Carboxylic acids and derivatives
Filtered Search Results
| CAS | 3891-07-4 |
|---|---|
| MDL Number | MFCD00005903 |
Diethyl acetylenedicarboxylate, 97%
CAS: 762-21-0 Molecular Formula: C8H10O4 Molecular Weight (g/mol): 170.17 MDL Number: MFCD00009186 InChI Key: STRNXFOUBFLVIN-UHFFFAOYSA-N Synonym: diethyl acetylenedicarboxylate,2-butynedioic acid, diethyl ester,diethyl 2-butynedioate,1,4-diethyl but-2-ynedioate,acetylenedicarboxylic acid, diethyl ester,acetylenedicarboxylic acid diethyl ester,diethylacetylenedicarboxylate,bis-ethoxycarbonyl acetylene,diethyl acetylene dicarboxylate,di-ethyl acetylenedicarboxylate PubChem CID: 69803 IUPAC Name: diethyl but-2-ynedioate SMILES: CCOC(=O)C#CC(=O)OCC
| PubChem CID | 69803 |
|---|---|
| CAS | 762-21-0 |
| Molecular Weight (g/mol) | 170.17 |
| MDL Number | MFCD00009186 |
| SMILES | CCOC(=O)C#CC(=O)OCC |
| Synonym | diethyl acetylenedicarboxylate,2-butynedioic acid, diethyl ester,diethyl 2-butynedioate,1,4-diethyl but-2-ynedioate,acetylenedicarboxylic acid, diethyl ester,acetylenedicarboxylic acid diethyl ester,diethylacetylenedicarboxylate,bis-ethoxycarbonyl acetylene,diethyl acetylene dicarboxylate,di-ethyl acetylenedicarboxylate |
| IUPAC Name | diethyl but-2-ynedioate |
| InChI Key | STRNXFOUBFLVIN-UHFFFAOYSA-N |
| Molecular Formula | C8H10O4 |
5-Bromoindoxyl diacetate, 98+%, Thermo Scientific Chemicals
CAS: 33588-54-4 Molecular Formula: C12H10BrNO3 Molecular Weight (g/mol): 296.12 MDL Number: MFCD00005799 InChI Key: XJRIDJAGAYGJCK-UHFFFAOYSA-N Synonym: 5-bromoindoxyl diacetate,1-acetyl-5-bromo-1h-indol-3-yl acetate,5-bromoindoxyldiacetate,n-acetyl-5-bromoindolyl acetate,1-acetyl-3-acetyloxy-5-bromoindole,3-acetoxy-1-acetyl-5-bromoindole,1h-indol-3-ol, 1-acetyl-5-bromo-, acetate ester,3-acetoxy-1-acetyl-5-bromo-indole,1h-indol-3-ol, 1-acetyl-5-bromo-, acetate,pubchem16263 PubChem CID: 118505 IUPAC Name: (1-acetyl-5-bromoindol-3-yl) acetate SMILES: CC(=O)N1C=C(C2=C1C=CC(=C2)Br)OC(=O)C
| PubChem CID | 118505 |
|---|---|
| CAS | 33588-54-4 |
| Molecular Weight (g/mol) | 296.12 |
| MDL Number | MFCD00005799 |
| SMILES | CC(=O)N1C=C(C2=C1C=CC(=C2)Br)OC(=O)C |
| Synonym | 5-bromoindoxyl diacetate,1-acetyl-5-bromo-1h-indol-3-yl acetate,5-bromoindoxyldiacetate,n-acetyl-5-bromoindolyl acetate,1-acetyl-3-acetyloxy-5-bromoindole,3-acetoxy-1-acetyl-5-bromoindole,1h-indol-3-ol, 1-acetyl-5-bromo-, acetate ester,3-acetoxy-1-acetyl-5-bromo-indole,1h-indol-3-ol, 1-acetyl-5-bromo-, acetate,pubchem16263 |
| IUPAC Name | (1-acetyl-5-bromoindol-3-yl) acetate |
| InChI Key | XJRIDJAGAYGJCK-UHFFFAOYSA-N |
| Molecular Formula | C12H10BrNO3 |
Isovaleric acid, 98%
CAS: 503-74-2 Molecular Formula: C5H10O2 Molecular Weight (g/mol): 102.13 MDL Number: MFCD00002726 InChI Key: GWYFCOCPABKNJV-UHFFFAOYSA-N Synonym: isovaleric acid,isopentanoic acid,3-methylbutyric acid,delphinic acid,isopropylacetic acid,butanoic acid, 3-methyl,isovalerianic acid,isobutylformic acid,3-methylbutyrate,beta-methylbutyric acid PubChem CID: 10430 ChEBI: CHEBI:28484 IUPAC Name: 3-methylbutanoic acid SMILES: CC(C)CC(O)=O
| PubChem CID | 10430 |
|---|---|
| CAS | 503-74-2 |
| Molecular Weight (g/mol) | 102.13 |
| ChEBI | CHEBI:28484 |
| MDL Number | MFCD00002726 |
| SMILES | CC(C)CC(O)=O |
| Synonym | isovaleric acid,isopentanoic acid,3-methylbutyric acid,delphinic acid,isopropylacetic acid,butanoic acid, 3-methyl,isovalerianic acid,isobutylformic acid,3-methylbutyrate,beta-methylbutyric acid |
| IUPAC Name | 3-methylbutanoic acid |
| InChI Key | GWYFCOCPABKNJV-UHFFFAOYSA-N |
| Molecular Formula | C5H10O2 |
4'-Chloroacetanilide, 97%
CAS: 539-03-7 MDL Number: MFCD00000612 InChI Key: GGUOCFNAWIODMF-UHFFFAOYSA-N Synonym: 4'-chloroacetanilide,n-4-chlorophenyl acetamide,4-chloroacetanilide,p-chloroacetanilide,n-acetyl-p-chloroaniline,acetamide, n-4-chlorophenyl,acetanilide, 4'-chloro,acetic-4-chloroanilide,n-p-chlorophenyl acetamide,n-4-chloro-phenyl-acetamide PubChem CID: 10871 ChEBI: CHEBI:116915 IUPAC Name: N-(4-chlorophenyl)acetamide SMILES: CC(=O)NC1=CC=C(C=C1)Cl
| PubChem CID | 10871 |
|---|---|
| CAS | 539-03-7 |
| ChEBI | CHEBI:116915 |
| MDL Number | MFCD00000612 |
| SMILES | CC(=O)NC1=CC=C(C=C1)Cl |
| Synonym | 4'-chloroacetanilide,n-4-chlorophenyl acetamide,4-chloroacetanilide,p-chloroacetanilide,n-acetyl-p-chloroaniline,acetamide, n-4-chlorophenyl,acetanilide, 4'-chloro,acetic-4-chloroanilide,n-p-chlorophenyl acetamide,n-4-chloro-phenyl-acetamide |
| IUPAC Name | N-(4-chlorophenyl)acetamide |
| InChI Key | GGUOCFNAWIODMF-UHFFFAOYSA-N |
MilliporeSigma™ BAPTA, Tetra sodium Salt, Calbiochem™,
CAS: 126824-24-6 Molecular Formula: C22H20N2Na4O10 Molecular Weight (g/mol): 564.37 MDL Number: MFCD02683087 InChI Key: ZWSMLJACYSGFKD-UHFFFAOYSA-J Synonym: bapta-na4,bapta tetrasodium,bapta tetrasodium salt,sodium 2,2',2,2'-ethane-1,2-diylbis oxy bis 2,1-phenylene bis azanetriyl tetraacetate,bapta, tetrasodium salt,bapta tetrasodium salt hydrate,1,2-bis 2-aminophenoxy ethane-n,n,n',n'-tetraacetic acid tetrasodium salt,tetrasodium 1,2-bis 2-aminophenoxy ethane-n,n,n',n'-tetraacetate,1,2-bis 2-aminophenoxy-ethane-n,n,n, n-tetraacetic acid tetrasodium salt,1,2-bis 2-aminophenoxy ethane-n,n,n',n'-tetraacetic acid tetrasodium salt hplc PubChem CID: 2734965 IUPAC Name: tetrasodium 2-{[2-(2-{2-[bis(carboxylatomethyl)amino]phenoxy}ethoxy)phenyl](carboxylatomethyl)amino}acetate SMILES: [Na+].[Na+].[Na+].[Na+].[O-]C(=O)CN(CC([O-])=O)C1=CC=CC=C1OCCOC1=CC=CC=C1N(CC([O-])=O)CC([O-])=O
| PubChem CID | 2734965 |
|---|---|
| CAS | 126824-24-6 |
| Molecular Weight (g/mol) | 564.37 |
| MDL Number | MFCD02683087 |
| SMILES | [Na+].[Na+].[Na+].[Na+].[O-]C(=O)CN(CC([O-])=O)C1=CC=CC=C1OCCOC1=CC=CC=C1N(CC([O-])=O)CC([O-])=O |
| Synonym | bapta-na4,bapta tetrasodium,bapta tetrasodium salt,sodium 2,2',2,2'-ethane-1,2-diylbis oxy bis 2,1-phenylene bis azanetriyl tetraacetate,bapta, tetrasodium salt,bapta tetrasodium salt hydrate,1,2-bis 2-aminophenoxy ethane-n,n,n',n'-tetraacetic acid tetrasodium salt,tetrasodium 1,2-bis 2-aminophenoxy ethane-n,n,n',n'-tetraacetate,1,2-bis 2-aminophenoxy-ethane-n,n,n, n-tetraacetic acid tetrasodium salt,1,2-bis 2-aminophenoxy ethane-n,n,n',n'-tetraacetic acid tetrasodium salt hplc |
| IUPAC Name | tetrasodium 2-{[2-(2-{2-[bis(carboxylatomethyl)amino]phenoxy}ethoxy)phenyl](carboxylatomethyl)amino}acetate |
| InChI Key | ZWSMLJACYSGFKD-UHFFFAOYSA-J |
| Molecular Formula | C22H20N2Na4O10 |
Ethyl mercaptoacetate, 98+%
CAS: 623-51-8 Molecular Formula: C4H8O2S Molecular Weight (g/mol): 120.166 MDL Number: MFCD00004874 InChI Key: PVBRSNZAOAJRKO-UHFFFAOYSA-N Synonym: ethyl thioglycolate,ethyl mercaptoacetate,ethyl 2-mercaptoacetate,mercaptoacetic acid ethyl ester,ethyl thioglycollate,acetic acid, mercapto-, ethyl ester,thioglycolic acid ethyl ester,ethyl mercaptoacetic acid,usaf ek-2070,acetic acid, 2-mercapto-, ethyl ester PubChem CID: 12185 IUPAC Name: ethyl 2-sulfanylacetate SMILES: CCOC(=O)CS
| PubChem CID | 12185 |
|---|---|
| CAS | 623-51-8 |
| Molecular Weight (g/mol) | 120.166 |
| MDL Number | MFCD00004874 |
| SMILES | CCOC(=O)CS |
| Synonym | ethyl thioglycolate,ethyl mercaptoacetate,ethyl 2-mercaptoacetate,mercaptoacetic acid ethyl ester,ethyl thioglycollate,acetic acid, mercapto-, ethyl ester,thioglycolic acid ethyl ester,ethyl mercaptoacetic acid,usaf ek-2070,acetic acid, 2-mercapto-, ethyl ester |
| IUPAC Name | ethyl 2-sulfanylacetate |
| InChI Key | PVBRSNZAOAJRKO-UHFFFAOYSA-N |
| Molecular Formula | C4H8O2S |
1-Cyclohexene-1-acetic acid
CAS: 18294-87-6 Molecular Formula: C8H12O2 Molecular Weight (g/mol): 140.182 MDL Number: MFCD00015482 InChI Key: KDFBPHXESBPHTK-UHFFFAOYSA-N Synonym: 1-cyclohexenylacetic acid,1-cyclohexene-1-acetic acid,2-cyclohex-1-en-1-yl acetic acid,cyclohex-1-enylacetic acid,1-cyclohexene-1-aceticacid,2-cyclohexen-1-yl acetic acid,2-cyclohex-1-enylacetic acid,cyclohex-1-en-1-ylacetic acid,1-cyclohexenylacetate,cyclohexenylacetic acid PubChem CID: 86699 IUPAC Name: 2-(cyclohexen-1-yl)acetic acid SMILES: C1CCC(=CC1)CC(=O)O
| PubChem CID | 86699 |
|---|---|
| CAS | 18294-87-6 |
| Molecular Weight (g/mol) | 140.182 |
| MDL Number | MFCD00015482 |
| SMILES | C1CCC(=CC1)CC(=O)O |
| Synonym | 1-cyclohexenylacetic acid,1-cyclohexene-1-acetic acid,2-cyclohex-1-en-1-yl acetic acid,cyclohex-1-enylacetic acid,1-cyclohexene-1-aceticacid,2-cyclohexen-1-yl acetic acid,2-cyclohex-1-enylacetic acid,cyclohex-1-en-1-ylacetic acid,1-cyclohexenylacetate,cyclohexenylacetic acid |
| IUPAC Name | 2-(cyclohexen-1-yl)acetic acid |
| InChI Key | KDFBPHXESBPHTK-UHFFFAOYSA-N |
| Molecular Formula | C8H12O2 |
Tamoxifen Citrate, USP, 99-101%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 54965-24-1 Molecular Formula: C32H37NO8 Molecular Weight (g/mol): 563.65 MDL Number: MFCD00058321 InChI Key: FQZYTYWMLGAPFJ-OQKDUQJOSA-N IUPAC Name: (2-{4-[(1Z)-1,2-diphenylbut-1-en-1-yl]phenoxy}ethyl)dimethylamine; 2-hydroxypropane-1,2,3-tricarboxylic acid SMILES: OC(=O)CC(O)(CC(O)=O)C(O)=O.CC\C(=C(/C1=CC=CC=C1)C1=CC=C(OCCN(C)C)C=C1)C1=CC=CC=C1
| CAS | 54965-24-1 |
|---|---|
| Molecular Weight (g/mol) | 563.65 |
| MDL Number | MFCD00058321 |
| SMILES | OC(=O)CC(O)(CC(O)=O)C(O)=O.CC\C(=C(/C1=CC=CC=C1)C1=CC=C(OCCN(C)C)C=C1)C1=CC=CC=C1 |
| IUPAC Name | (2-{4-[(1Z)-1,2-diphenylbut-1-en-1-yl]phenoxy}ethyl)dimethylamine; 2-hydroxypropane-1,2,3-tricarboxylic acid |
| InChI Key | FQZYTYWMLGAPFJ-OQKDUQJOSA-N |
| Molecular Formula | C32H37NO8 |
Methyl coumalate, 98%
CAS: 6018-41-3 Molecular Formula: C7H6O4 Molecular Weight (g/mol): 154.121 MDL Number: MFCD00010120 InChI Key: HHWWWZQYHPFCBY-UHFFFAOYSA-N Synonym: methyl coumalate,methyl 2-oxo-2h-pyran-5-carboxylate,coumalic acid, methyl ester,5-carbomethoxy-2-pyrone,2h-pyran-5-carboxylic acid, 2-oxo-, methyl ester,coumalic acid methyl ester,unii-1s7tmf0r8t,methyl 2-pyrone-5-carboxylate,methyl 2-oxopyran-5-carboxylate,1s7tmf0r8t PubChem CID: 80113 IUPAC Name: methyl 6-oxopyran-3-carboxylate SMILES: COC(=O)C1=COC(=O)C=C1
| PubChem CID | 80113 |
|---|---|
| CAS | 6018-41-3 |
| Molecular Weight (g/mol) | 154.121 |
| MDL Number | MFCD00010120 |
| SMILES | COC(=O)C1=COC(=O)C=C1 |
| Synonym | methyl coumalate,methyl 2-oxo-2h-pyran-5-carboxylate,coumalic acid, methyl ester,5-carbomethoxy-2-pyrone,2h-pyran-5-carboxylic acid, 2-oxo-, methyl ester,coumalic acid methyl ester,unii-1s7tmf0r8t,methyl 2-pyrone-5-carboxylate,methyl 2-oxopyran-5-carboxylate,1s7tmf0r8t |
| IUPAC Name | methyl 6-oxopyran-3-carboxylate |
| InChI Key | HHWWWZQYHPFCBY-UHFFFAOYSA-N |
| Molecular Formula | C7H6O4 |
Acetazolamide, USP, 98-102%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
EDTA, Disodium Salt, Dihydrate, Crystal, Ultrapure Bioreagent, J.T. Baker™
CAS: 6381-92-6 Molecular Formula: C10H18N2Na2O10 Molecular Weight (g/mol): 372.24 MDL Number: MFCD00150037,MFCD00003541 InChI Key: OVBJJZOQPCKUOR-UHFFFAOYSA-L Synonym: edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs PubChem CID: 44120005 SMILES: O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O
| PubChem CID | 44120005 |
|---|---|
| CAS | 6381-92-6 |
| Molecular Weight (g/mol) | 372.24 |
| MDL Number | MFCD00150037,MFCD00003541 |
| SMILES | O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
| Synonym | edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs |
| InChI Key | OVBJJZOQPCKUOR-UHFFFAOYSA-L |
| Molecular Formula | C10H18N2Na2O10 |
trans-Indole-3-acrylic acid, 98+%
CAS: 29953-71-7 Molecular Formula: C11H9NO2 Molecular Weight (g/mol): 187.198 MDL Number: MFCD00005633 InChI Key: PLVPPLCLBIEYEA-AATRIKPKSA-N Synonym: 3-indoleacrylic acid,trans-3-indoleacrylic acid,indole-3-acrylic acid,3-indolylacrylic acid,indole-3beta-acrylic acid,3-1h-indol-3-yl acrylic acid,indole-3-crylic acid,2e-3-1h-indol-3-yl prop-2-enoic acid,trans-3-1h-indol-3-yl acrylic acid,indoleacrylic acid van PubChem CID: 5375048 IUPAC Name: (E)-3-(1H-indol-3-yl)prop-2-enoic acid SMILES: C1=CC=C2C(=C1)C(=CN2)C=CC(=O)O
| PubChem CID | 5375048 |
|---|---|
| CAS | 29953-71-7 |
| Molecular Weight (g/mol) | 187.198 |
| MDL Number | MFCD00005633 |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C=CC(=O)O |
| Synonym | 3-indoleacrylic acid,trans-3-indoleacrylic acid,indole-3-acrylic acid,3-indolylacrylic acid,indole-3beta-acrylic acid,3-1h-indol-3-yl acrylic acid,indole-3-crylic acid,2e-3-1h-indol-3-yl prop-2-enoic acid,trans-3-1h-indol-3-yl acrylic acid,indoleacrylic acid van |
| IUPAC Name | (E)-3-(1H-indol-3-yl)prop-2-enoic acid |
| InChI Key | PLVPPLCLBIEYEA-AATRIKPKSA-N |
| Molecular Formula | C11H9NO2 |
Methyl 4-chlorocinnamate, 99%
CAS: 7560-44-3 Molecular Formula: C10H9ClO2 Molecular Weight (g/mol): 196.63 MDL Number: MFCD00075790 InChI Key: IIBXQGYKZKOORG-QPJJXVBHSA-N Synonym: methyl 4-chlorocinnamate,methyl p-chlorocinnamate,methyl 3-4-chlorophenyl acrylate,4-chlorocinnamic acid methyl ester,cinnamic acid, p-chloro-, methyl ester,2-propenoic acid, 3-4-chlorophenyl-, methyl ester,methyl e-3-4-chlorophenyl prop-2-enoate,e-methyl 3-4-chlorophenyl acrylate,methyl 2e-3-4-chlorophenyl prop-2-enoate,methyl 3-4-chlorophenyl prop-2-enoate PubChem CID: 5314314 IUPAC Name: methyl (E)-3-(4-chlorophenyl)prop-2-enoate SMILES: COC(=O)C=CC1=CC=C(C=C1)Cl
| PubChem CID | 5314314 |
|---|---|
| CAS | 7560-44-3 |
| Molecular Weight (g/mol) | 196.63 |
| MDL Number | MFCD00075790 |
| SMILES | COC(=O)C=CC1=CC=C(C=C1)Cl |
| Synonym | methyl 4-chlorocinnamate,methyl p-chlorocinnamate,methyl 3-4-chlorophenyl acrylate,4-chlorocinnamic acid methyl ester,cinnamic acid, p-chloro-, methyl ester,2-propenoic acid, 3-4-chlorophenyl-, methyl ester,methyl e-3-4-chlorophenyl prop-2-enoate,e-methyl 3-4-chlorophenyl acrylate,methyl 2e-3-4-chlorophenyl prop-2-enoate,methyl 3-4-chlorophenyl prop-2-enoate |
| IUPAC Name | methyl (E)-3-(4-chlorophenyl)prop-2-enoate |
| InChI Key | IIBXQGYKZKOORG-QPJJXVBHSA-N |
| Molecular Formula | C10H9ClO2 |
tert-Butyl vinylacetate, 97%
CAS: 14036-55-6 Molecular Formula: C8H14O2 Molecular Weight (g/mol): 142.20 MDL Number: MFCD06411714 InChI Key: NGASWKRTXGWPNN-UHFFFAOYSA-N Synonym: tert-butyl 3-butenoate,tert-butyl vinylacetate,3-butenoic acid tert-butyl ester,3-butenoic acid, 1,1-dimethylethyl ester,t-butyl vinylacetate,tert-butyl3-butenoate,tert-butyl-3-butenoate,acmc-20ajl7,vinylacetic acid tert-butyl ester,but-3-enoic acid tert-butyl ester PubChem CID: 639778 IUPAC Name: tert-butyl but-3-enoate SMILES: CC(C)(C)OC(=O)CC=C
| PubChem CID | 639778 |
|---|---|
| CAS | 14036-55-6 |
| Molecular Weight (g/mol) | 142.20 |
| MDL Number | MFCD06411714 |
| SMILES | CC(C)(C)OC(=O)CC=C |
| Synonym | tert-butyl 3-butenoate,tert-butyl vinylacetate,3-butenoic acid tert-butyl ester,3-butenoic acid, 1,1-dimethylethyl ester,t-butyl vinylacetate,tert-butyl3-butenoate,tert-butyl-3-butenoate,acmc-20ajl7,vinylacetic acid tert-butyl ester,but-3-enoic acid tert-butyl ester |
| IUPAC Name | tert-butyl but-3-enoate |
| InChI Key | NGASWKRTXGWPNN-UHFFFAOYSA-N |
| Molecular Formula | C8H14O2 |