Azoles
Apexbio Technology LLC Imidazol-1-yl-acetic-acid
Imidazol-1-yl-acetic acid (CAS No 22884-10-2) is a biochemical compound commonly utilized in biomedical research particularly in the study of pharmacological agents and cellular pathways Originating from imidazole chemistry this compound functions by interacting with specific enzyme targets and signaling pathways displaying activity within the nanomolar to low micromolar range It is often employed in various in vitro assays and cell culture experiments to elucidate mechanisms of action at the molecular level Researchers frequently utilize this compound in animal studies and drug screening programs to explore therapeutic potentials and pharmacodynamics Experimental concentrations typically depend on the specific research design taking into account variables such as cell type and assay conditions The compound s versatility makes it a valuable tool in the development and preclinical assessment of new pharmacotherapies
eMolecules 96989-50-3 | DPT | Ambeed | MFCD00074870 | 232.260 | C11H8N2O2S | 95.000 | S=C(Oc1ccccn1)Oc1ccccn1 | 1g | 561134119
DPT | Ambeed | 96989-50-3 | MFCD00074870 | 232.260 | C11H8N2O2S | 95.000 | S=C(Oc1ccccn1)Oc1ccccn1 | 1g | 561134119
eMolecules 288154-18-7 | tert-butyl 4-amino-4-carbamoylpiperidine-1-carboxylate | Pharmablock | MFCD04114477 | 243.307 | C11H21N3O3 | 97.000 | CC(C)(C)OC(=O)N1CCC(N)(CC1)C(N)=O | 250mg | 551156332
tert-butyl 4-amino-4-carbamoylpiperidine-1-carboxylate | Pharmablock | 288154-18-7 | MFCD04114477 | 243.307 | C11H21N3O3 | 97.000 | CC(C)(C)OC(=O)N1CCC(N)(CC1)C(N)=O | 250mg | 551156332
eMolecules 137081-41-5 | 1-Fluorocyclopropanecarboxylic acid | AA Blocks LLC | MFCD18205954 | 104.080 | C4H5FO2 | 0.000 | OC(=O)C1(F)CC1 | 25g | 626254399
1-Fluorocyclopropanecarboxylic acid | AA Blocks LLC | 137081-41-5 | MFCD18205954 | 104.080 | C4H5FO2 | 0.000 | OC(=O)C1(F)CC1 | 25g | 626254399