Carboxylic acids and derivatives
Filtered Search Results
N,N-Dimethylformamide 99.5+%, TCI America™
CAS: 68-12-2 Molecular Formula: C3H7NO Molecular Weight (g/mol): 73.10 MDL Number: MFCD00003284 InChI Key: ZMXDDKWLCZADIW-UHFFFAOYSA-N Synonym: dimethylformamide,dimethyl formamide,n,n-dimethylmethanamide,n-formyldimethylamine,formamide, n,n-dimethyl,dmf,dimethylformamid,dimetilformamide,dwumetyloformamid,dmfa PubChem CID: 6228 ChEBI: CHEBI:17741 IUPAC Name: N,N-dimethylformamide SMILES: CN(C)C=O
| PubChem CID | 6228 |
|---|---|
| CAS | 68-12-2 |
| Molecular Weight (g/mol) | 73.10 |
| ChEBI | CHEBI:17741 |
| MDL Number | MFCD00003284 |
| SMILES | CN(C)C=O |
| Synonym | dimethylformamide,dimethyl formamide,n,n-dimethylmethanamide,n-formyldimethylamine,formamide, n,n-dimethyl,dmf,dimethylformamid,dimetilformamide,dwumetyloformamid,dmfa |
| IUPAC Name | N,N-dimethylformamide |
| InChI Key | ZMXDDKWLCZADIW-UHFFFAOYSA-N |
| Molecular Formula | C3H7NO |
N,N-Dimethylacetamide, anhydrous, 99.8%, packaged under Argon in resealable ChemSeal™ bottles
CAS: 127-19-5 Molecular Formula: C4H9NO Molecular Weight (g/mol): 87.12 MDL Number: MFCD00008686 InChI Key: FXHOOIRPVKKKFG-UHFFFAOYSA-N Synonym: dimethylacetamide,dmac,acetamide, n,n-dimethyl,acetdimethylamide,dimethyl acetamide,n,n-dimethyl acetamide,dimethylamide acetate,n,n-dimethylethanamide,dimethylacetone amide,acetyldimethylamine PubChem CID: 31374 ChEBI: CHEBI:84254 IUPAC Name: N,N-dimethylacetamide SMILES: CN(C)C(C)=O
| PubChem CID | 31374 |
|---|---|
| CAS | 127-19-5 |
| Molecular Weight (g/mol) | 87.12 |
| ChEBI | CHEBI:84254 |
| MDL Number | MFCD00008686 |
| SMILES | CN(C)C(C)=O |
| Synonym | dimethylacetamide,dmac,acetamide, n,n-dimethyl,acetdimethylamide,dimethyl acetamide,n,n-dimethyl acetamide,dimethylamide acetate,n,n-dimethylethanamide,dimethylacetone amide,acetyldimethylamine |
| IUPAC Name | N,N-dimethylacetamide |
| InChI Key | FXHOOIRPVKKKFG-UHFFFAOYSA-N |
| Molecular Formula | C4H9NO |
Tripotassium citrate monohydrate, 97%
CAS: 6100-05-6 Molecular Formula: C6H7K3O8 Molecular Weight (g/mol): 324.41 MDL Number: MFCD00150442 InChI Key: PJAHUDTUZRZBKM-UHFFFAOYSA-K Synonym: potassium citrate monohydrate,tripotassium citrate monohydrate,unii-ee90oni6ff,ee90oni6ff,citric acid tripotassium salt,urocit-k,ccris 6543,tri-potassium citrate monohydrate,potassium citrate tribasic monohydrate,citric acid, tripotassium salt, monohydrate PubChem CID: 2735208 ChEBI: CHEBI:64746 IUPAC Name: tripotassium;2-hydroxypropane-1,2,3-tricarboxylate;hydrate SMILES: C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.O.[K+].[K+].[K+]
| PubChem CID | 2735208 |
|---|---|
| CAS | 6100-05-6 |
| Molecular Weight (g/mol) | 324.41 |
| ChEBI | CHEBI:64746 |
| MDL Number | MFCD00150442 |
| SMILES | C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.O.[K+].[K+].[K+] |
| Synonym | potassium citrate monohydrate,tripotassium citrate monohydrate,unii-ee90oni6ff,ee90oni6ff,citric acid tripotassium salt,urocit-k,ccris 6543,tri-potassium citrate monohydrate,potassium citrate tribasic monohydrate,citric acid, tripotassium salt, monohydrate |
| IUPAC Name | tripotassium;2-hydroxypropane-1,2,3-tricarboxylate;hydrate |
| InChI Key | PJAHUDTUZRZBKM-UHFFFAOYSA-K |
| Molecular Formula | C6H7K3O8 |
Methyl 3-mercaptopropionate, 98%
CAS: 2935-90-2 Molecular Formula: C4H8O2S Molecular Weight (g/mol): 120.17 MDL Number: MFCD00004895 InChI Key: LDTLDBDUBGAEDT-UHFFFAOYSA-N PubChem CID: 18050 IUPAC Name: methyl 3-sulfanylpropanoate SMILES: COC(=O)CCS
| PubChem CID | 18050 |
|---|---|
| CAS | 2935-90-2 |
| Molecular Weight (g/mol) | 120.17 |
| MDL Number | MFCD00004895 |
| SMILES | COC(=O)CCS |
| IUPAC Name | methyl 3-sulfanylpropanoate |
| InChI Key | LDTLDBDUBGAEDT-UHFFFAOYSA-N |
| Molecular Formula | C4H8O2S |
Ethylenediaminetetraacetic Acid Dipotassium Salt Dihydrate, 99%
CAS: 25102-12-9 Molecular Formula: C10H18K2N2O10 Molecular Weight (g/mol): 404.455 MDL Number: MFCD00150036 InChI Key: JFROQFOCFOKDKU-UHFFFAOYSA-L Synonym: ethylenediaminetetraacetic acid dipotassium salt dihydrate,dipotassium dihydrogen ethylenediaminetetraacetate dihydrate,potassium 2,2'-2-bis carboxymethyl amino ethyl azanediyl diacetate dihydrate,edta dipotassium salt dihydrate,edta dipotassium salt,ethylenediaminetetraacetic acid,dipotassium salt dihydrate,potassium ethylenediaminetetraacetate dibasic,dipotassium ethylenediaminetetraacetate dihydrate,ethylenedinitrilo tetraacetic acid dipotassium salt,acmc-209ggx PubChem CID: 53486451 IUPAC Name: dipotassium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;dihydrate SMILES: C(CN(CC(=O)[O-])CC(=O)[O-])N(CC(=O)O)CC(=O)O.O.O.[K+].[K+]
| PubChem CID | 53486451 |
|---|---|
| CAS | 25102-12-9 |
| Molecular Weight (g/mol) | 404.455 |
| MDL Number | MFCD00150036 |
| SMILES | C(CN(CC(=O)[O-])CC(=O)[O-])N(CC(=O)O)CC(=O)O.O.O.[K+].[K+] |
| Synonym | ethylenediaminetetraacetic acid dipotassium salt dihydrate,dipotassium dihydrogen ethylenediaminetetraacetate dihydrate,potassium 2,2'-2-bis carboxymethyl amino ethyl azanediyl diacetate dihydrate,edta dipotassium salt dihydrate,edta dipotassium salt,ethylenediaminetetraacetic acid,dipotassium salt dihydrate,potassium ethylenediaminetetraacetate dibasic,dipotassium ethylenediaminetetraacetate dihydrate,ethylenedinitrilo tetraacetic acid dipotassium salt,acmc-209ggx |
| IUPAC Name | dipotassium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;dihydrate |
| InChI Key | JFROQFOCFOKDKU-UHFFFAOYSA-L |
| Molecular Formula | C10H18K2N2O10 |
Ethyl oleate, 98%, mixture of homologeous fatty acid esters
CAS: 111-62-6 Molecular Formula: C20H38O2 Molecular Weight (g/mol): 310.51 InChI Key: LVGKNOAMLMIIKO-QXMHVHEDSA-N Synonym: ethyl oleate,ethyl cis-9-octadecenoate,oleic acid, ethyl ester,oleic acid ethyl ester,9-octadecenoic acid z-, ethyl ester,ethyl oleate nf,ethyl z-octadec-9-enoate,ethyl oleate natural,fema no. 2450 PubChem CID: 5363269 ChEBI: CHEBI:84940 IUPAC Name: ethyl (Z)-octadec-9-enoate SMILES: CCCCCCCCC=CCCCCCCCC(=O)OCC
| PubChem CID | 5363269 |
|---|---|
| CAS | 111-62-6 |
| Molecular Weight (g/mol) | 310.51 |
| ChEBI | CHEBI:84940 |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OCC |
| Synonym | ethyl oleate,ethyl cis-9-octadecenoate,oleic acid, ethyl ester,oleic acid ethyl ester,9-octadecenoic acid z-, ethyl ester,ethyl oleate nf,ethyl z-octadec-9-enoate,ethyl oleate natural,fema no. 2450 |
| IUPAC Name | ethyl (Z)-octadec-9-enoate |
| InChI Key | LVGKNOAMLMIIKO-QXMHVHEDSA-N |
| Molecular Formula | C20H38O2 |
Hydroxypropyl methacrylate, 97+%, mixture of isomers, stabilized
CAS: 27813-02-1 Molecular Formula: C7H12O3 Molecular Weight (g/mol): 144.17 MDL Number: MFCD00004536 InChI Key: ZMARGGQEAJXRFP-UHFFFAOYNA-N Synonym: 2-hydroxypropyl methacrylate,2-hydroxypropylmethacrylate,hpma,beta-hydroxypropyl methacrylate,acryester hp,2-hydroxypropyl 2-methylacrylate,poly 2-hydroxypropyl methacrylate,2-hydroxypropyl 2-methyl-2-propenoate,2-propenoic acid, 2-methyl-, 2-hydroxypropyl ester,2-hpma PubChem CID: 13539 ChEBI: CHEBI:53440 IUPAC Name: 2-hydroxypropyl 2-methylprop-2-enoate SMILES: CC(CO)OC(=O)C(C)=C
| PubChem CID | 13539 |
|---|---|
| CAS | 27813-02-1 |
| Molecular Weight (g/mol) | 144.17 |
| ChEBI | CHEBI:53440 |
| MDL Number | MFCD00004536 |
| SMILES | CC(CO)OC(=O)C(C)=C |
| Synonym | 2-hydroxypropyl methacrylate,2-hydroxypropylmethacrylate,hpma,beta-hydroxypropyl methacrylate,acryester hp,2-hydroxypropyl 2-methylacrylate,poly 2-hydroxypropyl methacrylate,2-hydroxypropyl 2-methyl-2-propenoate,2-propenoic acid, 2-methyl-, 2-hydroxypropyl ester,2-hpma |
| IUPAC Name | 2-hydroxypropyl 2-methylprop-2-enoate |
| InChI Key | ZMARGGQEAJXRFP-UHFFFAOYNA-N |
| Molecular Formula | C7H12O3 |
Isoamyl acetate, 99%, pure, mixture of 2- and 3-Methylbutyl acetate
CAS: 123-92-2 Molecular Formula: C7H14O2 Molecular Weight (g/mol): 130.19 MDL Number: MFCD00008946 InChI Key: MLFHJEHSLIIPHL-UHFFFAOYSA-N Synonym: isoamyl acetate,isopentyl acetate,isopentyl ethanoate,banana oil,pear oil,3-methylbutyl ethanoate,isoamyl ethanoate,iso-amyl acetate,3-methyl-1-butyl acetate,i-amyl acetate PubChem CID: 31276 ChEBI: CHEBI:31725 IUPAC Name: 3-methylbutyl acetate SMILES: CC(C)CCOC(C)=O
| PubChem CID | 31276 |
|---|---|
| CAS | 123-92-2 |
| Molecular Weight (g/mol) | 130.19 |
| ChEBI | CHEBI:31725 |
| MDL Number | MFCD00008946 |
| SMILES | CC(C)CCOC(C)=O |
| Synonym | isoamyl acetate,isopentyl acetate,isopentyl ethanoate,banana oil,pear oil,3-methylbutyl ethanoate,isoamyl ethanoate,iso-amyl acetate,3-methyl-1-butyl acetate,i-amyl acetate |
| IUPAC Name | 3-methylbutyl acetate |
| InChI Key | MLFHJEHSLIIPHL-UHFFFAOYSA-N |
| Molecular Formula | C7H14O2 |
Iron(III) citrate hydrate, 98%
CAS: 334024-15-6 Molecular Formula: C6H5FeO7 Molecular Weight (g/mol): 244.94 MDL Number: MFCD00149615 InChI Key: NPFOYSMITVOQOS-UHFFFAOYSA-K Synonym: ferric citrate monohydrate,iron iii citrate hydrate,unii-334s8t6lke,ferric citrate hydrate,ferric citrate usan,iron iii citrate tribasic monohydrate,citric acid iron iii salt,iron cento citrate hydrate,ksc534c4h,iron 3+ citrate hydrate PubChem CID: 22178220 IUPAC Name: 2-hydroxypropane-1,2,3-tricarboxylate;iron(3+);hydrate SMILES: [Fe+3].OC(CC([O-])=O)(CC([O-])=O)C([O-])=O
| PubChem CID | 22178220 |
|---|---|
| CAS | 334024-15-6 |
| Molecular Weight (g/mol) | 244.94 |
| MDL Number | MFCD00149615 |
| SMILES | [Fe+3].OC(CC([O-])=O)(CC([O-])=O)C([O-])=O |
| Synonym | ferric citrate monohydrate,iron iii citrate hydrate,unii-334s8t6lke,ferric citrate hydrate,ferric citrate usan,iron iii citrate tribasic monohydrate,citric acid iron iii salt,iron cento citrate hydrate,ksc534c4h,iron 3+ citrate hydrate |
| IUPAC Name | 2-hydroxypropane-1,2,3-tricarboxylate;iron(3+);hydrate |
| InChI Key | NPFOYSMITVOQOS-UHFFFAOYSA-K |
| Molecular Formula | C6H5FeO7 |
Sodium formate, 99%
CAS: 141-53-7 Molecular Formula: CHNaO2 Molecular Weight (g/mol): 68.007 MDL Number: MFCD00013101 InChI Key: HLBBKKJFGFRGMU-UHFFFAOYSA-M Synonym: sodium formate,formic acid, sodium salt,salachlor,formic acid sodium salt,formic acid, na salt,sodium formate, refined,sodium formiate,mravencan sodny czech,ccris 1037,hsdb 744 PubChem CID: 2723810 ChEBI: CHEBI:62965 IUPAC Name: sodium;formate SMILES: C(=O)[O-].[Na+]
| PubChem CID | 2723810 |
|---|---|
| CAS | 141-53-7 |
| Molecular Weight (g/mol) | 68.007 |
| ChEBI | CHEBI:62965 |
| MDL Number | MFCD00013101 |
| SMILES | C(=O)[O-].[Na+] |
| Synonym | sodium formate,formic acid, sodium salt,salachlor,formic acid sodium salt,formic acid, na salt,sodium formate, refined,sodium formiate,mravencan sodny czech,ccris 1037,hsdb 744 |
| IUPAC Name | sodium;formate |
| InChI Key | HLBBKKJFGFRGMU-UHFFFAOYSA-M |
| Molecular Formula | CHNaO2 |
n-Amyl acetate, 99%
CAS: 628-63-7 Molecular Formula: C7H14O2 Molecular Weight (g/mol): 130.19 MDL Number: MFCD00009500 InChI Key: PGMYKACGEOXYJE-UHFFFAOYSA-N Synonym: amyl acetate,n-amyl acetate,acetic acid, pentyl ester,n-pentyl acetate,amyl acetic ester,1-pentyl acetate,n-pentyl ethanoate,birnenoel,pent-acetate,amyl acetic ether PubChem CID: 12348 ChEBI: CHEBI:87362 IUPAC Name: pentyl acetate SMILES: CCCCCOC(=O)C
| PubChem CID | 12348 |
|---|---|
| CAS | 628-63-7 |
| Molecular Weight (g/mol) | 130.19 |
| ChEBI | CHEBI:87362 |
| MDL Number | MFCD00009500 |
| SMILES | CCCCCOC(=O)C |
| Synonym | amyl acetate,n-amyl acetate,acetic acid, pentyl ester,n-pentyl acetate,amyl acetic ester,1-pentyl acetate,n-pentyl ethanoate,birnenoel,pent-acetate,amyl acetic ether |
| IUPAC Name | pentyl acetate |
| InChI Key | PGMYKACGEOXYJE-UHFFFAOYSA-N |
| Molecular Formula | C7H14O2 |
N,N-Dimethylacetamide, 99.5%, Extra Dry over Molecular Sieve, AcroSeal™
CAS: 127-19-5 Molecular Formula: C4H9NO Molecular Weight (g/mol): 87.12 MDL Number: MFCD00008686 InChI Key: FXHOOIRPVKKKFG-UHFFFAOYSA-N Synonym: dimethylacetamide,dmac,acetamide, n,n-dimethyl,acetdimethylamide,dimethyl acetamide,n,n-dimethyl acetamide,dimethylamide acetate,n,n-dimethylethanamide,dimethylacetone amide,acetyldimethylamine PubChem CID: 31374 ChEBI: CHEBI:84254 IUPAC Name: N,N-dimethylacetamide SMILES: CN(C)C(C)=O
| PubChem CID | 31374 |
|---|---|
| CAS | 127-19-5 |
| Molecular Weight (g/mol) | 87.12 |
| ChEBI | CHEBI:84254 |
| MDL Number | MFCD00008686 |
| SMILES | CN(C)C(C)=O |
| Synonym | dimethylacetamide,dmac,acetamide, n,n-dimethyl,acetdimethylamide,dimethyl acetamide,n,n-dimethyl acetamide,dimethylamide acetate,n,n-dimethylethanamide,dimethylacetone amide,acetyldimethylamine |
| IUPAC Name | N,N-dimethylacetamide |
| InChI Key | FXHOOIRPVKKKFG-UHFFFAOYSA-N |
| Molecular Formula | C4H9NO |
Ethyl cyanoacetate, 98+%
CAS: 105-56-6 Molecular Formula: C5H7NO2 Molecular Weight (g/mol): 113.12 MDL Number: MFCD00001940 InChI Key: ZIUSEGSNTOUIPT-UHFFFAOYSA-N Synonym: ethyl cyanoacetate,ethyl cyanacetate,cyanoacetic acid ethyl ester,acetic acid, cyano-, ethyl ester,ethyl cyanoethanoate,cyanoacetic ester,cyanacetate ethyle,usaf kf-25,estere cianoacetico,ethyl cyano acetate PubChem CID: 7764 IUPAC Name: ethyl 2-cyanoacetate SMILES: CCOC(=O)CC#N
| PubChem CID | 7764 |
|---|---|
| CAS | 105-56-6 |
| Molecular Weight (g/mol) | 113.12 |
| MDL Number | MFCD00001940 |
| SMILES | CCOC(=O)CC#N |
| Synonym | ethyl cyanoacetate,ethyl cyanacetate,cyanoacetic acid ethyl ester,acetic acid, cyano-, ethyl ester,ethyl cyanoethanoate,cyanoacetic ester,cyanacetate ethyle,usaf kf-25,estere cianoacetico,ethyl cyano acetate |
| IUPAC Name | ethyl 2-cyanoacetate |
| InChI Key | ZIUSEGSNTOUIPT-UHFFFAOYSA-N |
| Molecular Formula | C5H7NO2 |
Trifluoroacetic anhydride, 99+%
CAS: 407-25-0 Molecular Formula: C4F6O3 Molecular Weight (g/mol): 210.03 MDL Number: MFCD00000416 InChI Key: QAEDZJGFFMLHHQ-UHFFFAOYSA-N Synonym: trifluoroacetic anhydride,trifluoroacetic acid anhydride,2,2,2-trifluoroacetic anhydride,bis trifluoroacetic anhydride,acetic acid, trifluoro-, anhydride,perfluoroacetic anhydride,trifluoroacetyl anhydride,tfaa,hexafluoroacetic anhydride,anhydrid kyseliny trifluoroctove PubChem CID: 9845 IUPAC Name: (2,2,2-trifluoroacetyl) 2,2,2-trifluoroacetate SMILES: FC(F)(F)C(=O)OC(=O)C(F)(F)F
| PubChem CID | 9845 |
|---|---|
| CAS | 407-25-0 |
| Molecular Weight (g/mol) | 210.03 |
| MDL Number | MFCD00000416 |
| SMILES | FC(F)(F)C(=O)OC(=O)C(F)(F)F |
| Synonym | trifluoroacetic anhydride,trifluoroacetic acid anhydride,2,2,2-trifluoroacetic anhydride,bis trifluoroacetic anhydride,acetic acid, trifluoro-, anhydride,perfluoroacetic anhydride,trifluoroacetyl anhydride,tfaa,hexafluoroacetic anhydride,anhydrid kyseliny trifluoroctove |
| IUPAC Name | (2,2,2-trifluoroacetyl) 2,2,2-trifluoroacetate |
| InChI Key | QAEDZJGFFMLHHQ-UHFFFAOYSA-N |
| Molecular Formula | C4F6O3 |