Azoles
eMolecules 4175-77-3 | 2,4-Dibromo-1,3-thiazole | Key Organics/BIONET | MFCD01318994 | 242.920 | C3HBr2NS | 95.000 | Brc1csc(Br)n1 | 1mg | 600885302
2,4-Dibromo-1,3-thiazole | Key Organics/BIONET | 4175-77-3 | MFCD01318994 | 242.920 | C3HBr2NS | 95.000 | Brc1csc(Br)n1 | 1mg | 600885302
Cayman Chemical 2-amIno-4- 1-adamntyl ThIaz 1g
A synthetic intermediate for pharmaceutical synthesis
eMolecules 885278-66-0 | 2-(3-Amino-phenyl)-thiazole-4-carboxylic acid ethyl ester | J & W PharmLab, LLC | MFCD06738349 | 248.300 | C12H12N2O2S | 96.000 | CCOC(=O)c1csc(n1)-c1cccc(N)c1 | 5g | 249995436
2-(3-Amino-phenyl)-thiazole-4-carboxylic acid ethyl ester | J & W PharmLab, LLC | 885278-66-0 | MFCD06738349 | 248.300 | C12H12N2O2S | 96.000 | CCOC(=O)c1csc(n1)-c1cccc(N)c1 | 5g | 249995436
eMolecules 1209726-22-6 | 2-(2,6-Difluorophenyl)amino-4-(2-hydroxyphenyl)-1,3-thiazole hydrobromide | Apollo Scientific | MFCD08458135 | 385.230 | C15H11BrF2N2OS | 97.000 | Br.Oc1ccccc1-c1csc(Nc2c(F)cccc2F)n1 | 1g | 562442948
2-(2,6-Difluorophenyl)amino-4-(2-hydroxyphenyl)-1,3-thiazole hydrobromide | Apollo Scientific | 1209726-22-6 | MFCD08458135 | 385.230 | C15H11BrF2N2OS | 97.000 | Br.Oc1ccccc1-c1csc(Nc2c(F)cccc2F)n1 | 1g | 562442948
eMolecules 1012881-39-8 | ChemScene | 2-(tert-Butyl)thiazole-5-carboxylic acid | 100mg | 781209655 | CS-0254709 | MFCD11208430 | 185.24 | C8H11NO2S
Ambeed | 2-(4-Biphenylyl)-46-dichloro-135-triazine | 1g | 600844396 | A623854 | 10202-45-6 | MFCD28556865 | 302.160 | C15H9Cl2N3
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool