Azoles
![eMolecules 7343-33-1 | 5-Bromo-1H-1,2,4-triazole | ChemScene | MFCD01421960 | 147.963 | C2H2BrN3 | 96.000 | Brc1nc[nH]n1 | 100g | 536846608](https://assets.fishersci.com/TFS-Assets/CCG/product-images/default.jpg-250.jpg)
eMolecules 7343-33-1 | 5-Bromo-1H-1,2,4-triazole | ChemScene | MFCD01421960 | 147.963 | C2H2BrN3 | 96.000 | Brc1nc[nH]n1 | 100g | 536846608
5-Bromo-1H-1,2,4-triazole | ChemScene | 7343-33-1 | MFCD01421960 | 147.963 | C2H2BrN3 | 96.000 | Brc1nc[nH]n1 | 100g | 536846608
eMolecules 288-88-0 | 1,2,4-TRIAZOLE | AstaTech | MFCD00005228 | 69.067 | C2H3N3 | 95.000 | c1nc[nH]n1 | 25g | 335872145
1,2,4-TRIAZOLE | AstaTech | 288-88-0 | MFCD00005228 | 69.067 | C2H3N3 | 95.000 | c1nc[nH]n1 | 25g | 335872145
eMolecules 66760-19-8 | Ambeed | 2-(4H-124-Triazol-4-yl)ethanol | 250mg | 528956897 | A924202 | MFCD03265455 | 113.12 | C4H7N3O
Ambeed | 2-(4H-124-Triazol-4-yl)ethanol | 250mg | 528956897 | A924202 | 66760-19-8 | MFCD03265455 | 113.120 | C4H7N3O
eMolecules 2170-39-0 | 2-(2H-Benzotriazol-2-yl)-4-methyl-6-(2-propenyl)phenol | Combi-Blocks | MFCD00236141 | 265.316 | C16H15N3O | 95.000 | Cc1cc(CC=C)c(O)c(c1)-n1nc2ccccc2n1 | 5g | 415502089
2-(2H-Benzotriazol-2-yl)-4-methyl-6-(2-propenyl)phenol | Combi-Blocks | 2170-39-0 | MFCD00236141 | 265.316 | C16H15N3O | 95.000 | Cc1cc(CC=C)c(O)c(c1)-n1nc2ccccc2n1 | 5g | 415502089
Accela Chembio Inc (benzotriazol-1-yloxy)tripyrrolidinophosphonium Hexafluorophosphate | 100g | 128625-52-5 | MFCD00077411 | 95+% | Shelf Life: 1620 Days | Light Sensitive/moisture Sensitive/+4
(benzotriazol-1-yloxy)tripyrrolidinophosphonium Hexafluorophosphate | 100g | 128625-52-5 | MFCD00077411 | 95+% | Shelf Life: 1620 Days | Light Sensitive/moisture Sensitive/+4
eMolecules 4-NITRO-1,2,3-TRIAZOLE | 14544-45-7 | MFCD00730971 | 5g
AstaTech | 4-NITRO-1,2,3-TRIAZOLE | 5g | 248473865 | 29378 | 95.000 | 14544-45-7 | MFCD00730971 | 114.064 | C2H2N4O2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
Cayman Chemical SSLV 319 Neurochemicals
A potent and selective CB1 receptor antagonist (Kis = 7.8 and 7,943 nM for CB1 and CB2, respectively); less lipophilic (log P = 5.1) and therefore more water soluble than other known CB1 receptor ligands
Medchemexpress LLC 1,2,4-triazole (sodium) | 41253-21-8 | MFCD00044437 | >95.0% | 92.06 | C2H3N3Na | 25g
1 2 4-Triazole (sodium) is a biochemical reagent that can be used as a biological material or organic compound for life science related research[1]
Chemscene ChemScene | 4-(Triazol-1-yl)aniline | 1G | CS-0038188 | 0.98 | 16279-88-2| MFCD09048597 | 160.18
ChemScene | 4-(Triazol-1-yl)aniline | 1G | CS-0038188 | 0.98 | 16279-88-2| MFCD09048597 | 160.18
Chemscene ChemScene | 4,5-Dibromo-2H-1,2,3-triazole | 100G | CS-W004184 | 0.98 | 22300-52-3| MFCD19440717 | 226.86
ChemScene | 4,5-Dibromo-2H-1,2,3-triazole | 100G | CS-W004184 | 0.98 | 22300-52-3| MFCD19440717 | 226.86
Accela Chembio Inc Methyl 1 | 2 | 4-triazole-3-carboxylate | 100g | 4928-88-5 | MFCD00135989 | 97+% | Shelf Life: 1440 Days | Light Sensitive/n2/+4
Methyl 1 | 2 | 4-triazole-3-carboxylate | 100g | 4928-88-5 | MFCD00135989 | 97+% | Shelf Life: 1440 Days | Light Sensitive/n2/+4
Chem-Impex International, Inc. Benzotriazol-1-yl-oxy-tris(pyrrolidino)phosphonium hexafluorophosphate | 128625-52-5 | MFCD00077411 | 250G
Benzotriazol-1-yl-oxy-tris(pyrrolidino)phosphonium hexafluorophosphate, 128625-52-5, MFCD00077411, 250G
TARGETMOL CHEMICALS INC 1-Aminobenzotriazole 500MG
Also available in 1 mL, 50 mg, 100 mg, 200 mg and bulk. Please contact Fisher for quotes. 1-Aminobenzotriazole (ABT) (ABT) is a non-specific cytochrome P450 (CYP) inhibitor. Purity 98.77%
Accela Chembio Inc Methyl 1 | 2 | 4-triazole-3-carboxylate | 25g | 4928-88-5 | MFCD00135989 | 97+% | Shelf Life: 1440 Days | Light Sensitive/n2/+4
Methyl 1 | 2 | 4-triazole-3-carboxylate | 25g | 4928-88-5 | MFCD00135989 | 97+% | Shelf Life: 1440 Days | Light Sensitive/n2/+4
Sigma Aldrich Fine Chemicals Biosciences 1-Aminobenzotriazole | 1614-12-6 | MFCD00132902 | 50MG
1-Aminobenzotriazole | Purity: >=98% (TLC) | Mol Wt: 134.14 | 1614-12-6 | MFCD00132902 | 50MG
