Aminobenzoic acids and derivatives
Aobchem 4-Chloro-3 5-dimethylbenzoic acid | ≥97% | CAS 90649-78-8 | C9H9ClO2 | 5g
4-Chloro-3 5-dimethylbenzoic acid | ≥97% | CAS 90649-78-8 | C9H9ClO2 | 5g
Aobchem 2-Bromo-4 5-dimethylbenzoic acid | ≥95% | CAS 4612-57-1 | C9H9BrO2 | 250mg
2-Bromo-4 5-dimethylbenzoic acid | ≥95% | CAS 4612-57-1 | C9H9BrO2 | 250mg
Chemscene 6-Bromo-2 2 -bipyridyl | 10g | CS-W004576 | 98% | 10495-73-5 | MFCD01318953 | 235 084 | C10H7BrN2
Chemscene | 6-Bromo-2 2 -bipyridyl | 10g | CS-W004576 | 98% | 10495-73-5 | MFCD01318953 | 235 084 | C10H7BrN2
Chemscene Fmoc-Asn(Trt)-OH | 10g | CS-W002327 | 98% | 132388-59-1 | MFCD00077049 | 596 67 | C38H32N2O5
Chemscene | Fmoc-Asn(Trt)-OH | 10g | CS-W002327 | 98% | 132388-59-1 | MFCD00077049 | 596 67 | C38H32N2O5
Medchemexpress LLC 3-Amino-4-chloropyridine | 20511-15-3 | 98.5% | 128.56 | 5 G
3-Amino-4-chloropyridine is a biochemical reagent that can be used as a biological material or organic compound for life science related research.
- Biochemical reagent
- Suitable for life science related research
- Can be used as a biological material
- Can be used as an organic compound
eMolecules 54223-76-6 | 2-Acetoxy-3,5-dibromobenzoic acid | Oakwood Chemicals | MFCD00132938 | 337.951 | C9H6Br2O4 | 99.000 | CC(=O)Oc1c(Br)cc(Br)cc1C(O)=O | 1g | 480154944
2-Acetoxy-3,5-dibromobenzoic acid | Oakwood Chemicals | 54223-76-6 | MFCD00132938 | 337.951 | C9H6Br2O4 | 99.000 | CC(=O)Oc1c(Br)cc(Br)cc1C(O)=O | 1g | 480154944
Chemscene (Ethane-1 2-diylbis(oxy))bis(ethane-2 1-diyl) bis(2-methylacrylate)(stabilized with 0 01%MEHQ) 98%(stabilized with MEHQ) | 500g | CS-W012220 | 98%(stabilized with MEHQ) | 109-16-0 | MFCD00008591 | 286 32 | C14H22O6
Chemscene | (Ethane-1 2-diylbis(oxy))bis(ethane-2 1-diyl) bis(2-methylacrylate)(stabilized with 0 01%MEHQ) 98%(stabilized with MEHQ) | 500g | CS-W012220 | 98%(stabilized with MEHQ) | 109-16-0 | MFCD00008591 | 286 32 | C14H22O6
Chemscene Isopropyl 2-cyanoacetate | 25g | CS-W013485 | 98% | 13361-30-3 | MFCD00019842 | 127 14 | C6H9NO2
Chemscene | Isopropyl 2-cyanoacetate | 25g | CS-W013485 | 98% | 13361-30-3 | MFCD00019842 | 127 14 | C6H9NO2
Chemscene [Rh(Cp-)Cl2]2 | 1g | CS-0031511 | 98% | 12354-85-7 | MFCD00061552 | 618 08 | C20H30Cl4Rh2
Chemscene | [Rh(Cp-)Cl2]2 | 1g | CS-0031511 | 98% | 12354-85-7 | MFCD00061552 | 618 08 | C20H30Cl4Rh2
Medchemexpress LLC 2-Amino-2'-chloro-5-nitrobenzophenone | 2011-66-7 | ≥98.0% | 276.68 | 10 G
2-Amino-2'-chloro-5-nitrobenzophenone is described as a precursor in the synthesis of benzodiazepines and a hydrolysis product of Clonazepam.
- Precursor in the synthesis of benzodiazepines
- Hydrolysis product of Clonazepam
- For research use only
Chemscene 3 5-Difluoromandelic acid | 5g | CS-B0381 | 98% | 132741-31-2 | MFCD00061300 | 188 13 | C8H6F2O3
Chemscene | 3 5-Difluoromandelic acid | 5g | CS-B0381 | 98% | 132741-31-2 | MFCD00061300 | 188 13 | C8H6F2O3
Chemscene 2-Hydrazinoethanol | 100g | CS-W007663 | 97% | 109-84-2 | MFCD00007623 | 76 10 | C2H8N2O
Chemscene | 2-Hydrazinoethanol | 100g | CS-W007663 | 97% | 109-84-2 | MFCD00007623 | 76 10 | C2H8N2O
Chemscene (S)-(-)-2-(Diphenylhydroxymethyl)pyrrolidine | 10g | CS-D1383 | 98% | 112068-01-6 | MFCD00075506 | 253 34 | C17H19NO
Chemscene | (S)-(-)-2-(Diphenylhydroxymethyl)pyrrolidine | 10g | CS-D1383 | 98% | 112068-01-6 | MFCD00075506 | 253 34 | C17H19NO
Chemscene (S)-2-Aminohexanedioic acid | 5g | CS-W014381 | 97% | 1118-90-7 | MFCD00002636 | 161 16 | C6H11NO4
Chemscene | (S)-2-Aminohexanedioic acid | 5g | CS-W014381 | 97% | 1118-90-7 | MFCD00002636 | 161 16 | C6H11NO4