Carboxylic acids and derivatives
Filtered Search Results
Methyl thiophene-2-carboxylate, 97%
CAS: 5380-42-7 Molecular Formula: C6H6O2S Molecular Weight (g/mol): 142.17 MDL Number: MFCD00016895 InChI Key: PGBFYLVIMDQYMS-UHFFFAOYSA-N Synonym: methyl 2-thiophenecarboxylate,methyl thenoate,methylthiophene-2-carboxylate,2-thiophenecarboxylic acid methyl ester,2-carbomethoxy thiophene,2-thiophenecarboxylic acid, methyl ester,thiophenate methyl,2-methoxycarbonyl thiophene,methyl 2-thiophene carboxylate,thiophenate-methyl PubChem CID: 79340 IUPAC Name: methyl thiophene-2-carboxylate SMILES: COC(=O)C1=CC=CS1
| PubChem CID | 79340 |
|---|---|
| CAS | 5380-42-7 |
| Molecular Weight (g/mol) | 142.17 |
| MDL Number | MFCD00016895 |
| SMILES | COC(=O)C1=CC=CS1 |
| Synonym | methyl 2-thiophenecarboxylate,methyl thenoate,methylthiophene-2-carboxylate,2-thiophenecarboxylic acid methyl ester,2-carbomethoxy thiophene,2-thiophenecarboxylic acid, methyl ester,thiophenate methyl,2-methoxycarbonyl thiophene,methyl 2-thiophene carboxylate,thiophenate-methyl |
| IUPAC Name | methyl thiophene-2-carboxylate |
| InChI Key | PGBFYLVIMDQYMS-UHFFFAOYSA-N |
| Molecular Formula | C6H6O2S |
2,2,3,4,4,4-Hexafluorobutyl methacrylate, 96%, stab.
CAS: 36405-47-7 Molecular Formula: C8H8F6O2 Molecular Weight (g/mol): 250.14 MDL Number: MFCD00042311 InChI Key: DFVPUWGVOPDJTC-UHFFFAOYSA-N Synonym: 2,2,3,4,4,4-hexafluorobutyl methacrylate,1h,1h,3h-hexafluorobutyl methacrylate,hexafluorobutyl methacrylate,methacrylic acid 2,2,3,4,4,4-hexafluorobutyl ester,2-propenoic acid, 2-methyl-, 2,2,3,4,4,4-hexafluorobutyl ester,hexafluorobutyl methacrylate polymer,hfbma,acmc-1adv6,ksc489s1j,2-propenoic acid, 2-methyl-, 2,2,3,4,4,4-hexafluorobutyl ester, homopolymer PubChem CID: 549772 IUPAC Name: 2,2,3,4,4,4-hexafluorobutyl 2-methylprop-2-enoate SMILES: CC(=C)C(=O)OCC(C(C(F)(F)F)F)(F)F
| PubChem CID | 549772 |
|---|---|
| CAS | 36405-47-7 |
| Molecular Weight (g/mol) | 250.14 |
| MDL Number | MFCD00042311 |
| SMILES | CC(=C)C(=O)OCC(C(C(F)(F)F)F)(F)F |
| Synonym | 2,2,3,4,4,4-hexafluorobutyl methacrylate,1h,1h,3h-hexafluorobutyl methacrylate,hexafluorobutyl methacrylate,methacrylic acid 2,2,3,4,4,4-hexafluorobutyl ester,2-propenoic acid, 2-methyl-, 2,2,3,4,4,4-hexafluorobutyl ester,hexafluorobutyl methacrylate polymer,hfbma,acmc-1adv6,ksc489s1j,2-propenoic acid, 2-methyl-, 2,2,3,4,4,4-hexafluorobutyl ester, homopolymer |
| IUPAC Name | 2,2,3,4,4,4-hexafluorobutyl 2-methylprop-2-enoate |
| InChI Key | DFVPUWGVOPDJTC-UHFFFAOYSA-N |
| Molecular Formula | C8H8F6O2 |
Methyl Acetate, 96%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 79-20-9
| CAS | 79-20-9 |
|---|
Methyl 3-mercaptopropionate, 98%
CAS: 2935-90-2 Molecular Formula: C4H8O2S Molecular Weight (g/mol): 120.166 MDL Number: MFCD00004895 InChI Key: LDTLDBDUBGAEDT-UHFFFAOYSA-N Synonym: methyl 3-mercaptopropionate,propanoic acid, 3-mercapto-, methyl ester,3-mercaptopropionic acid methyl ester,methyl mercaptopropionate,methyl3-mercaptopropionate,methyl 3-mercaptopropanoate,propionic acid, 3-mercapto-, methyl ester,unii-v920f0bcrz,methyl-3-mercaptopropionate,v920f0bcrz PubChem CID: 18050 IUPAC Name: methyl 3-sulfanylpropanoate SMILES: COC(=O)CCS
| PubChem CID | 18050 |
|---|---|
| CAS | 2935-90-2 |
| Molecular Weight (g/mol) | 120.166 |
| MDL Number | MFCD00004895 |
| SMILES | COC(=O)CCS |
| Synonym | methyl 3-mercaptopropionate,propanoic acid, 3-mercapto-, methyl ester,3-mercaptopropionic acid methyl ester,methyl mercaptopropionate,methyl3-mercaptopropionate,methyl 3-mercaptopropanoate,propionic acid, 3-mercapto-, methyl ester,unii-v920f0bcrz,methyl-3-mercaptopropionate,v920f0bcrz |
| IUPAC Name | methyl 3-sulfanylpropanoate |
| InChI Key | LDTLDBDUBGAEDT-UHFFFAOYSA-N |
| Molecular Formula | C4H8O2S |
tert-Butyl propiolate, 98%
CAS: 13831-03-3 Molecular Formula: C7H10O2 Molecular Weight (g/mol): 126.16 MDL Number: MFCD00060100 InChI Key: XGTPDIIFEPTULX-UHFFFAOYSA-N Synonym: tert-butyl propiolate,propiolic acid tert-butyl ester,t-butyl propiolate,2-propynoic acid, 1,1-dimethylethyl ester,boc-acetylene,tert-butyl propalate,tert-butyl propargylate,acmc-209chj,tert-butyl propiolate # PubChem CID: 543038 IUPAC Name: tert-butyl prop-2-ynoate SMILES: CC(C)(C)OC(=O)C#C
| PubChem CID | 543038 |
|---|---|
| CAS | 13831-03-3 |
| Molecular Weight (g/mol) | 126.16 |
| MDL Number | MFCD00060100 |
| SMILES | CC(C)(C)OC(=O)C#C |
| Synonym | tert-butyl propiolate,propiolic acid tert-butyl ester,t-butyl propiolate,2-propynoic acid, 1,1-dimethylethyl ester,boc-acetylene,tert-butyl propalate,tert-butyl propargylate,acmc-209chj,tert-butyl propiolate # |
| IUPAC Name | tert-butyl prop-2-ynoate |
| InChI Key | XGTPDIIFEPTULX-UHFFFAOYSA-N |
| Molecular Formula | C7H10O2 |
alpha-Angelicalactone, 98%
CAS: 591-12-8 Molecular Formula: C5H6O2 Molecular Weight (g/mol): 98.10 MDL Number: MFCD00005375 InChI Key: QOTQFLOTGBBMEX-UHFFFAOYSA-N Synonym: alpha-angelica lactone,alpha-angelicalactone,5-methyl-2 3h-furanone,5-methylfuran-2 3h-one,2 3h-furanone, 5-methyl,4-hydroxypent-3-enoic acid lactone,delta 2-angelica lactone,4-hydroxy-3-pentenoic acid gamma-lactone,gamma-methyl-beta,gamma-crotonolactone,.alpha.-angelica lactone PubChem CID: 11559 ChEBI: CHEBI:36433 IUPAC Name: 5-methyl-3H-furan-2-one SMILES: CC1=CCC(=O)O1
| PubChem CID | 11559 |
|---|---|
| CAS | 591-12-8 |
| Molecular Weight (g/mol) | 98.10 |
| ChEBI | CHEBI:36433 |
| MDL Number | MFCD00005375 |
| SMILES | CC1=CCC(=O)O1 |
| Synonym | alpha-angelica lactone,alpha-angelicalactone,5-methyl-2 3h-furanone,5-methylfuran-2 3h-one,2 3h-furanone, 5-methyl,4-hydroxypent-3-enoic acid lactone,delta 2-angelica lactone,4-hydroxy-3-pentenoic acid gamma-lactone,gamma-methyl-beta,gamma-crotonolactone,.alpha.-angelica lactone |
| IUPAC Name | 5-methyl-3H-furan-2-one |
| InChI Key | QOTQFLOTGBBMEX-UHFFFAOYSA-N |
| Molecular Formula | C5H6O2 |
Methyl 2,3-dichloropropionate, 98%
CAS: 3674-09-7 Molecular Formula: C4H6Cl2O2 Molecular Weight (g/mol): 156.99 MDL Number: MFCD00000944 InChI Key: OFHMODDLBXETIK-UHFFFAOYNA-N IUPAC Name: methyl 2,3-dichloropropanoate
| CAS | 3674-09-7 |
|---|---|
| Molecular Weight (g/mol) | 156.99 |
| MDL Number | MFCD00000944 |
| IUPAC Name | methyl 2,3-dichloropropanoate |
| InChI Key | OFHMODDLBXETIK-UHFFFAOYNA-N |
| Molecular Formula | C4H6Cl2O2 |
2,2,2-Trifluoroethyl methacrylate, 99%, stabilized, Thermo Scientific Chemicals
CAS: 352-87-4 Molecular Formula: C6H7F3O2 Molecular Weight (g/mol): 168.12 MDL Number: MFCD00013576,MFCD00274739 InChI Key: QTKPMCIBUROOGY-UHFFFAOYSA-N Synonym: 2,2,2-trifluoroethyl methacrylate,trifluoroethyl methacrylate,methacrylic acid 2,2,2-trifluoroethyl ester,2,2,2-trifluoroethylmethacrylate,2-propenoic acid, 2-methyl-, 2,2,2-trifluoroethyl ester,2-methyl-acrylic acid 2,2,2-trifluoro-ethyl ester,2-propenoic acid, 2-methyl-, trifluoroethyl ester,2-methyl-2-propenoic acid 2,2,2-trifluoroethyl ester,2,2,2-trifluoroethyl m,acmc-1af8z PubChem CID: 9608 IUPAC Name: 2,2,2-trifluoroethyl 2-methylprop-2-enoate SMILES: CC(=C)C(=O)OCC(F)(F)F
| PubChem CID | 9608 |
|---|---|
| CAS | 352-87-4 |
| Molecular Weight (g/mol) | 168.12 |
| MDL Number | MFCD00013576,MFCD00274739 |
| SMILES | CC(=C)C(=O)OCC(F)(F)F |
| Synonym | 2,2,2-trifluoroethyl methacrylate,trifluoroethyl methacrylate,methacrylic acid 2,2,2-trifluoroethyl ester,2,2,2-trifluoroethylmethacrylate,2-propenoic acid, 2-methyl-, 2,2,2-trifluoroethyl ester,2-methyl-acrylic acid 2,2,2-trifluoro-ethyl ester,2-propenoic acid, 2-methyl-, trifluoroethyl ester,2-methyl-2-propenoic acid 2,2,2-trifluoroethyl ester,2,2,2-trifluoroethyl m,acmc-1af8z |
| IUPAC Name | 2,2,2-trifluoroethyl 2-methylprop-2-enoate |
| InChI Key | QTKPMCIBUROOGY-UHFFFAOYSA-N |
| Molecular Formula | C6H7F3O2 |
Methyl 3-methoxythiophene-2-carboxylate, 97%
CAS: 62353-75-7 Molecular Formula: C7H8O3S Molecular Weight (g/mol): 172.20 MDL Number: MFCD00102115 InChI Key: MWADWXJPBMFRGL-UHFFFAOYSA-N Synonym: 3-methoxy-2-thiophenecarboxylic acid methyl ester,acmc-20abea,methyl 3-methoxythiophene carboxylate,methyl 3-methoxy-2-thiophenecarboxylate,2-thiophenecarboxylicacid,3-methoxy-,methyl ester,3-methoxythiophene-2-carboxylic acid methyl ester PubChem CID: 701637 IUPAC Name: methyl 3-methoxythiophene-2-carboxylate SMILES: COC(=O)C1=C(OC)C=CS1
| PubChem CID | 701637 |
|---|---|
| CAS | 62353-75-7 |
| Molecular Weight (g/mol) | 172.20 |
| MDL Number | MFCD00102115 |
| SMILES | COC(=O)C1=C(OC)C=CS1 |
| Synonym | 3-methoxy-2-thiophenecarboxylic acid methyl ester,acmc-20abea,methyl 3-methoxythiophene carboxylate,methyl 3-methoxy-2-thiophenecarboxylate,2-thiophenecarboxylicacid,3-methoxy-,methyl ester,3-methoxythiophene-2-carboxylic acid methyl ester |
| IUPAC Name | methyl 3-methoxythiophene-2-carboxylate |
| InChI Key | MWADWXJPBMFRGL-UHFFFAOYSA-N |
| Molecular Formula | C7H8O3S |
Dimethyl fumarate, 99%
CAS: 624-49-7 Molecular Formula: C6H8O4 Molecular Weight (g/mol): 144.13 MDL Number: MFCD00064438 InChI Key: LDCRTTXIJACKKU-ONEGZZNKSA-N Synonym: dimethyl fumarate,tecfidera,e-dimethyl fumarate,fumaderm,dimethyl e-but-2-enedioate,fumaric acid, dimethyl ester,boletic acid dimethyl ester,fumaric acid dimethyl ester,methyl fumarate,dimethyl trans-ethylenedicarboxylate PubChem CID: 637568 ChEBI: CHEBI:76004 IUPAC Name: dimethyl (E)-but-2-enedioate SMILES: COC(=O)C=CC(=O)OC
| PubChem CID | 637568 |
|---|---|
| CAS | 624-49-7 |
| Molecular Weight (g/mol) | 144.13 |
| ChEBI | CHEBI:76004 |
| MDL Number | MFCD00064438 |
| SMILES | COC(=O)C=CC(=O)OC |
| Synonym | dimethyl fumarate,tecfidera,e-dimethyl fumarate,fumaderm,dimethyl e-but-2-enedioate,fumaric acid, dimethyl ester,boletic acid dimethyl ester,fumaric acid dimethyl ester,methyl fumarate,dimethyl trans-ethylenedicarboxylate |
| IUPAC Name | dimethyl (E)-but-2-enedioate |
| InChI Key | LDCRTTXIJACKKU-ONEGZZNKSA-N |
| Molecular Formula | C6H8O4 |
Methyl 3-(4-hydroxyphenyl)propionate, 98%
CAS: 5597-50-2 Molecular Formula: C10H12O3 Molecular Weight (g/mol): 180.203 MDL Number: MFCD00071577 InChI Key: XRAMJHXWXCMGJM-UHFFFAOYSA-N PubChem CID: 79706 IUPAC Name: methyl 3-(4-hydroxyphenyl)propanoate SMILES: COC(=O)CCC1=CC=C(C=C1)O
| PubChem CID | 79706 |
|---|---|
| CAS | 5597-50-2 |
| Molecular Weight (g/mol) | 180.203 |
| MDL Number | MFCD00071577 |
| SMILES | COC(=O)CCC1=CC=C(C=C1)O |
| IUPAC Name | methyl 3-(4-hydroxyphenyl)propanoate |
| InChI Key | XRAMJHXWXCMGJM-UHFFFAOYSA-N |
| Molecular Formula | C10H12O3 |
Methyl trifluoroacetate, 98+%
CAS: 431-47-0 Molecular Formula: C3H3F3O2 Molecular Weight (g/mol): 128.05 MDL Number: MFCD00000417 InChI Key: VMVNZNXAVJHNDJ-UHFFFAOYSA-N Synonym: methyl trifluoroacetate,trifluoroacetic acid methyl ester,acetic acid, trifluoro-, methyl ester,methyltrifluoroacetate,2,2,2-trifluoromethylacetate,acetic acid, 2,2,2-trifluoro-, methyl ester,methyl trifluoracetate,tfamt,methyl triflouroacetate,pubchem12490 PubChem CID: 9893 IUPAC Name: methyl 2,2,2-trifluoroacetate SMILES: COC(=O)C(F)(F)F
| PubChem CID | 9893 |
|---|---|
| CAS | 431-47-0 |
| Molecular Weight (g/mol) | 128.05 |
| MDL Number | MFCD00000417 |
| SMILES | COC(=O)C(F)(F)F |
| Synonym | methyl trifluoroacetate,trifluoroacetic acid methyl ester,acetic acid, trifluoro-, methyl ester,methyltrifluoroacetate,2,2,2-trifluoromethylacetate,acetic acid, 2,2,2-trifluoro-, methyl ester,methyl trifluoracetate,tfamt,methyl triflouroacetate,pubchem12490 |
| IUPAC Name | methyl 2,2,2-trifluoroacetate |
| InChI Key | VMVNZNXAVJHNDJ-UHFFFAOYSA-N |
| Molecular Formula | C3H3F3O2 |
1-(Trifluoromethyl)vinyl acetate, 97%
CAS: 2247-91-8 Molecular Formula: C5H5F3O2 Molecular Weight (g/mol): 154.088 MDL Number: MFCD00040844 InChI Key: VOKGSDIHTCTXDS-UHFFFAOYSA-N Synonym: 1-trifluoromethyl vinyl acetate,1-trifluoromethyl ethenyl acetate,1-propen-2-ol, 3,3,3-trifluoro-, acetate,1-propen-2-ol, 3,3,3-trifluoro-, 2-acetate,trifluoroacetone enol acetate,trifluoroacetone enolacetate,alpha-trifluoromethylvinyl acetate,acmc-1cjli,3,3,3-trifluoropropen-2-yl acetate,alpa-trifluoromethyl vinyl acetate PubChem CID: 75254 IUPAC Name: 3,3,3-trifluoroprop-1-en-2-yl acetate SMILES: CC(=O)OC(=C)C(F)(F)F
| PubChem CID | 75254 |
|---|---|
| CAS | 2247-91-8 |
| Molecular Weight (g/mol) | 154.088 |
| MDL Number | MFCD00040844 |
| SMILES | CC(=O)OC(=C)C(F)(F)F |
| Synonym | 1-trifluoromethyl vinyl acetate,1-trifluoromethyl ethenyl acetate,1-propen-2-ol, 3,3,3-trifluoro-, acetate,1-propen-2-ol, 3,3,3-trifluoro-, 2-acetate,trifluoroacetone enol acetate,trifluoroacetone enolacetate,alpha-trifluoromethylvinyl acetate,acmc-1cjli,3,3,3-trifluoropropen-2-yl acetate,alpa-trifluoromethyl vinyl acetate |
| IUPAC Name | 3,3,3-trifluoroprop-1-en-2-yl acetate |
| InChI Key | VOKGSDIHTCTXDS-UHFFFAOYSA-N |
| Molecular Formula | C5H5F3O2 |
Methyl trans-2-hexenoate, 97%
CAS: 13894-63-8 Molecular Formula: C7H12O2 Molecular Weight (g/mol): 128.171 MDL Number: MFCD00048798 InChI Key: GFUGBRNILVVWIE-AATRIKPKSA-N Synonym: methyl 2-hexenoate,methyl e-2-hexenoate,methyl trans-2-hexenoate,methyl e-hex-2-enoate,methyl 2e-hexenoate,methyl 2e-hex-2-enoate,2-hexenoic acid, methyl ester, e,methyl 2e-2-hexenoate,2e-2-hexenoic acid methyl ester,unii-x2ddu82182 PubChem CID: 5364409 IUPAC Name: methyl (E)-hex-2-enoate SMILES: CCCC=CC(=O)OC
| PubChem CID | 5364409 |
|---|---|
| CAS | 13894-63-8 |
| Molecular Weight (g/mol) | 128.171 |
| MDL Number | MFCD00048798 |
| SMILES | CCCC=CC(=O)OC |
| Synonym | methyl 2-hexenoate,methyl e-2-hexenoate,methyl trans-2-hexenoate,methyl e-hex-2-enoate,methyl 2e-hexenoate,methyl 2e-hex-2-enoate,2-hexenoic acid, methyl ester, e,methyl 2e-2-hexenoate,2e-2-hexenoic acid methyl ester,unii-x2ddu82182 |
| IUPAC Name | methyl (E)-hex-2-enoate |
| InChI Key | GFUGBRNILVVWIE-AATRIKPKSA-N |
| Molecular Formula | C7H12O2 |
Methyl 3-methylthiophene-2-carboxylate, 99%
CAS: 81452-54-2 Molecular Formula: C7H8O2S Molecular Weight (g/mol): 156.20 MDL Number: MFCD00234332 InChI Key: BRWROFVPMUPMJQ-UHFFFAOYSA-N Synonym: methyl 3-methyl-2-thiophenecarboxylate,3-methylthiophene-2-carboxylic acid methyl ester,3-methyl-thiophene-2-carboxylic acid methyl ester,2-thiophenecarboxylic acid, 3-methyl-, methyl ester,methyl 3-methyl-thiophene-2-carboxylate,d methyl ester,3-methyl-thiophene-2-carboxylic acid,pubchem10098,pubchem22915,ksc495k9b PubChem CID: 580757 IUPAC Name: methyl 3-methylthiophene-2-carboxylate SMILES: COC(=O)C1=C(C)C=CS1
| PubChem CID | 580757 |
|---|---|
| CAS | 81452-54-2 |
| Molecular Weight (g/mol) | 156.20 |
| MDL Number | MFCD00234332 |
| SMILES | COC(=O)C1=C(C)C=CS1 |
| Synonym | methyl 3-methyl-2-thiophenecarboxylate,3-methylthiophene-2-carboxylic acid methyl ester,3-methyl-thiophene-2-carboxylic acid methyl ester,2-thiophenecarboxylic acid, 3-methyl-, methyl ester,methyl 3-methyl-thiophene-2-carboxylate,d methyl ester,3-methyl-thiophene-2-carboxylic acid,pubchem10098,pubchem22915,ksc495k9b |
| IUPAC Name | methyl 3-methylthiophene-2-carboxylate |
| InChI Key | BRWROFVPMUPMJQ-UHFFFAOYSA-N |
| Molecular Formula | C7H8O2S |