pyrrole-2-carboxylate |
| InChI Key | ZXFCRVGOHJHZNF-UHFFFAOYSA-N |
| Molecular Formula | C6H6BrNO2 |
Methyl coumalate, 98%
CAS: 6018-41-3 Molecular Formula: C7H6O4 Molecular Weight (g/mol): 154.121 MDL Number: MFCD00010120 InChI Key: HHWWWZQYHPFCBY-UHFFFAOYSA-N Synonym: methyl coumalate,methyl 2-oxo-2h-pyran-5-carboxylate,coumalic acid, methyl ester,5-carbomethoxy-2-pyrone,2h-pyran-5-carboxylic acid, 2-oxo-, methyl ester,coumalic acid methyl ester,unii-1s7tmf0r8t,methyl 2-pyrone-5-carboxylate,methyl 2-oxopyran-5-carboxylate,1s7tmf0r8t PubChem CID: 80113 IUPAC Name: methyl 6-oxopyran-3-carboxylate SMILES: COC(=O)C1=COC(=O)C=C1
| PubChem CID | 80113 |
|---|---|
| CAS | 6018-41-3 |
| Molecular Weight (g/mol) | 154.121 |
| MDL Number | MFCD00010120 |
| SMILES | COC(=O)C1=COC(=O)C=C1 |
| Synonym | methyl coumalate,methyl 2-oxo-2h-pyran-5-carboxylate,coumalic acid, methyl ester,5-carbomethoxy-2-pyrone,2h-pyran-5-carboxylic acid, 2-oxo-, methyl ester,coumalic acid methyl ester,unii-1s7tmf0r8t,methyl 2-pyrone-5-carboxylate,methyl 2-oxopyran-5-carboxylate,1s7tmf0r8t |
| IUPAC Name | methyl 6-oxopyran-3-carboxylate |
| InChI Key | HHWWWZQYHPFCBY-UHFFFAOYSA-N |
| Molecular Formula | C7H6O4 |
Methyl 3,3-dimethylacrylate, 98%
CAS: 924-50-5 Molecular Formula: C6H10O2 Molecular Weight (g/mol): 114.144 MDL Number: MFCD00043940 InChI Key: FZIBCCGGICGWBP-UHFFFAOYSA-N Synonym: methyl 3-methyl-2-butenoate,methyl 3,3-dimethylacrylate,2-butenoic acid, 3-methyl-, methyl ester,3-methyl-but-2-enoic acid methyl ester,methyl senecioate,3,3-dimethylacrylic acid methyl ester,methyl-3,3-dimethylacrylate,crotonic acid, 3-methyl-, methyl ester,methyl-3,3-dimethyl acrylate,methylsenecioate PubChem CID: 13546 IUPAC Name: methyl 3-methylbut-2-enoate SMILES: CC(=CC(=O)OC)C
| PubChem CID | 13546 |
|---|---|
| CAS | 924-50-5 |
| Molecular Weight (g/mol) | 114.144 |
| MDL Number | MFCD00043940 |
| SMILES | CC(=CC(=O)OC)C |
| Synonym | methyl 3-methyl-2-butenoate,methyl 3,3-dimethylacrylate,2-butenoic acid, 3-methyl-, methyl ester,3-methyl-but-2-enoic acid methyl ester,methyl senecioate,3,3-dimethylacrylic acid methyl ester,methyl-3,3-dimethylacrylate,crotonic acid, 3-methyl-, methyl ester,methyl-3,3-dimethyl acrylate,methylsenecioate |
| IUPAC Name | methyl 3-methylbut-2-enoate |
| InChI Key | FZIBCCGGICGWBP-UHFFFAOYSA-N |
| Molecular Formula | C6H10O2 |
Methyl 4-methoxyphenylacetate, 97+%
CAS: 23786-14-3 Molecular Formula: C10H12O3 Molecular Weight (g/mol): 180.20 MDL Number: MFCD00008454 InChI Key: ZQYLDVNTWDEAJI-UHFFFAOYSA-N Synonym: methyl 4-methoxyphenylacetate,methyl 2-4-methoxyphenyl acetate,methyl 4-methoxyphenyl acetate,4-methoxyphenylacetic acid methyl ester,4-methoxy-phenyl-acetic acid methyl ester,methyl 4-methoxybenzeneacetate,methyl p-methoxyphenyl acetate,benzeneacetic acid, 4-methoxy-, methyl ester,acetic acid, p-methoxyphenyl-, methyl ester,methyl 2-p-methoxyphenyl acetate PubChem CID: 90266 IUPAC Name: methyl 2-(4-methoxyphenyl)acetate SMILES: COC(=O)CC1=CC=C(OC)C=C1
| PubChem CID | 90266 |
|---|---|
| CAS | 23786-14-3 |
| Molecular Weight (g/mol) | 180.20 |
| MDL Number | MFCD00008454 |
| SMILES | COC(=O)CC1=CC=C(OC)C=C1 |
| Synonym | methyl 4-methoxyphenylacetate,methyl 2-4-methoxyphenyl acetate,methyl 4-methoxyphenyl acetate,4-methoxyphenylacetic acid methyl ester,4-methoxy-phenyl-acetic acid methyl ester,methyl 4-methoxybenzeneacetate,methyl p-methoxyphenyl acetate,benzeneacetic acid, 4-methoxy-, methyl ester,acetic acid, p-methoxyphenyl-, methyl ester,methyl 2-p-methoxyphenyl acetate |
| IUPAC Name | methyl 2-(4-methoxyphenyl)acetate |
| InChI Key | ZQYLDVNTWDEAJI-UHFFFAOYSA-N |
| Molecular Formula | C10H12O3 |
Methyl 3-(methylthio)propionate, 98%
CAS: 13532-18-8 Molecular Formula: C5H10O2S Molecular Weight (g/mol): 134.19 MDL Number: MFCD00008565 InChI Key: DMMJVMYCBULSIS-UHFFFAOYSA-N Synonym: methyl 3-methylthio propionate,methyl 3-methylthiopropionate,methyl 3-methylthio propanoate,propanoic acid, 3-methylthio-, methyl ester,methyl beta-methiopropionate,methyl 3-methylsulfanyl propanoate,methyl-3-methylthio propionate,methyl 3-methylthiopropanoate,propionic acid, 3-methylthio-, methyl ester,methyl beta-methylthiopropionate PubChem CID: 61641 IUPAC Name: methyl 3-methylsulfanylpropanoate SMILES: COC(=O)CCSC
| PubChem CID | 61641 |
|---|---|
| CAS | 13532-18-8 |
| Molecular Weight (g/mol) | 134.19 |
| MDL Number | MFCD00008565 |
| SMILES | COC(=O)CCSC |
| Synonym | methyl 3-methylthio propionate,methyl 3-methylthiopropionate,methyl 3-methylthio propanoate,propanoic acid, 3-methylthio-, methyl ester,methyl beta-methiopropionate,methyl 3-methylsulfanyl propanoate,methyl-3-methylthio propionate,methyl 3-methylthiopropanoate,propionic acid, 3-methylthio-, methyl ester,methyl beta-methylthiopropionate |
| IUPAC Name | methyl 3-methylsulfanylpropanoate |
| InChI Key | DMMJVMYCBULSIS-UHFFFAOYSA-N |
| Molecular Formula | C5H10O2S |
Methyl 2-octynoate, 98%
CAS: 111-12-6 Molecular Formula: C9H14O2 Molecular Weight (g/mol): 154.209 MDL Number: MFCD00009530 InChI Key: FRLZQXRXIKQFNS-UHFFFAOYSA-N Synonym: methyl 2-octynoate,folione,methyl heptine carbonate,methyl 2-octynate,methyl 2-octinate,2-octynoic acid, methyl ester,vert de violette, artificial,methyl hept-1-yne-1-carboxylate,methyl pentylacetylenecarboxylate,unii-0ttp6yt2t3 PubChem CID: 8092 IUPAC Name: methyl oct-2-ynoate SMILES: CCCCCC#CC(=O)OC
| PubChem CID | 8092 |
|---|---|
| CAS | 111-12-6 |
| Molecular Weight (g/mol) | 154.209 |
| MDL Number | MFCD00009530 |
| SMILES | CCCCCC#CC(=O)OC |
| Synonym | methyl 2-octynoate,folione,methyl heptine carbonate,methyl 2-octynate,methyl 2-octinate,2-octynoic acid, methyl ester,vert de violette, artificial,methyl hept-1-yne-1-carboxylate,methyl pentylacetylenecarboxylate,unii-0ttp6yt2t3 |
| IUPAC Name | methyl oct-2-ynoate |
| InChI Key | FRLZQXRXIKQFNS-UHFFFAOYSA-N |
| Molecular Formula | C9H14O2 |
Methyl 4-aminobenzoate, 98%
CAS: 619-45-4 Molecular Formula: C8H9NO2 Molecular Weight (g/mol): 151.17 MDL Number: MFCD00007891 InChI Key: LZXXNPOYQCLXRS-UHFFFAOYSA-N Synonym: 4-aminobenzoic acid methyl ester,methyl p-aminobenzoate,benzoic acid, 4-amino-, methyl ester,p-methoxycarbonyl aniline,4-methoxycarbonyl aniline,p-aminobenzoic acid methyl ester,methyl aniline-4-carboxylate,4-carbomethoxyaniline,methyl4-aminobenzoate,benzoic acid, p-amino-, methyl ester PubChem CID: 12082 IUPAC Name: methyl 4-aminobenzoate SMILES: COC(=O)C1=CC=C(C=C1)N
| PubChem CID | 12082 |
|---|---|
| CAS | 619-45-4 |
| Molecular Weight (g/mol) | 151.17 |
| MDL Number | MFCD00007891 |
| SMILES | COC(=O)C1=CC=C(C=C1)N |
| Synonym | 4-aminobenzoic acid methyl ester,methyl p-aminobenzoate,benzoic acid, 4-amino-, methyl ester,p-methoxycarbonyl aniline,4-methoxycarbonyl aniline,p-aminobenzoic acid methyl ester,methyl aniline-4-carboxylate,4-carbomethoxyaniline,methyl4-aminobenzoate,benzoic acid, p-amino-, methyl ester |
| IUPAC Name | methyl 4-aminobenzoate |
| InChI Key | LZXXNPOYQCLXRS-UHFFFAOYSA-N |
| Molecular Formula | C8H9NO2 |
Methyl thiophene-3-carboxylate, 97%, Thermo Scientific Chemicals
CAS: 22913-26-4 Molecular Formula: C6H6O2S Molecular Weight (g/mol): 142.17 MDL Number: MFCD06203810 InChI Key: ZTRAEMILTFNZSM-UHFFFAOYSA-N Synonym: methyl 3-thiophenecarboxylate,3-thiophenecarboxylic acid, methyl ester,thiophene-3-carboxylic acid methyl ester,3-thiophenecarboxylicacid, methyl ester,methyl thiophen-3-carboxylate,methyl-3-thenoate,methyl 3-thenoate,3-methoxycarbonylthiophene,3-methoxy carbonyl-thiophene,methyl 3-thiophenecarboxylate # PubChem CID: 574151 IUPAC Name: methyl thiophene-3-carboxylate SMILES: COC(=O)C1=CSC=C1
| PubChem CID | 574151 |
|---|---|
| CAS | 22913-26-4 |
| Molecular Weight (g/mol) | 142.17 |
| MDL Number | MFCD06203810 |
| SMILES | COC(=O)C1=CSC=C1 |
| Synonym | methyl 3-thiophenecarboxylate,3-thiophenecarboxylic acid, methyl ester,thiophene-3-carboxylic acid methyl ester,3-thiophenecarboxylicacid, methyl ester,methyl thiophen-3-carboxylate,methyl-3-thenoate,methyl 3-thenoate,3-methoxycarbonylthiophene,3-methoxy carbonyl-thiophene,methyl 3-thiophenecarboxylate # |
| IUPAC Name | methyl thiophene-3-carboxylate |
| InChI Key | ZTRAEMILTFNZSM-UHFFFAOYSA-N |
| Molecular Formula | C6H6O2S |
methyl 4-amino-1-methyl-1H-pyrrole-2-carboxylate hydrochloride, Thermo Scientific™
CAS: 180258-45-1 Molecular Formula: C7H11ClN2O2 Molecular Weight (g/mol): 190.63 MDL Number: MFCD01318761 InChI Key: HEOKCJUUKIPIMM-UHFFFAOYSA-N Synonym: methyl 4-amino-1-methyl-1h-pyrrole-2-carboxylate hydrochloride,methyl 4-amino-1-methylpyrrole-2-carboxylate hydrochloride,methyl-4-amino-1-methyl pyrrole-2-carboxylate hydrochloride,4-amino-1-methyl-1h-pyrrole-2-carboxylic acid-methyl ester hcl,4-amino-1-methylpyrrole-2-carboxylic acid methyl ester hydrochloride,h-nh 4-mepyl-2-ome hcl,methyl 4-amino-1-methyl-pyrrole-2-carboxylate hydrochloride,methyl-4-amino-1-methyl pyrrole-2-carboxylate, hcl,n-methyl-2-carbomethoxy-4-aminopyrrole hydrochloride,3-amino-1-methyl-5-methyloxycarbonylpyrrol hydrochloride PubChem CID: 2794656 SMILES: Cl.COC(=O)C1=CC(N)=CN1C
| PubChem CID | 2794656 |
|---|---|
| CAS | 180258-45-1 |
| Molecular Weight (g/mol) | 190.63 |
| MDL Number | MFCD01318761 |
| SMILES | Cl.COC(=O)C1=CC(N)=CN1C |
| Synonym | methyl 4-amino-1-methyl-1h-pyrrole-2-carboxylate hydrochloride,methyl 4-amino-1-methylpyrrole-2-carboxylate hydrochloride,methyl-4-amino-1-methyl pyrrole-2-carboxylate hydrochloride,4-amino-1-methyl-1h-pyrrole-2-carboxylic acid-methyl ester hcl,4-amino-1-methylpyrrole-2-carboxylic acid methyl ester hydrochloride,h-nh 4-mepyl-2-ome hcl,methyl 4-amino-1-methyl-pyrrole-2-carboxylate hydrochloride,methyl-4-amino-1-methyl pyrrole-2-carboxylate, hcl,n-methyl-2-carbomethoxy-4-aminopyrrole hydrochloride,3-amino-1-methyl-5-methyloxycarbonylpyrrol hydrochloride |
| InChI Key | HEOKCJUUKIPIMM-UHFFFAOYSA-N |
| Molecular Formula | C7H11ClN2O2 |
Methyl methoxyacetate, 99%
CAS: 6290-49-9 Molecular Formula: C4H8O3 Molecular Weight (g/mol): 104.11 MDL Number: MFCD00008451 InChI Key: QRMHDGWGLNLHMN-UHFFFAOYSA-N Synonym: methyl methoxyacetate,acetic acid, methoxy-, methyl ester,methoxyacetic acid methyl ester,methyl-2-methoxyacetate,methoxyacetic acid, methyl ester,acetic acid, 2-methoxy-, methyl ester,unii-n960nq69lf,methoxy acetic acid methyl ester,methyl metoxyacetate,methyl methoxylacetate PubChem CID: 80507 ChEBI: CHEBI:34841 IUPAC Name: methyl 2-methoxyacetate SMILES: COCC(=O)OC
| PubChem CID | 80507 |
|---|---|
| CAS | 6290-49-9 |
| Molecular Weight (g/mol) | 104.11 |
| ChEBI | CHEBI:34841 |
| MDL Number | MFCD00008451 |
| SMILES | COCC(=O)OC |
| Synonym | methyl methoxyacetate,acetic acid, methoxy-, methyl ester,methoxyacetic acid methyl ester,methyl-2-methoxyacetate,methoxyacetic acid, methyl ester,acetic acid, 2-methoxy-, methyl ester,unii-n960nq69lf,methoxy acetic acid methyl ester,methyl metoxyacetate,methyl methoxylacetate |
| IUPAC Name | methyl 2-methoxyacetate |
| InChI Key | QRMHDGWGLNLHMN-UHFFFAOYSA-N |
| Molecular Formula | C4H8O3 |
Dimethyl Fumarate, Certified Reference Material, MilliporeSigma™ Supelco™
Pharmaceutical secondary standards for application in quality control. Provides pharma laboratories and manufacturers with a convenient, and cost-effective alternative to the preparation of in-house working standards.
5,6-Dihydro-2H-pyran-2-one, 90%
CAS: 3393-45-1 Molecular Formula: C5H6O2 Molecular Weight (g/mol): 98.10 MDL Number: MFCD00010439 InChI Key: VREFDQNWPNDZEX-UHFFFAOYSA-N Synonym: 5,6-dihydro-2h-pyran-2-one,2h-pyran-2-one, 5,6-dihydro,5,6-dihydropyran-2-one,5,6-dihydro-pyran-2-one,chembl55078,5,6-dihydro-2-pyranone,acmc-1ck70,2-pentenoic acid, 5-hydroxy-, .delta.-lactone,5,6-dihydro-2h-pyran-2-one, technical grade PubChem CID: 520660 SMILES: O=C1CC=CCO1
| PubChem CID | 520660 |
|---|---|
| CAS | 3393-45-1 |
| Molecular Weight (g/mol) | 98.10 |
| MDL Number | MFCD00010439 |
| SMILES | O=C1CC=CCO1 |
| Synonym | 5,6-dihydro-2h-pyran-2-one,2h-pyran-2-one, 5,6-dihydro,5,6-dihydropyran-2-one,5,6-dihydro-pyran-2-one,chembl55078,5,6-dihydro-2-pyranone,acmc-1ck70,2-pentenoic acid, 5-hydroxy-, .delta.-lactone,5,6-dihydro-2h-pyran-2-one, technical grade |
| InChI Key | VREFDQNWPNDZEX-UHFFFAOYSA-N |
| Molecular Formula | C5H6O2 |